{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e7416316-f662-47a9-a08f-053b08ee30cc",
          "code": "138164-12-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=138164-12-2",
          "code_system": "CAS",
          "references": [
            "1499a9e4-261b-4b2c-8b21-adc7c761964d",
            "273177fe-0f8e-492e-a11b-edb77e463d8b"
          ]
        },
        {
          "uuid": "32fd608f-df28-4d8b-9822-d31e686d9ffd",
          "code": "10905426",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10905426",
          "code_system": "PUBCHEM",
          "references": [
            "1499a9e4-261b-4b2c-8b21-adc7c761964d"
          ]
        },
        {
          "uuid": "904fb0f1-2308-12c0-2ad2-b4f300d8afbe",
          "code": "DTXSID0057968",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0057968",
          "code_system": "EPA CompTox",
          "references": [
            "89f46acd-74ed-cd6c-a46d-bb02399444e4"
          ]
        },
        {
          "uuid": "5fbd303a-13ab-8720-0fee-823c8c7e02c3",
          "code": "Butroxydim",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Butroxydim",
          "code_system": "WIKIPEDIA",
          "references": [
            "869b1774-bf8a-439a-a80a-654623cff99c"
          ]
        },
        {
          "uuid": "baf34769-f0d7-4415-a013-3185f93fe7fd",
          "code": "LN82LZK7KD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "eb12bf67-ac29-f0d7-b586-e30d5a9e64d9",
          "code": "butroxydim",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/butroxydim.html",
          "code_system": "ALANWOOD",
          "references": [
            "e35e4d1c-5585-8e24-f226-18f6890c0f73"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "efb6f162-cf04-4b15-992d-33f8242b81cd",
          "name": "2-(1-(ETHOXYIMINO)PROPYL)-3-HYDROXY-5-(2,4,6-TRIMETHYL-3-(1-OXOBUTYL)PHENYL)-2-CYCLOHEXEN-1-ONE",
          "stdName": "2-(1-(ETHOXYIMINO)PROPYL)-3-HYDROXY-5-(2,4,6-TRIMETHYL-3-(1-OXOBUTYL)PHENYL)-2-CYCLOHEXEN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "273177fe-0f8e-492e-a11b-edb77e463d8b"
          ],
          "display_name": false
        },
        {
          "uuid": "46fd82c8-ccd0-4f9e-b4d1-6349363def8c",
          "name": "2-CYCLOHEXEN-1-ONE, 2-(1-(ETHOXYIMINO)PROPYL)-3-HYDROXY-5-(2,4,6-TRIMETHYL-3-(1-OXOBUTYL)PHENYL)-",
          "stdName": "2-CYCLOHEXEN-1-ONE, 2-(1-(ETHOXYIMINO)PROPYL)-3-HYDROXY-5-(2,4,6-TRIMETHYL-3-(1-OXOBUTYL)PHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "273177fe-0f8e-492e-a11b-edb77e463d8b"
          ],
          "display_name": false
        },
        {
          "uuid": "bd32a03e-e706-45cf-b821-a80f6cb3d7b8",
          "name": "5-(3-BUTYRYL-2,4,6-TRIMETHYLPHENYL)-2-(1-ETHOXYIMINOPROPYL)-3-HYDROXYCYCLOHEX-2-ENONE",
          "stdName": "5-(3-BUTYRYL-2,4,6-TRIMETHYLPHENYL)-2-(1-ETHOXYIMINOPROPYL)-3-HYDROXYCYCLOHEX-2-ENONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c9b9505-ac44-49d8-b237-2ac8ec65ec30",
            "273177fe-0f8e-492e-a11b-edb77e463d8b"
          ],
          "display_name": false
        },
        {
          "uuid": "682639e9-8382-4f6d-b237-149700a3b0cd",
          "name": "BUTROXYDIM",
          "stdName": "BUTROXYDIM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c9b9505-ac44-49d8-b237-2ac8ec65ec30"
          ],
          "display_name": true,
          "domains": [
            "Pesticide"
          ],
          "name_orgs": [
            {
              "uuid": "b6bb97c7-5d27-48c2-9b78-bbe0062dfea7",
              "name_org": "ISO"
            }
          ]
        },
        {
          "uuid": "eb93bf20-4615-4482-92a9-f34c63be7a96",
          "name": "BUTROXYDIM [ISO]",
          "stdName": "BUTROXYDIM [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd4d0be8-6624-4a93-99ef-2dedebe7567d",
            "f9bc60f5-6f7e-4087-8d7a-b720a0ac936a"
          ],
          "display_name": false
        },
        {
          "uuid": "23a4390c-c04d-4851-98fd-e658b85c18fe",
          "name": "FENOXYDIM",
          "stdName": "FENOXYDIM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5002a0fd-d228-4e98-a665-c3e2014e96d3",
            "f9bc60f5-6f7e-4087-8d7a-b720a0ac936a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "cd4d0be8-6624-4a93-99ef-2dedebe7567d",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9bc60f5-6f7e-4087-8d7a-b720a0ac936a",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5002a0fd-d228-4e98-a665-c3e2014e96d3",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1499a9e4-261b-4b2c-8b21-adc7c761964d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392242000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89f46acd-74ed-cd6c-a46d-bb02399444e4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=138164-12-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "869b1774-bf8a-439a-a80a-654623cff99c",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "e35e4d1c-5585-8e24-f226-18f6890c0f73",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "273177fe-0f8e-492e-a11b-edb77e463d8b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "23913ef5-553d-4405-b0d9-c0133c3f6777",
          "citation": "butroxydim",
          "url": "https://pesticidecompendium.bcpc.org/butroxydim.html",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "9c9b9505-ac44-49d8-b237-2ac8ec65ec30",
          "citation": "https://pesticidecompendium.bcpc.org/index_new_frame.html",
          "url": "https://pesticidecompendium.bcpc.org/index_new_frame.html",
          "doc_type": "ALANWOOD",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "81f0e1b3-4f0e-4c30-95cd-a37e6506633e",
          "id": "81f0e1b3-4f0e-4c30-95cd-a37e6506633e",
