{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6f4cad61-59df-4aad-9289-16500c490de5", "code": "185529-25-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=185529-25-3", "code_system": "CAS", "references": [ "3349d86f-c71e-4ae7-b267-013cdcfa0187", "51a36877-a1e8-4b3c-95c5-573907c81da6" ] }, { "uuid": "2f5f30c3-44de-43c8-a86b-acfa202aed27", "code": "71587601", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587601", "code_system": "PUBCHEM", "references": [ "3349d86f-c71e-4ae7-b267-013cdcfa0187" ] }, { "uuid": "b00fa4d8-ce1b-49ca-b0cc-1d3b516a06dc", "code": "LOP57B1ZJ4", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "4e307cd0-09c9-c311-d2c0-9b89ff1e9e71", "code": "DTXSID70939979", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70939979", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "d15e50a2-ba0d-4dc6-ab91-1966bea586ef", "name": "(±)-DIOCTADECYL IPDI", "stdName": "(+/-)-DIOCTADECYL IPDI", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bd0ca852-aca1-412a-9fd9-213d3f29c183", "ad1f405a-31cd-4610-b412-04f3161d2900" ], "display_name": false }, { "uuid": "14f08ba5-5ae2-4945-bc27-b3b12366b845", "name": "CARBAMIC ACID, (3- ((((ISOOCTADECYLOXY)CARBONYL)AMINO)METHYL)-3,5,5-TRIMETHYLCYCLOHEXYL)- ISOOCTADECYL ESTER", "stdName": "CARBAMIC ACID, (3- ((((ISOOCTADECYLOXY)CARBONYL)AMINO)METHYL)-3,5,5-TRIMETHYLCYCLOHEXYL)- ISOOCTADECYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ad1f405a-31cd-4610-b412-04f3161d2900", "ccb4d784-1993-4368-b058-e1e5484c5b9e" ], "display_name": false }, { "uuid": "c9ed1c87-4512-49c7-b8d8-b460ebc1f9d5", "name": "DIOCTADECYL IPDI", "stdName": "DIOCTADECYL IPDI", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bd0ca852-aca1-412a-9fd9-213d3f29c183", "ad1f405a-31cd-4610-b412-04f3161d2900" ], "display_name": false }, { "uuid": "48f8133f-e6be-42f9-907a-637101f66e86", "name": "DIOCTYLDECYL IPDI", "stdName": "DIOCTYLDECYL IPDI", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "ad1f405a-31cd-4610-b412-04f3161d2900", "7c9aef62-3a87-486b-ab11-b9e12d4e89e3", "ccb4d784-1993-4368-b058-e1e5484c5b9e" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "13998ff1-ccb9-48fe-8a95-678d9bbad876", "name_org": "INCI" } ] }, { "uuid": "37ff4c26-0274-4ed1-961d-e53b7d93aac1", "name": "DIOCTYLDECYL ISOPHORONE DIISOCYANATE", "stdName": "DIOCTYLDECYL ISOPHORONE DIISOCYANATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "bd0ca852-aca1-412a-9fd9-213d3f29c183", "ad1f405a-31cd-4610-b412-04f3161d2900" ], "display_name": true }, { "uuid": "ec104738-9b47-45ed-a1fc-6da3fae49c4b", "name": "MONODERM I-18", "stdName": "MONODERM I-18", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "ad1f405a-31cd-4610-b412-04f3161d2900", "ccb4d784-1993-4368-b058-e1e5484c5b9e" ], "display_name": false } ], "references": [ { "uuid": "ccb4d784-1993-4368-b058-e1e5484c5b9e", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ad1f405a-31cd-4610-b412-04f3161d2900", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bd0ca852-aca1-412a-9fd9-213d3f29c183", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3349d86f-c71e-4ae7-b267-013cdcfa0187", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391637000, "tags": [ "NOMEN" ] }, { "uuid": "1b7f7d4c-490c-4206-bcff-f7593411a52b", "citation": "SRS import [LOP57B1ZJ4]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=LOP57B1ZJ4", "doc_type": "SRS", "public_domain": true, "document_date": 1493391637000, "tags": [ "NOMEN" ] }, { "uuid": "7c9aef62-3a87-486b-ab11-b9e12d4e89e3", "citation": "DIOCTYLDECYL IPDI [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "51a36877-a1e8-4b3c-95c5-573907c81da6", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5d9899ca-05f6-4685-9cf9-c8fc6ee1a937", "id": "5d9899ca-05f6-4685-9cf9-c8fc6ee1a937", "molfile": "\n Marvin 01132104512D \n\n 54 54 0 0 0 0 999 V2000\n 2.3984 -20.7957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2234 -20.7957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6358 -20.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4608 -20.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8733 -19.3668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6983 -19.3668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1108 -18.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9358 -18.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3483 -17.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9358 -17.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1108 -17.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6983 -16.5089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8733 -16.5089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4608 -15.7945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6358 -15.7945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2234 -15.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3984 -15.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1733 -17.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5858 -18.6523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4108 -18.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8233 -17.9378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8233 -19.3668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4108 -20.0812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8233 -20.7957 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 9.0481 -21.0779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4553 -20.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2305 -20.5476 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 11.3738 -21.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7418 -21.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3293 -22.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3738 -22.4206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9666 -21.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8625 -20.0173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6378 -20.2994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7810 -21.1119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2698 -19.7691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0450 -20.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6770 -19.5210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5337 -18.7085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7584 -18.4264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6152 -17.6139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8400 -17.