{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d2d9c410-5fab-44e3-ad54-f41fa1a2d90c", "code": "800-73-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=800-73-7", "code_system": "CAS", "references": [ "5813c35e-5302-4b94-900c-8e7f8e526c32", "70873ff2-5f1d-48c8-89eb-2b40a5735afa" ] }, { "uuid": "9fac60fa-3149-4b67-9108-74c3a29427ea", "code": "150855", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/150855", "code_system": "PUBCHEM", "references": [ "5813c35e-5302-4b94-900c-8e7f8e526c32" ] }, { "uuid": "a7f54605-a41d-4645-8809-21f22675ae23", "code": "M07S1BKN37", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "1993fc90-8e4b-5d5d-8a66-33acda7a40d5", "code": "58593", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:58593", "code_system": "CHEBI", "references": [ "758d3375-2b49-b84c-765f-fb74ce66e278" ] }, { "uuid": "32b23013-4f12-cac0-a664-8d93687376e0", "code": "28846", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28846", "code_system": "CHEBI", "references": [ "758d3375-2b49-b84c-765f-fb74ce66e278" ] }, { "uuid": "a3116822-e5e0-3997-94aa-b19f0d8dcc97", "code": "Deoxycytidine diphosphate", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Deoxycytidine_diphosphate", "code_system": "WIKIPEDIA", "references": [ "8f8bfe28-9a49-12ac-9886-25db1f5325d1" ] }, { "uuid": "b8056a1c-f440-4cd3-3bcc-096d5ace8140", "code": "DTXSID301027111", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301027111", "code_system": "EPA CompTox", "references": [ "758d3375-2b49-b84c-765f-fb74ce66e278" ] } ], "substance_class": "chemical", "names": [ { "uuid": "aaf1a018-b93f-4e4c-8a16-a8553a2b1872", "name": "DCDP", "stdName": "DCDP", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7cc9e876-f1b9-489d-9f0c-172485c3196d" ], "display_name": false }, { "uuid": "282928e6-cb2d-412e-b001-6048280e9bc1", "name": "DEOXYCYTIDINE 5'-DIPHOSPHATE", "stdName": "DEOXYCYTIDINE 5'-DIPHOSPHATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "d0b6ca29-97f0-407a-8ca9-3e75d8d755a5" ], "display_name": true } ], "references": [ { "uuid": "d0b6ca29-97f0-407a-8ca9-3e75d8d755a5", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "7cc9e876-f1b9-489d-9f0c-172485c3196d", "citation": "fda_srs", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "5813c35e-5302-4b94-900c-8e7f8e526c32", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391115000, "tags": [ "NOMEN" ] }, { "uuid": "a4c79c30-e811-4b9f-a022-5f5b190aa346", "citation": "SRS import [M07S1BKN37]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=M07S1BKN37", "doc_type": "SRS", "public_domain": true, "document_date": 1493391115000, "tags": [ "NOMEN" ] }, { "uuid": "c0b89955-6821-40b5-a172-f0780c554ab6", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8f8bfe28-9a49-12ac-9886-25db1f5325d1", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "70873ff2-5f1d-48c8-89eb-2b40a5735afa", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "758d3375-2b49-b84c-765f-fb74ce66e278", "doc_type": "SYSTEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5fc4b41e-6709-4559-adea-0f3ff127a9a2", "id": "5fc4b41e-6709-4559-adea-0f3ff127a9a2", "molfile": "\n Marvin 01132104572D \n\n 24 25 0 0 1 0 999 V2000\n 4.9092 -4.1171 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 4.3758 -4.7504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7259 -4.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0368 -3.4117 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 5.4085 -2.8797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7088 -3.3168 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 3.9393 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2869 -3.5134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5269 -3.2039 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2159 -3.9690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7573 -2.8919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8390 -2.4344 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3283 -1.7868 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8239 -1.1359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6776 -2.2914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9807 -1.2777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8422 -3.2128 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0715 -2.4206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8705 -2.2252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4416 -2.8172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2412 -2.6220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2123 -3.6093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4118 -3.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1825 -4.6018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 3 1 0 0 0 0\n 1 6 1 0 0 0 0\n 4 3 1 1 0 0 0\n 4 5 1 0 0 0 0\n 4 17 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 1 0 0 0\n 7 8 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 2 0 0 0 0\n 9 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 13 16 2 0 0 0 0\n 17 18 1 0 0 0 0\n 17 23 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 20 2 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 2 0 0 0 0\nM END", "smiles": "c1cn([C@H]2C[C@@H]([C@@H](COP(=O)(O)OP(=O)(O)O)O2)O)c(=O)nc1N", "formula": "C9H15N3O10P2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5371e48d-ed70-4b8d-8811-e96469b8820f" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "387.1774", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "37ac6093-9227-402a-9278-74154b6a49da", "version": "7", "structure": { "id": "ef8c2ac9-1471-488d-8226-5fe7d41a3888", "molfile": "\n Marvin 01132112252D \n\n 24 25 0 0 1 0 999 V2000\n 3.9393 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7088 -3.3168 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 4.9092 -4.1171 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.3758 -4.7504 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7259 -4.1766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0368 -3.4117 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 5.4085 -2.8797 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8422 -3.2128 0.0000 N 0 0 1 0 0 0 0 0 0 0 0 0\n 7.4118 -3.8097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1825 -4.6018 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2123 -3.6093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4416 -2.8172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2412 -2.6220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8705 -2.2252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0715 -2.4206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2869 -3.5134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5269 -3.2039 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7573 -2.8919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2159 -3.9690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8390 -2.4344 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3283 -1.7868 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9807 -1.2777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8239 -1.1359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6776 -2.2914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 1 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 6 0 0 0\n 3 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 2 7 1 0 0 0 0\n 6 8 1 1 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 8 15 1 0 0 0 0\n 1 16 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 2 0 0 0 0\n 17 19 1 0 0 0 0\n 17 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 1 0 0 0 0\n 21 24 1 0 0 0 0\nM END", "smiles": "c1cn([C@H]2C[C@@H]([C@@H](COP(=O)(O)OP(=O)(O)O)O2)O)c(=O)nc1N", "formula": "C9H15N3O10P2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "387.1774", "optical_activity": "UNSPECIFIED", "references": [ "a4c79c30-e811-4b9f-a022-5f5b190aa346", "c0b89955-6821-40b5-a172-f0780c554ab6" ], "stereo_centers": 3 }, "unii": "M07S1BKN37" } ] }