{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "dc203e3d-6423-41ac-a098-f38107917955", "code": "126309-42-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=126309-42-0", "code_system": "CAS", "references": [ "da8aa9f9-124c-42d1-bf22-7a077944e518", "19d46ad2-46cd-4218-8908-12c625bc6ce1" ] }, { "uuid": "fa34de5a-b7b5-41ab-a4e5-87a6f5677ff7", "code": "1366853", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1366853/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "da8aa9f9-124c-42d1-bf22-7a077944e518" ] }, { "uuid": "00291bf9-534a-4053-b069-e1a0f4e3ab31", "code": "49857633", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/49857633", "code_system": "PUBCHEM", "references": [ "da8aa9f9-124c-42d1-bf22-7a077944e518" ] }, { "uuid": "f18fcb55-815f-49c7-969b-af8e9a29442a", "code": "LVB19G8AUT", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "b36e0ef7-4564-54fc-3f03-0dd7fe2aeff6", "code": "LVB19G8AUT", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=LVB19G8AUT", "code_system": "DAILYMED", "references": [ "f53ac9e1-39b9-0ecb-9df3-f823c87c03d5" ] }, { "uuid": "87fd58aa-9097-8436-4f80-742fc155cb01", "code": "DTXSID30155138", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30155138", "code_system": "EPA CompTox", "references": [ "a302cf87-92e5-c67d-0d9e-d92466bbc7ec" ] } ], "relationships": [ { "uuid": "713d6130-2bc7-4390-b54d-516ebdd6546f", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "698fe291-7996-4e92-8b42-432c52573585", "refuuid": "19641cf0-408d-40b0-8b04-1efbcf58c4f9", "name": "OLEANOLIC ACID", "unii": "6SMK8R7TGJ", "linking_id": "6SMK8R7TGJ", "ref_pname": "OLEANOLIC ACID", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "60f53d3e-29c2-4e69-bd1f-69189aa11825", "name": "OLEAN-12-EN-28-OIC ACID, 3-HYDROXY-, MONOSODIUM SALT, (3.BETA.)-", "stdName": "OLEAN-12-EN-28-OIC ACID, 3-HYDROXY-, MONOSODIUM SALT, (3.BETA.)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "20d42ed3-7f44-4b5c-9942-a9ea1b4c8352", "2e04e24c-5332-4236-a922-a0e5de4385c3" ], "display_name": false }, { "uuid": "804af571-8685-4c9d-a1ab-e8ebeeed65e8", "name": "OLEAN-12-EN-28-OIC ACID, 3-HYDROXY-, SODIUM SALT (1:1), (3.BETA.)-", "stdName": "OLEAN-12-EN-28-OIC ACID, 3-HYDROXY-, SODIUM SALT (1:1), (3.BETA.)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "20d42ed3-7f44-4b5c-9942-a9ea1b4c8352", "2e04e24c-5332-4236-a922-a0e5de4385c3" ], "display_name": false }, { "uuid": "4ff98694-3d88-4af7-876b-1ea874fa27a2", "name": "SODIUM OLEANOLATE", "stdName": "SODIUM OLEANOLATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "e3c198ff-03f4-4eb1-87fc-c887fe22966a", "2e04e24c-5332-4236-a922-a0e5de4385c3", "629ae1e7-1cbd-47b7-8ba7-94f236be14ed" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "f6abad5f-1aec-4852-89bf-1bab01df371a", "name_org": "INCI" } ] }, { "uuid": "83f7cdd0-7006-46b8-9393-00173c4e231b", "name": "URSOLIC ACID SODIUM SALT", "stdName": "URSOLIC ACID SODIUM SALT", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "e3c198ff-03f4-4eb1-87fc-c887fe22966a", "2e04e24c-5332-4236-a922-a0e5de4385c3" ], "display_name": false } ], "references": [ { "uuid": "e3c198ff-03f4-4eb1-87fc-c887fe22966a", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2e04e24c-5332-4236-a922-a0e5de4385c3", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "20d42ed3-7f44-4b5c-9942-a9ea1b4c8352", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "da8aa9f9-124c-42d1-bf22-7a077944e518", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391354000, "tags": [ "NOMEN" ] }, { "uuid": "5ea22e97-e120-46f9-b1b5-08d9c66777ab", "citation": "SRS import [LVB19G8AUT]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=LVB19G8AUT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391354000, "tags": [ "NOMEN" ] }, { "uuid": "629ae1e7-1cbd-47b7-8ba7-94f236be14ed", "citation": "SODIUM OLEANOLATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "23e0f832-343b-cf99-00ac-d22892caeecc", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=126309-42-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "19d46ad2-46cd-4218-8908-12c625bc6ce1", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "f53ac9e1-39b9-0ecb-9df3-f823c87c03d5", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "a302cf87-92e5-c67d-0d9e-d92466bbc7ec", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6651fb17-e8a9-445d-a39e-6b76e5619778", "id": "6651fb17-e8a9-445d-a39e-6b76e5619778", "molfile": "\n Marvin 01132105192D \n\n 1 0 0 0 1 0 999 V2000\n 18.4520 -7.1926 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "a8c33603-23fd-4444-8d24-d868edafef2c" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "9d1c3f7d-be2d-44fa-ba05-31b5f16d98e7", "id": "9d1c3f7d-be2d-44fa-ba05-31b5f16d98e7", "molfile": "\n Marvin 01132108102D \n\n 33 37 0 0 1 0 999 V2000\n 10.8693 -9.0363 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 10.2352 -9.3833 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 10.8693 -8.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5849 -7.7867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2890 -8.1974 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 12.2890 -7.5075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2890 -9.0363 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 13.0218 -9.4470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7337 -9.0363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7337 -8.1974 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 13.7337 -7.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0218 -7.7867 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 13.0218 -6.9585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7337 -6.5446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4272 -6.9585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1565 -6.5481 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 15.1493 -5.