{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a8bc34e0-0045-450d-82ca-3c00116ac31a", "code": "21034-17-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=21034-17-3", "code_system": "CAS", "references": [ "4e752458-3b16-4499-b8b3-4f6a6d5f8224", "9b1a3c77-9b5a-4845-8a8a-121336821737" ] }, { "uuid": "2d553c69-6278-4611-a636-c56002d3ec7b", "code": "244-158-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.040.128", "code_system": "ECHA (EC/EINECS)", "references": [ "4e752458-3b16-4499-b8b3-4f6a6d5f8224" ] }, { "uuid": "9b0d081c-931a-8109-d4a2-efdb1d0e1f8b", "code": "159902", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/159902", "code_system": "PUBCHEM", "references": [ "81605249-dca1-ab5b-f78e-d9e010fb4bd9" ] }, { "uuid": "bc721b22-e5f8-874f-ec21-bbb3f2f58a62", "code": "DTXSID50943332", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50943332", "code_system": "EPA CompTox" }, { "uuid": "7ec48613-2e06-4bf4-ace3-1644fd6e5049", "code": "LY7YN4R63F", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "bf115202-90b2-4492-bdba-66fad14e6cc9", "amount": { "uuid": "4fa91b6d-1622-4ac8-8a5d-1002d17cbeac" }, "type": "PARENT->SALT/SOLVATE", "references": [ "103bb85e-d9c4-4e13-ba9e-f446fa98050a" ], "related_substance": { "uuid": "3c8b98a1-961e-48d9-9df0-59293109b9b4", "refuuid": "eaaa11a8-d8ef-41af-865b-4f702858a693", "name": "N-[2-(3,4-dimethyl-1,3-oxazol-3-ium-2-yl)ethenyl]aniline", "unii": "2FNB62JLE5", "linking_id": "2FNB62JLE5", "ref_pname": "N-[2-(3,4-dimethyl-1,3-oxazol-3-ium-2-yl)ethenyl]aniline", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "6607968c-42e1-424e-ad3d-9973f556e560", "name": "N-[2-(3,4-Dimethyl-1,3-oxazol-3-ium-2-yl)ethenyl]aniline iodide", "stdName": "N-(2-(3,4-DIMETHYL-1,3-OXAZOL-3-IUM-2-YL)ETHENYL)ANILINE IODIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9b1a3c77-9b5a-4845-8a8a-121336821737" ], "display_name": true }, { "uuid": "39b0a14b-0c7f-467a-b401-0f3422011f64", "name": "Oxazolium, 3,4-dimethyl-2-[2-(phenylamino)ethenyl]-, iodide", "stdName": "OXAZOLIUM, 3,4-DIMETHYL-2-(2-(PHENYLAMINO)ETHENYL)-, IODIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9b1a3c77-9b5a-4845-8a8a-121336821737" ], "display_name": false }, { "uuid": "bd03b69a-c207-4b9f-b32c-baa1264ca6a9", "name": "Quaternium-45", "stdName": "QUATERNIUM-45", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9fa0e1fe-684e-4fb4-b1ba-0f220d1d7c2b", "a280f2fd-328c-41ca-be75-e50db3b92bed" ], "display_name": false } ], "references": [ { "uuid": "9fa0e1fe-684e-4fb4-b1ba-0f220d1d7c2b", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4e752458-3b16-4499-b8b3-4f6a6d5f8224", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392076000, "tags": [ "NOMEN" ] }, { "uuid": "81605249-dca1-ab5b-f78e-d9e010fb4bd9", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "9b1a3c77-9b5a-4845-8a8a-121336821737", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "103bb85e-d9c4-4e13-ba9e-f446fa98050a", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "a280f2fd-328c-41ca-be75-e50db3b92bed", "citation": "INCI Beauty", "url": "https://incibeauty.com/en/ingredients/13307-quaternium-45", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7e47b926-d805-4fd3-9955-e7530763f4b2", "id": "7e47b926-d805-4fd3-9955-e7530763f4b2", "molfile": "\n CDK 07052415482D\n\n 16 17 0 0 0 0 0 0 0 0999 V2000\n 29.3573 -7.9776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8059 -8.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.0285 -9.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.4986 -9.1678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.3444 -7.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9954 -6.8300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.6425 -7.6066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2935 -6.8232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9405 -7.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5909 -6.8156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2380 -7.5923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2347 -9.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.5842 -9.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9371 -9.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.7620 -6.9807 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 27.0857 -5.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 9 14 1 0 0 0 0\n 5 15 2 0 0 0 0\n 2 15 1 0 0 0 0\n 15 16 1 0 0 0 0\nM CHG 1 15 1\nM END", "smiles": "Cc1coc(/C=C/Nc2ccccc2)[n+]1C", "formula": "C13H15N2O", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "baa1c00d-3249-4542-bec0-ca83503899f4" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "215.2715", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "b3b822a0-a2e6-415e-b1fc-1910b93de1f3", "id": "b3b822a0-a2e6-415e-b1fc-1910b93de1f3", "molfile": "\n CDK 07052415482D\n\n 1 0 0 0 0 0 0 0 0 0999 V2000\n 33.1760 -8.2576 0.0000 I 0 5 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 -1\nM END", "smiles": "[I-]", "formula": "I", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c7a0d98e-c078-4f93-868d-7f4b0f83a226" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "126.9045", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "23f9a866-7149-4b56-be22-11079455a41a", "version": "8", "structure": { "id": "a3bb86fa-1965-420e-bcfd-65af64f8cf43", "molfile": "\n JSDraw207052415492D\n\n 17 17 0 0 0 0 0 V2000\n 27.7080 -7.9776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.1565 -8.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.3791 -9.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.8493 -9.1678 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.6951 -7.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3461 -6.8300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9932 -7.6066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6441 -6.8232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2912 -7.5999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9416 -6.8156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5887 -7.5923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5853 -9.1531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9348 -9.9374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2878 -9.1607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1127 -6.9807 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 25.4363 -5.4546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.0067 -8.0496 0.0000 I 0 5 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 9 14 1 0 0 0 0\n 5 15 2 0 0 0 0\n 2 15 1 0 0 0 0\n 15 16 1 0 0 0 0\nM CHG 2 15 1 17 -1\nM END", "smiles": "Cc1coc(/C=C/Nc2ccccc2)[n+]1C.[I-]", "formula": "C13H15N2O.I", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "342.176", "optical_activity": "NONE", "references": [ "9fa0e1fe-684e-4fb4-b1ba-0f220d1d7c2b", "9b1a3c77-9b5a-4845-8a8a-121336821737" ], "stereo_centers": 0 }, "unii": "LY7YN4R63F" } ] }