{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8fc46a30-2eb1-4473-a7df-5124ae296b3b",
          "code": "6804-07-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6804-07-5",
          "code_system": "CAS",
          "references": [
            "979b083a-e6f4-4e3a-a441-f11806207b97",
            "a4002b00-5ae2-4510-8364-189a3359bce5"
          ]
        },
        {
          "uuid": "7e308eb8-e705-48f9-8a46-3b8fdc4e59d9",
          "code": "C81718",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81718",
          "code_system": "NCI_THESAURUS",
          "references": [
            "979b083a-e6f4-4e3a-a441-f11806207b97"
          ]
        },
        {
          "uuid": "484a7755-283d-4776-84c4-dba4e4462f5e",
          "code": "D002218",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002218",
          "code_system": "MESH",
          "references": [
            "979b083a-e6f4-4e3a-a441-f11806207b97"
          ]
        },
        {
          "uuid": "05d61907-269b-4279-9213-8a8801fe9cb4",
          "code": "CARBADOX",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Carbadox",
          "code_system": "WIKIPEDIA",
          "references": [
            "979b083a-e6f4-4e3a-a441-f11806207b97"
          ]
        },
        {
          "uuid": "ebda2850-215a-4686-b5c1-c34851028116",
          "code": "2487",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2487",
          "code_system": "INN",
          "references": [
            "979b083a-e6f4-4e3a-a441-f11806207b97"
          ]
        },
        {
          "uuid": "8f04ebf7-ed7a-4320-86eb-9bef85f72327",
          "code": "1314339",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1314339/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "979b083a-e6f4-4e3a-a441-f11806207b97"
          ]
        },
        {
          "uuid": "ea73aab6-05a3-4b57-b54c-812f32fdb417",
          "code": "m3052",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3052?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "979b083a-e6f4-4e3a-a441-f11806207b97"
          ]
        },
        {
          "uuid": "fcf8088e-3d05-455d-b814-d4a46f7daeaa",
          "code": "SUB06088MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "979b083a-e6f4-4e3a-a441-f11806207b97"
          ]
        },
        {
          "uuid": "24ca2c7b-3997-4f89-9513-23b2fa1442ad",
          "code": "21 CFR 556.100",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 556 -- TOLERANCES FOR RESIDUES OF NEW ANIMAL DRUGS IN FOOD|Subpart B--Specific Tolerances for Residues of New Animal Drugs|Sec. 556.100 Carbadox.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=556.100",
          "code_system": "CFR",
          "references": [
            "979b083a-e6f4-4e3a-a441-f11806207b97"
          ]
        },
        {
          "uuid": "6d2f60e0-4c90-4459-b07c-6a3389fb9953",
          "code": "CHEMBL13779",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL13779",
          "code_system": "ChEMBL",
          "references": [
            "979b083a-e6f4-4e3a-a441-f11806207b97"
          ]
        },
        {
          "uuid": "38cbe939-da7c-4429-99ef-0058fa4d8701",
          "code": "21 CFR 558.115",
          "comments": "PART 558--NEW ANIMAL DRUGS FOR USE IN ANIMAL FEEDS|Subpart B--Specific New Animal Drugs for Use in Animal Feeds|Sec. 558.115 Carbadox.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=558.115",
          "code_system": "CFR",
          "references": [
            "979b083a-e6f4-4e3a-a441-f11806207b97"
          ]
        },
        {
          "uuid": "cb9ec790-c194-49f1-8380-c53aa5fc04e7",
          "code": "229-879-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.027.163",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "979b083a-e6f4-4e3a-a441-f11806207b97"
          ]
        },
        {
          "uuid": "cb7aae0b-e42e-498c-8d44-6903c098bcad",
          "code": "21 CFR 558.115",
          "comments": "PART 558--NEW ANIMAL DRUGS FOR USE IN ANIMAL FEEDS|Subpart B--Specific New Animal Drugs for Use in Animal Feeds|Sec. 558.115 Carbadox.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=558.115",
          "code_system": "CFR",
          "references": [
            "979b083a-e6f4-4e3a-a441-f11806207b97"
          ]
        },
        {
          "uuid": "d4ac6ab9-3fd9-2749-0ecb-709de8ca64d7",
          "code": "7028",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7028",
          "code_system": "HSDB",
          "references": [
            "93a64356-7d51-53f3-d0ec-bd70a5bbb7f7"
          ]
        },
        {
          "uuid": "d151d025-706b-5d97-895b-f57774dfec14",
          "code": "DTXSID6043913",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6043913",
          "code_system": "EPA CompTox",
          "references": [
            "8f65627e-41ea-9741-90ac-0af9b6e16978"
          ]