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6967 -16.5193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9215 -16.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7782 -15.4247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0029 -15.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4522 -19.8032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0842 -19.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8594 -19.5551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4914 -19.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2667 -19.3070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8987 -18.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6739 -19.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3059 -18.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 18 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 2 0 0 0 0\n 22 20 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 24 25 1 0 0 0 0\n 24 26 1 0 0 0 0\n 32 24 1 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 33 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 1 0 0 0 0\n 29 32 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 2 0 0 0 0\n 34 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 38 47 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\n 48 47 1 0 0 0 0\n 48 49 1 0 0 0 0\n 49 50 1 0 0 0 0\n 50 51 1 0 0 0 0\n 51 52 1 0 0 0 0\n 52 53 1 0 0 0 0\n 53 54 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(CCCCCCCC)COC(=O)NCC1(C)CC(CC(C)(C)C1)NC(=O)OCC(CCCCCCCC)CCCCCCCC", "formula": "C48H94N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f8d0ea80-a215-4971-87f9-22ac66fe4202" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "763.2728", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "65559a6c-af0d-4d92-a19c-08d62b157f61", "version": "4", "structure": { "id": "ac83165e-080b-434b-8fce-47a76ab3855e", "molfile": "\n Marvin 01132108572D \n\n 54 54 0 0 0 0 999 V2000\n 6.1108 -17.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9358 -17.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3483 -17.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9358 -18.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1108 -18.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6983 -19.3668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8733 -19.3668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4608 -20.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6358 -20.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2234 -20.7957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3984 -20.7957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1733 -17.9379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5858 -18.6523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4108 -18.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8233 -19.3668 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4108 -20.0812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8233 -20.7957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4553 -20.2654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2305 -20.5476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8625 -20.0173 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6378 -20.2994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7810 -21.1119 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2698 -19.7691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0450 -20.0513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6770 -19.5210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5337 -18.7085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7584 -18.4264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6152 -17.6139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8400 -17.3318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6967 -16.5193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9215 -16.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.7782 -15.4247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0029 -15.1425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4522 -19.8032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0842 -19.2729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.8594 -19.5551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4914 -19.0248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.2667 -19.3070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8987 -18.7767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.6739 -19.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.3059 -18.5285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3738 -21.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7418 -21.8903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3293 -22.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3738 -22.4206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9666 -21.6082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0481 -21.0779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.8233 -17.9378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6983 -16.5089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8733 -16.5089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4608 -15.7945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6358 -15.7945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2234 -15.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3984 -15.0800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 3 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 25 34 1 0 0 0 0\n 35 34 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 19 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 43 45 1 0 0 0 0\n 43 46 1 0 0 0 0\n 46 17 1 0 0 0 0\n 17 47 1 0 0 0 0\n 14 48 2 0 0 0 0\n 1 49 1 0 0 0 0\n 49 50 1 0 0 0 0\n 50 51 1 0 0 0 0\n 51 52 1 0 0 0 0\n 52 53 1 0 0 0 0\n 53 54 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(CCCCCCCC)COC(=O)NCC1(C)CC(CC(C)(C)C1)NC(=O)OCC(CCCCCCCC)CCCCCCCC", "formula": "C48H94N2O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "763.2728", "optical_activity": "UNSPECIFIED", "references": [ "1b7f7d4c-490c-4206-bcff-f7593411a52b", "ccb4d784-1993-4368-b058-e1e5484c5b9e" ], "stereo_centers": 2 }, "unii": "LOP57B1ZJ4" } ] }