{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b257b47a-135e-4e18-9bc3-7298ecd161f6",
          "code": "4221-80-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4221-80-1",
          "code_system": "CAS",
          "references": [
            "4e1a9a63-5389-494d-b672-424eec92b10b",
            "5a7706f6-0f09-4260-8a84-ebeacbe51277"
          ]
        },
        {
          "uuid": "7fc43114-4902-416a-b3ea-0c6dc4993889",
          "code": "77897",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/77897",
          "code_system": "PUBCHEM",
          "references": [
            "4e1a9a63-5389-494d-b672-424eec92b10b"
          ]
        },
        {
          "uuid": "f90a5195-e99c-483b-873d-f773cb234720",
          "code": "224-166-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.970",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4e1a9a63-5389-494d-b672-424eec92b10b"
          ]
        },
        {
          "uuid": "6580ba4a-441c-41df-7357-f6872fcd9ac7",
          "code": "DTXSID5063364",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5063364",
          "code_system": "EPA CompTox",
          "references": [
            "6cd12692-828f-87b4-99db-52bcfab24b50"
          ]
        },
        {
          "uuid": "4417e9b9-b9d3-479c-b06a-c0e57d45d41a",
          "code": "M2AC510TZ8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "970ee31f-e13f-485c-bba1-85c967fa170f",
          "name": "2,4-DI-TERT-BUTYLPHENYL 3',5'-DI-TERT-BUTYL-4'-HYDROXYBENZOATE",
          "stdName": "2,4-DI-TERT-BUTYLPHENYL 3',5'-DI-TERT-BUTYL-4'-HYDROXYBENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbee1989-6df8-4f81-b81d-fb3b32a9ec86",
            "9adc0af5-38c6-4f39-90c2-8e555fb777f6"
          ],
          "display_name": false
        },
        {
          "uuid": "23f85cfd-22f8-4262-9867-865db0a9fea0",
          "name": "2,4-DI-TERT-BUTYLPHENYL 4'-HYDROXY-3',5'-DI-TERT-BUTYLBENZOATE",
          "stdName": "2,4-DI-TERT-BUTYLPHENYL 4'-HYDROXY-3',5'-DI-TERT-BUTYLBENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbee1989-6df8-4f81-b81d-fb3b32a9ec86",
            "9adc0af5-38c6-4f39-90c2-8e555fb777f6"
          ],
          "display_name": false
        },
        {
          "uuid": "3eff0d16-579e-4af3-8620-5f304da9b70d",
          "name": "BENZOIC ACID, 3,5-BIS(1,1-DIMETHYLETHYL)-4-HYDROXY-, 2,4-BIS(1,1-DIMETHYLETHYL)PHENYL ESTER",
          "stdName": "BENZOIC ACID, 3,5-BIS(1,1-DIMETHYLETHYL)-4-HYDROXY-, 2,4-BIS(1,1-DIMETHYLETHYL)PHENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbee1989-6df8-4f81-b81d-fb3b32a9ec86",
            "9adc0af5-38c6-4f39-90c2-8e555fb777f6"
          ],
          "display_name": false
        },
        {
          "uuid": "da6b9ec0-2dce-4eca-99de-701dfb6aa352",
          "name": "BENZOIC ACID, 3,5-DI-TERT-BUTYL-4-HYDROXY-, 2,4-DI-TERT-BUTYLPHENYL ESTER",
          "stdName": "BENZOIC ACID, 3,5-DI-TERT-BUTYL-4-HYDROXY-, 2,4-DI-TERT-BUTYLPHENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbee1989-6df8-4f81-b81d-fb3b32a9ec86",
            "9adc0af5-38c6-4f39-90c2-8e555fb777f6"
          ],
          "display_name": false
        },
        {
          "uuid": "870ac942-30c0-4a2f-958a-8c2566869f50",
          "name": "TETRABUTYL PHENYL HYDROXYBENZOATE",
          "stdName": "TETRABUTYL PHENYL HYDROXYBENZOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f0a646c-993b-4781-8a51-780bc15fafdd",
            "bbee1989-6df8-4f81-b81d-fb3b32a9ec86",
            "f0dbc08d-c37d-4e0e-b595-83227bf02073"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "67850bbc-b831-4233-9c12-4fcd75cf5173",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f487169f-5a2c-4b1b-8aca-8344b6a9c9c9",
          "name": "UV-CHEK AM-340",
          "stdName": "UV-CHEK AM-340",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bbee1989-6df8-4f81-b81d-fb3b32a9ec86",
            "f0dbc08d-c37d-4e0e-b595-83227bf02073"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f0dbc08d-c37d-4e0e-b595-83227bf02073",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bbee1989-6df8-4f81-b81d-fb3b32a9ec86",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9adc0af5-38c6-4f39-90c2-8e555fb777f6",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e1a9a63-5389-494d-b672-424eec92b10b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391012000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74bbb9dd-e17a-4df9-985e-4bdc5843aa96",
          "citation": "SRS import [M2AC510TZ8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M2AC510TZ8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391012000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42297282-549d-4075-a068-feeff35dd67b",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f0a646c-993b-4781-8a51-780bc15fafdd",
          "citation": "TETRABUTYL PHENYL HYDROXYBENZOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6cd12692-828f-87b4-99db-52bcfab24b50",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4221-80-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5a7706f6-0f09-4260-8a84-ebeacbe51277",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "28cba1ce-13a5-41b6-85a1-81054042cb07",
          "id": "28cba1ce-13a5-41b6-85a1-81054042cb07",
