{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1025c6ff-1878-4c46-a8e7-1f3da6a4275a",
          "code": "121-60-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=121-60-8",
          "code_system": "CAS",
          "references": [
            "8a82217f-5104-4d30-aee5-16da1d7e8d5c",
            "877e1386-0175-44ef-a52f-8a795bc7f741"
          ]
        },
        {
          "uuid": "7c7598c9-01e6-4b52-a611-d53c1257f086",
          "code": "204-485-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.078",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8a82217f-5104-4d30-aee5-16da1d7e8d5c"
          ]
        },
        {
          "uuid": "1d45a463-afb8-43a6-b493-98d096d9a048",
          "code": "m1365",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1365?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8a82217f-5104-4d30-aee5-16da1d7e8d5c"
          ]
        },
        {
          "uuid": "1dbafad6-f4e4-4777-8132-cb3be0e36b0e",
          "code": "8481",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/8481",
          "code_system": "PUBCHEM",
          "references": [
            "8a82217f-5104-4d30-aee5-16da1d7e8d5c"
          ]
        },
        {
          "uuid": "3615e582-8823-adf9-f57f-920e17bc747b",
          "code": "2712",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2712",
          "code_system": "HSDB",
          "references": [
            "f4aedc81-a9c3-778f-5918-3f3084798b36"
          ]
        },
        {
          "uuid": "17f9a534-0b62-408f-9d92-c6160fe45229",
          "code": "DTXSID8026981",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8026981",
          "code_system": "EPA CompTox",
          "references": [
            "baffe08c-ac3c-2159-258d-a9824e617de2"
          ]
        },
        {
          "uuid": "83b0bfd1-aef9-e179-f195-a150b903b306",
          "code": "DB12337",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB12337",
          "code_system": "DRUG BANK",
          "references": [
            "a717db55-e1a6-22d8-c609-dd7f0d0d7709"
          ]
        },
        {
          "uuid": "a9706cf1-0cb5-443d-bb9e-4041a23c4dbe",
          "code": "LIX4M9AIVM",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "14b5e685-f2f8-5f2b-27ea-9dd58e16088f",
          "code": "127860",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=127860",
          "code_system": "NSC",
          "references": [
            "3b17ed80-a089-b646-e652-f41b9bd256a1"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b214f539-68bb-475f-b611-b16814fca7ab",
          "name": "4-(ACETYLAMINO)BENZENESULFONYL CHLORIDE",
          "stdName": "4-(ACETYLAMINO)BENZENESULFONYL CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd05a144-143a-4f20-a475-fbcc8744070e",
            "1891f546-8240-43cb-a7dd-0f30d76df0b5",
            "7d2d9fc3-783d-48ad-97ca-7ac87254f7c7",
            "ba9bd313-b146-4c74-ab6e-036767a5ba9d"
          ],
          "display_name": false
        },
        {
          "uuid": "8c2a733b-6d44-4d50-baff-c54c106b57b7",
          "name": "4-(ACETYLAMINO)BENZENESULFONYL CHLORIDE [HSDB]",
          "stdName": "4-(ACETYLAMINO)BENZENESULFONYL CHLORIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1891f546-8240-43cb-a7dd-0f30d76df0b5",
            "ba9bd313-b146-4c74-ab6e-036767a5ba9d"
          ],
          "display_name": false
        },
        {
          "uuid": "c69afe59-b2ba-420e-ba27-a72b9234cde4",
          "name": "ACETANILIDE-P-SULFONYL CHLORIDE",
          "stdName": "ACETANILIDE-P-SULFONYL CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d2d9fc3-783d-48ad-97ca-7ac87254f7c7",
            "ba9bd313-b146-4c74-ab6e-036767a5ba9d"
          ],
          "display_name": false
        },
        {
          "uuid": "a236a13c-5322-400a-b9bb-7c619d7a1da6",
          "name": "ACETYLAMINOBENZENE SULFONYL CHLORIDE, P-",
          "stdName": "ACETYLAMINOBENZENE SULFONYL CHLORIDE, P-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8e483477-709c-470d-a394-431e27d87822"
          ],
          "display_name": false
        },
        {
          "uuid": "a09ea785-d096-45da-80fa-de2aca5fc0a1",
          "name": "ASC",
          "stdName": "ASC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d2d9fc3-783d-48ad-97ca-7ac87254f7c7",
            "ba9bd313-b146-4c74-ab6e-036767a5ba9d"
          ],
          "display_name": false
        },
        {
          "uuid": "42389ad5-fb6a-47cc-abcb-d1a50b15f58a",
          "name": "BENZENESULFONYL CHLORIDE, 4-(ACETYLAMINO)-",
          "stdName": "BENZENESULFONYL CHLORIDE, 4-(ACETYLAMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c0777f7-eea7-4ad2-9fae-14e2cdc05c2a",
            "ba9bd313-b146-4c74-ab6e-036767a5ba9d"
          ],
          "display_name": false
        },
        {
          "uuid": "0e622392-85fb-4422-acdb-3e0cd70906d5",
          "name": "N-ACETYLSULFANILYL CHLORIDE [MI]",
          "stdName": "N-ACETYLSULFANILYL CHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36cbaac1-b97d-4f20-9aef-f021cd1f7c1e",
            "ba9bd313-b146-4c74-ab6e-036767a5ba9d"
          ],
          "display_name": false
        },
        {
          "uuid": "ef327dc4-68ee-482f-992e-393fbcf361b4",
          "name": "N-Acetylsulfanilyl chloride",
          "stdName": "N-ACETYLSULFANILYL CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b3645c3-05ef-4d5b-a825-0666c385ed56",
            "7d2d9fc3-783d-48ad-97ca-7ac87254f7c7",
            "ba9bd313-b146-4c74-ab6e-036767a5ba9d",
            "36cbaac1-b97d-4f20-9aef-f021cd1f7c1e"
          ],
          "display_name": true
        },
        {
          "uuid": "898b06a4-a95a-48c8-a274-0751ab163f7a",
          "name": "NSC-127860",
          "stdName": "NSC-127860",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c0777f7-eea7-4ad2-9fae-14e2cdc05c2a",
            "ba9bd313-b146-4c74-ab6e-036767a5ba9d"
          ],
          "display_name": false
        },
        {
          "uuid": "ab441199-bdd7-4ccc-afbf-0bef8ccacc14",
          "name": "P-ACETAMIDOBENZENESULFONYL CHLORIDE",
