{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "94ead1cc-5d00-4c74-aa7d-0b89efdcdf68",
          "code": "91269",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/91269/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "993e1c91-5a5d-4a37-ae9d-cec3f4204df1"
          ]
        },
        {
          "uuid": "567a7094-7d39-47b9-ab8a-40f74f6ae5e7",
          "code": "m5775",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5775?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "993e1c91-5a5d-4a37-ae9d-cec3f4204df1"
          ]
        },
        {
          "uuid": "e61efdbb-4c49-4a42-84e4-8466c40ef0f0",
          "code": "SUB13989MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "993e1c91-5a5d-4a37-ae9d-cec3f4204df1"
          ]
        },
        {
          "uuid": "85deef64-216b-4ad8-98c8-d31d0398ca0b",
          "code": "CHEMBL1255943",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1255943",
          "code_system": "ChEMBL",
          "references": [
            "993e1c91-5a5d-4a37-ae9d-cec3f4204df1"
          ]
        },
        {
          "uuid": "f9900493-ab38-4d09-86f6-5348f6612efc",
          "code": "205-315-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.833",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "993e1c91-5a5d-4a37-ae9d-cec3f4204df1"
          ]
        },
        {
          "uuid": "1707c297-c1dd-4b8f-ad82-dc677712787b",
          "code": "2723891",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2723891",
          "code_system": "PUBCHEM",
          "references": [
            "993e1c91-5a5d-4a37-ae9d-cec3f4204df1"
          ]
        },
        {
          "uuid": "0a5e9475-c203-4107-91d0-ffaf066ed4a4",
          "code": "A09AB01",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|DIGESTIVES, INCL. ENZYMES|DIGESTIVES, INCL. ENZYMES|Acid preparations|glutamic acid hydrochloride",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A09AB01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "993e1c91-5a5d-4a37-ae9d-cec3f4204df1"
          ]
        },
        {
          "uuid": "0ec2ae25-9d10-46c5-ad18-ec69bdb4c64f",
          "code": "QA09AB01",
          "comments": "VATC|DIGESTIVES, INCL. ENZYMES|DIGESTIVES, INCL. ENZYMES|Acid preparations|glutamic acid hydrochloride",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA09AB01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "993e1c91-5a5d-4a37-ae9d-cec3f4204df1"
          ]
        },
        {
          "uuid": "9cc1de4f-2286-4cb4-bbf2-57e8e2a77873",
          "code": "138-15-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=138-15-8",
          "code_system": "CAS",
          "references": [
            "993e1c91-5a5d-4a37-ae9d-cec3f4204df1",
            "21e4b72d-2f48-491b-8474-ce89d5d4799d"
          ]
        },
        {
          "uuid": "b85ce52d-eb34-4c57-8930-14fc851d2d4b",
          "code": "C28515",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28515",
          "code_system": "NCI_THESAURUS",
          "references": [
            "993e1c91-5a5d-4a37-ae9d-cec3f4204df1"
          ]
        },
        {
          "uuid": "640dd1fd-8851-410d-bd1d-3f3d5a3ac762",
          "code": "21 CFR 172.320",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart D--Special Dietary and Nutritional Additives|Sec. 172.320 Amino acids.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.320",
          "code_system": "CFR",
          "references": [
            "993e1c91-5a5d-4a37-ae9d-cec3f4204df1"
          ]
        },
        {
          "uuid": "22cdfb97-8830-4976-83e2-00dea82b1ff4",
          "code": "21 CFR 310.540",
          "comments": "PART 310 -- NEW DRUGS|Subpart E--Requirements for Specific New Drugs or Devices|Sec. 310.540 Drug products containing active ingredients offered over-the-counter (OTC) for use as stomach acidifiers.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=310.540",
          "code_system": "CFR",
          "references": [
            "993e1c91-5a5d-4a37-ae9d-cec3f4204df1"
          ]
        },
        {
          "uuid": "b5f562cc-9f42-574b-c0a9-600d26046f59",
          "code": "138-15-8",
          "type": "PRIMARY",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+138-15-8",
          "code_system": "HSDB",
          "references": [
            "0e5b1815-e846-a58c-f178-bf3444149469"
          ]
        },
        {
          "uuid": "33095d09-7f63-0ff0-03cb-f73f7c8520ec",
          "code": "DTXSID6047155",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6047155",
          "code_system": "EPA CompTox",
