{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9b6485e5-7e81-669f-059b-5db02138d865",
          "code": "155491247",
          "comments": "PUBCHEM",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/155491247",
          "code_system": "PUBCHEM",
          "references": [
            "0f46a7f8-ce17-3886-9cba-491710d3c11c"
          ]
        },
        {
          "uuid": "fa88c97c-fbdd-4c4b-8c5a-976e5b4d0e1e",
          "code": "LP9RET0GZW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9799906b-917d-5c18-48ea-a26a047c91e4",
          "name": "DIGLYCERIN 2 HYDROXYPROPYL ETHYLHEXYL ETHER",
          "stdName": "DIGLYCERIN 2 HYDROXYPROPYL ETHYLHEXYL ETHER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "24e69aeb-c8da-1276-3da7-9c99af13bf44"
          ],
          "display_name": false
        },
        {
          "uuid": "d86af35c-e1ad-ee03-beaf-8e19b19a6d42",
          "name": "POLYGLYCERYL-2 HYDROXYPROPYL ETHYLHEXYL ETHER",
          "stdName": "POLYGLYCERYL-2 HYDROXYPROPYL ETHYLHEXYL ETHER",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "87b4a9a9-b8b6-1e93-9cb0-59d187dba6fb"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "dbd6efc4-8bfc-84d9-430e-8fff420ac699",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "0f46a7f8-ce17-3886-9cba-491710d3c11c",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "24e69aeb-c8da-1276-3da7-9c99af13bf44",
          "citation": "FDA_SRS",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true
        },
        {
          "uuid": "87b4a9a9-b8b6-1e93-9cb0-59d187dba6fb",
          "citation": "PCPC-DB",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9fe8fb65-febe-2f80-d917-8227daf11394",
          "id": "9fe8fb65-febe-2f80-d917-8227daf11394",
          "molfile": "\n  Marvin  01132108182D          \n\n 24 23  0  0  0  0            999 V2000\n   20.5291   -7.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5291   -7.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8146   -6.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8146   -5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1001   -5.3626    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   18.3857   -5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3857   -6.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1001   -4.5376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3857   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3857   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6712   -2.8876    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   16.9568   -3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6712   -2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9567   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2422   -2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5278   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   15.5278   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8134   -2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0988   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3844   -2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6699   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   12.6699   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9554   -2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9554   -2.8876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 21  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COCC(COCC(COCC(CO)O)O)O",
          "formula": "C17H36O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "93cd5e3f-7c40-4763-a0c3-7505139e5959"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "352.4642",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "REPRESENTATIVE",
      "uuid": "1c5ce342-86f5-e08a-d84c-b8a727c6b311",
      "version": "4",
      "structure": {
        "id": "31cc268d-751c-64d9-af7e-a949ed147aa9",
        "molfile": "\n  Marvin  01132102402D          \n\n 24 23  0  0  0  0            999 V2000\n   20.5291   -7.8376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5291   -7.0126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8146   -6.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8146   -5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1001   -5.3626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1001   -4.5376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3857   -4.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3857   -3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6712   -2.8876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5278   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6699   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9554   -2.8876    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9554   -2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6699   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3844   -2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0988   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8134   -2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5278   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2422   -2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9567   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6712   -2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9568   -3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3857   -5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3857   -6.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 21  9  1  0  0  0  0\n 18 10  1  0  0  0  0\n 14 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n  9 22  1  0  0  0  0\n  5 23  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COCC(COCC(COCC(CO)O)O)O",
        "formula": "C17H36O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "352.4642",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "87b4a9a9-b8b6-1e93-9cb0-59d187dba6fb"
        ],
        "stereo_centers": 4,
        "stereo_comments": "Assumed mixed"
      },
      "unii": "LP9RET0GZW"
    }
  ]
}