{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "93180f9f-0086-4a48-8ac7-6e08d2a7e1a9",
          "code": "J01DB02",
          "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIBACTERIALS FOR SYSTEMIC USE|OTHER BETA-LACTAM ANTIBACTERIALS|First-generation cephalosporins|cefaloridine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=J01DB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "60c2fe40-2df6-4a85-9065-15939d66347d"
          ]
        },
        {
          "uuid": "24508fed-2ca6-440f-abd9-36b05c5ca493",
          "code": "QJ01DB02",
          "comments": "VATC|ANTIBACTERIALS FOR SYSTEMIC USE|OTHER BETA-LACTAM ANTIBACTERIALS|First-generation cephalosporins|cefaloridine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QJ01DB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "60c2fe40-2df6-4a85-9065-15939d66347d"
          ]
        },
        {
          "uuid": "b193abd6-6819-4f7d-a200-a76f46d72d3d",
          "code": "50-59-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=50-59-9",
          "code_system": "CAS",
          "references": [
            "60c2fe40-2df6-4a85-9065-15939d66347d",
            "c4fbfd2c-c75e-4098-ac61-93aac61a5635"
          ]
        },
        {
          "uuid": "70660a6b-694c-4159-8035-0e6adac9c283",
          "code": "D002509",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68002509",
          "code_system": "MESH",
          "references": [
            "60c2fe40-2df6-4a85-9065-15939d66347d"
          ]
        },
        {
          "uuid": "6afa817c-308e-457a-acd0-0d1e7b0db634",
          "code": "CEPHALORIDINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cephaloridine",
          "code_system": "WIKIPEDIA",
          "references": [
            "60c2fe40-2df6-4a85-9065-15939d66347d"
          ]
        },
        {
          "uuid": "35f845a3-6ce0-4974-90ec-70de9c5affe9",
          "code": "SUB06169MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "60c2fe40-2df6-4a85-9065-15939d66347d"
          ]
        },
        {
          "uuid": "2eaeefc0-f748-4649-9fd6-76badd9f587e",
          "code": "1910",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1910",
          "code_system": "INN",
          "references": [
            "60c2fe40-2df6-4a85-9065-15939d66347d"
          ]
        },
        {
          "uuid": "ce639df0-5ac3-466f-9dd4-60b71927aef5",
          "code": "200-052-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.048",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "60c2fe40-2df6-4a85-9065-15939d66347d"
          ]
        },
        {
          "uuid": "96f1994b-dfd1-4fee-803a-655a763753bb",
          "code": "C76594",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76594",
          "code_system": "NCI_THESAURUS",
          "references": [
            "60c2fe40-2df6-4a85-9065-15939d66347d"
          ]
        },
        {
          "uuid": "3b73827f-84d8-4c35-9bb9-59d2e9c63913",
          "code": "2233",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2233/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "60c2fe40-2df6-4a85-9065-15939d66347d"
          ]
        },
        {
          "uuid": "b820d790-16b5-4589-a9a5-4d76c49dcb58",
          "code": "m1065",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1065?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "60c2fe40-2df6-4a85-9065-15939d66347d"
          ]
        },
        {
          "uuid": "a4b077db-2ed6-4189-a6fe-932c2341cee5",
          "code": "DB09008",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB09008",
          "code_system": "DRUG BANK",
          "references": [
            "60c2fe40-2df6-4a85-9065-15939d66347d"
          ]
        },
        {
          "uuid": "f32d05da-1ce8-4c51-8d67-fbf691b4089f",
          "code": "CHEMBL316157",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL316157",
          "code_system": "ChEMBL",
          "references": [
            "60c2fe40-2df6-4a85-9065-15939d66347d"
          ]
        },
        {
          "uuid": "16780047-8233-4b18-8937-049e54d0b584",
          "code": "5773",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5773",
          "code_system": "PUBCHEM",
          "references": [
            "60c2fe40-2df6-4a85-9065-15939d66347d"
          ]
        },
        {
          "uuid": "abb1826f-2a27-ef32-01d7-9af7f165f335",
          "code": "3023",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3023",
          "code_system": "HSDB",
          "references": [
            "40fe23ec-4fd3-3a72-424c-ac6cc80ab584"
          ]
        },
        {
          "uuid": "dfc3a490-6ff5-ef9c-69c2-97bc983ade1d",
          "code": "DTXSID9022782",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9022782",
          "code_system": "EPA CompTox",
          "references": [
            "50802deb-f6e1-e749-14db-3a21b83733ba"
          ]
        },
        {
          "uuid": "7befa58f-f6cf-502f-a8e8-220e60bb5a76",
          "code": "C357",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antibiotic[C258]|Beta-Lactam Antibiotic[C260]|Cephalosporin Antibiotic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C357",
          "code_system": "NCI_THESAURUS",
          "references": [