          "references": [
            "5bb2dad1-833b-7e88-be27-13ba7fc9cec4"
          ]
        },
        {
          "uuid": "f4fb2cc3-86e6-17f2-19df-146920ea5669",
          "code": "C78276",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Digestive System or Metabolism",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C78276",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ee5671dd-92b4-21fd-b747-6f4e91396fd3"
          ]
        },
        {
          "uuid": "e9c0c140-427e-8bbd-9024-a3a5474c9e92",
          "code": "DBSALT002484",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT002484",
          "code_system": "DRUG BANK",
          "references": [
            "ee5671dd-92b4-21fd-b747-6f4e91396fd3"
          ]
        },
        {
          "uuid": "57671ea1-12e6-4a66-93bf-141d3ed834a6",
          "code": "M0C2SP444T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6ed23cde-1947-b7d9-79d0-e4e136cd9536",
          "code": "1294987",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1294987",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "ee5671dd-92b4-21fd-b747-6f4e91396fd3"
          ]
        },
        {
          "uuid": "8377041b-3ef9-7745-19ad-3b2f926d109c",
          "code": "100000078194",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "04ea46d9-9c73-1a86-912d-1fe80eae87f7"
          ]
        },
        {
          "uuid": "71ebf718-cde8-be97-c70a-57f9c61a1a92",
          "code": "9239",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=9239",
          "code_system": "NSC",
          "references": [
            "8e1b90eb-1806-ddb9-a820-f94c0b10e978"
          ]
        },
        {
          "uuid": "a0d0107e-5c90-0c05-1e56-17213e0208db",
          "code": "M0C2SP444T",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=M0C2SP444T",
          "code_system": "DAILYMED",
          "references": [
            "c8fe00eb-4131-f975-540c-5e3d250628cb"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "1873fa7a-5564-4461-a28a-007d4a966b28",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "671e67af-1e3b-4709-b185-8d751c8f4cc4",
            "refuuid": "c1a85f3b-7e72-4564-8f18-461f9b6f8aa5",
            "name": "Glutamic Acid",
            "unii": "3KX376GY7L",
            "linking_id": "3KX376GY7L",
            "ref_pname": "Glutamic Acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "54bc3bfa-a8c1-4b87-99d9-7b2d1c6053fd",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "b47f8317-8615-409c-93da-a0f6ed9f9b76",
            "refuuid": "c1a85f3b-7e72-4564-8f18-461f9b6f8aa5",
            "name": "Glutamic Acid",
            "unii": "3KX376GY7L",
            "linking_id": "3KX376GY7L",
            "ref_pname": "Glutamic Acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "be61536f-1c6b-4c8e-a2fc-6de019b3e08b",
          "name": "GLUTAMIC ACID HCL",
          "stdName": "GLUTAMIC ACID HCL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ee087bc-0b08-4459-abd5-1656462a0aa5"
          ],
          "display_name": false
        },
        {
          "uuid": "26c9bb58-92dc-4aef-a7a1-ed9057c86252",
          "name": "GLUTAMIC ACID HYDROCHLORIDE",
          "stdName": "GLUTAMIC ACID HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "836b5694-fc85-48a5-9e5f-4c8a0c347958",
            "a47e6863-2c36-45a2-ba6a-885d84fca5e7",
            "42120a79-9462-4a3a-a001-89efcd41e089",
            "c4eab963-93da-46fa-80a0-a20a805d66eb",
            "5833d42c-dbae-4051-bc3a-39648b2bf462",
            "74f7c5e0-c5a3-4480-b1d0-442ce74b9422",
            "b67c4443-ca1f-405e-8f1a-bc8e2c90f6da",
            "f45040da-8d59-49d6-a748-281770497a94",
            "62f3efc5-4904-47c7-a18f-27903653993f",
            "f03ddbba-c9e9-4fa4-813a-b2c5eb75a6af",
            "2ba1716b-4a8d-4815-baf4-f1ef66f05f07",
            "be0a9427-3df2-4e99-87c5-f3c355288818"
          ],
          "display_name": true
        },
        {
          "uuid": "69194783-e1d7-4ea8-8a5c-2d195f7a6dff",
          "name": "GLUTAMIC ACID HYDROCHLORIDE [HSDB]",
          "stdName": "GLUTAMIC ACID HYDROCHLORIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b67c4443-ca1f-405e-8f1a-bc8e2c90f6da",
            "f45040da-8d59-49d6-a748-281770497a94"
          ],
          "display_name": false
        },
        {
          "uuid": "99344714-4bb3-408b-9818-f0dd57d6ba1b",
          "name": "GLUTAMIC ACID HYDROCHLORIDE [II]",
          "stdName": "GLUTAMIC ACID HYDROCHLORIDE [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a47e6863-2c36-45a2-ba6a-885d84fca5e7",
            "42120a79-9462-4a3a-a001-89efcd41e089"
