{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c5006754-fc08-4c26-afe6-161622b8eb09", "code": "4118-16-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=4118-16-5", "code_system": "CAS", "references": [ "729a918f-e6e8-4595-9fc2-6d15b5583441", "2a433c06-688e-40ea-9b77-34457fa0c52b" ] }, { "uuid": "e1350f5f-63c5-4a0e-bfc4-2451bc05452b", "code": "21 CFR 178.3297", "comments": "PART 178 -- INDIRECT FOOD ADDITIVES: ADJUVANTS, PRODUCTION AIDS, AND SANITIZERS|Subpart D--Certain Adjuvants and Production Aids|Sec. 178.3297 Colorants for polymers.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=178.3297", "code_system": "CFR", "references": [ "729a918f-e6e8-4595-9fc2-6d15b5583441" ] }, { "uuid": "609a785e-9fc8-4078-af78-909e1337d2eb", "code": "21 CFR 176.170", "comments": "PART 176 -- INDIRECT FOOD ADDITIVES: PAPER AND PAPERBOARD COMPONENTS|Subpart B--Substances for Use Only as Components of Paper and Paperboard|Sec. 176.170 Components of paper and paperboard in contact with aqueous and fatty foods.", "type": "PRIMARY", "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/cfrsearch.cfm?fr=176.170", "code_system": "CFR", "references": [ "729a918f-e6e8-4595-9fc2-6d15b5583441" ] }, { "uuid": "86376ba2-8497-4829-b210-1b3243813aab", "code": "223-912-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.739", "code_system": "ECHA (EC/EINECS)", "references": [ "729a918f-e6e8-4595-9fc2-6d15b5583441" ] }, { "uuid": "051e1ba2-7601-4ed3-99c3-e4c08d8583b9", "code": "77767", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/77767", "code_system": "PUBCHEM", "references": [ "729a918f-e6e8-4595-9fc2-6d15b5583441" ] }, { "uuid": "e33ecb4e-6e8f-855b-4fa7-d9d7b1c23efc", "code": "DTXSID6052083", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6052083", "code_system": "EPA CompTox", "references": [ "1cd1e3a0-bd48-4021-6883-bd9aecc371b8" ] }, { "uuid": "20f07a4b-17cc-4596-b2a0-0efad8a689bc", "code": "LQ3G1P1NFN", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "3dcf80f0-cdac-4db3-a29a-675852726e52", "name": "1,1'-((6-PHENYL-1,3,5-TRIAZINE-2,4-DIYL)DIIMINO)BIS-9,10-ANTHRACENEDIONE", "stdName": "1,1'-((6-PHENYL-1,3,5-TRIAZINE-2,4-DIYL)DIIMINO)BIS-9,10-ANTHRACENEDIONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "483802c4-e078-4e40-bf41-f44c142c8bd5", "bec064e7-2d6a-4415-9bfd-78a7c5e5a74e" ], "display_name": false }, { "uuid": "536115df-b3a4-454a-904e-effe02686246", "name": "1,1'-((6-PHENYL-1,3,5-TRIAZINE-2,4-DIYL)DIIMINO)BISANTHRAQUINONE", "stdName": "1,1'-((6-PHENYL-1,3,5-TRIAZINE-2,4-DIYL)DIIMINO)BISANTHRAQUINONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "483802c4-e078-4e40-bf41-f44c142c8bd5", "258c0c90-7e35-4249-aaff-a4ad422b7d64" ], "display_name": false }, { "uuid": "ea5c91c9-6236-4c26-8530-46597750a590", "name": "9,10-ANTHRACENEDIONE, 1,1'-((6-PHENYL-1,3,5-TRIAZINE-2,4-DIYL)DIIMINO)BIS-", "stdName": "9,10-ANTHRACENEDIONE, 1,1'-((6-PHENYL-1,3,5-TRIAZINE-2,4-DIYL)DIIMINO)BIS-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "483802c4-e078-4e40-bf41-f44c142c8bd5", "258c0c90-7e35-4249-aaff-a4ad422b7d64" ], "display_name": false }, { "uuid": "586ba179-6b71-49ac-8dda-6784e0522fbc", "name": "C.I. 60645", "stdName": "C.I. 60645", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "483802c4-e078-4e40-bf41-f44c142c8bd5", "322972df-d083-4844-9eff-6590f5be0817" ], "display_name": false }, { "uuid": "d7fb69c7-0279-45fe-80d0-5b165c4295fc", "name": "C.I. PIGMENT YELLOW 147", "stdName": "C.I. PIGMENT YELLOW 147", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f80f5576-9d56-4aec-b24f-e7056b4e08f6" ], "display_name": false }, { "uuid": "b3914fa6-268d-4acd-bbfb-82515649e205", "name": "CI 60645", "stdName": "CI 60645", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "42bb33ca-1c55-4f8c-ad67-baa5bb5385d1", "483802c4-e078-4e40-bf41-f44c142c8bd5" ], "display_name": false }, { "uuid": "a772708d-36e6-4ab9-9f42-4b68013a077e", "name": "CROMOPHTAL YELLOW AGR", "stdName": "CROMOPHTAL YELLOW AGR", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "483802c4-e078-4e40-bf41-f44c142c8bd5", "322972df-d083-4844-9eff-6590f5be0817" ], "display_name": false }, { "uuid": "f38b642f-a112-49ea-bd27-6f5930b1655f", "name": "FILESTER YELLOW 2648A", "stdName": "FILESTER YELLOW 2648A", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "483802c4-e078-4e40-bf41-f44c142c8bd5", "322972df-d083-4844-9eff-6590f5be0817" ], "display_name": false }, { "uuid": "f69ec50c-ade6-4997-a72e-75b18b8765ee", "name": "FILESTER YELLOW RN", "stdName": "FILESTER YELLOW RN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "483802c4-e078-4e40-bf41-f44c142c8bd5", "322972df-d083-4844-9eff-6590f5be0817" ], "display_name": false }, { "uuid": "a56b4643-10bf-4d88-89bf-9a0d030dd654", "name": "KAYASET YELLOW E-AR", "stdName": "KAYASET YELLOW E-AR", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "483802c4-e078-4e40-bf41-f44c142c8bd5", "322972df-d083-4844-9eff-6590f5be0817" ], "display_name": false }, { "uuid": "51edbed2-1f8b-465f-b0b2-da79bb098523", "name": "PIGMENT