{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "399feac7-cf19-53ab-586d-f94c43169732",
          "code": "DTXSID20331585",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20331585",
          "code_system": "EPA CompTox",
          "references": [
            "11737561-1ab0-4918-f818-3780173c5a36"
          ]
        },
        {
          "uuid": "09560c1a-64f1-42a4-aa6f-f0d7725858fb",
          "code": "470-15-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=470-15-5",
          "code_system": "CAS",
          "references": [
            "e3026666-f909-1d39-fd88-11d3e49916e9"
          ]
        },
        {
          "uuid": "454c0994-ac7f-bc25-c8ea-66055ad054b6",
          "code": "441484",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441484",
          "code_system": "PUBCHEM",
          "references": [
            "cb7cd263-fc40-bab0-1530-d9488e9aba88"
          ]
        },
        {
          "uuid": "c7465375-ea58-455b-8449-f3c0ade633f5",
          "code": "LH7RF28TXF",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f4f025d8-b1dc-7478-5f29-50a2cb5c3fdf",
          "name": ".ALPHA.-L-SORBOPYRANOSE",
          "stdName": ".ALPHA.-L-SORBOPYRANOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3026666-f909-1d39-fd88-11d3e49916e9"
          ],
          "display_name": true
        },
        {
          "uuid": "a07f98a5-fa3a-995c-5dfd-e2b36bdc9d68",
          "name": ".ALPHA.-L-XYLO-HEXOPYRANOS-2-ULOSE",
          "stdName": ".ALPHA.-L-XYLO-HEXOPYRANOS-2-ULOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e3026666-f909-1d39-fd88-11d3e49916e9"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e3026666-f909-1d39-fd88-11d3e49916e9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cb7cd263-fc40-bab0-1530-d9488e9aba88",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "11737561-1ab0-4918-f818-3780173c5a36",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "00c302b4-6ef9-bd1c-697d-64c68a4f4e77",
          "id": "00c302b4-6ef9-bd1c-697d-64c68a4f4e77",
          "molfile": "\n  Marvin  01132100212D          \n\n 12 12  0  0  1  0            999 V2000\n   14.3717   -3.2451    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   13.6572   -2.8325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0861   -2.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8006   -3.2451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8006   -4.0701    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   16.0828   -4.8453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6131   -3.9268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8953   -3.1515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0861   -4.4825    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   15.0861   -5.3075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3717   -4.0701    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   13.6572   -4.4825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 11  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  9  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  6  0  0  0\nM  END",
          "smiles": "C1[C@@H]([C@H]([C@@H]([C@](CO)(O)O1)O)O)O",
          "formula": "C6H12O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2540a261-f7da-4242-a222-7b402518f73d"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "180.1561",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4b9887da-e92d-4500-b375-fd37811323d8",
      "version": "10",
      "structure": {
        "id": "38603ff8-4857-2e0a-70e6-f4f6ec0ae71f",
        "molfile": "Homoserine\n  Marvin  01132103002D          \n\n 12 12  0  0  1  0            999 V2000\n   16.8953   -3.1515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0828   -4.8453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0861   -5.3075    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0861   -4.4825    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.6572   -4.4825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3717   -4.0701    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.6572   -2.8325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3717   -3.2451    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   15.0861   -2.8325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8006   -3.2451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8006   -4.0701    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.6131   -3.9268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 12  1  1  0  0  0  0\n 11  2  1  1  0  0  0\n  4  3  1  1  0  0  0\n 11  4  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  5  1  6  0  0  0\n  6  8  1  0  0  0  0\n  8  7  1  1  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\nM  END",
        "smiles": "C1[C@@H]([C@H]([C@@H]([C@](CO)(O)O1)O)O)O",
        "formula": "C6H12O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "180.1561",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e3026666-f909-1d39-fd88-11d3e49916e9"
        ],
        "stereo_centers": 4
      },
      "unii": "LH7RF28TXF"
    }
  ]
}