{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b9a55bf2-006d-45f5-b030-f854316106fc",
          "code": "R07AB04",
          "comments": "ATC|RESPIRATORY SYSTEM|OTHER RESPIRATORY SYSTEM PRODUCTS|OTHER RESPIRATORY SYSTEM PRODUCTS|Respiratory stimulants|etamivan",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R07AB04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "40c8dea0-73d1-4e25-8fe9-01fb10fb0c81"
          ]
        },
        {
          "uuid": "ced3f0cc-532f-4d33-8ee3-c02a00700895",
          "code": "QR07AB04",
          "comments": "VATC|OTHER RESPIRATORY SYSTEM PRODUCTS|OTHER RESPIRATORY SYSTEM PRODUCTS|Respiratory stimulants|etamivan",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR07AB04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "40c8dea0-73d1-4e25-8fe9-01fb10fb0c81"
          ]
        },
        {
          "uuid": "9b32c926-55f7-4647-b4da-874bf3d3adae",
          "code": "304-84-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=304-84-7",
          "code_system": "CAS",
          "references": [
            "40c8dea0-73d1-4e25-8fe9-01fb10fb0c81",
            "eb01ff78-cfbd-48cf-a179-24cf4d247325"
          ]
        },
        {
          "uuid": "a82fa3ae-3045-4ab8-9845-6618af7f441e",
          "code": "C100268",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67100268",
          "code_system": "MESH",
          "references": [
            "40c8dea0-73d1-4e25-8fe9-01fb10fb0c81"
          ]
        },
        {
          "uuid": "7fd75f6a-d7d3-4f4e-8e18-ca23f9c38b06",
          "code": "SUB07259MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "40c8dea0-73d1-4e25-8fe9-01fb10fb0c81"
          ]
        },
        {
          "uuid": "4f73faad-eeab-4faa-818d-6a51ba687993",
          "code": "1174",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1174",
          "code_system": "INN",
          "references": [
            "40c8dea0-73d1-4e25-8fe9-01fb10fb0c81"
          ]
        },
        {
          "uuid": "d18f223d-c07b-4dcc-a556-afeb594fd857",
          "code": "206-157-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.599",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "40c8dea0-73d1-4e25-8fe9-01fb10fb0c81"
          ]
        },
        {
          "uuid": "fbbf2da0-5368-4720-a0a1-bcffc4d58bf6",
          "code": "C76623",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76623",
          "code_system": "NCI_THESAURUS",
          "references": [
            "40c8dea0-73d1-4e25-8fe9-01fb10fb0c81"
          ]
        },
        {
          "uuid": "7a256afa-8192-4bb5-aa25-c4b6e86dea76",
          "code": "24453",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/24453/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "40c8dea0-73d1-4e25-8fe9-01fb10fb0c81"
          ]
        },
        {
          "uuid": "ed03df62-6d48-427e-8bb1-5ec1748b0b57",
          "code": "m5046",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5046?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "40c8dea0-73d1-4e25-8fe9-01fb10fb0c81"
          ]
        },
        {
          "uuid": "db6d7cda-ae6a-4f67-a394-bac3389d6859",
          "code": "CHEMBL1229908",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1229908",
          "code_system": "ChEMBL",
          "references": [
            "40c8dea0-73d1-4e25-8fe9-01fb10fb0c81"
          ]
        },
        {
          "uuid": "d4c86725-e659-41c0-8e47-fe480daa9b63",
          "code": "9363",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9363",
          "code_system": "PUBCHEM",
          "references": [
            "40c8dea0-73d1-4e25-8fe9-01fb10fb0c81"
          ]
        },
        {
          "uuid": "5e958fdc-ca85-fc7c-2054-ad9902f14ac7",
          "code": "Etamivan",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Etamivan",
          "code_system": "WIKIPEDIA",
          "references": [
            "96305b64-7e13-250b-9392-093245705bd8"
          ]
        },
        {
          "uuid": "7ca3ca77-155c-75b8-46a5-47bea75e9c80",
          "code": "DTXSID3023007",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3023007",
          "code_system": "EPA CompTox",
          "references": [
            "66f4db22-eea7-716e-5668-d31560ad86b0"
          ]
        },
        {
          "uuid": "79b22c17-6a71-41f2-6dee-359feb950f96",
          "code": "C47795",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|CNS Stimulant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47795",
          "code_system": "NCI_THESAURUS",
          "references": [
            "aced5ded-9648-7a5b-87f4-63e1bc8c195d"
          ]
        },
        {
          "uuid": "d363b73c-9b40-4d3f-8a34-c5cda8901184",
          "code": "M44O63YPV9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4da0af22-d4cb-b607-e007-5688c20e58c0",
          "code": "DB08989",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB08989",
          "code_system": "DRUG BANK",
          "references": [
            "e210d3cd-01a9-a0fd-4ac1-9d7786110065"
          ]
        },
        {
          "uuid": "12b5baf5-efe4-33f7-45b7-f76c13a11a92",
          "code": "1074",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1074",
          "code_system": "DRUG CENTRAL",
          "references": [
            "e210d3cd-01a9-a0fd-4ac1-9d7786110065"
          ]
        },
        {
          "uuid": "7ffb5a0e-c816-d3fc-3292-d9355e7bad37",
          "code": "92675",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:92675",
          "code_system": "CHEBI",
          "references": [
            "e210d3cd-01a9-a0fd-4ac1-9d7786110065"
          ]
        },
        {
          "uuid": "9b2ec7a7-3b04-cf30-81b5-d87d32eec7f1",
          "code": "100000082368",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "3f25a273-740a-ce2f-2476-6b625486c0dd"
