{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "278dfe4f-a9e2-4f22-baa9-b045391dbc0f",
          "code": "480-23-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=480-23-9",
          "code_system": "CAS",
          "references": [
            "bb1778d3-460b-40f1-9800-845e4626d749",
            "67b243bf-cdd9-45af-ae08-c24ba06dd3ad"
          ]
        },
        {
          "uuid": "9846b0ef-2e7d-427a-af68-7922019665fb",
          "code": "OROBOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Orobol",
          "code_system": "WIKIPEDIA",
          "references": [
            "bb1778d3-460b-40f1-9800-845e4626d749"
          ]
        },
        {
          "uuid": "44df4e1e-9e7c-49af-9405-611c75388401",
          "code": "5281801",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281801",
          "code_system": "PUBCHEM",
          "references": [
            "bb1778d3-460b-40f1-9800-845e4626d749"
          ]
        },
        {
          "uuid": "627f1d1e-19ee-2c21-3a51-f854e8ed4423",
          "code": "DTXSID20197380",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20197380",
          "code_system": "EPA CompTox",
          "references": [
            "e3e05492-ee02-87a7-4d3c-c55a65cb0342"
          ]
        },
        {
          "uuid": "c16ff251-e60a-4082-9fc0-7cee2b537431",
          "code": "LU8UZM1T51",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f716f3a0-d63d-9628-70a8-30991a63f85d",
          "code": "69437",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:69437",
          "code_system": "CHEBI",
          "references": [
            "fb2a2865-b238-2d8b-51a2-4c9edf382774"
          ]
        },
        {
          "uuid": "d8838119-1c42-75e8-9ddf-1e645099152f",
          "code": "678114",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=678114",
          "code_system": "NSC",
          "references": [
            "fd241989-0c02-f91b-7b92-106795f1b1e5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "11bd9975-2c31-40fa-810c-7c782fe9b708",
          "name": "3',4',5,7-TETRAHYDROXYISOFLAVONE",
          "stdName": "3',4',5,7-TETRAHYDROXYISOFLAVONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b911671-2427-4911-a997-d00df8280fe6",
            "bc2e1719-ac6d-407d-96d0-b7e4e535c440"
          ],
          "display_name": false
        },
        {
          "uuid": "3c5f6bac-9d4d-432b-862e-8ac4c3f35444",
          "name": "4H-1-BENZOPYRAN-4-ONE, 5,7-DIHYDROXY-3-(3,4-DIHYDROXYPHENYL)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 5,7-DIHYDROXY-3-(3,4-DIHYDROXYPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b911671-2427-4911-a997-d00df8280fe6",
            "bc2e1719-ac6d-407d-96d0-b7e4e535c440"
          ],
          "display_name": false
        },
        {
          "uuid": "1d920894-b446-4b1e-b894-83356bbab0c8",
          "name": "ISOFLAVONE, 3',4',5,7-TETRAHYDROXY-",
          "stdName": "ISOFLAVONE, 3',4',5,7-TETRAHYDROXY-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b911671-2427-4911-a997-d00df8280fe6",
            "bc2e1719-ac6d-407d-96d0-b7e4e535c440"
          ],
          "display_name": false
        },
        {
          "uuid": "6b1a0bc2-b5e8-4100-a1c3-7cb13c098bf5",
          "name": "ISOLUTEOLIN",
          "stdName": "ISOLUTEOLIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b911671-2427-4911-a997-d00df8280fe6",
            "bc2e1719-ac6d-407d-96d0-b7e4e535c440"
          ],
          "display_name": false
        },
        {
          "uuid": "593432fa-c14d-4111-b865-bccfaa2086f8",
          "name": "NSC-678114",
          "stdName": "NSC-678114",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2b911671-2427-4911-a997-d00df8280fe6",
            "ca72b220-cd0b-488f-959f-033284f929da"
          ],
          "display_name": false
        },
        {
          "uuid": "5aa19755-e107-44c9-a325-0274419022e9",
          "name": "OROBOL",
          "stdName": "OROBOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b7ab866-45d7-4da4-99bc-446ebd1a62e7"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "6b7ab866-45d7-4da4-99bc-446ebd1a62e7",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bc2e1719-ac6d-407d-96d0-b7e4e535c440",
          "citation": "http://chem.sis.nlm.nih.gov/chemidplus/jsp/common/ChemInfo.jsp?type=names",
          "url": "http://chem.sis.nlm.nih.gov/chemidplus/jsp/common/ChemInfo.jsp?type=names",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2b911671-2427-4911-a997-d00df8280fe6",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca72b220-cd0b-488f-959f-033284f929da",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb1778d3-460b-40f1-9800-845e4626d749",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390932000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a786cc41-1fc7-41ee-b0cb-da8b4de6b801",