          "stdName": "P-ACETAMIDOBENZENESULFONYL CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d2d9fc3-783d-48ad-97ca-7ac87254f7c7",
            "ba9bd313-b146-4c74-ab6e-036767a5ba9d"
          ],
          "display_name": false
        },
        {
          "uuid": "ed7801bf-1b7b-4ab4-b29d-de995d76a16d",
          "name": "P-ACETAMINOBENZENESULFONYL CHLORIDE",
          "stdName": "P-ACETAMINOBENZENESULFONYL CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7d2d9fc3-783d-48ad-97ca-7ac87254f7c7",
            "ba9bd313-b146-4c74-ab6e-036767a5ba9d"
          ],
          "display_name": false
        },
        {
          "uuid": "fbeaa2f7-5aa0-4649-bb9c-aefc267b9847",
          "name": "SULFANILYL CHLORIDE, N-ACETYL-",
          "stdName": "SULFANILYL CHLORIDE, N-ACETYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ba9bd313-b146-4c74-ab6e-036767a5ba9d",
            "d2ddb36a-cc90-427f-b363-f0177207f0d0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8e483477-709c-470d-a394-431e27d87822",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "36cbaac1-b97d-4f20-9aef-f021cd1f7c1e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba9bd313-b146-4c74-ab6e-036767a5ba9d",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d2d9fc3-783d-48ad-97ca-7ac87254f7c7",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c0777f7-eea7-4ad2-9fae-14e2cdc05c2a",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2ddb36a-cc90-427f-b363-f0177207f0d0",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1891f546-8240-43cb-a7dd-0f30d76df0b5",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a82217f-5104-4d30-aee5-16da1d7e8d5c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390885000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26d3add6-ecae-4e8a-81df-4fd46500471c",
          "citation": "SRS import [LIX4M9AIVM]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=LIX4M9AIVM",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390885000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f074da4b-c54e-4440-92c5-372130d54b51",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b3645c3-05ef-4d5b-a825-0666c385ed56",
          "citation": "N-ACETYLSULFANILYL CHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fd05a144-143a-4f20-a475-fbcc8744070e",
          "citation": "4-(ACETYLAMINO)BENZENESULFONYL CHLORIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f4aedc81-a9c3-778f-5918-3f3084798b36",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+121-60-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "baffe08c-ac3c-2159-258d-a9824e617de2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=121-60-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a717db55-e1a6-22d8-c609-dd7f0d0d7709",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "877e1386-0175-44ef-a52f-8a795bc7f741",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3b17ed80-a089-b646-e652-f41b9bd256a1",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ac599019-d807-43b8-837b-e17ba17bc99d",
          "id": "ac599019-d807-43b8-837b-e17ba17bc99d",
          "molfile": "\n  Marvin  01132108562D          \n\n 14 14  0  0  0  0            999 V2000\n    5.9824   -5.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5700   -4.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7450   -4.3135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9824   -3.5990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8074   -3.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2199   -2.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0449   -2.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4573   -3.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0449   -4.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2199   -4.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2823   -3.5990    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1073   -3.5990    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.2823   -4.4240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2823   -2.7741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n 10  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 11  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)Nc1ccc(cc1)S(=O)(=O)Cl",
          "formula": "C8H8ClNO3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "10e6ef47-01a4-414e-8550-f995c920aa08"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "233.6734",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bf62a9cc-865c-4344-beb9-a6ac4202167c",
      "version": "10",
      "structure": {
        "id": "3567a63b-3bc9-448b-9546-a2e85fbdad43",
        "molfile": "\n  Marvin  01132102512D          \n\n 14 14  0  0  0  0            999 V2000\n    8.4573   -3.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0449   -2.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2199   -2.8846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8074   -3.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9824   -3.5990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5700   -4.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9824   -5.0279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7450   -4.3135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2199   -4.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0449   -4.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2823   -3.5990    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2823   -4.4240    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2823   -2.7741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1073   -3.5990    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  2  0  0  0  0\n  9  4  1  0  0  0  0\n 10  9  2  0  0  0  0\n  1 10  1  0  0  0  0\n  1 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)Nc1ccc(cc1)S(=O)(=O)Cl",
        "formula": "C8H8ClNO3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "233.6734",
        "optical_activity": "NONE",
        "references": [
          "f074da4b-c54e-4440-92c5-372130d54b51",
          "26d3add6-ecae-4e8a-81df-4fd46500471c"
        ],
        "stereo_centers": 0
      },
      "unii": "LIX4M9AIVM"
    }
  ]
}