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8756 -5.3020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2696 -4.9155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4771 -4.9335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5868 -5.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5868 -6.5481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8756 -6.9585 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 15.8756 -7.7867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1565 -8.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4272 -7.7867 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 14.4272 -8.4669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6002 -7.3377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2946 -7.0150 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6111 -7.9106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5849 -9.4470 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.8586 -9.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5705 -10.1872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 3 1 1 0 0 0 0\n 31 1 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 1 1 0 0 0\n 5 7 1 0 0 0 0\n 12 5 1 0 0 0 0\n 8 7 1 0 0 0 0\n 7 31 1 1 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 1 0 0 0\n 10 12 1 0 0 0 0\n 10 26 1 0 0 0 0\n 12 13 1 1 0 0 0\n 13 14 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 6 0 0 0\n 26 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 23 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 18 21 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 28 1 1 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 1 6 0 0 0\n 28 29 1 0 0 0 0\n 28 30 2 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\nM CHG 1 2 -1\nM END", "smiles": "CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC[C@@H](C(C)(C)[C@@H]5CC[C@]43C)[O-])[C@@H]2C1)C(=O)O", "formula": "C30H47O3", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8a3e90fd-2126-4fc3-ac31-4fc321c154b9" }, "defined_stereo": 8, "ez_centers": 0, "molecular_weight": "455.6935", "optical_activity": "UNSPECIFIED", "stereo_centers": 8 } ], "definition_level": "COMPLETE", "uuid": "44803ba4-cd95-4d8e-b963-c1be2b77c3f1", "version": "7", "structure": { "id": "06832c7a-2e99-43ae-b7a6-3c9dfced1410", "molfile": "\n Marvin 01132100372D \n\n 37 40 0 0 1 0 999 V2000\n 10.8597 -9.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5860 -9.4479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2902 -9.0372 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.2902 -8.1982 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 11.5860 -7.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8704 -8.1982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8704 -9.0372 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.2362 -9.3842 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2902 -7.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0231 -7.7875 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.0231 -6.9592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7350 -6.5452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4286 -6.9592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4286 -7.7875 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.7350 -8.1982 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.7350 -7.5325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7350 -9.0372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0231 -9.4479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4286 -8.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1580 -8.1982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8771 -7.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8771 -6.9592 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.1580 -6.5487 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 15.1508 -5.7128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8771 -5.3025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2711 -4.9160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4787 -4.9340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5884 -5.7128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5884 -6.5487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1508 -7.3806 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6018 -7.3384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2963 -7.0157 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 16.6127 -7.9114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0159 -8.5702 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2830 -9.8619 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5716 -10.1882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4448 -7.1898 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 2 7 1 0 0 0 0\n 7 8 1 1 0 0 0\n 4 9 1 1 0 0 0\n 10 4 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 10 1 0 0 0 0\n 15 16 1 1 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 3 1 0 0 0 0\n 14 19 1 6 0 0 0\n 14 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 23 22 1 0 0 0 0\n 13 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 1 0 0 0 0\n 25 28 1 0 0 0 0\n 29 28 1 0 0 0 0\n 22 29 1 0 0 0 0\n 23 30 1 1 0 0 0\n 22 31 1 1 0 0 0\n 31 32 1 0 0 0 0\n 31 33 2 0 0 0 0\n 10 34 1 6 0 0 0\n 3 35 1 6 0 0 0\n 2 36 1 0 0 0 0\nM CHG 2 32 -1 37 1\nM END", "smiles": "CC1(C)CC[C@@]2(CC[C@]3(C)C(=CC[C@]4([H])[C@@]5(C)CC[C@@H](C(C)(C)[C@]5([H])CC[C@]43C)O)[C@]2([H])C1)C(=O)[O-].[Na+]", "formula": "C30H47O3.Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 8, "ez_centers": 0, "molecular_weight": "478.6833", "optical_activity": "UNSPECIFIED", "references": [ "5ea22e97-e120-46f9-b1b5-08d9c66777ab", "20d42ed3-7f44-4b5c-9942-a9ea1b4c8352" ], "stereo_centers": 8 }, "unii": "LVB19G8AUT" } ] }