          "citation": "SRS import [LU8UZM1T51]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=LU8UZM1T51",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390932000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6b1e6f29-a551-4e5f-a4c0-bb42ce914369",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3e05492-ee02-87a7-4d3c-c55a65cb0342",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=480-23-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fb2a2865-b238-2d8b-51a2-4c9edf382774",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fd241989-0c02-f91b-7b92-106795f1b1e5",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "67b243bf-cdd9-45af-ae08-c24ba06dd3ad",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5ff99b90-7d4c-4358-a151-485813bd9082",
          "id": "5ff99b90-7d4c-4358-a151-485813bd9082",
          "molfile": "\n  Marvin  01132104582D          \n\n 21 23  0  0  0  0            999 V2000\n    3.8500   -3.7101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5697   -4.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5697   -4.9512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2825   -5.3630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2825   -6.1825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9952   -4.9465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9952   -4.1220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2805   -3.7097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7050   -3.7087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4209   -4.1143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4209   -4.9423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1323   -5.3462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1323   -6.1698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8491   -6.5829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5626   -6.1683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2737   -6.5755    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5626   -5.3364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2645   -4.9176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8404   -4.9322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7112   -5.3565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7112   -6.1780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6 20  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 20 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 19 12  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 20 21  2  0  0  0  0\nM  END",
          "smiles": "c1cc(c(cc1-c2coc3cc(cc(c3c2=O)O)O)O)O",
          "formula": "C15H10O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "02c461f1-bbeb-4074-80c6-63c1b7e5f8a0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "286.2369",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "25f57f0f-14c2-4c12-b9a7-82be571a42e4",
      "version": "5",
      "structure": {
        "id": "f026c341-96c8-47c7-9cdb-6bebaf827181",
        "molfile": "\n  Marvin  01132112282D          \n\n 21 23  0  0  0  0            999 V2000\n    4.5701   -4.1264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8504   -3.7105    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5701   -4.9517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2830   -5.3635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2830   -6.1831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9958   -4.9470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9958   -4.1224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7056   -3.7091    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4216   -4.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4216   -4.9428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7118   -5.3570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7118   -6.1786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1331   -5.3467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1331   -6.1704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8500   -6.5835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5635   -6.1689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5635   -5.3369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8413   -4.9327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2655   -4.9181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2747   -6.5761    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2810   -3.7101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n  6 11  1  0  0  0  0\n 10 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 13  1  0  0  0  0\n 17 19  1  0  0  0  0\n 16 20  1  0  0  0  0\n  7 21  2  0  0  0  0\n 21  1  1  0  0  0  0\nM  END",
        "smiles": "c1cc(c(cc1-c2coc3cc(cc(c3c2=O)O)O)O)O",
        "formula": "C15H10O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "286.2369",
        "optical_activity": "NONE",
        "references": [
          "6b1e6f29-a551-4e5f-a4c0-bb42ce914369",
          "a786cc41-1fc7-41ee-b0cb-da8b4de6b801"
        ],
        "stereo_centers": 0
      },
      "unii": "LU8UZM1T51"
    }
  ]
}