{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c467f7d0-b29e-455e-8403-c6979f132867",
          "code": "72178-02-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=72178-02-0",
          "code_system": "CAS",
          "references": [
            "f5f27888-7d8e-44a8-afa8-c164abec6baf",
            "84182733-a90f-4f80-ad89-6a0ea56ba910"
          ]
        },
        {
          "uuid": "a127214f-19fc-4e60-a9e4-7d4951be4faa",
          "code": "C088563",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67088563",
          "code_system": "MESH",
          "references": [
            "f5f27888-7d8e-44a8-afa8-c164abec6baf"
          ]
        },
        {
          "uuid": "270b573c-c67d-4620-a897-da6cc3c4e0a5",
          "code": "123803",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4936",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "f5f27888-7d8e-44a8-afa8-c164abec6baf"
          ]
        },
        {
          "uuid": "5fefe05e-a3be-4eae-b366-f14980a32e4e",
          "code": "m5524",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5524?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f5f27888-7d8e-44a8-afa8-c164abec6baf"
          ]
        },
        {
          "uuid": "a14e44bd-793e-46d6-82e8-0f6488831b9c",
          "code": "276-439-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.069.470",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f5f27888-7d8e-44a8-afa8-c164abec6baf"
          ]
        },
        {
          "uuid": "8ee9af03-b272-4312-aa67-3851cfd95514",
          "code": "51556",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/51556",
          "code_system": "PUBCHEM",
          "references": [
            "f5f27888-7d8e-44a8-afa8-c164abec6baf"
          ]
        },
        {
          "uuid": "991bc226-5e45-97af-ce9f-17716250f713",
          "code": "6660",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6660",
          "code_system": "HSDB",
          "references": [
            "cb874c28-9654-6aec-7775-873eec47a79f"
          ]
        },
        {
          "uuid": "a903cec8-14a9-fe83-468b-42fc5e4e3878",
          "code": "DTXSID7024112",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7024112",
          "code_system": "EPA CompTox",
          "references": [
            "8e144fbe-2ca8-d732-0a3e-52244cec9c3c"
          ]
        },
        {
          "uuid": "2a3a2f90-38b2-4f7c-9ec7-aaf124eff342",
          "code": "M0A3U4CDTF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c837ec22-0c6f-3fbd-b4b3-716eca726cc1",
          "code": "Fomesafen",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fomesafen",
          "code_system": "WIKIPEDIA",
          "references": [
            "e330fc0b-edb2-f75d-8925-cc699a5d2986"
          ]
        },
        {
          "uuid": "f25f5906-7db1-5424-4a71-5e92b0d101e0",
          "code": "fomesafen",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fomesafen.html",
          "code_system": "ALANWOOD",
          "references": [
            "1fd04240-ec1b-e57d-f0de-caeeee4b4798"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4260732a-0cec-4e22-a6a8-cc6bf7564a59",
          "name": "5-(2-CHLORO-.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-P-TOLYLOXY)-N-MESYL-2-NITROBENZAMIDE",
          "stdName": "5-(2-CHLORO-.ALPHA.,.ALPHA.,.ALPHA.-TRIFLUORO-P-TOLYLOXY)-N-MESYL-2-NITROBENZAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0cc7218f-c749-4e55-a619-6165a12f5222",
            "32b66617-95ad-4770-8b54-6aab5e91feec"
          ],
          "display_name": false
        },
        {
          "uuid": "9b60c430-ba7d-422c-8c18-3f2b70e3fe99",
          "name": "5-(2-CHLORO-4-(TRIFLUOROMETHYL)PHENOXY)-N-(METHYLSULFONYL)-2-NITROBENZAMIDE",
          "stdName": "5-(2-CHLORO-4-(TRIFLUOROMETHYL)PHENOXY)-N-(METHYLSULFONYL)-2-NITROBENZAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0cc7218f-c749-4e55-a619-6165a12f5222",
            "89975ee9-5d1d-49d1-91dc-0521b9fb5d12"
          ],
          "display_name": false
        },
        {
          "uuid": "5d909df2-d595-49a9-8d87-8102fba757fd",
          "name": "FOMESAFEN",
          "stdName": "FOMESAFEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "291eeb22-eee2-461c-87d5-0c8f243ccda4",
            "7b67555c-b4cf-47b6-86de-8f3995ce62e5",
            "372e8c6a-9867-4d10-a817-e2717fcaabea",
            "515cdc4e-1a92-41c6-8158-067d86a19c76",
            "e1e7ca77-237f-412e-a6ef-2069eebdeff4",
            "da3ce5eb-cc5d-4eb3-9505-5b814bb21198",
            "9b1bca3f-c7f1-4997-bf66-1a19a7cee2de",
            "f9009856-609f-4e41-963c-12fe9a305775"
          ],
          "display_name": true
        },
        {
          "uuid": "b680f4a3-276f-4b95-adbf-7b6b5d34ebf8",
          "name": "FOMESAFEN [HSDB]",
          "stdName": "FOMESAFEN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "515cdc4e-1a92-41c6-8158-067d86a19c76",
            "372e8c6a-9867-4d10-a817-e2717fcaabea"
          ],
          "display_name": false
        },
        {
          "uuid": "34905d3f-28db-4993-96e8-86b885e91514",
          "name": "FOMESAFEN [ISO]",
          "stdName": "FOMESAFEN [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b67555c-b4cf-47b6-86de-8f3995ce62e5",
            "372e8c6a-9867-4d10-a817-e2717fcaabea"
          ],
          "display_name": false
        },
        {
          "uuid": "5fcdd244-b2cf-4985-a635-3319e7e07788",
          "name": "FOMESAFEN [MI]",
          "stdName": "FOMESAFEN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "372e8c6a-9867-4d10-a817-e2717fcaabea",
            "9b1bca3f-c7f1-4997-bf66-1a19a7cee2de"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "0cc7218f-c749-4e55-a619-6165a12f5222",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "89975ee9-5d1d-49d1-91dc-0521b9fb5d12",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32b66617-95ad-4770-8b54-6aab5e91feec",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "291eeb22-eee2-461c-87d5-0c8f243ccda4",
          "citation": "ALANWOOD.NET 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b1bca3f-c7f1-4997-bf66-1a19a7cee2de",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "372e8c6a-9867-4d10-a817-e2717fcaabea",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "515cdc4e-1a92-41c6-8158-067d86a19c76",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b67555c-b4cf-47b6-86de-8f3995ce62e5",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5f27888-7d8e-44a8-afa8-c164abec6baf",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390974000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f191db1a-56dc-4051-af9c-6c81be4d4d58",
