{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "086e09d3-7ed4-4e10-b1fa-afcb5879f5e3",
          "code": "159939-87-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=159939-87-4",
          "code_system": "CAS",
          "references": [
            "8efc92eb-c2ed-4c2b-804b-3008f2d295b3",
            "f3778005-05bc-490e-949a-20eb363c36fb"
          ]
        },
        {
          "uuid": "35af8d12-149e-4a89-b796-1ae541f8cd3d",
          "code": "178033",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/178033",
          "code_system": "PUBCHEM",
          "references": [
            "8efc92eb-c2ed-4c2b-804b-3008f2d295b3"
          ]
        },
        {
          "uuid": "7cf7dad1-b979-4071-94a1-1bb118095016",
          "code": "LG34LSI9IU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "aa63830b-6425-e5c2-6676-b345874d2699",
          "code": "140422",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:140422",
          "code_system": "CHEBI",
          "references": [
            "41316491-0428-a324-6ec2-1e06672bc869"
          ]
        },
        {
          "uuid": "5e37c10f-ad77-b0e3-6601-d2a8b79517c3",
          "code": "VR (nerve agent)",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/VR_(nerve_agent)",
          "code_system": "WIKIPEDIA",
          "references": [
            "9e51c9c1-cc4e-d03e-ad4a-4a72ad0f71a6"
          ]
        },
        {
          "uuid": "541cddf1-9d01-ee0d-baa6-10a366af268e",
          "code": "DTXSID10897226",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10897226",
          "code_system": "EPA CompTox",
          "references": [
            "41316491-0428-a324-6ec2-1e06672bc869"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "baefe85b-56a1-4203-a5e3-c0ce25fb8093",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "5100a57c-1988-44ee-8ef9-94d25efa02c2",
            "refuuid": "c4ec412c-c508-4acb-8da6-0be1ab68bcdc",
            "name": "VR",
            "unii": "LG34LSI9IU",
            "linking_id": "LG34LSI9IU",
            "ref_pname": "VR",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a5da8b8e-b5d6-4785-8924-a4d16440366d",
          "name": "PHOSPHONOTHIOIC ACID, P-METHYL-, S-(2-(DIETHYLAMINO)ETHYL) O-(2-METHYLPROPYL) ESTER",
          "stdName": "PHOSPHONOTHIOIC ACID, P-METHYL-, S-(2-(DIETHYLAMINO)ETHYL) O-(2-METHYLPROPYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "358418b7-36df-472c-982d-80d5480f771e",
            "cd8f3372-5037-451b-a99e-85169de50632"
          ],
          "display_name": false
        },
        {
          "uuid": "288a0f8c-060b-4796-985e-8fa9905b5b1d",
          "name": "R-33",
          "stdName": "R-33",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "358418b7-36df-472c-982d-80d5480f771e",
            "cd8f3372-5037-451b-a99e-85169de50632"
          ],
          "display_name": false
        },
        {
          "uuid": "657195c3-af47-4e65-bb16-2c2e5cfd393f",
          "name": "R-VX",
          "stdName": "R-VX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "358418b7-36df-472c-982d-80d5480f771e",
            "cd8f3372-5037-451b-a99e-85169de50632"
          ],
          "display_name": false
        },
        {
          "uuid": "8118aae4-0e50-4b32-8f80-19cb859a3c5b",
          "name": "RUSSIAN VX",
          "stdName": "RUSSIAN VX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "358418b7-36df-472c-982d-80d5480f771e",
            "cd8f3372-5037-451b-a99e-85169de50632"
          ],
          "display_name": false
        },
        {
          "uuid": "f4281532-8d22-49d0-b6d2-beb2270c99ff",
          "name": "VR",
          "stdName": "VR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5783d25-45b0-431d-b572-f19ec10389bf",
            "a3d511d4-8781-48bd-a197-bba9d5bb9121"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "a3d511d4-8781-48bd-a197-bba9d5bb9121",
          "citation": "CHEMID 2011 Drugportal",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f5783d25-45b0-431d-b572-f19ec10389bf",
          "citation": "DRUGPORTAL 2011",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd8f3372-5037-451b-a99e-85169de50632",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "358418b7-36df-472c-982d-80d5480f771e",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8efc92eb-c2ed-4c2b-804b-3008f2d295b3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391075000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de64a293-3139-443c-a466-adb27fa70ea3",
          "citation": "SRS import [LG34LSI9IU]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=LG34LSI9IU",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391075000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10865a0e-a9ab-46b4-a3b2-4472518f2e52",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3778005-05bc-490e-949a-20eb363c36fb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9e51c9c1-cc4e-d03e-ad4a-4a72ad0f71a6",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "41316491-0428-a324-6ec2-1e06672bc869",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "48c26370-3656-4a93-ab11-4b8498e59ddc",
          "id": "48c26370-3656-4a93-ab11-4b8498e59ddc",
          "molfile": "\n  Marvin  01132103492D          \n\n 16 15  0  0  0  0            999 V2000\n    5.0442    2.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6457    2.2086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8295    2.1949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4054    2.8987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5891    2.8836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4277    1.4717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6029    1.4560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2056    0.7355    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3759    0.7167    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5495    0.6989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3570    1.5470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3947   -0.1132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1162   -0.5108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1319   -1.3361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4287   -1.7601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8516   -1.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 11  2  0  0  0  0\n  9 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)CCSP(=O)(C)OCC(C)C",
          "formula": "C11H26NO2PS",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c547208b-a617-48dc-9cd2-c65b5e8ca36c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "267.3699",
          "optical_activity": "NONE",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c4ec412c-c508-4acb-8da6-0be1ab68bcdc",
      "version": "6",
      "structure": {
        "id": "dcabb8a2-b51a-4d0b-8ff1-dcd399cfc747",
        "molfile": "\n  Marvin  01132111272D          \n\n 16 15  0  0  0  0            999 V2000\n    0.5495    0.6989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3758    0.7167    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3569    1.5469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3946   -0.1132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2055    0.7355    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1161   -0.5108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1318   -1.3360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4286   -1.7600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8514   -1.7368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6027    1.4559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4275    1.4716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8293    2.1948    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6454    2.2085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0439    2.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4052    2.8985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5889    2.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  1  2  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  4  6  1  0  0  0  0\n 10 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 12 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 12 15  1  0  0  0  0\n 11 12  1  0  0  0  0\n  5 10  1  0  0  0  0\nM  END",
        "smiles": "CCN(CC)CCSP(=O)(C)OCC(C)C",
        "formula": "C11H26NO2PS",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "267.3699",
        "optical_activity": "( + / - )",
        "references": [
          "10865a0e-a9ab-46b4-a3b2-4472518f2e52",
          "de64a293-3139-443c-a466-adb27fa70ea3"
        ],
        "stereo_centers": 1
      },
      "unii": "LG34LSI9IU"
    }
  ]
}