{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1dc43df2-f40f-4685-a2e5-cba844b09f53",
          "code": "7675-83-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7675-83-4",
          "code_system": "CAS",
          "references": [
            "afb08f72-7724-4782-aa5b-b136e42c7bd6",
            "6000e28d-74fe-4550-b5d9-0a651f1085cb"
          ]
        },
        {
          "uuid": "16919fd4-0eb2-450c-abfa-f54416dc655e",
          "code": "C024891",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67024891",
          "code_system": "MESH",
          "references": [
            "afb08f72-7724-4782-aa5b-b136e42c7bd6"
          ]
        },
        {
          "uuid": "6fa003d6-6240-4fe9-8108-4894db3b6365",
          "code": "231-656-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.779",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "afb08f72-7724-4782-aa5b-b136e42c7bd6"
          ]
        },
        {
          "uuid": "b176e8d8-92a9-4cc0-b9d9-ab6add867f14",
          "code": "18254",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/18254/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "afb08f72-7724-4782-aa5b-b136e42c7bd6"
          ]
        },
        {
          "uuid": "5afcc5d4-e8e9-41a1-bfc1-096a640edc8b",
          "code": "m2100",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2100?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "afb08f72-7724-4782-aa5b-b136e42c7bd6"
          ]
        },
        {
          "uuid": "0d9925b4-c7b5-4498-a053-d066008a5466",
          "code": "SUB12934MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "afb08f72-7724-4782-aa5b-b136e42c7bd6"
          ]
        },
        {
          "uuid": "22a93763-2926-4ad7-b82e-0513456ef19a",
          "code": "11500504",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11500504",
          "code_system": "PUBCHEM",
          "references": [
            "afb08f72-7724-4782-aa5b-b136e42c7bd6"
          ]
        },
        {
          "uuid": "dfb03c28-d5e7-f5d0-996e-6e65001123d8",
          "code": "3054-35-1",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3054-35-1",
          "code_system": "CAS",
          "references": [
            "6000e28d-74fe-4550-b5d9-0a651f1085cb"
          ]
        },
        {
          "uuid": "96ded393-d0ca-4fe4-06bb-e6779969c662",
          "code": "3781 (Number of products:2)",
          "comments": "Dietary Supplement Label Database|chemical|Arginine aspartate",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3781&item=Arginine aspartate",
          "code_system": "DSLD",
          "references": [
            "14834132-b7e8-f01a-cc8e-0e995b81705e"
          ]
        },
        {
          "uuid": "6a3a1702-5f45-49f3-a73e-f04c422cdd1b",
          "code": "LZB1G2I725",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "607c84ab-1275-bc4e-23f9-1b8f81aab751",
          "code": "DTXSID70884415",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70884415",
          "code_system": "EPA CompTox",
          "references": [
            "14834132-b7e8-f01a-cc8e-0e995b81705e"
          ]
        },
        {
          "uuid": "6f6c4b95-2284-8725-2911-ee0fb670fa53",
          "code": "100000088484",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1f24b436-4088-926b-ae69-0d7a8f36a3dd"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "825bcf09-03e9-4593-a9d5-cc275cdef258",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "879430f1-ee49-41b9-a004-3a921b22188f",
            "refuuid": "24d940bc-1e16-44c1-841a-40740861e06f",
            "name": "ARGININE",
            "unii": "94ZLA3W45F",
            "linking_id": "94ZLA3W45F",
            "ref_pname": "ARGININE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1aea7361-b117-4003-992d-7b68cd928e84",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "ba63cd64-5932-4b68-9daf-8a1253219023",
            "refuuid": "24d940bc-1e16-44c1-841a-40740861e06f",
            "name": "ARGININE",
            "unii": "94ZLA3W45F",
            "linking_id": "94ZLA3W45F",
            "ref_pname": "ARGININE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ef8e9d87-20f5-4056-a8e2-e12a40dfdc25",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "19423719-23d7-4b0f-924c-729d8f3d3ee8",
            "refuuid": "a8521c7c-75bd-4430-9468-dbd72574b575",
            "name": "ASPARTIC ACID",
            "unii": "30KYC7MIAI",
            "linking_id": "30KYC7MIAI",
            "ref_pname": "ASPARTIC ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c4cd52bb-f082-4db8-9984-97ad82b73c56",
          "name": "(2S)-2-AMINO-5-GUANIDINOPENTANOIC ACID (2S)-2-AMINOBUTANEDIOATE",
          "stdName": "(2S)-2-AMINO-5-GUANIDINOPENTANOIC ACID (2S)-2-AMINOBUTANEDIOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f9bdbc3-3d94-4da4-aa01-bad9ec7aa15b"
          ],
          "display_name": false
        },
        {
          "uuid": "9acaa155-72ba-47e9-8537-d0b96035fc6c",
          "name": "ARGININE ASPARTATE",
          "stdName": "ARGININE ASPARTATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc4bce85-7763-4d92-9588-e98db507c6ad",
            "ecf22b51-1079-4a01-8e61-f90a88340c80",
            "d42a0624-7726-4c88-bc21-8fc8d31df1e3",
            "ff3d15f2-240a-4b85-9294-fb093c5ea093",
            "543daef4-184f-4070-a6b1-bb6fdebf515d",
            "e0ace00c-e6b4-474c-945e-c5bec5331932",
            "846b0da2-8a99-42eb-af22-aa9b41167aa7",
            "c6ee0e59-7bc1-4ce5-9b4c-93ce967d3628",
            "f2842535-9a19-42dd-b39e-17bb8beae9c1"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0b9a876a-b9a2-4169-9e3f-556a1240627b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "fd689447-6b9c-24cd-3b8b-2f48d424147b",