          ]
        },
        {
          "uuid": "14aaaa00-c9b5-7b25-463d-af1cef97d163",
          "code": "406087",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=406087",
          "code_system": "NSC",
          "references": [
            "b3082310-d877-f678-9226-c49bb5e4bddb"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6c719a32-b3bf-4cb0-828b-52f70c4c4546",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "bfa0113e-545a-43b1-a9f3-481929ebc204",
            "refuuid": "e57dfd5b-412e-4ef2-8cdb-6a30b2178f92",
            "name": "ETHAMIVAN",
            "unii": "M44O63YPV9",
            "linking_id": "M44O63YPV9",
            "ref_pname": "ETHAMIVAN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bfab3454-04e4-4bee-b468-f78879ce09da",
          "name": "BENZAMIDE, N,N-DIETHYL-4-HYDROXY-3-METHOXY-",
          "stdName": "BENZAMIDE, N,N-DIETHYL-4-HYDROXY-3-METHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7de1c89-601e-40fd-8124-4fa4d30df0d9"
          ],
          "display_name": false
        },
        {
          "uuid": "c9cf4f00-ee30-35c0-bd1d-7a103b0ce6aa",
          "name": "EMIVAN",
          "stdName": "EMIVAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aced5ded-9648-7a5b-87f4-63e1bc8c195d"
          ],
          "display_name": false
        },
        {
          "uuid": "cee7c2c0-8140-467b-9dce-4c262177fd61",
          "name": "ETAMIVAN",
          "stdName": "ETAMIVAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b61e1d0c-0c08-4753-a060-040238448930",
            "99d34a38-f830-434b-a8b0-7f1e76e83fb7",
            "96bb2d39-c3e8-438a-b5c2-ca65946cd65f",
            "1e37cc49-3b92-4c5b-a009-d8e689c95bfa",
            "d7de1c89-601e-40fd-8124-4fa4d30df0d9",
            "81edaf1b-83fd-4e44-8740-e83c8ebc85a4",
            "fff05a55-b724-48b1-aaf2-fef6f11f7da5",
            "2057bf4a-f948-4179-a7f2-40b06bc2f170"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "c0943477-40e4-4f18-9ce8-63233588d67c",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "7bc0f510-b9be-4bd5-9b5f-9289fd3d5c7d",
          "name": "ETAMIVAN [MART.]",
          "stdName": "ETAMIVAN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fff05a55-b724-48b1-aaf2-fef6f11f7da5"
          ],
          "display_name": false
        },
        {
          "uuid": "7bb3cbdb-0df0-4120-b9ef-d9460413ae11",
          "name": "ETHAMIVAN",
          "stdName": "ETHAMIVAN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99d34a38-f830-434b-a8b0-7f1e76e83fb7",
            "968e3b18-c6f3-4426-9a00-5aa2997b320b",
            "66d7c529-00b4-473d-ad71-4096db3a6cff",
            "08c19df9-028a-4c2f-91da-ecb07d44f753",
            "affdd4ce-9cdb-4bc7-a352-c27681d5b548",
            "96c1e267-bc6b-4e4d-875b-494f3f5aada0"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "e09513c4-391c-4ae6-b8da-1d7e2e858fce",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "b0939378-486b-49c1-956c-34c7158a09ef",
          "name": "ETHAMIVAN [MI]",
          "stdName": "ETHAMIVAN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99d34a38-f830-434b-a8b0-7f1e76e83fb7",
            "08c19df9-028a-4c2f-91da-ecb07d44f753"
          ],
          "display_name": false
        },
        {
          "uuid": "c50da219-4ee6-4d81-9f1f-67f6de991ec3",
          "name": "ETHAMIVAN [USAN]",
          "stdName": "ETHAMIVAN [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "968e3b18-c6f3-4426-9a00-5aa2997b320b"
          ],
          "display_name": false
        },
        {
          "uuid": "c430617d-002a-9e3c-6132-60d37bcd4f5f",
          "name": "Etamivan [WHO-DD]",
          "stdName": "ETAMIVAN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cd58fca-6485-5925-1005-e3ca1749f0ea"
          ],
          "display_name": false
        },
        {
          "uuid": "01abb83c-aee2-45ae-a64a-5f08b92aa133",
          "name": "N,N-Diethylvanillamide",
          "stdName": "N,N-DIETHYLVANILLAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7de1c89-601e-40fd-8124-4fa4d30df0d9"
          ],
          "display_name": false
        },
        {
          "uuid": "dc813bee-338f-410d-ba6b-7b57fcd72264",
          "name": "NSC-406087",
          "stdName": "NSC-406087",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7de1c89-601e-40fd-8124-4fa4d30df0d9"
          ],
          "display_name": false
        },
        {
          "uuid": "7f11d191-2e12-4195-bb71-668d17ceff74",
          "name": "VANDID",
          "stdName": "VANDID",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7de1c89-601e-40fd-8124-4fa4d30df0d9"
          ],
          "display_name": false
        },
        {
          "uuid": "a447d28a-30fc-406f-b738-c15f45c04fcb",
          "name": "etamivan [INN]",
          "stdName": "ETAMIVAN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2057bf4a-f948-4179-a7f2-40b06bc2f170"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "66d7c529-00b4-473d-ad71-4096db3a6cff",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d7de1c89-601e-40fd-8124-4fa4d30df0d9",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2057bf4a-f948-4179-a7f2-40b06bc2f170",
          "citation": "INN Proposed List 12",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL12.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "968e3b18-c6f3-4426-9a00-5aa2997b320b",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fff05a55-b724-48b1-aaf2-fef6f11f7da5",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08c19df9-028a-4c2f-91da-ecb07d44f753",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99d34a38-f830-434b-a8b0-7f1e76e83fb7",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96bb2d39-c3e8-438a-b5c2-ca65946cd65f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40c8dea0-73d1-4e25-8fe9-01fb10fb0c81",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389677000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f912633e-86d0-4338-bd9d-3b096a8c9f7f",