          "molfile": "\n  Marvin  01132102142D          \n\n 32 33  0  0  0  0            999 V2000\n    4.3190   -7.7621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9033   -7.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4923   -6.3318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1881   -7.4579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6184   -6.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3307   -7.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0493   -6.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0493   -5.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7629   -5.3974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4728   -5.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4728   -6.6348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1868   -5.3932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1868   -4.5682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9097   -4.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6177   -4.5692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0438   -4.3229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6177   -5.3942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9052   -5.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3325   -5.8057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7440   -5.0909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9165   -6.5205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0473   -6.2173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9097   -3.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0847   -3.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7347   -3.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9097   -2.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3279   -5.3984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6184   -5.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3279   -4.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5029   -4.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1529   -4.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3279   -3.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n 28  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 27  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 18  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 14 23  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 17  1  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n 23 26  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 29 31  1  0  0  0  0\n 29 32  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1ccc(c(c1)C(C)(C)C)OC(=O)c2cc(c(c(c2)C(C)(C)C)O)C(C)(C)C",
          "formula": "C29H42O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "12fa58a1-8eb8-416d-9858-a571e91b180f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "438.6431",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a796b45e-fb5f-46c9-b47a-51500755de75",
      "version": "4",
      "structure": {
        "id": "8a9f3b01-9b4e-4317-89f0-1339bdd716c5",
        "molfile": "\n  Marvin  01132107122D          \n\n 32 33  0  0  0  0            999 V2000\n    7.4728   -6.6348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4728   -5.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7629   -5.3974    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0493   -5.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3279   -5.3984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6184   -5.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6184   -6.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3307   -7.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0493   -6.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9033   -7.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3190   -7.7621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4923   -6.3318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1881   -7.4579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3279   -4.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5029   -4.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1529   -4.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3279   -3.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1868   -5.3932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9052   -5.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6177   -5.3942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6177   -4.5692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0438   -4.3229    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9097   -4.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9097   -3.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0847   -3.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7347   -3.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9097   -2.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1868   -4.5682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3325   -5.8057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7440   -5.0909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9165   -6.5205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0473   -6.2173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9  4  2  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n  5 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n  2 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 24 27  1  0  0  0  0\n 23 28  1  0  0  0  0\n 28 18  2  0  0  0  0\n 20 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 29 31  1  0  0  0  0\n 29 32  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1ccc(c(c1)C(C)(C)C)OC(=O)c2cc(c(c(c2)C(C)(C)C)O)C(C)(C)C",
        "formula": "C29H42O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "438.6431",
        "optical_activity": "NONE",
        "references": [
          "74bbb9dd-e17a-4df9-985e-4bdc5843aa96",
          "42297282-549d-4075-a068-feeff35dd67b"
        ],
        "stereo_centers": 0
      },
      "unii": "M2AC510TZ8"
    }
  ]
}