{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f894343c-4ecd-42f4-b955-75f521f07a29",
          "code": "5119-24-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=5119-24-4",
          "code_system": "CAS",
          "references": [
            "134f5e70-3576-4662-b0b3-dc2a8e097b54",
            "494759ac-d674-418b-ac43-034810c4a895"
          ]
        },
        {
          "uuid": "63993ed9-5dcc-44aa-abe0-2ea1006a20d1",
          "code": "87319941",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/87319941",
          "code_system": "PUBCHEM",
          "references": [
            "134f5e70-3576-4662-b0b3-dc2a8e097b54"
          ]
        },
        {
          "uuid": "aa353c7d-73d3-d420-be15-9f56ffaf9253",
          "code": "DTXSID00199206",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00199206",
          "code_system": "EPA CompTox",
          "references": [
            "ceac4b72-0b17-caad-44f9-f7ce91f37c9a"
          ]
        },
        {
          "uuid": "411c5c82-3972-4ea2-818d-16924d577774",
          "code": "M25U72FT59",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "dabe5d15-b275-4865-a0d4-4ca73664847f",
          "name": "ALLANTOIN GALACTURONIC ACID",
          "stdName": "ALLANTOIN GALACTURONIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a677a18-06ae-4b93-a4bc-38e1081716d0",
            "fd35bb6f-0c0a-4d54-b5cc-0c6fa4c8229f",
            "0af9848b-2401-42ed-9e93-a94629daf868"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8063782a-34ba-4fd5-bd06-c4b7015aec2a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "a451daef-ccc3-4a1e-b083-f92bed32e618",
          "name": "ALLANTOIN, MONOGALACTOPYRANURONATE",
          "stdName": "ALLANTOIN, MONOGALACTOPYRANURONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a677a18-06ae-4b93-a4bc-38e1081716d0",
            "614b845f-a084-4162-b16f-151959ec7d9a"
          ],
          "display_name": false
        },
        {
          "uuid": "ff7e9679-8e44-4c7b-8694-0ff5995cf2ac",
          "name": "GALACTOPYRANURONIC ACID, COMPD. WITH ALLANTOIN (1:1)",
          "stdName": "GALACTOPYRANURONIC ACID, COMPD. WITH ALLANTOIN (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a677a18-06ae-4b93-a4bc-38e1081716d0",
            "614b845f-a084-4162-b16f-151959ec7d9a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0af9848b-2401-42ed-9e93-a94629daf868",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4a677a18-06ae-4b93-a4bc-38e1081716d0",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "614b845f-a084-4162-b16f-151959ec7d9a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "134f5e70-3576-4662-b0b3-dc2a8e097b54",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391421000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec850c1c-91c1-4d32-846b-75cfffc2056f",
          "citation": "SRS import [M25U72FT59]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M25U72FT59",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391421000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd35bb6f-0c0a-4d54-b5cc-0c6fa4c8229f",
          "citation": "ALLANTOIN GALACTURONIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ceac4b72-0b17-caad-44f9-f7ce91f37c9a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5119-24-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "494759ac-d674-418b-ac43-034810c4a895",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5dfe345c-c30b-48df-a754-b81f2a290fbd",
          "id": "5dfe345c-c30b-48df-a754-b81f2a290fbd",
          "molfile": "\n  Marvin  01132104522D          \n\n 11 11  0  0  1  0            999 V2000\n    6.2752   -5.7956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0288   -5.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6963   -5.9449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1151   -4.6396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4477   -4.1547    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.4477   -3.3297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6631   -3.0748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4082   -2.2902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1781   -3.7422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6631   -4.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4082   -5.1942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\nM  END",
          "smiles": "C1(C(=O)NC(=O)N1)NC(=O)N",
          "formula": "C4H6N4O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4c26b5c2-e6e3-4fa8-ade3-933c7b300dc5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "158.1156",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        },
        {
          "uuid": "bc122983-d484-40eb-8ba3-11e534275b1d",
          "id": "bc122983-d484-40eb-8ba3-11e534275b1d",
          "molfile": "\n  Marvin  01132109442D          \n\n 13 12  0  0  1  0            999 V2000\n   12.7007   -3.2750    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   12.7158   -2.4501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4075   -3.7005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1293   -3.3012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9788   -3.6744    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   11.9637   -4.4992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2720   -3.2489    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   11.2871   -2.4240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5501   -3.6483    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   10.5350   -4.4731    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8433   -3.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1214   -3.6221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8584   -2.3979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  6  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\nM  END",
          "smiles": "C(=O)[C@@H]([C@H]([C@H]([C@@H](C(=O)O)O)O)O)O",
          "formula": "C6H10O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bbee3b1b-d494-4996-91c1-4b6f7cebd045"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "194.1397",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cf2c9388-d185-47e2-96d9-03308408016e",
      "version": "8",
      "structure": {
        "id": "d4bfee66-b439-4ccd-98f0-9ff7378fc5f2",
        "molfile": "\n  Marvin  01132111012D          \n\n 24 23  0  0  1  0            999 V2000\n    5.1781   -3.7422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6631   -4.4096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4082   -5.1942    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4477   -4.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1151   -4.6396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0288   -5.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6963   -5.9449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2752   -5.7956    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4477   -3.3297    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6631   -3.0748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4082   -2.2902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7007   -3.2750    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.9788   -3.6744    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   11.2720   -3.2489    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.5501   -3.6483    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.7158   -2.4501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9637   -4.4992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5350   -4.4731    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8433   -3.2227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1214   -3.6221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8584   -2.3979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2871   -2.4240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4075   -3.7005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1293   -3.3012    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  9  1  0  0  0  0\n  1 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 12 16  1  1  0  0  0\n 13 17  1  1  0  0  0\n 15 18  1  6  0  0  0\n 15 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 14 22  1  6  0  0  0\n 12 23  1  0  0  0  0\n 23 24  2  0  0  0  0\nM  END",
        "smiles": "C(=O)[C@@H]([C@H]([C@H]([C@@H](C(=O)O)O)O)O)O.C1(C(=O)NC(=O)N1)NC(=O)N",
        "formula": "C6H10O7.C4H6N4O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "EPIMERIC",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "352.2553",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "ec850c1c-91c1-4d32-846b-75cfffc2056f",
          "0af9848b-2401-42ed-9e93-a94629daf868"
        ],
        "stereo_centers": 5,
        "stereo_comments": "C4H6N4O3"
      },
      "unii": "M25U72FT59"
    }
  ]
}