        },
        {
          "uuid": "b047059e-1dfa-1885-83ed-3d9d2fa6372d",
          "code": "C52588",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antibacterial Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C52588",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0074f890-1a07-75b6-ea46-8bb563dbd432"
          ]
        },
        {
          "uuid": "b6b33fca-f250-4910-a2dd-24dbcd3ab355",
          "code": "M2X04R2E2Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6dd91d89-1f1e-c117-f4aa-74f630e6cc52",
          "code": "135403805",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135403805",
          "code_system": "PUBCHEM",
          "references": [
            "79f14886-1149-b935-68c5-bf7189753b94"
          ]
        },
        {
          "uuid": "d77dea5b-f348-22ab-b60a-baf2c9af9825",
          "code": "100000088404",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c57b99d2-3084-2113-9228-b5e4afce5320"
          ]
        },
        {
          "uuid": "a41b9aef-5164-0441-6fac-bb00247a4843",
          "code": "M2X04R2E2Y",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=M2X04R2E2Y",
          "code_system": "DAILYMED",
          "references": [
            "38ec601c-2ebf-736a-19f1-fedd0588f3fe"
          ]
        },
        {
          "uuid": "314595c5-2f94-6939-108f-83ca009eab76",
          "code": "758942",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758942",
          "code_system": "NSC",
          "references": [
            "f5d55fc8-3610-7bf9-6c76-101d6e03231e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "e60e8387-9b12-4d43-836c-bacd580f959a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "390a7b81-63ea-49d1-8998-151b4747493f",
            "refuuid": "3d56f43d-67dd-446f-b32d-1b5241035a58",
            "name": "CARBADOX",
            "unii": "M2X04R2E2Y",
            "linking_id": "M2X04R2E2Y",
            "ref_pname": "CARBADOX",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "22653385-a5ef-435b-81eb-f14e3f1f1ae6",
          "amount": {
            "uuid": "d81058a3-bfc2-4c7d-8d73-ff31be6fe271"
          },
          "type": "METABOLITE->PARENT",
          "references": [
            "a071146d-79ef-443a-a5bc-07ef54f419fe"
          ],
          "related_substance": {
            "uuid": "4690e446-8770-4fbc-a2c9-4505ed20b975",
            "refuuid": "9755d843-26ad-4d04-90fd-f45009c8e46e",
            "name": "Methyl carbazate",
            "unii": "0L5442J16Q",
            "linking_id": "0L5442J16Q",
            "ref_pname": "Methyl carbazate"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f7ad3d6e-b303-4fd0-a611-15b3458e86cd",
          "name": "CARBADOX",
          "stdName": "CARBADOX",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5166e3c-36a4-4bc4-8118-e50348b7e886",
            "34288b80-423d-4ff9-ab16-85f4a80b7447",
            "307c59f5-076b-403e-9020-0afdbe01040c",
            "7b79d64b-15f6-486b-9198-cb02df544256",
            "c62386ec-86bf-4b0b-b514-a268b1f83129",
            "200df982-283c-4a7a-80be-0aa7143ddc06",
            "63b9faa4-1b72-41c2-a266-c5b230e49819",
            "ecc48ed7-7334-48d0-93d1-8d17bdaebb79",
            "2d11c89c-f887-4748-9fbc-552a63b3eec0",
            "f535288c-a2ec-429a-9c01-6f340d4ad400",
            "0d547868-0f32-49b5-bdbe-f1899ca96fd2",
            "3ca80669-15a3-45bc-acc3-d4b2a20c57b7",
            "070c310a-7592-4de6-9822-05ac7d89b6e6"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "ff2d6924-f1f3-447d-b869-e4ade4ba8199",
              "name_org": "INN"
            },
            {
              "uuid": "ff83ffdb-9e81-4ee7-a25e-42571a605fdd",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "4723ada6-ae5a-4f35-af05-68bc74c6adc9",
          "name": "CARBADOX [GREEN BOOK]",
          "stdName": "CARBADOX [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c62386ec-86bf-4b0b-b514-a268b1f83129"
          ],
          "display_name": false
        },
        {
          "uuid": "68d5f84b-205b-493b-8ca7-85e9c4487893",
          "name": "CARBADOX [HSDB]",
          "stdName": "CARBADOX [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f535288c-a2ec-429a-9c01-6f340d4ad400"
          ],
          "display_name": false
        },
        {
          "uuid": "b40c9c56-d208-4b2b-b7fb-903a318184a8",
          "name": "CARBADOX [MART.]",
          "stdName": "CARBADOX [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "307c59f5-076b-403e-9020-0afdbe01040c"
          ],
          "display_name": false
        },
        {
          "uuid": "34df33cb-f49c-48df-af7a-260f5f4c7fcb",
          "name": "CARBADOX [MI]",
          "stdName": "CARBADOX [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ca80669-15a3-45bc-acc3-d4b2a20c57b7"
          ],
          "display_name": false
        },
        {
          "uuid": "188fab9a-9da2-4e14-b0e6-6f2b626d03b4",
