{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2eed8f63-7cd5-40ef-94d3-5cb2dd881883",
          "code": "423152-20-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=423152-20-9",
          "code_system": "CAS",
          "references": [
            "e5673842-e1ee-48a2-992f-8393c5e8ae32",
            "e91e7466-ded9-4a45-aefd-13a3fcab931d"
          ]
        },
        {
          "uuid": "c3edf140-ada4-4da5-b991-7dc770faef18",
          "code": "87549923",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/87549923",
          "code_system": "PUBCHEM",
          "references": [
            "20d99998-7136-4d09-83a4-a30276f3611c"
          ]
        },
        {
          "uuid": "d0c6d08a-fa09-488e-bf99-336eba9c6639",
          "code": "LY38SJU4DG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5786c452-d67e-c596-48f7-98194a2b350e",
          "code": "Glycine propionyl-L-carnitine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Glycine_propionyl-L-carnitine",
          "code_system": "WIKIPEDIA",
          "references": [
            "e5673842-e1ee-48a2-992f-8393c5e8ae32"
          ]
        },
        {
          "uuid": "e9275daa-6686-2f3b-013b-08eca1e1d436",
          "code": "DTXSID901029527",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901029527",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d43f9f12-ba84-42a5-a226-874d7ffc7db2",
          "name": "GLYCINE PROPIONYL-L-CARNITINE HYDROCHLORIDE",
          "stdName": "GLYCINE PROPIONYL-L-CARNITINE HYDROCHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e5673842-e1ee-48a2-992f-8393c5e8ae32"
          ],
          "display_name": true
        },
        {
          "uuid": "f880e9c7-8360-4099-baee-ce747acf12ca",
          "name": "GLYCINE, COMPD. WITH (2R)-3-CARBOXY-N,N,N-TRIMETHYL-2-(1-OXOPROPOXY)-1-PROPANAMINIUM CHLORIDE (1:1)",
          "stdName": "GLYCINE, COMPD. WITH (2R)-3-CARBOXY-N,N,N-TRIMETHYL-2-(1-OXOPROPOXY)-1-PROPANAMINIUM CHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c808c6e2-02a9-4da8-a14f-e6c9d617607f"
          ],
          "display_name": false
        },
        {
          "uuid": "0f13b589-05fb-42d6-8045-8805c30f6127",
          "name": "GLYCINE, COMPD. WITH (2R)-3-CARBOXY-N,N,N-TRIMETHYL-2-(1-OXOPROPOXY)-1-PROPANAMINIUM CHLORIDE (1:1:1)",
          "stdName": "GLYCINE, COMPD. WITH (2R)-3-CARBOXY-N,N,N-TRIMETHYL-2-(1-OXOPROPOXY)-1-PROPANAMINIUM CHLORIDE (1:1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e91e7466-ded9-4a45-aefd-13a3fcab931d"
          ],
          "display_name": false
        },
        {
          "uuid": "5cd2d2f0-449d-4913-bc57-2b7c61731bcf",
          "name": "GLYCOCARN",
          "stdName": "GLYCOCARN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e91e7466-ded9-4a45-aefd-13a3fcab931d"
          ],
          "display_name": false
        },
        {
          "uuid": "4007f977-b222-71ed-6dbc-aa3607e2b724",
          "name": "Glycine propionyl L-carnitine hydrochloride [WHO-DD]",
          "stdName": "GLYCINE PROPIONYL L-CARNITINE HYDROCHLORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0acaff1d-4335-00a0-b468-36874a1a5139"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "20d99998-7136-4d09-83a4-a30276f3611c",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c808c6e2-02a9-4da8-a14f-e6c9d617607f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e5673842-e1ee-48a2-992f-8393c5e8ae32",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e91e7466-ded9-4a45-aefd-13a3fcab931d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0acaff1d-4335-00a0-b468-36874a1a5139",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "43c789c7-bf3a-4af5-abc1-2c9b8d716e2e",
          "id": "43c789c7-bf3a-4af5-abc1-2c9b8d716e2e",
          "molfile": "\n  Marvin  05062107132D          \n\n  5  4  0  0  0  0            999 V2000\n    8.5508   -8.3004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2653   -8.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9798   -8.3004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8363   -8.7129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5508   -7.4754    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  2  0  0  0  0\n  2  3  1  0  0  0  0\nM  END",
          "smiles": "C(C(=O)O)N",
          "formula": "C2H5NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ab186fad-a8a8-4aed-a680-54f1d4b1ebe5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "75.0667",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "502e1090-efd7-44cd-9ab1-1a8bfc1ab763",
          "id": "502e1090-efd7-44cd-9ab1-1a8bfc1ab763",
          "molfile": "\n  Marvin  05062107132D          \n\n 15 14  0  0  0  0            999 V2000\n    8.6406   -3.9991    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.6406   -3.1741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9262   -2.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2117   -3.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4972   -2.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9262   -1.9366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3551   -4.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0696   -3.9991    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   10.7840   -4.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0696   -3.1741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7840   -3.5866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9262   -4.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9262   -5.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2117   -5.6491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6406   -5.6491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  7  1  0  0  0  0\n  1 12  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  6  2  0  0  0  0\n  4  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\nM  CHG  1   8   1\nM  END",
          "smiles": "CCC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C",
          "formula": "C10H20NO4",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0a5286de-e3a8-47cb-9ce4-d5ddf91e2328"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "218.2705",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        },
        {
          "uuid": "a8435d05-da77-4f5f-9cb4-daf392e63412",
          "id": "a8435d05-da77-4f5f-9cb4-daf392e63412",
          "molfile": "\n  Marvin  05062107132D          \n\n  1  0  0  0  0  0            999 V2000\n   11.0076   -5.9967    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "[Cl-]",
          "formula": "Cl",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bd297200-cd20-4d40-a549-93bbf17c9ba6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "35.4529",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cf847948-a46a-4aa0-b5ba-3aaa31dca4dd",
      "version": "13",
      "structure": {
        "id": "c9b6bb7d-769e-4135-8de6-5cb4e8eabed5",
        "molfile": "Glycine, compd. with (2R)-3-carboxy-N,N,N-trimethyl-2-(1-oxopropoxy)-1-propan...\n   JSDraw205062107132D\n\n 21 18  0  0  1  0              0 V2000\n   30.3176   -9.2373    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n   25.8418   -5.4599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8418   -3.8999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4909   -3.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1399   -3.8999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.7888   -3.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4909   -1.5600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1929   -6.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5439   -5.4599    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   29.8948   -6.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.5439   -3.8999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8948   -4.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4909   -6.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4909   -7.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1399   -8.5799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8418   -8.5799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6721  -13.5933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.0230  -14.3734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.3741  -13.5933    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   24.3210  -14.3734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.6721  -12.0333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  1  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  4  7  2  0  0  0  0\n  2  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n  2 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 17 21  2  0  0  0  0\nM  CHG  2   1  -1   9   1\nM  END",
        "smiles": "CCC(=O)O[C@H](CC(=O)O)C[N+](C)(C)C.C(C(=O)O)N.[Cl-]",
        "formula": "C10H20NO4.C2H5NO2.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "328.7901",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e5673842-e1ee-48a2-992f-8393c5e8ae32",
          "e91e7466-ded9-4a45-aefd-13a3fcab931d"
        ],
        "stereo_centers": 1
      },
      "unii": "LY38SJU4DG"
    }
  ]
}