            "dba63606-8a45-8c6d-7c2e-3349cc2e04f3"
          ]
        },
        {
          "uuid": "dc580eea-f020-4942-a2c2-d44503d3f58f",
          "code": "LVZ1VC61HB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0d3a0969-11a1-c004-1e10-f6430fa25566",
          "code": "573",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/573",
          "code_system": "DRUG CENTRAL",
          "references": [
            "dba63606-8a45-8c6d-7c2e-3349cc2e04f3"
          ]
        },
        {
          "uuid": "da0bcab9-4568-1a9f-cf9b-902e376644d1",
          "code": "3537",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3537",
          "code_system": "CHEBI",
          "references": [
            "dba63606-8a45-8c6d-7c2e-3349cc2e04f3"
          ]
        },
        {
          "uuid": "7aa37302-eb69-8d51-b251-33a1206f9611",
          "code": "100000081556",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a66dc178-50d1-f3c4-a7f5-5ac8b8a7cb05"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8c5b3cdc-2be1-4c29-9fb0-200b94e84f3e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "0a64804f-53f1-4abc-8698-0fe031ac5ba5",
            "refuuid": "ed417378-bdeb-4b82-aa7f-d7dbae0f8703",
            "name": "CEPHALORIDINE",
            "unii": "LVZ1VC61HB",
            "linking_id": "LVZ1VC61HB",
            "ref_pname": "CEPHALORIDINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f1091fb3-a218-411a-a1f2-41eac984d91e",
          "name": "((6R,7R)-1-((2-CARBOXY-8-OXO-7-(2-(2-THIENYL)ACETAMIDO)-5-THIA-1-AZABICYCLO(4.2.0)OCT-2-EN-3-YL)METHYL)PYRIDINIUM HYDROXIDE, INNER SALT",
          "stdName": "((6R,7R)-1-((2-CARBOXY-8-OXO-7-(2-(2-THIENYL)ACETAMIDO)-5-THIA-1-AZABICYCLO(4.2.0)OCT-2-EN-3-YL)METHYL)PYRIDINIUM HYDROXIDE, INNER SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc40cc0f-5de0-4ba8-b410-cb3b129f971f"
          ],
          "display_name": false
        },
        {
          "uuid": "c8c11f0d-a367-48a7-a326-67602d0b36bf",
          "name": "40602",
          "stdName": "40602",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc40cc0f-5de0-4ba8-b410-cb3b129f971f"
          ],
          "display_name": false
        },
        {
          "uuid": "a2658b69-5fde-408b-9fd9-fe1f5474c5f7",
          "name": "7-(.ALPHA.-(2-THIENYL)ACETAMIDO)-3-(1-PYRIDYLMETHYL)-3-CEPHEM-4-CARBOXYLIC ACID BETAINE",
          "stdName": "7-(.ALPHA.-(2-THIENYL)ACETAMIDO)-3-(1-PYRIDYLMETHYL)-3-CEPHEM-4-CARBOXYLIC ACID BETAINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc40cc0f-5de0-4ba8-b410-cb3b129f971f"
          ],
          "display_name": false
        },
        {
          "uuid": "611cec93-e143-4ad1-b9f7-f19b5a4f714a",
          "name": "CEFALORIDINE",
          "stdName": "CEFALORIDINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ac0ab26-d1e7-42bb-bc95-3731778b8012",
            "f1040e35-be1b-47da-ac70-952d611d3683",
            "4b30aa05-e208-4ad6-b0c6-5b04f08fe206",
            "71288355-ae18-4695-86da-e4b85942df64",
            "8c3b7e58-514a-4a30-9c4f-ecbd46eac892",
            "768c6929-bf8a-4765-9559-77ed33d4d3fb",
            "2920f63a-e1dd-4cdd-b867-a9dd04f928c9",
            "8ccb516d-8d73-49c4-bbb2-0218d17c95bf",
            "b6c9852c-aa05-4318-8a13-5d1f9f9ee0c0"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "84d4341c-fb7d-4630-8d3b-53380fcc28e0",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "bcb6d163-5d84-47ea-9d22-5b1ce06148b0",
          "name": "CEFALORIDINE [JAN]",
          "stdName": "CEFALORIDINE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1040e35-be1b-47da-ac70-952d611d3683"
          ],
          "display_name": false
        },
        {
          "uuid": "bc8f2b5a-c354-4c20-bf7c-989be3ad4820",
          "name": "CEFALORIDINE [MART.]",
          "stdName": "CEFALORIDINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71288355-ae18-4695-86da-e4b85942df64"
          ],
          "display_name": false
        },
        {
          "uuid": "640cb39f-7119-4865-951b-f9929064c1c0",
          "name": "CEPHALORIDINE",
          "stdName": "CEPHALORIDINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85bcc885-0b32-427d-8327-5d0e7dc9d68a",
            "b057b13b-de43-400e-b1f5-a5aa3989a066",
            "15fc57b1-63fd-46b4-b7bf-41604dfef167",
            "9f9893e1-c8e4-4449-9969-4ead723d67fa",
            "7083b54e-e0fe-4496-9ac2-cdf5e2a7d80b",
            "cc40cc0f-5de0-4ba8-b410-cb3b129f971f",
            "afde02ae-9c43-4535-b863-7cfbe4b82fd6"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "c556dedb-c132-4f5a-a8fa-53069b01c408",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "8ac09ecd-c2be-47b4-95ff-1fa29d1c7e3a",
          "name": "CEPHALORIDINE [HSDB]",
          "stdName": "CEPHALORIDINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7083b54e-e0fe-4496-9ac2-cdf5e2a7d80b"
          ],
          "display_name": false
        },
        {
          "uuid": "65f74280-5a34-4011-bdd7-3296bf1fce61",
          "name": "CEPHALORIDINE [MI]",
          "stdName": "CEPHALORIDINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15fc57b1-63fd-46b4-b7bf-41604dfef167"
          ],
          "display_name": false
        },
        {
          "uuid": "6b62ba87-745e-419b-a1d0-35852663db77",
