{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "fc3d5022-0c18-4e30-acfa-f5b25a384534",
          "code": "365400-11-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=365400-11-9",
          "code_system": "CAS",
          "references": [
            "15f5c02e-84d0-4f1c-ad15-4934331fbc95",
            "fc09759b-1f9a-4cf4-a730-37c2c56387f4"
          ]
        },
        {
          "uuid": "19d65b91-4741-4a8f-af77-b9591301e8d0",
          "code": "11693711",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11693711",
          "code_system": "PUBCHEM",
          "references": [
            "15f5c02e-84d0-4f1c-ad15-4934331fbc95"
          ]
        },
        {
          "uuid": "733f1684-60b1-0e04-4e0c-a6e1ab0f1a8d",
          "code": "7879",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7879",
          "code_system": "HSDB",
          "references": [
            "c4964451-09cc-d7bd-3bb7-369c3b4e70bd"
          ]
        },
        {
          "uuid": "b6af206a-03e6-a845-d9b9-9c8c5fb5e022",
          "code": "DTXSID2044343",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2044343",
          "code_system": "EPA CompTox",
          "references": [
            "76ffa6ae-a321-2699-302b-9dce614f27cb"
          ]
        },
        {
          "uuid": "f3e7b771-658c-428a-ad8d-c93281b84b60",
          "code": "M31E7U368M",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6b0da7ba-4749-8aa4-0c4e-d92abb8b912d",
          "code": "pyrasulfotole",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/pyrasulfotole.html",
          "code_system": "ALANWOOD",
          "references": [
            "e35040d3-372e-2fc3-eb84-fbbef20a3914"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d0f8e938-0299-49d9-8255-55ed410ed80e",
          "name": "METHANONE, (5-HYDROXY-1,3-DIMETHYL-1H-PYRAZOL-4-YL)(2-(METHYLSULFONYL)-4-(TRIFLUOROMETHYL)PHENYL)-",
          "stdName": "METHANONE, (5-HYDROXY-1,3-DIMETHYL-1H-PYRAZOL-4-YL)(2-(METHYLSULFONYL)-4-(TRIFLUOROMETHYL)PHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0d25d946-109a-4632-8f09-67687495557b",
            "dca3bb27-9e2d-4f72-a256-c0aeba206116"
          ],
          "display_name": false
        },
        {
          "uuid": "3f19744f-d345-4bcf-85ea-e882234f2707",
          "name": "PYRASULFATOLE",
          "stdName": "PYRASULFATOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a51c13db-ef46-452c-93ed-301f30c8a205"
          ],
          "display_name": false
        },
        {
          "uuid": "87aab706-5ae4-4d89-a8fd-ab54e549642f",
          "name": "PYRASULFOTOLE",
          "stdName": "PYRASULFOTOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "192ba43b-db97-45dd-877c-8d7b125a9e80",
            "4750d79f-cd38-40df-a6bb-dd46e114b31f",
            "dca3bb27-9e2d-4f72-a256-c0aeba206116"
          ],
          "display_name": true
        },
        {
          "uuid": "f9bcef18-6429-4987-b47d-6d07ab96c6ee",
          "name": "PYRASULFOTOLE [ISO]",
          "stdName": "PYRASULFOTOLE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4750d79f-cd38-40df-a6bb-dd46e114b31f",
            "dca3bb27-9e2d-4f72-a256-c0aeba206116"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a51c13db-ef46-452c-93ed-301f30c8a205",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4750d79f-cd38-40df-a6bb-dd46e114b31f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dca3bb27-9e2d-4f72-a256-c0aeba206116",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d25d946-109a-4632-8f09-67687495557b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15f5c02e-84d0-4f1c-ad15-4934331fbc95",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c58ce2b-6d67-4292-814d-122b68206ca3",
          "citation": "SRS import [M31E7U368M]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M31E7U368M",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1858d34c-0c44-4266-9ee6-917a9a452006",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "192ba43b-db97-45dd-877c-8d7b125a9e80",
          "citation": "PYRASULFOTOLE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c4964451-09cc-d7bd-3bb7-369c3b4e70bd",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+365400-11-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "76ffa6ae-a321-2699-302b-9dce614f27cb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=365400-11-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e35040d3-372e-2fc3-eb84-fbbef20a3914",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "fc09759b-1f9a-4cf4-a730-37c2c56387f4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0c1591e5-c0a0-4a43-bfc3-47c894c37228",
          "id": "0c1591e5-c0a0-4a43-bfc3-47c894c37228",
          "molfile": "\n  Marvin  01132100522D          \n\n 24 25  0  0  0  0            999 V2000\n    8.6704   -6.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1104   -5.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9328   -5.6913    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2126   -4.9362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0000   -4.7032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5559   -4.4311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5559   -3.6088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8791   -4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4082   -3.9259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4082   -3.0984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0134   -4.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3266   -4.4239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5844   -4.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5844   -5.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2875   -6.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0134   -5.6820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7170   -6.1138    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3510   -6.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2727   -6.8066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1613   -5.4161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8607   -6.0367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1583   -5.6079    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8607   -6.8638    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6669   -5.2362    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 16 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 21  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 17 20  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  1  0  0  0  0\nM  END",
          "smiles": "Cc1c(C(=O)c2ccc(cc2S(=O)(=O)C)C(F)(F)F)c(=O)n(C)[nH]1",
          "formula": "C14H13F3N2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "42d898d6-2e3c-4793-9815-b0663d08e36a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "362.3259",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1d3df9d3-e8bc-4686-833a-200fc70fd7b8",
      "version": "6",
      "structure": {
        "id": "dc0358c7-a1c8-45b9-8204-310182bf07db",
        "molfile": "\n  Marvin  01132111252D          \n\n 24 25  0  0  0  0            999 V2000\n    9.1104   -5.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6704   -6.2420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8791   -4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5559   -4.4311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5559   -3.6088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2126   -4.9362    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0000   -4.7032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9328   -5.6913    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4082   -3.9259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0134   -4.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0134   -5.6820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2875   -6.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5844   -5.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5844   -4.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3266   -4.4239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8607   -6.0367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1583   -5.6079    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8607   -6.8638    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6669   -5.2362    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7170   -6.1138    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2727   -6.8066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1613   -5.4161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3510   -6.5335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4082   -3.0984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  1  8  2  0  0  0  0\n  9  3  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 10 15  2  0  0  0  0\n 13 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 19  1  0  0  0  0\n 11 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  2  0  0  0  0\n 20 23  1  0  0  0  0\n  9 24  2  0  0  0  0\nM  END",
        "smiles": "Cc1c(C(=O)c2ccc(cc2S(=O)(=O)C)C(F)(F)F)c(n(C)n1)O",
        "formula": "C14H13F3N2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "362.3259",
        "optical_activity": "NONE",
        "references": [
          "1858d34c-0c44-4266-9ee6-917a9a452006",
          "1c58ce2b-6d67-4292-814d-122b68206ca3"
        ],
        "stereo_centers": 0
      },
      "unii": "M31E7U368M"
    }
  ]
}