          "name": "CARBADOX [USAN]",
          "stdName": "CARBADOX [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63b9faa4-1b72-41c2-a266-c5b230e49819"
          ],
          "display_name": false
        },
        {
          "uuid": "aae916d5-dbec-4446-971a-66e34973089b",
          "name": "GS-6244",
          "stdName": "GS-6244",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0d547868-0f32-49b5-bdbe-f1899ca96fd2"
          ],
          "display_name": false
        },
        {
          "uuid": "5952aa4e-a253-40ed-943b-8a8076f1a341",
          "name": "HYDRAZINECARBOXYLIC ACID (2-QUINOXALINYLMETHYLENE)-, METHYL ESTER N1,N4-DIOXIDE",
          "stdName": "HYDRAZINECARBOXYLIC ACID (2-QUINOXALINYLMETHYLENE)-, METHYL ESTER N1,N4-DIOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0d547868-0f32-49b5-bdbe-f1899ca96fd2"
          ],
          "display_name": false
        },
        {
          "uuid": "06d52ef3-381f-4dec-9af4-25a2477089c4",
          "name": "MECADOX",
          "stdName": "MECADOX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5525ffc3-80cc-41c5-9173-19fddf64b4ee",
            "8987ec65-9be7-49a3-a648-c31c1143929a"
          ],
          "display_name": false
        },
        {
          "uuid": "b57ae964-b089-4701-9f32-4a7ca67b0fef",
          "name": "Methyl 3-(2-quinoxalinylmethylene)carbazate N1,N4-dioxide",
          "stdName": "METHYL 3-(2-QUINOXALINYLMETHYLENE)CARBAZATE N1,N4-DIOXIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0d547868-0f32-49b5-bdbe-f1899ca96fd2"
          ],
          "display_name": false
        },
        {
          "uuid": "dbeb78c3-2a16-6748-2f4f-5bbac7bcf7b8",
          "name": "NSC-758942",
          "stdName": "NSC-758942",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5d55fc8-3610-7bf9-6c76-101d6e03231e"
          ],
          "display_name": false
        },
        {
          "uuid": "1900971e-7a6b-44c5-9b69-9301408126fe",
          "name": "carbadox [INN]",
          "stdName": "CARBADOX [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "200df982-283c-4a7a-80be-0aa7143ddc06"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0d547868-0f32-49b5-bdbe-f1899ca96fd2",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "200df982-283c-4a7a-80be-0aa7143ddc06",
          "citation": "INN Proposed List 19",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL19.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "63b9faa4-1b72-41c2-a266-c5b230e49819",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "307c59f5-076b-403e-9020-0afdbe01040c",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ca80669-15a3-45bc-acc3-d4b2a20c57b7",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5525ffc3-80cc-41c5-9173-19fddf64b4ee",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8987ec65-9be7-49a3-a648-c31c1143929a",
          "citation": "D03382",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c62386ec-86bf-4b0b-b514-a268b1f83129",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f535288c-a2ec-429a-9c01-6f340d4ad400",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "979b083a-e6f4-4e3a-a441-f11806207b97",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389744000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81042a50-9b3d-4f10-8ed9-7af58c5da7d2",
          "citation": "SRS import [M2X04R2E2Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M2X04R2E2Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389744000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d11c89c-f887-4748-9fbc-552a63b3eec0",
          "citation": "CARBADOX [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f5166e3c-36a4-4bc4-8118-e50348b7e886",
          "citation": "CARBADOX [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "34288b80-423d-4ff9-ab16-85f4a80b7447",
          "citation": "CARBADOX [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ecc48ed7-7334-48d0-93d1-8d17bdaebb79",
          "citation": "CARBADOX [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7b79d64b-15f6-486b-9198-cb02df544256",
          "citation": "CARBADOX [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "070c310a-7592-4de6-9822-05ac7d89b6e6",
          "citation": "CARBADOX [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "93a64356-7d51-53f3-d0ec-bd70a5bbb7f7",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+6804-07-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8f65627e-41ea-9741-90ac-0af9b6e16978",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6804-07-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0074f890-1a07-75b6-ea46-8bb563dbd432",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a4002b00-5ae2-4510-8364-189a3359bce5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "79f14886-1149-b935-68c5-bf7189753b94",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "a071146d-79ef-443a-a5bc-07ef54f419fe",
