{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ccde39a9-ed5a-43f4-8df0-9a557d1c91ff",
          "code": "210896-25-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=210896-25-6",
          "code_system": "CAS",
          "references": [
            "05dc5b9e-3ab5-4efb-b23d-7eb2af270bc3",
            "46b9d6d5-be59-409a-904c-a44a6f2eb808"
          ]
        },
        {
          "uuid": "1ee5af89-8a05-4fb5-9629-bd5420c46a53",
          "code": "10874009",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10874009",
          "code_system": "PUBCHEM",
          "references": [
            "05dc5b9e-3ab5-4efb-b23d-7eb2af270bc3"
          ]
        },
        {
          "uuid": "948806e7-97ae-7e29-9ec5-0928f96ee6f4",
          "code": "DTXSID30893366",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30893366",
          "code_system": "EPA CompTox",
          "references": [
            "2fa6950b-d1ec-ab74-9f96-f813794e89e1"
          ]
        },
        {
          "uuid": "e8841b91-1691-4918-ab53-030443ec578d",
          "code": "LN2J86A2N6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "71863532-2e2e-49cf-b70f-53ea96104e94",
          "name": "(±)-PERFLUOROHEXYLETHYL DIMETHYLBUTYL ETHER",
          "stdName": "(+/-)-PERFLUOROHEXYLETHYL DIMETHYLBUTYL ETHER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad13e35b-4bd6-4fee-b93b-81ae73d8f806",
            "08bb50dd-7b0a-49e5-8ff4-f74438c1d741"
          ],
          "display_name": false
        },
        {
          "uuid": "3f3072e4-4a90-4bdc-8dd7-858a21ef1291",
          "name": "1H,1H,2H,2H-PERFLUOROOCTYL 1,3-DIMETHYLBUTYL ETHER",
          "stdName": "1H,1H,2H,2H-PERFLUOROOCTYL 1,3-DIMETHYLBUTYL ETHER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0adcd813-f29f-4026-9f77-bfbcb12775f9",
            "08bb50dd-7b0a-49e5-8ff4-f74438c1d741"
          ],
          "display_name": false
        },
        {
          "uuid": "79dcd6ef-4259-457d-a88f-7cc75ff7fc71",
          "name": "OCTANE, 8-(1,3-DIMETHYLBUTOXY)-1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-",
          "stdName": "OCTANE, 8-(1,3-DIMETHYLBUTOXY)-1,1,1,2,2,3,3,4,4,5,5,6,6-TRIDECAFLUORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0adcd813-f29f-4026-9f77-bfbcb12775f9",
            "08bb50dd-7b0a-49e5-8ff4-f74438c1d741"
          ],
          "display_name": false
        },
        {
          "uuid": "9c854d20-4b73-4694-9af3-53af79aec0b1",
          "name": "PERFLUOROHEXYLETHYL DIMETHYLBUTYL ETHER",
          "stdName": "PERFLUOROHEXYLETHYL DIMETHYLBUTYL ETHER",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08bb50dd-7b0a-49e5-8ff4-f74438c1d741",
            "c110188c-f2fd-4bdf-94ac-f4625524abaf",
            "d25f4578-ef58-406b-ba55-ec1418b9bb2e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ed159385-a248-4608-8186-28b9ef498388",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "3c34f925-b871-48bd-8056-90625522b2b8",
          "name": "PERFLUOROHEXYLETHYL DIMETHYLBUTYL ETHER, (±)-",
          "stdName": "PERFLUOROHEXYLETHYL DIMETHYLBUTYL ETHER, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad13e35b-4bd6-4fee-b93b-81ae73d8f806",
            "08bb50dd-7b0a-49e5-8ff4-f74438c1d741"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d25f4578-ef58-406b-ba55-ec1418b9bb2e",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "08bb50dd-7b0a-49e5-8ff4-f74438c1d741",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0adcd813-f29f-4026-9f77-bfbcb12775f9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad13e35b-4bd6-4fee-b93b-81ae73d8f806",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05dc5b9e-3ab5-4efb-b23d-7eb2af270bc3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b1e9710f-497a-4ac1-85f8-b857c6d33d73",
          "citation": "SRS import [LN2J86A2N6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=LN2J86A2N6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c110188c-f2fd-4bdf-94ac-f4625524abaf",
          "citation": "PERFLUOROHEXYLETHYL DIMETHYLBUTYL ETHER [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "46b9d6d5-be59-409a-904c-a44a6f2eb808",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2fa6950b-d1ec-ab74-9f96-f813794e89e1",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "57712435-0295-47eb-a9f4-b4d096af46b9",
          "id": "57712435-0295-47eb-a9f4-b4d096af46b9",
          "molfile": "\n  Marvin  01132104322D          \n\n 28 27  0  0  0  0            999 V2000\n    2.3225   -2.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1475   -2.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5600   -1.6041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5600   -3.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3850   -3.0330    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.7975   -2.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7975   -3.7476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6225   -3.7476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0350   -4.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8571   -4.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6827   -4.4640    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8628   -3.6385    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8550   -5.2876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7559   -6.1072    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0303   -5.2322    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1527   -5.5280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9662   -5.6725    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3029   -4.7132    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9124   -6.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0924   -6.8222    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8682   -7.6473    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2302   -6.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2784   -6.1574    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0476   -7.0375    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1596   -8.0525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1078   -8.8792    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9806   -8.1058    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3329   -8.0006    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 13 10  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 16 13  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 19 16  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 22 19  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 25 22  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 25 28  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CC(C)OCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F",
          "formula": "C14H17F13O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "207fd457-e633-4e95-a2ff-84004b35a286"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "448.2639",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "358d4b3c-b8b1-4d10-8524-3375b69fc01a",
      "version": "6",
      "structure": {
        "id": "3760ff08-6dcb-4378-be3a-083134b24e41",
        "molfile": "\n  Marvin  01132102572D          \n\n 28 27  0  0  0  0            999 V2000\n    5.6225   -3.7476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0350   -4.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8571   -4.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8550   -5.2876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1527   -5.5280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9124   -6.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2302   -6.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1596   -8.0525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1078   -8.8792    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9806   -8.1058    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3329   -8.0006    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2784   -6.1574    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0476   -7.0375    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0924   -6.8222    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8682   -7.6473    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9662   -5.6725    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3029   -4.7132    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7559   -6.1072    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0303   -5.2322    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6827   -4.4640    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8628   -3.6385    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7975   -3.7476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3850   -3.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7975   -2.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5600   -3.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1475   -2.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3225   -2.3186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5600   -1.6041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n  7 12  1  0  0  0  0\n  7 13  1  0  0  0  0\n  6 14  1  0  0  0  0\n  6 15  1  0  0  0  0\n  5 16  1  0  0  0  0\n  5 17  1  0  0  0  0\n  4 18  1  0  0  0  0\n  4 19  1  0  0  0  0\n  3 20  1  0  0  0  0\n  3 21  1  0  0  0  0\n  1 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CC(C)OCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F",
        "formula": "C14H17F13O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "448.2639",
        "optical_activity": "( + / - )",
        "references": [
          "b1e9710f-497a-4ac1-85f8-b857c6d33d73",
          "0adcd813-f29f-4026-9f77-bfbcb12775f9"
        ],
        "stereo_centers": 1
      },
      "unii": "LN2J86A2N6"
    }
  ]
}