          "molfile": "\n  Marvin  11172118582D          \n\n 29 30  0  0  0  0            999 V2000\n    7.1870   -3.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3291   -3.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1870   -1.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9015   -2.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1870   -0.8063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6159   -1.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3304   -2.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3291   -5.7563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1870   -5.7563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7581   -0.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7581   -6.5813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4725   -6.9938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0436   -6.9938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1702   -7.4184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3291   -6.5813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9182   -7.2282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4987   -7.7029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7581   -3.2813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4725   -2.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0436   -2.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4725   -2.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0436   -2.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7581   -1.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7581   -4.1063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0436   -4.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4725   -4.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0436   -5.3438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4725   -5.3438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7581   -5.7563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1 19  1  0  0  0  0\n  2 20  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  3 21  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8 27  2  0  0  0  0\n  9 28  2  0  0  0  0\n 10 23  1  0  0  0  0\n 11 12  2  3  0  0  0\n 11 13  1  0  0  0  0\n 11 29  1  0  0  0  0\n 12 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 18 24  1  0  0  0  0\n 19 21  1  0  0  0  0\n 20 22  2  0  0  0  0\n 21 23  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 26 28  1  0  0  0  0\n 27 29  1  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
          "smiles": "CCCC(=O)c1c(C)cc(C)c(c1C)C2CC(=O)C(C(=NOCC)CC)C(=O)C2",
          "formula": "C24H33NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fc765ebd-8d48-4802-b22e-d17156cf53cd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "399.524",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5a63f32e-c573-4c23-bb4f-1c87dde4b7a3",
      "version": "10",
      "structure": {
        "id": "63007916-f700-4320-ab29-6bc8aa9e12f2",
        "molfile": "Butroxydim\n   JSDraw211172118582D\n\n 29 30  0  0  0  0              0 V2000\n   27.1007   -6.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6967   -6.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1007   -3.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.4517   -3.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1007   -1.5600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8027   -3.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.1538   -3.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6967  -10.9200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.1007  -10.9200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.3988   -1.5600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.3988  -12.4800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.7497  -13.2600    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0477  -13.2600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.0690  -14.0628    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6967  -12.4800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.4833  -13.7032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.5811  -14.6009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.3988   -6.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.7497   -5.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0477   -5.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.7497   -3.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0477   -3.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.3988   -3.1200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.3988   -7.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0477   -8.5800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.7497   -8.5800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.0477  -10.1400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.7497  -10.1400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.3988  -10.9200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1 19  1  0  0  0  0\n  2 20  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  3 21  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8 27  2  0  0  0  0\n  9 28  2  0  0  0  0\n 10 23  1  0  0  0  0\n 11 12  2  3  0  0  0\n 11 13  1  0  0  0  0\n 11 29  1  0  0  0  0\n 12 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 18 24  1  0  0  0  0\n 19 21  1  0  0  0  0\n 20 22  2  0  0  0  0\n 21 23  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 26 28  1  0  0  0  0\n 27 29  1  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
        "smiles": "CCCC(=O)c1c(C)cc(C)c(c1C)C2CC(=O)C(C(=NOCC)CC)C(=O)C2",
        "formula": "C24H33NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "399.524",
        "optical_activity": "NONE",
        "references": [
          "5002a0fd-d228-4e98-a665-c3e2014e96d3",
          "23913ef5-553d-4405-b0d9-c0133c3f6777"
        ],
        "stereo_centers": 0
      },
      "modifications": {
        "uuid": "b87b8475-57dc-4bf9-a6b7-b98aef905445"
      },
      "unii": "LN82LZK7KD"
    }
  ]
}