          "citation": "SRS import [M44O63YPV9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M44O63YPV9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389677000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4cf6f69-59dc-4e33-bf52-0209317ebb11",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b61e1d0c-0c08-4753-a060-040238448930",
          "citation": "ETAMIVAN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "affdd4ce-9cdb-4bc7-a352-c27681d5b548",
          "citation": "ETHAMIVAN [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "81edaf1b-83fd-4e44-8740-e83c8ebc85a4",
          "citation": "ETAMIVAN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "96c1e267-bc6b-4e4d-875b-494f3f5aada0",
          "citation": "ETHAMIVAN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1e37cc49-3b92-4c5b-a009-d8e689c95bfa",
          "citation": "ETAMIVAN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "96305b64-7e13-250b-9392-093245705bd8",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Etamivan",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "66f4db22-eea7-716e-5668-d31560ad86b0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=304-84-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aced5ded-9648-7a5b-87f4-63e1bc8c195d",
          "citation": "pubchem",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "eb01ff78-cfbd-48cf-a179-24cf4d247325",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e210d3cd-01a9-a0fd-4ac1-9d7786110065",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "b3082310-d877-f678-9226-c49bb5e4bddb",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8cd58fca-6485-5925-1005-e3ca1749f0ea",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "3f25a273-740a-ce2f-2476-6b625486c0dd",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a6e651cc-1c07-4c00-a2ff-821e0dccfef6",
          "id": "a6e651cc-1c07-4c00-a2ff-821e0dccfef6",
          "molfile": "\n  Marvin  01132108402D          \n\n 16 16  0  0  0  0            999 V2000\n    0.8995   -3.9575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1628   -3.5439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1551   -2.7168    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8685   -2.2980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5820   -2.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5712   -2.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5816   -1.5044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2692   -2.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2614   -3.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9748   -3.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6960   -3.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4095   -4.0118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7038   -2.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4302   -2.3574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4327   -1.5277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9904   -2.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n  5  4  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 16  8  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 16  1  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)C(=O)c1ccc(c(c1)OC)O",
          "formula": "C12H17NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6cfccae4-1287-4721-9315-ba070ba2323c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "223.2687",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e57dfd5b-412e-4ef2-8cdb-6a30b2178f92",
      "version": "14",
      "structure": {
        "id": "cea25b91-fe2f-449b-9dd3-cd8cea026155",
        "molfile": "\n  Marvin  01132110402D          \n\n 16 16  0  0  0  0            999 V2000\n   -0.5712   -2.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2692   -2.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9904   -2.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7038   -2.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1551   -2.7168    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5816   -1.5044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6960   -3.5827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2614   -3.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9748   -3.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4302   -2.3574    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4095   -4.0118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8685   -2.2980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1628   -3.5439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4327   -1.5277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8995   -3.9575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5820   -2.6935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  1  2  0  0  0  0\n  7  9  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  4  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12  5  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14 10  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16 12  1  0  0  0  0\n  7  4  2  0  0  0  0\nM  END",
        "smiles": "CCN(CC)C(=O)c1ccc(c(c1)OC)O",
        "formula": "C12H17NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "223.2687",
        "optical_activity": "NONE",
        "references": [
          "c4cf6f69-59dc-4e33-bf52-0209317ebb11",
          "f912633e-86d0-4338-bd9d-3b096a8c9f7f",
          "2057bf4a-f948-4179-a7f2-40b06bc2f170"
        ],
        "stereo_centers": 0
      },
      "unii": "M44O63YPV9"
    }
  ]
}