          "citation": "SRS import [M0A3U4CDTF]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M0A3U4CDTF",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390974000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ded9b42a-e1f4-4485-aac0-d9bf26c34d4f",
          "citation": "CHEMID  2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9009856-609f-4e41-963c-12fe9a305775",
          "citation": "FOMESAFEN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "da3ce5eb-cc5d-4eb3-9505-5b814bb21198",
          "citation": "FOMESAFEN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e1e7ca77-237f-412e-a6ef-2069eebdeff4",
          "citation": "FOMESAFEN [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cb874c28-9654-6aec-7775-873eec47a79f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+72178-02-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8e144fbe-2ca8-d732-0a3e-52244cec9c3c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=72178-02-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e330fc0b-edb2-f75d-8925-cc699a5d2986",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "1fd04240-ec1b-e57d-f0de-caeeee4b4798",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "84182733-a90f-4f80-ad89-6a0ea56ba910",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4503fc79-83d8-470f-8f4e-66f3320c27bd",
          "id": "4503fc79-83d8-470f-8f4e-66f3320c27bd",
          "molfile": "\n  Marvin  01132103382D          \n\n 28 29  0  0  0  0            999 V2000\n   10.8156   -6.6394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6021   -5.8424    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4145   -5.6992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5302   -5.0206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7771   -5.8424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3646   -5.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7771   -4.4136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5396   -5.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1271   -5.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3021   -5.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8896   -6.5568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0647   -6.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6522   -7.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8271   -7.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4147   -6.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8271   -5.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6522   -5.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0647   -5.1279    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.5897   -6.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3762   -7.3538    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6617   -5.7351    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7772   -6.4137    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8896   -5.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3021   -4.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1271   -4.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5396   -3.6991    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.3646   -3.6991    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.1271   -2.9847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 25  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 23  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 17  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 15 19  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  2  0  0  0  0\nM  CHG  2  26   1  27  -1\nM  END",
          "smiles": "CS(=O)(=O)NC(=O)c1cc(ccc1[N+](=O)[O-])Oc2ccc(cc2Cl)C(F)(F)F",
          "formula": "C15H10ClF3N2O6S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "95be98b1-3679-4c65-83f0-b7fd1bd6207b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "438.7645",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6530def8-5cbc-4345-973f-6ec903d3a39f",
      "version": "6",
      "structure": {
        "id": "d77afe09-8e76-45a4-b63e-cb1172af6c3f",
        "molfile": "\n  Marvin  01132111102D          \n\n 28 29  0  0  0  0            999 V2000\n    8.5396   -5.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1271   -4.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3021   -4.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8896   -5.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3021   -5.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1271   -5.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8896   -6.5568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0647   -6.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6522   -5.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8271   -5.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4147   -6.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5897   -6.5568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3762   -7.3538    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6617   -5.7351    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7772   -6.4137    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8271   -7.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6522   -7.2713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0647   -5.1279    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.5396   -3.6991    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.3646   -3.6991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1271   -2.9847    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.3646   -5.1279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7771   -5.8424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6021   -5.8424    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8156   -6.6394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4145   -5.6992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5302   -5.0206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7771   -4.4136    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 16 11  1  0  0  0  0\n 17 16  2  0  0  0  0\n  8 17  1  0  0  0  0\n  9 18  1  0  0  0  0\n  2 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n  1 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\n 24 27  2  0  0  0  0\n 22 28  2  0  0  0  0\nM  CHG  2  19   1  21  -1\nM  END",
        "smiles": "CS(=O)(=O)NC(=O)c1cc(ccc1[N+](=O)[O-])Oc2ccc(cc2Cl)C(F)(F)F",
        "formula": "C15H10ClF3N2O6S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "438.7645",
        "optical_activity": "NONE",
        "references": [
          "ded9b42a-e1f4-4485-aac0-d9bf26c34d4f",
          "f191db1a-56dc-4051-af9c-6c81be4d4d58"
        ],
        "stereo_centers": 0
      },
      "unii": "M0A3U4CDTF"
    }
  ]
}