{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "15e9c52a-653e-418e-abd6-27f54ca766d5", "code": "2725-22-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2725-22-6", "code_system": "CAS", "references": [ "c7cf9e9b-285a-4f8c-87c1-e5b630e6b355", "ad73e8ff-a862-4e35-bf4d-4f3fdf9f77c0" ] }, { "uuid": "0109c5bc-92b8-ec77-3596-af3e533a3113", "code": "DTXSID5051949", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5051949", "code_system": "EPA CompTox", "references": [ "730d4105-e5a3-46f8-ee20-e953c69e1c0b" ] }, { "uuid": "7d7138fb-858c-1987-a2c3-c7687d808af7", "code": "135414248", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135414248", "code_system": "PUBCHEM", "references": [ "f8e78854-9faf-fbd4-e17c-406174863744" ] }, { "uuid": "1fa08a0d-626d-424a-bff4-eda83879ee02", "code": "LO7K59NM8V", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "c88e9bd9-d7fa-4384-92e0-8593757a412d", "name": "2-(4,6-BIS(2,4-DIMETHYLPHENYL)-1,3,5-TRIAZIN-2-YL)-5-(OCTYLOXY)PHENOL", "stdName": "2-(4,6-BIS(2,4-DIMETHYLPHENYL)-1,3,5-TRIAZIN-2-YL)-5-(OCTYLOXY)PHENOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c5c62a27-1211-4cba-87ad-c7f6424027ba", "ae952510-8f3b-4238-b43e-4566766e15aa" ], "display_name": true }, { "uuid": "4f107501-a8c3-4afa-bd37-44f8259a20ae", "name": "BIS(2,4-DIMETHYLPHENYL)-1,3,5-TRIAZIN-2-YL)-5-(OCTYLOXY)PHENOL, 2-(4,6-", "stdName": "BIS(2,4-DIMETHYLPHENYL)-1,3,5-TRIAZIN-2-YL)-5-(OCTYLOXY)PHENOL, 2-(4,6-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "41877e19-dfb7-40f0-b39e-377b19242ed4" ], "display_name": false }, { "uuid": "d17e99aa-5006-431c-adeb-adcd68b6d532", "name": "CYAGARD UV 1164", "stdName": "CYAGARD UV 1164", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c5c62a27-1211-4cba-87ad-c7f6424027ba", "ae952510-8f3b-4238-b43e-4566766e15aa" ], "display_name": false }, { "uuid": "4a62f193-88ca-4309-9b02-902e9fbfa863", "name": "CYASORB 1164", "stdName": "CYASORB 1164", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c5c62a27-1211-4cba-87ad-c7f6424027ba", "ae952510-8f3b-4238-b43e-4566766e15aa" ], "display_name": false }, { "uuid": "ecef966e-7cb8-44ba-bf83-29003913fc04", "name": "CYASORB UV 1164", "stdName": "CYASORB UV 1164", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c5c62a27-1211-4cba-87ad-c7f6424027ba", "ae952510-8f3b-4238-b43e-4566766e15aa" ], "display_name": false }, { "uuid": "bb582d50-d104-4db3-9808-ed61e4fde05d", "name": "CYTEC UV 1164", "stdName": "CYTEC UV 1164", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c5c62a27-1211-4cba-87ad-c7f6424027ba", "ae952510-8f3b-4238-b43e-4566766e15aa" ], "display_name": false }, { "uuid": "fe846d75-1d22-4113-acfd-1d1a367c1312", "name": "PHENOL, 2-(4,6-BIS(2,4-DIMETHYLPHENYL)-1,3,5-TRIAZIN-2-YL)- 5-(OCTYLOXY)-", "stdName": "PHENOL, 2-(4,6-BIS(2,4-DIMETHYLPHENYL)-1,3,5-TRIAZIN-2-YL)- 5-(OCTYLOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c5c62a27-1211-4cba-87ad-c7f6424027ba", "ea951dda-2f89-48b0-b4b1-251b77bb6651" ], "display_name": false }, { "uuid": "3288899b-4fd9-49c2-9370-137ff740f1b6", "name": "TINUVIN 1545", "stdName": "TINUVIN 1545", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "c5c62a27-1211-4cba-87ad-c7f6424027ba", "ae952510-8f3b-4238-b43e-4566766e15aa" ], "display_name": false }, { "uuid": "c46c18e5-ce91-4ac7-b0df-9eefdda93832", "name": "UV-1164", "stdName": "UV-1164", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "c5c62a27-1211-4cba-87ad-c7f6424027ba", "ae952510-8f3b-4238-b43e-4566766e15aa" ], "display_name": false } ], "references": [ { "uuid": "41877e19-dfb7-40f0-b39e-377b19242ed4", "citation": "ICSAS BATCH 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ae952510-8f3b-4238-b43e-4566766e15aa", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c5c62a27-1211-4cba-87ad-c7f6424027ba", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ea951dda-2f89-48b0-b4b1-251b77bb6651", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c7cf9e9b-285a-4f8c-87c1-e5b630e6b355", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390949000, "tags": [ "NOMEN" ] }, { "uuid": "352bcabd-9c47-4cfd-a50b-3a0615f86c01", "citation": "SRS import [LO7K59NM8V]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=LO7K59NM8V", "doc_type": "SRS", "public_domain": true, "document_date": 1493390949000, "tags": [ "NOMEN" ] }, { "uuid": "09a29528-800a-4aaa-b15e-cf87a64b8502", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "730d4105-e5a3-46f8-ee20-e953c69e1c0b", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2725-22-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f8e78854-9faf-fbd4-e17c-406174863744", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "ad73e8ff-a862-4e35-bf4d-4f3fdf9f77c0", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a0c8a55c-5b7a-48f9-9f0e-7dab1231d217", "id": "a0c8a55c-5b7a-48f9-9f0e-7dab1231d217", "molfile": "\n Marvin 01132108212D \n\n 38 41 0 0 0 0 999 V2000\n -6.4302 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7158 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0013 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2868 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5724 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 -3.0938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -3.0938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -0.6188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -0.6188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -1.8563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7158 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7158 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 10 16 2 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 2 0 0 0 0\n 13 17 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 17 22 2 0 0 0 0\n 18 19 2 0 0 0 0\n 20 19 1 0 0 0 0\n 19 31 1 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 21 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 29 2 0 0 0 0\n 25 24 2 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 1 0 0 0 0\n 28 26 2 0 0 0 0\n 29 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 37 2 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\n 34 35 1 0 0 0 0\n 36 34 2 0 0 0 0\n 37 36 1 0 0 0 0\n 37 38 1 0 0 0 0\nM END", "smiles": "CCCCCCCCOc1ccc(c(c1)O)-c2nc(-c3ccc(C)cc3C)nc(-c4ccc(C)cc4C)n2", "formula": "C33H39N3O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c21b5488-2f26-4ef2-9d5a-8b38ea6a265e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "509.6829", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "aea7157a-af52-462d-9dd8-68e1168d238d", "version": "6", "structure": { "id": "61f23c23-b476-4f0d-9d36-98b5d5563b3e", "molfile": "\n Marvin 01132105042D \n\n 38 41 0 0 0 0 999 V2000\n 1.4289 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7145 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -3.0938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7145 -3.0938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4289 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.1434 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.8579 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.5724 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.2868 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.0013 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.7158 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -6.4302 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -0.6188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -1.8563 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -0.6188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1434 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8579 3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4289 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2868 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7158 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7158 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0013 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4302 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5724 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 2 0 0 0 0\n 1 7 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 8 9 1 0 0 0 0\n 5 8 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 17 22 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 23 28 2 0 0 0 0\n 26 29 1 0 0 0 0\n 24 30 1 0 0 0 0\n 22 23 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 2 0 0 0 0\n 35 36 1 0 0 0 0\n 31 36 2 0 0 0 0\n 34 37 1 0 0 0 0\n 32 38 1 0 0 0 0\n 20 31 1 0 0 0 0\n 2 18 1 0 0 0 0\nM END", "smiles": "CCCCCCCCOc1ccc(c(c1)O)-c2nc(-c3ccc(C)cc3C)nc(-c4ccc(C)cc4C)n2", "formula": "C33H39N3O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "509.6829", "optical_activity": "NONE", "references": [ "09a29528-800a-4aaa-b15e-cf87a64b8502", "352bcabd-9c47-4cfd-a50b-3a0615f86c01" ], "stereo_centers": 0 }, "unii": "LO7K59NM8V" } ] }