          ],
          "display_name": false
        },
        {
          "uuid": "5ab20afb-c6e7-47f5-90da-76bf65575c59",
          "name": "GLUTAMIC ACID HYDROCHLORIDE [MART.]",
          "stdName": "GLUTAMIC ACID HYDROCHLORIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ba1716b-4a8d-4815-baf4-f1ef66f05f07"
          ],
          "display_name": false
        },
        {
          "uuid": "19df4191-1896-4891-8745-3f08c0edcb59",
          "name": "GLUTAMIC ACID HYDROCHLORIDE [MI]",
          "stdName": "GLUTAMIC ACID HYDROCHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5833d42c-dbae-4051-bc3a-39648b2bf462",
            "f45040da-8d59-49d6-a748-281770497a94"
          ],
          "display_name": false
        },
        {
          "uuid": "915e1353-e5cc-66a5-39d0-4f6a35395e9f",
          "name": "Glutamic acid hydrochloride [WHO-DD]",
          "stdName": "GLUTAMIC ACID HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "df8d489a-39cd-673b-4e73-da83572b3ed6"
          ],
          "display_name": false
        },
        {
          "uuid": "68078028-ca90-46a7-acaa-53174a9447b4",
          "name": "L-GLUTAMIC ACID HYDROCHLORIDE",
          "stdName": "L-GLUTAMIC ACID HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5437311b-8b46-4113-bedc-963a2bea9702",
            "52b79155-7f9b-4152-8d1c-2f854a55003a",
            "63eeb1a5-a381-4fcc-87f1-f23442a32d8b",
            "19d9219e-bf36-4673-a360-3340a653a5ad",
            "f45040da-8d59-49d6-a748-281770497a94"
          ],
          "display_name": false
        },
        {
          "uuid": "d9c9839a-4243-4a9a-9469-3f2361d4af67",
          "name": "L-GLUTAMIC ACID HYDROCHLORIDE [FCC]",
          "stdName": "L-GLUTAMIC ACID HYDROCHLORIDE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19d9219e-bf36-4673-a360-3340a653a5ad",
            "f45040da-8d59-49d6-a748-281770497a94"
          ],
          "display_name": false
        },
        {
          "uuid": "686c88be-2503-4dac-ac29-9b89a680a5fa",
          "name": "L-GLUTAMIC ACID HYDROCHLORIDE [USP-RS]",
          "stdName": "L-GLUTAMIC ACID HYDROCHLORIDE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63eeb1a5-a381-4fcc-87f1-f23442a32d8b",
            "f45040da-8d59-49d6-a748-281770497a94"
          ],
          "display_name": false
        },
        {
          "uuid": "b75e48ea-fddc-4601-a7f2-1715b46d9979",
          "name": "NSC-9239",
          "stdName": "NSC-9239",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70acecf0-1e08-4598-83c9-18486fc90643",
            "f45040da-8d59-49d6-a748-281770497a94"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "135575ff-a651-46d0-bee8-973c7975378a",
          "citation": "SRS import [M0C2SP444T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M0C2SP444T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390761000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be0a9427-3df2-4e99-87c5-f3c355288818",
          "citation": "GLUTAMIC ACID HYDROCHLORIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5437311b-8b46-4113-bedc-963a2bea9702",
          "citation": "L-GLUTAMIC ACID HYDROCHLORIDE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f03ddbba-c9e9-4fa4-813a-b2c5eb75a6af",
          "citation": "GLUTAMIC ACID HYDROCHLORIDE [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "74f7c5e0-c5a3-4480-b1d0-442ce74b9422",
          "citation": "GLUTAMIC ACID HYDROCHLORIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "52b79155-7f9b-4152-8d1c-2f854a55003a",
          "citation": "L-GLUTAMIC ACID HYDROCHLORIDE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "836b5694-fc85-48a5-9e5f-4c8a0c347958",
          "citation": "GLUTAMIC ACID HYDROCHLORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c4eab963-93da-46fa-80a0-a20a805d66eb",
          "citation": "GLUTAMIC ACID HYDROCHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a47e6863-2c36-45a2-ba6a-885d84fca5e7",
          "citation": "Merck Index 14th Edition",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "42120a79-9462-4a3a-a001-89efcd41e089",
          "citation": "OTC",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ee087bc-0b08-4459-abd5-1656462a0aa5",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ba1716b-4a8d-4815-baf4-f1ef66f05f07",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19d9219e-bf36-4673-a360-3340a653a5ad",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f45040da-8d59-49d6-a748-281770497a94",
          "citation": "USP FOOD CHEMICALS CODEX",