          "citation": "Toxicology 1981;22(3):219",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f5d55fc8-3610-7bf9-6c76-101d6e03231e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "38ec601c-2ebf-736a-19f1-fedd0588f3fe",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c57b99d2-3084-2113-9228-b5e4afce5320",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "35f9c5a1-8d40-4722-ab35-bee6dd60e027",
          "id": "35f9c5a1-8d40-4722-ab35-bee6dd60e027",
          "molfile": "\n  Marvin  01132102522D          \n\n 19 20  0  0  0  0            999 V2000\n    2.1109   -4.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9838   -3.3036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6603   -2.7906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3536   -3.0750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5574   -1.9662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2463   -1.4500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8776   -1.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6167   -1.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6167   -2.1890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3249   -2.6202    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.3326   -3.4670    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.0640   -2.2121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7954   -2.6202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5063   -2.2121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5063   -1.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8031   -1.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0871   -1.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3326   -1.0265    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.3557   -0.1771    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  3  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 18  2  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 17  2  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\nM  CHG  4  10   1  11  -1  18   1  19  -1\nM  END",
          "smiles": "COC(=O)NN=Cc1c[n+](c2ccccc2[n+]1[O-])[O-]",
          "formula": "C11H10N4O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fd2b0160-13ab-4cda-8f46-bbba0bc949f5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "262.2219",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3d56f43d-67dd-446f-b32d-1b5241035a58",
      "version": "14",
      "structure": {
        "id": "90eab895-ece2-4531-978c-7032ea50c27e",
        "molfile": "\n  Marvin  01132107312D          \n\n 19 20  0  0  0  0            999 V2000\n    5.3326   -1.0265    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.3249   -2.6202    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.6167   -1.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0871   -1.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0640   -2.2121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6167   -2.1890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6603   -2.7906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3557   -0.1771    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.8776   -1.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3326   -3.4670    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.2463   -1.4500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5574   -1.9662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3536   -3.0750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9838   -3.3036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8031   -1.0265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7954   -2.6202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1109   -4.1297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5063   -1.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5063   -2.2121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  5  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  3  1  0  0  0  0\n  7 12  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  9  2  3  0  0  0\n 12 11  1  0  0  0  0\n 13  7  2  0  0  0  0\n 14  7  1  0  0  0  0\n 15  4  1  0  0  0  0\n 16  5  1  0  0  0  0\n 17 14  1  0  0  0  0\n 18 15  2  0  0  0  0\n 19 18  1  0  0  0  0\n  6  2  2  0  0  0  0\n 19 16  2  0  0  0  0\nM  CHG  4   1   1   2   1   8  -1  10  -1\nM  END",
        "smiles": "COC(=O)NN=Cc1c[n+](c2ccccc2[n+]1[O-])[O-]",
        "formula": "C11H10N4O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "262.2219",
        "optical_activity": "NONE",
        "references": [
          "0d547868-0f32-49b5-bdbe-f1899ca96fd2",
          "81042a50-9b3d-4f10-8ed9-7af58c5da7d2",
          "200df982-283c-4a7a-80be-0aa7143ddc06"
        ],
        "stereo_centers": 0
      },
      "unii": "M2X04R2E2Y"
    }
  ]
}