{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "bd60c403-ce27-4441-8c76-133599665a6f", "code": "757942-88-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=757942-88-4", "code_system": "CAS", "references": [ "2390c8da-135f-4957-ad34-ccbdd9035ef2", "05121741-948f-404f-9307-0665a4dcec07" ] }, { "uuid": "cf41058e-3060-a266-587e-823e13edf21f", "code": "M24S4WZS8J", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=M24S4WZS8J", "code_system": "DAILYMED", "references": [ "ef615645-2304-a3a2-6ed6-806147690d40" ] }, { "uuid": "360ccc7e-1769-209b-86f2-0ad7d0a0ee14", "code": "91936905", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/91936905", "code_system": "PUBCHEM", "references": [ "dddfb5a3-b8b5-9abb-51b2-95826aea90f8" ] }, { "uuid": "c298dfad-e716-4c56-b089-4ecd7797ed2b", "code": "M24S4WZS8J", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "749be1bf-7b2a-1bb9-38e8-a691deddf067", "code": "2476004", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2476004/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "159d988f-2686-2c25-0f01-a94af4a1e411" ] } ], "relationships": [ { "uuid": "54998dd9-94c8-481a-a7df-646b560a8739", "type": "SUBSTANCE->SUB_ALTERNATE", "related_substance": { "uuid": "eb6f2746-62f1-403b-b1ab-78e9ea20880e", "refuuid": "423ff035-b8e6-4f87-b968-1a89faef8fbd", "name": "ALTERNATIVE DEFINITION for [ACETYL TETRAPEPTIDE-2]", "linking_id": "423ff035-b8e6-4f87-b968-1a89faef8fbd", "ref_pname": "NO NAME" } } ], "substance_class": "chemical", "names": [ { "uuid": "fec68677-6302-42a4-8902-92dc687b0af2", "name": "AC-LYS-ASP-VAL-TYR", "stdName": "AC-LYS-ASP-VAL-TYR", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c8ba1ded-d738-48c0-ab6c-5755f2a2d8b1", "afc4dee5-f712-4392-b929-4df22c6209e3" ], "display_name": false }, { "uuid": "6d56931e-4993-4c05-9aaa-fb812731dcfb", "name": "ACETYL TETRAPEPTIDE-2", "stdName": "ACETYL TETRAPEPTIDE-2", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "c8ba1ded-d738-48c0-ab6c-5755f2a2d8b1", "ec27600b-6241-4a18-87e4-b0b029b8bdc9", "1b9002f1-cf02-4d2f-a694-7026d6bdfd2d" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "f7172eaa-86f2-4b4a-8a20-c4fa880e9eef", "name_org": "INCI" } ] }, { "uuid": "532f145f-46e1-4e3c-a6eb-1c14477169eb", "name": "L-TYROSINE, N2-ACETYL-L-LYSYL-L-.ALPHA.-ASPARTYL-L-VALYL-", "stdName": "L-TYROSINE, N2-ACETYL-L-LYSYL-L-.ALPHA.-ASPARTYL-L-VALYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "963ab9d1-f303-49c6-af95-7470cb36ab2f", "c8ba1ded-d738-48c0-ab6c-5755f2a2d8b1" ], "display_name": false }, { "uuid": "090fe5dc-3344-4b9a-92e3-33bdfea53978", "name": "PEPTIGRAVITY", "stdName": "PEPTIGRAVITY", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "c8ba1ded-d738-48c0-ab6c-5755f2a2d8b1", "1b9002f1-cf02-4d2f-a694-7026d6bdfd2d" ], "display_name": false }, { "uuid": "0a758f90-6574-490a-9a32-ece7cd03ef4c", "name": "THYMULEN 4", "stdName": "THYMULEN 4", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "c8ba1ded-d738-48c0-ab6c-5755f2a2d8b1", "1b9002f1-cf02-4d2f-a694-7026d6bdfd2d" ], "display_name": false } ], "references": [ { "uuid": "1b9002f1-cf02-4d2f-a694-7026d6bdfd2d", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "c8ba1ded-d738-48c0-ab6c-5755f2a2d8b1", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "afc4dee5-f712-4392-b929-4df22c6209e3", "citation": "http://www.rssynthesis.com/cosmetic-peptides/", "url": "http://www.rssynthesis.com/cosmetic-peptides/", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "963ab9d1-f303-49c6-af95-7470cb36ab2f", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2390c8da-135f-4957-ad34-ccbdd9035ef2", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391914000, "tags": [ "NOMEN" ] }, { "uuid": "b8101cdf-dee9-45cc-a259-85182ea7afba", "citation": "SRS import [M24S4WZS8J]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M24S4WZS8J", "doc_type": "SRS", "public_domain": true, "document_date": 1493391914000, "tags": [ "NOMEN" ] }, { "uuid": "ec27600b-6241-4a18-87e4-b0b029b8bdc9", "citation": "ACETYL TETRAPEPTIDE-2 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "dddfb5a3-b8b5-9abb-51b2-95826aea90f8", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "05121741-948f-404f-9307-0665a4dcec07", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "159d988f-2686-2c25-0f01-a94af4a1e411", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "ef615645-2304-a3a2-6ed6-806147690d40", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ee5c79fc-3f2e-4954-a11e-3bc5e9a3920d", "id": "ee5c79fc-3f2e-4954-a11e-3bc5e9a3920d", "molfile": "\n Marvin 01132112212D \n\n 40 40 0 0 1 0 999 V2000\n 14.4367 -10.7590 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 14.5800 -9.9465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3552 -9.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4985 -8.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2738 -8.5697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4171 -7.7571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0687 -11.2892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8440 -11.0071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9873 -10.1946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4759 -11.5374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6614 -11.0411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0295 -10.5108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5182 -11.8536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1502 -12.3839 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 14.9254 -12.1017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5575 -12.6321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4142 -13.4446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3327 -12.3499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0069 -13.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6389 -13.7267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2316 -13.4785 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2316 -14.3036 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 13.9461 -14.