{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7ce523e4-38a4-4409-bad1-36c14634ee27", "code": "18758-91-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=18758-91-3", "code_system": "CAS", "references": [ "479a3398-b764-4981-a33b-3100b7222ca9", "0df8e252-7b1b-4424-b728-6e0420188cf2" ] }, { "uuid": "9026fdf9-d3f7-4f89-8c64-40dd937144fd", "code": "10144957", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10144957", "code_system": "PUBCHEM", "references": [ "479a3398-b764-4981-a33b-3100b7222ca9" ] }, { "uuid": "fe236dd7-8442-1f37-cb37-d37de424a06f", "code": "DTXSID90172068", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90172068", "code_system": "EPA CompTox", "references": [ "446e1c2f-17b9-93ae-9130-789212bb85a3" ] }, { "uuid": "d7b6b58d-1ed2-49a1-a105-cf3394428367", "code": "M10QI69BSD", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "456b9c63-08a9-4d35-aaf9-6a69c58444e3", "name": "1,1,1,7,7,7-HEXAMETHYL-3,5-DIPHENYL-3,5-BIS(TRIMETHYLSILYLOXY)TETRASILOXANE", "stdName": "1,1,1,7,7,7-HEXAMETHYL-3,5-DIPHENYL-3,5-BIS(TRIMETHYLSILYLOXY)TETRASILOXANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "883efec7-0806-43b3-84d7-57b7d0b88e4c", "49bcd0f6-ad39-4799-a33a-b8a811d5439c" ], "display_name": false }, { "uuid": "409a0c85-fe63-4301-a324-4e02d51f1480", "name": "BISPHENYLHEXAMETHICONE", "stdName": "BISPHENYLHEXAMETHICONE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "1a60e075-b3eb-40d2-a4e0-8b37adfd0451", "49bcd0f6-ad39-4799-a33a-b8a811d5439c", "ecf87016-67a4-4552-bb22-70e51ce5023e" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "0e60c6f4-45bc-4293-80a1-78b403af21fe", "name_org": "INCI" } ] }, { "uuid": "1149a523-6283-4ff5-b85f-eb87b33de38a", "name": "DIPHENYLHEXAMETHICONE", "stdName": "DIPHENYLHEXAMETHICONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8a9f166f-e663-4e9a-8863-ef9a3fe5bde5", "49bcd0f6-ad39-4799-a33a-b8a811d5439c" ], "display_name": false }, { "uuid": "1cb27630-392f-4f10-afa7-5d355c51dcac", "name": "TETRAKIS(TRIMETHYLSILYLOXY)-1,3-DIPHENYLDISILOXANE", "stdName": "TETRAKIS(TRIMETHYLSILYLOXY)-1,3-DIPHENYLDISILOXANE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "883efec7-0806-43b3-84d7-57b7d0b88e4c", "49bcd0f6-ad39-4799-a33a-b8a811d5439c" ], "display_name": false }, { "uuid": "6571ed6d-4529-420b-ac0e-5864e17e42eb", "name": "TETRASILOXANE, 1,1,1,7,7,7-HEXAMETHYL-3,5-DIPHENYL-3,5-BIS((TRIMETHYLSILYL)OXY)-", "stdName": "TETRASILOXANE, 1,1,1,7,7,7-HEXAMETHYL-3,5-DIPHENYL-3,5-BIS((TRIMETHYLSILYL)OXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "883efec7-0806-43b3-84d7-57b7d0b88e4c", "49bcd0f6-ad39-4799-a33a-b8a811d5439c" ], "display_name": false }, { "uuid": "de5b8158-7aec-4299-a8cc-dae896af3c72", "name": "TETRASILOXANE, 1,1,1,7,7,7-HEXAMETHYL-3,5-DIPHENYL-3,5-BIS(TRIMETHYLSILOXY)-", "stdName": "TETRASILOXANE, 1,1,1,7,7,7-HEXAMETHYL-3,5-DIPHENYL-3,5-BIS(TRIMETHYLSILOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "883efec7-0806-43b3-84d7-57b7d0b88e4c", "49bcd0f6-ad39-4799-a33a-b8a811d5439c" ], "display_name": false } ], "references": [ { "uuid": "ecf87016-67a4-4552-bb22-70e51ce5023e", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "49bcd0f6-ad39-4799-a33a-b8a811d5439c", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "883efec7-0806-43b3-84d7-57b7d0b88e4c", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8a9f166f-e663-4e9a-8863-ef9a3fe5bde5", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "479a3398-b764-4981-a33b-3100b7222ca9", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391413000, "tags": [ "NOMEN" ] }, { "uuid": "89a368d1-a487-4244-ad6e-880fdae7191f", "citation": "SRS import [M10QI69BSD]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M10QI69BSD", "doc_type": "SRS", "public_domain": true, "document_date": 1493391413000, "tags": [ "NOMEN" ] }, { "uuid": "1a60e075-b3eb-40d2-a4e0-8b37adfd0451", "citation": "BISPHENYLHEXAMETHICONE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "446e1c2f-17b9-93ae-9130-789212bb85a3", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=18758-91-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "0df8e252-7b1b-4424-b728-6e0420188cf2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c28b643e-bc20-46e0-a377-693ec351a0bf", "id": "c28b643e-bc20-46e0-a377-693ec351a0bf", "molfile": "\n Marvin 01132110032D \n\n 35 36 0 0 0 0 999 V2000\n 4.7739 -5.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3116 -5.0326 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5010 -4.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0387 -4.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1223 -5.1856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6600 -4.5600 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0640 -5.2793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6430 -5.9888 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2221 -6.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8181 -5.9789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0469 -6.7080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3793 -4.1561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0888 -4.5771 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6115 -5.2153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4255 -5.0817 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9483 -5.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7169 -4.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2397 -4.