YELLOW 147", "stdName": "PIGMENT YELLOW 147", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "483802c4-e078-4e40-bf41-f44c142c8bd5", "322972df-d083-4844-9eff-6590f5be0817" ], "display_name": true } ], "references": [ { "uuid": "322972df-d083-4844-9eff-6590f5be0817", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "42bb33ca-1c55-4f8c-ad67-baa5bb5385d1", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "729a918f-e6e8-4595-9fc2-6d15b5583441", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391007000, "tags": [ "NOMEN" ] }, { "uuid": "d55181d8-01fd-488e-ada3-21e21ba60551", "citation": "SRS import [LQ3G1P1NFN]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=LQ3G1P1NFN", "doc_type": "SRS", "public_domain": true, "document_date": 1493391007000, "tags": [ "NOMEN" ] }, { "uuid": "7ffae026-a033-407e-a19d-ececa0528214", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f80f5576-9d56-4aec-b24f-e7056b4e08f6", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "258c0c90-7e35-4249-aaff-a4ad422b7d64", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "483802c4-e078-4e40-bf41-f44c142c8bd5", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bec064e7-2d6a-4415-9bfd-78a7c5e5a74e", "citation": "CEDI", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1cd1e3a0-bd48-4021-6883-bd9aecc371b8", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4118-16-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "2a433c06-688e-40ea-9b77-34457fa0c52b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a65669b9-bff4-4994-9c24-a13919516051", "id": "a65669b9-bff4-4994-9c24-a13919516051", "molfile": "\n Marvin 01132108382D \n\n 46 53 0 0 0 0 999 V2000\n 4.3655 -1.7290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3655 -2.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6522 -2.9611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9372 -2.5505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2233 -2.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2233 -3.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9383 -4.1988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6522 -3.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3666 -4.2025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3666 -5.0276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0832 -3.7862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7976 -4.1988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7976 -5.0238 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5095 -5.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2253 -5.0276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9406 -5.4464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6633 -5.0341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6633 -4.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9564 -3.7952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9564 -2.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6708 -2.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3832 -2.9789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1018 -2.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1018 -1.7431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8175 -2.9819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5269 -2.5743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2357 -2.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2357 -3.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5188 -4.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8175 -3.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0943 -4.2165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0943 -5.0417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3832 -3.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9406 -6.2659 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2233 -6.6760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5095 -6.2667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2233 -7.5012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5045 -7.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5045 -8.7350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2190 -9.1494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9312 -8.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9312 -7.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5109 -3.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5109 -2.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7965 -2.5505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0832 -2.