          "name": "ARGININE ASPARTATE [EP MONOGRAPH]",
          "stdName": "ARGININE ASPARTATE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31884786-4149-a1af-5883-d2b0eb9a47e5"
          ],
          "display_name": false
        },
        {
          "uuid": "d59cb018-173d-4cea-9a8e-8427b04e1a3b",
          "name": "ARGININE ASPARTATE [MART.]",
          "stdName": "ARGININE ASPARTATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6ee0e59-7bc1-4ce5-9b4c-93ce967d3628"
          ],
          "display_name": false
        },
        {
          "uuid": "74e2fd8e-7da1-48c1-bc54-ce25982e4578",
          "name": "ARGININE L-ASPARTATE",
          "stdName": "ARGININE L-ASPARTATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b274bdb6-80ff-4023-9f33-a0a22d996d02",
            "eb9ba271-c1da-4b2e-822e-de55ac76f7c4",
            "d42a0624-7726-4c88-bc21-8fc8d31df1e3"
          ],
          "display_name": false
        },
        {
          "uuid": "80b2715b-43bd-4848-960d-3f4e39cabed9",
          "name": "ARGININE, L-, L-ASPARTATE (1:1)",
          "stdName": "ARGININE, L-, L-ASPARTATE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eaa2a3de-fd98-411f-9635-a0b0b4808916"
          ],
          "display_name": false
        },
        {
          "uuid": "08afa8d1-c8b5-4011-b034-5b18bf745ac6",
          "name": "ASPARTIC ACID COMPOUND WITH L-ARGININE [MI]",
          "stdName": "ASPARTIC ACID COMPOUND WITH L-ARGININE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "062c92d8-047d-4c53-a990-a2b5af572f5d"
          ],
          "display_name": false
        },
        {
          "uuid": "e80b02ee-c14d-4665-9044-88854becf98b",
          "name": "ASPARTIC ACID, L-, COMPD. WITH L-ARGININE (1:1)",
          "stdName": "ASPARTIC ACID, L-, COMPD. WITH L-ARGININE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eaa2a3de-fd98-411f-9635-a0b0b4808916"
          ],
          "display_name": false
        },
        {
          "uuid": "494775c0-cd8c-5e80-f01d-fc3ed2d31d36",
          "name": "Arginine L-aspartate [WHO-DD]",
          "stdName": "ARGININE L-ASPARTATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c75b5ba-56f7-ff07-788c-ee6e2f67f8aa"
          ],
          "display_name": false
        },
        {
          "uuid": "3bff1e15-a6d7-7f31-03a2-3e606195edb9",
          "name": "Arginine aspartate [WHO-DD]",
          "stdName": "ARGININE ASPARTATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c75b5ba-56f7-ff07-788c-ee6e2f67f8aa"
          ],
          "display_name": false
        },
        {
          "uuid": "426954db-77b4-4062-9ba7-240774031c1c",
          "name": "L-ASPARTIC ACID, COMPD. WITH L-ARGININE (1:1)",
          "stdName": "L-ASPARTIC ACID, COMPD. WITH L-ARGININE (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f2842535-9a19-42dd-b39e-17bb8beae9c1"
          ],
          "display_name": false
        },
        {
          "uuid": "1b9ee541-a372-46f1-9f4f-b49c43e6a6c8",
          "name": "SARGENOR",
          "stdName": "SARGENOR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "062c92d8-047d-4c53-a990-a2b5af572f5d"
          ],
          "display_name": false
        },
        {
          "uuid": "a4a7b0b1-cc60-44c7-bcc4-7d204cfea706",
          "name": "TARGIFOR",
          "stdName": "TARGIFOR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4eba4ba-df02-47de-af21-0f38cacca1e2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f2842535-9a19-42dd-b39e-17bb8beae9c1",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7f9bdbc3-3d94-4da4-aa01-bad9ec7aa15b",
          "citation": "EP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0ace00c-e6b4-474c-945e-c5bec5331932",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6ee0e59-7bc1-4ce5-9b4c-93ce967d3628",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff3d15f2-240a-4b85-9294-fb093c5ea093",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d42a0624-7726-4c88-bc21-8fc8d31df1e3",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b274bdb6-80ff-4023-9f33-a0a22d996d02",
          "citation": "who-dd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4eba4ba-df02-47de-af21-0f38cacca1e2",
          "citation": "http://www.drugs.com/international/targifor.html",
          "url": "http://www.drugs.com/international/targifor.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "062c92d8-047d-4c53-a990-a2b5af572f5d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eaa2a3de-fd98-411f-9635-a0b0b4808916",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "afb08f72-7724-4782-aa5b-b136e42c7bd6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390997000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "518e51bc-fdbe-4d14-a552-aba50f89d4fb",
          "citation": "SRS import [LZB1G2I725]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=LZB1G2I725",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390997000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc4bce85-7763-4d92-9588-e98db507c6ad",
          "citation": "ARGININE ASPARTATE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "543daef4-184f-4070-a6b1-bb6fdebf515d",
          "citation": "ARGININE ASPARTATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "846b0da2-8a99-42eb-af22-aa9b41167aa7",
          "citation": "ARGININE ASPARTATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ecf22b51-1079-4a01-8e61-f90a88340c80",
          "citation": "ARGININE ASPARTATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eb9ba271-c1da-4b2e-822e-de55ac76f7c4",