          "doc_type": "USP FOOD CHEMICALS CODEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b67c4443-ca1f-405e-8f1a-bc8e2c90f6da",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "63eeb1a5-a381-4fcc-87f1-f23442a32d8b",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62f3efc5-4904-47c7-a18f-27903653993f",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5833d42c-dbae-4051-bc3a-39648b2bf462",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70acecf0-1e08-4598-83c9-18486fc90643",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "993e1c91-5a5d-4a37-ae9d-cec3f4204df1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390761000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e5b1815-e846-a58c-f178-bf3444149469",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+138-15-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5bb2dad1-833b-7e88-be27-13ba7fc9cec4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=138-15-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ee5671dd-92b4-21fd-b747-6f4e91396fd3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "21e4b72d-2f48-491b-8474-ce89d5d4799d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8e1b90eb-1806-ddb9-a820-f94c0b10e978",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c8fe00eb-4131-f975-540c-5e3d250628cb",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "df8d489a-39cd-673b-4e73-da83572b3ed6",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "04ea46d9-9c73-1a86-912d-1fe80eae87f7",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "cc652290-7cd2-4340-88ba-9608ba28e576",
          "id": "cc652290-7cd2-4340-88ba-9608ba28e576",
          "molfile": "\n  Marvin  01132110332D          \n\n  1  0  0  0  1  0            999 V2000\n   -0.2792   -2.2976    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "19fa753a-0824-4253-8b4c-5181f72fc123"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "3f6d0cb6-61aa-4bfd-a037-43b3e3705d25",
          "id": "3f6d0cb6-61aa-4bfd-a037-43b3e3705d25",
          "molfile": "\n  Marvin  01132103212D          \n\n 10  9  0  0  1  0            999 V2000\n   -2.4837   -2.7135    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -3.1991   -2.3034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4837   -3.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2050   -3.9437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9175   -3.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9233   -2.7047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.6330   -3.9379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7682   -2.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7682   -1.4775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0470   -2.7077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  8  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\nM  END",
          "smiles": "C(CC(=O)O)[C@@H](C(=O)O)N",
          "formula": "C5H9NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c4825f30-c2b8-4ac4-950b-e8f5460a6301"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "147.1295",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "68ba578e-e301-49cf-92a1-5080c4b9fd08",
      "version": "15",
      "structure": {
        "id": "51196947-9170-410c-8815-cb0eb5e925d5",
        "molfile": "\n  Marvin  01132104132D          \n\n 11  9  0  0  1  0            999 V2000\n   -1.7682   -2.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9175   -3.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7682   -1.4775    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4837   -2.7135    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -3.9233   -2.7047    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4837   -3.5365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2050   -3.9437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0470   -2.7077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1991   -2.3034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.6330   -3.9379    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2792   -2.2976    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  2  0  0  0  0\n  4  6  1  6  0  0  0\n  7  6  1  0  0  0  0\n  8  1  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  2  1  0  0  0  0\nM  END",
        "smiles": "C(CC(=O)O)[C@@H](C(=O)O)N.Cl",
        "formula": "C5H9NO4.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "183.5903",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a47e6863-2c36-45a2-ba6a-885d84fca5e7",
          "135575ff-a651-46d0-bee8-973c7975378a"
        ],
        "stereo_centers": 1
      },
      "unii": "M0C2SP444T"
    }
  ]
}