          "name": "CEPHALORIDINE [USAN]",
          "stdName": "CEPHALORIDINE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "afde02ae-9c43-4535-b863-7cfbe4b82fd6"
          ],
          "display_name": false
        },
        {
          "uuid": "c771c6b7-90c0-d331-8e42-3c85341e1e01",
          "name": "Cefaloridine [WHO-DD]",
          "stdName": "CEFALORIDINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c880807e-cb47-d483-16e7-3b1d1f1f3068"
          ],
          "display_name": false
        },
        {
          "uuid": "e14a10b8-3f58-4801-a261-c5ae24efe8ed",
          "name": "PYRIDINIUM, 1-((2-CARBOXY-8-OXO-7-((2-THIENYLACETYL)AMINO)-5-THIA-1-AZABICYCLO(4.2.0)-OCT-2-EN-3-YL)METHYL)-, HYDROXIDE, INNER SALT, (6R-TRANS)-",
          "stdName": "PYRIDINIUM, 1-((2-CARBOXY-8-OXO-7-((2-THIENYLACETYL)AMINO)-5-THIA-1-AZABICYCLO(4.2.0)-OCT-2-EN-3-YL)METHYL)-, HYDROXIDE, INNER SALT, (6R-TRANS)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc40cc0f-5de0-4ba8-b410-cb3b129f971f"
          ],
          "display_name": false
        },
        {
          "uuid": "c8ab8b90-7811-457e-8bcc-aeb253845a5d",
          "name": "cefaloridine [INN]",
          "stdName": "CEFALORIDINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8c3b7e58-514a-4a30-9c4f-ecbd46eac892"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cc40cc0f-5de0-4ba8-b410-cb3b129f971f",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8ccb516d-8d73-49c4-bbb2-0218d17c95bf",
          "citation": "EMEA 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c3b7e58-514a-4a30-9c4f-ecbd46eac892",
          "citation": "INN Proposed List 15",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL15.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "afde02ae-9c43-4535-b863-7cfbe4b82fd6",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1040e35-be1b-47da-ac70-952d611d3683",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71288355-ae18-4695-86da-e4b85942df64",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15fc57b1-63fd-46b4-b7bf-41604dfef167",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7083b54e-e0fe-4496-9ac2-cdf5e2a7d80b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ac0ab26-d1e7-42bb-bc95-3731778b8012",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60c2fe40-2df6-4a85-9065-15939d66347d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389713000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d73eb88f-9d53-4f06-9648-5f3ccdfffbde",
          "citation": "SRS import [LVZ1VC61HB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=LVZ1VC61HB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389713000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "739b12f9-1060-487a-a90e-10a9db9fbcc9",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b30aa05-e208-4ad6-b0c6-5b04f08fe206",
          "citation": "CEFALORIDINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b057b13b-de43-400e-b1f5-a5aa3989a066",
          "citation": "CEPHALORIDINE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "768c6929-bf8a-4765-9559-77ed33d4d3fb",
          "citation": "CEFALORIDINE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b6c9852c-aa05-4318-8a13-5d1f9f9ee0c0",
          "citation": "CEFALORIDINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9f9893e1-c8e4-4449-9969-4ead723d67fa",
          "citation": "CEPHALORIDINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "85bcc885-0b32-427d-8327-5d0e7dc9d68a",
          "citation": "CEPHALORIDINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2920f63a-e1dd-4cdd-b867-a9dd04f928c9",
          "citation": "CEFALORIDINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "40fe23ec-4fd3-3a72-424c-ac6cc80ab584",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+50-59-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "50802deb-f6e1-e749-14db-3a21b83733ba",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=50-59-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dba63606-8a45-8c6d-7c2e-3349cc2e04f3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c4fbfd2c-c75e-4098-ac61-93aac61a5635",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c880807e-cb47-d483-16e7-3b1d1f1f3068",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a66dc178-50d1-f3c4-a7f5-5ac8b8a7cb05",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f924c354-4ede-472d-8331-143661e2889d",
          "id": "f924c354-4ede-472d-8331-143661e2889d",
          "molfile": "\n  Marvin  01132112552D          \n\n 28 31  0  0  1  0            999 V2000\n    4.5711   -5.7873    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.2494   -5.3793    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9432   -5.8003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9354   -6.6449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6371   -7.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3543   -6.6682    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.0923   -7.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8173   -6.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8173   -5.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1105   -5.4521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3543   -5.