          "citation": "ARGININE L-ASPARTATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6000e28d-74fe-4550-b5d9-0a651f1085cb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "14834132-b7e8-f01a-cc8e-0e995b81705e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "31884786-4149-a1af-5883-d2b0eb9a47e5",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "1c75b5ba-56f7-ff07-788c-ee6e2f67f8aa",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1f24b436-4088-926b-ae69-0d7a8f36a3dd",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "42ba2dd1-002c-42ac-b079-8d11ca0ad752",
          "id": "42ba2dd1-002c-42ac-b079-8d11ca0ad752",
          "molfile": "\n  Marvin  01132103312D          \n\n  9  8  0  0  1  0            999 V2000\n    5.6213   -2.2569    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.6213   -3.1012    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3328   -1.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0521   -2.2465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7766   -1.8191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0651   -3.0778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8864   -1.8322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8864   -1.0112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1749   -2.2465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  7  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\nM  END",
          "smiles": "C([C@@H](C(=O)O)N)C(=O)O",
          "formula": "C4H7NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ae40061b-0b64-4410-8555-ee689ca21a5b"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "133.1029",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        },
        {
          "uuid": "86857de5-09c1-4057-b6d4-39bcdd9457e0",
          "id": "86857de5-09c1-4057-b6d4-39bcdd9457e0",
          "molfile": "\n  Marvin  01132106592D          \n\n 12 11  0  0  1  0            999 V2000\n   -1.9122   -2.2485    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -1.9200   -3.0456    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2136   -1.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4839   -2.2305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2355   -1.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9522   -2.2175    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6664   -1.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6664   -0.9807    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3857   -2.2305    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6134   -1.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6264   -0.9988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3508   -2.2305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 10  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\nM  END",
          "smiles": "C(C[C@@H](C(=O)O)N)CNC(=N)N",
          "formula": "C6H14N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fe7c8209-2f13-456a-b7c7-dd77ffeb44b3"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "174.2012",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e25fd456-3a9f-4496-a2d8-314479c8f763",
      "version": "18",
      "structure": {
        "id": "acb001b9-c44c-4888-af96-4c588df55588",
        "molfile": "\n  Marvin  01132108582D          \n\n 21 19  0  0  1  0            999 V2000\n    6.2877   -1.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8516   -1.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0019   -2.2305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5813   -2.2408    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.8516   -1.0040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7212   -1.8061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5813   -3.0791    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1452   -2.2305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0148   -3.0559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6664   -1.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6134   -1.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6664   -0.9807    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6264   -0.9988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9522   -2.2175    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9122   -2.2485    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.3857   -2.2305    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3508   -2.2305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9200   -3.0456    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2355   -1.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2136   -1.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4839   -2.2305    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  2  0  0  0  0\n  6  3  2  0  0  0  0\n  4  7  1  6  0  0  0\n  8  2  1  0  0  0  0\n  9  3  1  0  0  0  0\n 11 15  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13 11  2  0  0  0  0\n 14 10  1  0  0  0  0\n 15 20  1  0  0  0  0\n 16 10  1  0  0  0  0\n 17 11  1  0  0  0  0\n 15 18  1  6  0  0  0\n 19 14  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 19  1  0  0  0  0\nM  END",
        "smiles": "C(C[C@@H](C(=O)O)N)CNC(=N)N.C([C@@H](C(=O)O)N)C(=O)O",
        "formula": "C6H14N4O2.C4H7NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "307.3041",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "7f9bdbc3-3d94-4da4-aa01-bad9ec7aa15b",
          "518e51bc-fdbe-4d14-a552-aba50f89d4fb"
        ],
        "stereo_centers": 2
      },
      "unii": "LZB1G2I725"
    }
  ]
}