{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f10dac60-f65d-4ea9-8ce6-9295bca3a4b1", "code": "57079-01-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=57079-01-3", "code_system": "CAS", "references": [ "81064ea2-9555-4911-b72b-368a9312795b", "da6fc0bf-21bc-47e0-9752-a4c34433a728" ] }, { "uuid": "655e98fa-171b-45f4-b055-b3ebab9181ae", "code": "4618600", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4618600", "code_system": "PUBCHEM", "references": [ "81064ea2-9555-4911-b72b-368a9312795b" ] }, { "uuid": "e8bfc976-0236-4044-9abb-2daa6146ff44", "code": "LG78EY7HVB", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "2cb4ff45-bf1f-5953-d9ae-f53a921e17cf", "code": "DTXSID50205689", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50205689", "code_system": "EPA CompTox", "references": [ "4e6f6667-e0f9-f52f-8a97-b091df27e2a9" ] } ], "relationships": [ { "uuid": "e3872052-e401-4eb8-9af4-4a3459888385", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "ccd493f5-4a84-4c5d-9839-d13137d08160", "refuuid": "19c3f6b5-2f40-4de1-91f3-3bed653992d9", "name": "AM-10", "unii": "LG78EY7HVB", "linking_id": "LG78EY7HVB", "ref_pname": "AM-10", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "fed4a25a-8058-4c8f-b199-fc7edab91a45", "name": "11-MALEIMIDOUNDECANOIC ACID", "stdName": "11-MALEIMIDOUNDECANOIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "89160d45-289e-41b1-80fa-622a1caadb81", "2154aea5-3e5d-4346-a3c7-9385097db0fa" ], "display_name": false }, { "uuid": "1206a930-ccc3-467a-a869-4f507d055742", "name": "1H-PYRROLE-1-UNDECANOIC ACID, 2,5-DIHYDRO-2,5-DIOXO-", "stdName": "1H-PYRROLE-1-UNDECANOIC ACID, 2,5-DIHYDRO-2,5-DIOXO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "89160d45-289e-41b1-80fa-622a1caadb81", "2154aea5-3e5d-4346-a3c7-9385097db0fa" ], "display_name": false }, { "uuid": "44941ecc-5fc5-4d3b-a08d-d29751865307", "name": "AM-10", "stdName": "AM-10", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "89160d45-289e-41b1-80fa-622a1caadb81", "2154aea5-3e5d-4346-a3c7-9385097db0fa" ], "display_name": true }, { "uuid": "4fd67240-f77a-46be-bb3b-f9e098178b2d", "name": "N-(10-CARBOXYDECYL)MALEIMIDE", "stdName": "N-(10-CARBOXYDECYL)MALEIMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "89160d45-289e-41b1-80fa-622a1caadb81", "2154aea5-3e5d-4346-a3c7-9385097db0fa" ], "display_name": false } ], "references": [ { "uuid": "89160d45-289e-41b1-80fa-622a1caadb81", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2154aea5-3e5d-4346-a3c7-9385097db0fa", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "81064ea2-9555-4911-b72b-368a9312795b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392207000, "tags": [ "NOMEN" ] }, { "uuid": "2bcb136a-7293-437a-aad5-c2635d591c4a", "citation": "SRS import [LG78EY7HVB]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=LG78EY7HVB", "doc_type": "SRS", "public_domain": true, "document_date": 1493392207000, "tags": [ "NOMEN" ] }, { "uuid": "4e6f6667-e0f9-f52f-8a97-b091df27e2a9", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=57079-01-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "da6fc0bf-21bc-47e0-9752-a4c34433a728", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "002a1ee6-8562-4ddb-9923-550a8fa666f7", "id": "002a1ee6-8562-4ddb-9923-550a8fa666f7", "molfile": "\n Marvin 01132100192D \n\n 20 20 0 0 0 0 999 V2000\n 4.2252 -1.3050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2252 -0.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9397 -0.0675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5107 -0.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7963 -0.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0818 -0.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3673 -0.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6529 -0.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0616 -0.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7761 -0.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4906 -0.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2050 -0.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9195 -0.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.6340 -0.0675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3876 -0.4031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5592 -1.2100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9397 0.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5272 0.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7202 0.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1071 1.3050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 19 1 0 0 0 0\n 15 16 2 0 0 0 0\n 17 15 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 2 0 0 0 0\nM END", "smiles": "C(CCCCCN1C(=O)C=CC1=O)CCCCC(=O)O", "formula": "C15H23NO4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c022cad0-28ed-496f-abca-5b24643f7164" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "281.348", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "19c3f6b5-2f40-4de1-91f3-3bed653992d9", "version": "3", "structure": { "id": "888e3ead-7339-47ef-854b-576a35de8ec5", "molfile": "\n Marvin 01132107052D \n\n 20 20 0 0 0 0 999 V2000\n -3.6340 -0.0675 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -3.7202 0.7530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5272 0.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.9397 0.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.3876 -0.4031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2252 -0.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5107 -0.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7963 -0.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0818 -0.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3673 -0.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6529 -0.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.0616 -0.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7761 -0.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.4906 -0.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2050 -0.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.9195 -0.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2252 -1.3050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9397 -0.0675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -4.5592 -1.2100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -3.1071 1.3050 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 1 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 6 17 2 0 0 0 0\n 6 18 1 0 0 0 0\n 1 16 1 0 0 0 0\n 5 19 2 0 0 0 0\n 2 20 2 0 0 0 0\nM END", "smiles": "C(CCCCCN1C(=O)C=CC1=O)CCCCC(=O)O", "formula": "C15H23NO4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "281.348", "optical_activity": "NONE", "references": [ "89160d45-289e-41b1-80fa-622a1caadb81", "2bcb136a-7293-437a-aad5-c2635d591c4a" ], "stereo_centers": 0 }, "unii": "LG78EY7HVB" } ] }