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6678 -5.2865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0717 -6.0058 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4757 -6.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8967 -6.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6508 -6.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5098 -3.8676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1058 -3.1483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5268 -2.4388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3517 -2.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7556 -3.1680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3346 -3.8775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2562 -3.8407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4312 -3.8309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0272 -3.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4482 -2.4021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2732 -2.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6771 -3.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 12 1 0 0 0 0\n 6 30 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 8 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 19 1 0 0 0 0\n 13 24 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 15 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 1 0 0 0 0\n 20 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 24 29 2 0 0 0 0\n 26 25 2 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 2 0 0 0 0\n 29 28 1 0 0 0 0\n 31 30 1 0 0 0 0\n 30 35 2 0 0 0 0\n 32 31 2 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 2 0 0 0 0\n 35 34 1 0 0 0 0\nM END", "smiles": "C[Si](C)(C)O[Si](c1ccccc1)(O[Si](C)(C)C)O[Si](c2ccccc2)(O[Si](C)(C)C)O[Si](C)(C)C", "formula": "C24H46O5Si6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "fb08cca4-b0cb-4a9d-892b-ac16a850476c" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "583.1323", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "23ccb548-3f1f-4942-bd7e-2ea0bb45ad3d", "version": "4", "structure": { "id": "82f9148d-02c2-47f4-b075-d35d465c5bcf", "molfile": "\n Marvin 01132106482D \n\n 35 36 0 0 0 0 999 V2000\n 9.4255 -5.0817 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6115 -5.2153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3116 -5.0326 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1223 -5.1856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6600 -4.5600 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3793 -4.1561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0888 -4.5771 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0640 -5.2793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6430 -5.9888 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6678 -5.2865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.0717 -6.0058 0.0000 Si 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7739 -5.6583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5010 -4.8798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0387 -4.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2562 -3.8407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5098 -3.8676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9483 -5.7199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7169 -4.3100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2397 -4.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4757 -6.7251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8967 -6.0157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6508 -6.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2221 -6.6982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8181 -5.9789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0469 -6.7080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4312 -3.8309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0272 -3.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4482 -2.4021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2732 -2.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.6771 -3.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1058 -3.1483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5268 -2.4388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3517 -2.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7556 -3.1680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3346 -3.8775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7 2 1 0 0 0 0\n 4 5 1 0 0 0 0\n 3 4 1 0 0 0 0\n 6 7 1 0 0 0 0\n 5 6 1 0 0 0 0\n 2 1 1 0 0 0 0\n 9 8 1 0 0 0 0\n 5 8 1 0 0 0 0\n 11 10 1 0 0 0 0\n 7 10 1 0 0 0 0\n 3 12 1 0 0 0 0\n 3 13 1 0 0 0 0\n 3 14 1 0 0 0 0\n 5 15 1 0 0 0 0\n 7 16 1 0 0 0 0\n 1 17 1 0 0 0 0\n 1 18 1 0 0 0 0\n 1 19 1 0 0 0 0\n 11 20 1 0 0 0 0\n 11 21 1 0 0 0 0\n 11 22 1 0 0 0 0\n 9 23 1 0 0 0 0\n 9 24 1 0 0 0 0\n 9 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 2 0 0 0 0\n 29 28 1 0 0 0 0\n 30 29 2 0 0 0 0\n 26 15 2 0 0 0 0\n 15 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 2 0 0 0 0\n 31 16 2 0 0 0 0\n 16 35 1 0 0 0 0\nM END", "smiles": "C[Si](C)(C)O[Si](c1ccccc1)(O[Si](C)(C)C)O[Si](c2ccccc2)(O[Si](C)(C)C)O[Si](C)(C)C", "formula": "C24H46O5Si6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "583.1323", "optical_activity": "NONE", "references": [ "883efec7-0806-43b3-84d7-57b7d0b88e4c", "89a368d1-a487-4244-ad6e-880fdae7191f" ], "stereo_centers": 0 }, "unii": "M10QI69BSD" } ] }