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9461 -15.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6606 -14.3036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5171 -14.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5171 -15.5412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8026 -14.3036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0881 -14.7161 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 10.3737 -14.3036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3737 -13.4785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0882 -13.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0882 -12.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3737 -11.8286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3737 -11.0036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6592 -12.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6592 -13.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0881 -15.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3737 -15.9536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8026 -15.9536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 7 1 6 0 0 0\n 1 11 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 2 0 0 0 0\n 11 12 2 0 0 0 0\n 13 11 1 0 0 0 0\n 14 13 1 1 0 0 0\n 14 15 1 0 0 0 0\n 14 19 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 2 0 0 0 0\n 19 20 2 0 0 0 0\n 19 21 1 0 0 0 0\n 22 21 1 1 0 0 0\n 22 23 1 0 0 0 0\n 22 26 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 25 1 0 0 0 0\n 26 27 2 0 0 0 0\n 26 28 1 0 0 0 0\n 29 28 1 6 0 0 0\n 29 30 1 0 0 0 0\n 29 38 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 37 2 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 36 34 2 0 0 0 0\n 37 36 1 0 0 0 0\n 38 39 1 0 0 0 0\n 38 40 2 0 0 0 0\nM END", "smiles": "CC(C)[C@@H](C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)C", "formula": "C26H39N5O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "848a19e0-b2c2-4322-aaea-f01f37c7afdf" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "565.617", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "f586292a-06e2-41d4-b421-ae8788f1c2af", "version": "10", "structure": { "id": "040ee137-ec14-485d-afc2-f040c3c57c12", "molfile": "\n Marvin 01132100312D \n\n 40 40 0 0 1 0 999 V2000\n 14.1502 -12.3839 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.4367 -10.7590 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.2316 -14.3036 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.0881 -14.7161 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.9254 -12.1017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5575 -12.6321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4142 -13.4446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3327 -12.3499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5182 -11.8536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6614 -11.0411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0295 -10.5108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0687 -11.2892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8440 -11.0071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4759 -11.5374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9873 -10.1946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5800 -9.9465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3552 -9.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4985 -8.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.2738 -8.5697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4171 -7.7571 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0069 -13.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6389 -13.7267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2316 -13.4785 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9461 -14.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9461 -15.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6606 -14.3036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5171 -14.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5171 -15.5412 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8026 -14.3036 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0881 -15.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3737 -15.9536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8026 -15.9536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3737 -14.3036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3737 -13.4785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0882 -13.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0882 -12.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3737 -11.8286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3737 -11.0036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6592 -12.2410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6592 -13.0661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 1 9 1 1 0 0 0\n 10 2 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 2 12 1 6 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 13 15 1 0 0 0 0\n 2 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 1 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 3 23 1 1 0 0 0\n 21 23 1 0 0 0 0\n 3 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 3 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 4 29 1 6 0 0 0\n 27 29 1 0 0 0 0\n 4 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 30 32 1 0 0 0 0\n 4 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 2 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 39 37 2 0 0 0 0\n 40 39 1 0 0 0 0\n 34 40 2 0 0 0 0\nM END", "smiles": "CC(C)[C@@H](C(=O)N[C@@H](Cc1ccc(cc1)O)C(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCCCN)NC(=O)C", "formula": "C26H39N5O9", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "565.617", "optical_activity": "UNSPECIFIED", "references": [ "b8101cdf-dee9-45cc-a259-85182ea7afba", "afc4dee5-f712-4392-b929-4df22c6209e3" ], "stereo_centers": 4 }, "unii": "M24S4WZS8J" } ] }