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 2 3 1 0 0 0 0\n 46 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 8 3 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 2 0 0 0 0\n 9 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 46 2 0 0 0 0\n 12 13 1 0 0 0 0\n 43 12 2 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 1 0 0 0 0\n 14 36 2 0 0 0 0\n 16 15 2 0 0 0 0\n 16 17 1 0 0 0 0\n 34 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 18 1 0 0 0 0\n 18 33 2 0 0 0 0\n 20 19 2 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 2 0 0 0 0\n 22 23 1 0 0 0 0\n 33 22 1 0 0 0 0\n 23 24 2 0 0 0 0\n 23 25 1 0 0 0 0\n 26 25 1 0 0 0 0\n 25 30 2 0 0 0 0\n 27 26 2 0 0 0 0\n 28 27 1 0 0 0 0\n 29 28 2 0 0 0 0\n 30 29 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 2 0 0 0 0\n 31 33 1 0 0 0 0\n 35 34 2 0 0 0 0\n 36 35 1 0 0 0 0\n 35 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 42 37 2 0 0 0 0\n 38 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 2 0 0 0 0\n 41 42 1 0 0 0 0\n 44 43 1 0 0 0 0\n 45 44 2 0 0 0 0\n 46 45 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)-c2nc(Nc3cccc4c3C(=O)c5ccccc5C4=O)nc(Nc6cccc7c6C(=O)c8ccccc8C7=O)n2", "formula": "C37H21N5O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "41d1fcec-da82-40d0-a63e-77ce2574b9a9" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "599.5951", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "ad31816e-9d29-4c82-ac52-f300df13c654", "version": "3", "structure": { "id": "0a6c722f-5b03-44d1-8ff3-50f796fc2de1", "molfile": "\n Marvin 01132100482D \n\n 46 53 0 0 0 0 999 V2000\n 4.3666 -5.0276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3666 -4.2025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0832 -3.7862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0832 -2.9668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3655 -2.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3655 -1.7290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6522 -2.9611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9372 -2.5505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2233 -2.9639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2233 -3.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9383 -4.1988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6522 -3.7900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7965 -2.5505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5109 -2.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5109 -3.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7976 -4.1988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7976 -5.0238 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5095 -5.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5095 -6.2667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2233 -6.6760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9406 -6.2659 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9406 -5.4464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6633 -5.0341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6633 -4.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3832 -3.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3832 -2.9789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1018 -2.5682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1018 -1.7431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8175 -2.9819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8175 -3.8100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5188 -4.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2357 -3.8171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2357 -2.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5269 -2.5743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0943 -4.2165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0943 -5.0417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6708 -2.5606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9564 -2.9663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9564 -3.7952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2253 -5.0276 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2233 -7.5012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5045 -7.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5045 -8.7350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2190 -9.1494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9312 -8.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9312 -7.9156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 2 1 0 0 0 0\n 12 7 2 0 0 0 0\n 4 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 3 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 34 29 2 0 0 0 0\n 30 35 1 0 0 0 0\n 35 25 1 0 0 0 0\n 35 36 2 0 0 0 0\n 26 37 1 0 0 0 0\n 37 38 2 0 0 0 0\n 38 39 1 0 0 0 0\n 39 24 2 0 0 0 0\n 22 40 1 0 0 0 0\n 40 18 2 0 0 0 0\n 20 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 2 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 2 0 0 0 0\n 45 46 1 0 0 0 0\n 46 41 2 0 0 0 0\nM END", "smiles": "c1ccc(cc1)-c2nc(Nc3cccc4c3C(=O)c5ccccc5C4=O)nc(Nc6cccc7c6C(=O)c8ccccc8C7=O)n2", "formula": "C37H21N5O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "599.5951", "optical_activity": "NONE", "references": [ "7ffae026-a033-407e-a19d-ececa0528214", "d55181d8-01fd-488e-ada3-21e21ba60551" ], "stereo_centers": 0 }, "unii": "LQ3G1P1NFN" } ] }