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2182   -7.0502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5711   -6.6110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6824   -6.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0821   -7.1724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7031   -5.7873    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.0015   -5.3819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1907   -5.7769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1907   -6.6344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4995   -5.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8524   -5.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0494   -5.4884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4807   -6.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0831   -6.7930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7484   -6.6215    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2182   -7.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4749   -8.2664    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.8886   -8.2976    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1 13  1  0  0  0  0\n 16  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 12  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n 11  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 26 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 18  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 25 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 26  2  0  0  0  0\nM  CHG  2   6   1  27  -1\nM  END",
          "smiles": "c1cc[n+](cc1)CC2=C(C(=O)[O-])N3C(=O)[C@H]([C@H]3SC2)NC(=O)Cc4cccs4",
          "formula": "C19H17N3O4S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "07f9b308-8773-422f-b2f0-f99836919b0f"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "415.4889",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ed417378-bdeb-4b82-aa7f-d7dbae0f8703",
      "version": "18",
      "structure": {
        "id": "a38664f1-6a7a-446c-81fe-1af4b4cf43aa",
        "molfile": "\n  Marvin  01132108302D          \n\n 29 32  0  0  1  0            999 V2000\n    4.5711   -6.6110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6824   -6.6110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5711   -5.7873    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.7031   -5.7873    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.2182   -7.0502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9354   -6.6449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2494   -5.3793    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3543   -6.6682    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    3.0015   -5.3819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2182   -7.8974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1907   -5.7769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6371   -7.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9432   -5.8003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4995   -5.3819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8524   -5.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0821   -7.1724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7484   -6.6215    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4749   -8.2664    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.0831   -6.7930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8886   -8.2976    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0494   -5.4884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1907   -6.6344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4807   -6.0524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3543   -5.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0923   -7.1048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8173   -6.7306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1105   -5.4521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8173   -5.8470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5633   -4.9817    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  3  1  0  0  0  0\n  8 12  1  0  0  0  0\n  4  9  1  1  0  0  0\n 10  5  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12  6  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16  2  2  0  0  0  0\n 17 15  1  0  0  0  0\n 18 10  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 10  2  0  0  0  0\n 21 15  2  0  0  0  0\n 22 11  2  0  0  0  0\n 23 21  1  0  0  0  0\n 24  8  1  0  0  0  0\n 25  8  2  0  0  0  0\n 26 25  1  0  0  0  0\n 27 24  2  0  0  0  0\n 28 26  2  0  0  0  0\n  3 29  1  6  0  0  0\n  4  2  1  0  0  0  0\n 13  7  1  0  0  0  0\n 28 27  1  0  0  0  0\n 23 19  2  0  0  0  0\nM  CHG  2   8   1  18  -1\nM  END",
        "smiles": "c1cc[n+](cc1)CC2=C(C(=O)[O-])N3C(=O)[C@H]([C@@]3([H])SC2)NC(=O)Cc4cccs4",
        "formula": "C19H17N3O4S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "415.4889",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d73eb88f-9d53-4f06-9648-5f3ccdfffbde",
          "739b12f9-1060-487a-a90e-10a9db9fbcc9",
          "8c3b7e58-514a-4a30-9c4f-ecbd46eac892"
        ],
        "stereo_centers": 2
      },
      "unii": "LVZ1VC61HB"
    }
  ]
}