{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "90fcc3a2-0c2f-4ec8-b5e7-715bd4788b08", "code": "399-76-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=399-76-8", "code_system": "CAS", "references": [ "05367ec2-4679-403b-9a98-d02cde7bd022", "bb369643-247f-4b02-ba71-5e1ff2df6f0b" ] }, { "uuid": "d475425a-ac7f-4c1f-a191-54b21953c14d", "code": "206-919-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.291", "code_system": "ECHA (EC/EINECS)", "references": [ "05367ec2-4679-403b-9a98-d02cde7bd022" ] }, { "uuid": "713cddd5-d7b7-49c2-bf07-d59e74371e11", "code": "1820", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1820", "code_system": "PUBCHEM", "references": [ "05367ec2-4679-403b-9a98-d02cde7bd022" ] }, { "uuid": "cdb541d9-fa32-23f3-e444-23b73953706e", "code": "DTXSID10192945", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10192945", "code_system": "EPA CompTox", "references": [ "7ad27f28-c565-1809-6aa0-508315e700ee" ] }, { "uuid": "d1ec4da4-3f0b-4689-a715-39f9beab13dd", "code": "LFV2Z936CQ", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "cffbc34b-8fac-48e3-bf30-8e0269ffdb7a", "name": "1H-Indole-2-carboxylic acid, 5-fluoro-", "stdName": "1H-INDOLE-2-CARBOXYLIC ACID, 5-FLUORO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bb369643-247f-4b02-ba71-5e1ff2df6f0b" ], "display_name": false }, { "uuid": "ed7b2698-3b90-4add-adfa-be663f0c616d", "name": "5-Fluoro-1H-indole-2-carboxylic acid", "stdName": "5-FLUORO-1H-INDOLE-2-CARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bb369643-247f-4b02-ba71-5e1ff2df6f0b" ], "display_name": false }, { "uuid": "a86bb459-9122-44b7-8d48-bc7c5520acc6", "name": "5-Fluoroindole-2-carboxylic acid", "stdName": "5-FLUOROINDOLE-2-CARBOXYLIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "67cabf5a-f618-4179-add3-1f4b8ed649c5", "7ae4d7a7-a265-4dc6-8b8e-527b6760bdb2" ], "display_name": true } ], "references": [ { "uuid": "67cabf5a-f618-4179-add3-1f4b8ed649c5", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7ae4d7a7-a265-4dc6-8b8e-527b6760bdb2", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "05367ec2-4679-403b-9a98-d02cde7bd022", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394032000, "tags": [ "NOMEN" ] }, { "uuid": "7ad27f28-c565-1809-6aa0-508315e700ee", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=399-76-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "bb369643-247f-4b02-ba71-5e1ff2df6f0b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "66645901-ea23-4563-96ce-f9583cb10dbf", "id": "66645901-ea23-4563-96ce-f9583cb10dbf", "molfile": "\n Marvin 01132105202D \n\n 13 14 0 0 0 0 999 V2000\n 3.1500 -13.5221 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5625 -14.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1500 -14.9510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3875 -14.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8724 -13.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6570 -13.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3715 -13.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0860 -13.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8004 -13.4116 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0860 -14.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3715 -15.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6570 -14.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8724 -14.9041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 4 5 2 0 0 0 0\n 13 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 12 2 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\nM END", "smiles": "c1cc2c(cc1F)cc(C(=O)O)[nH]2", "formula": "C9H6FNO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "0107d038-5c13-462e-9a2c-ddc6f48f9c48" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "179.1482", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "0d22387d-78a5-4df9-8a8f-6fe5ed19e71c", "version": "5", "structure": { "id": "2885462b-ace7-4e22-bafb-fd3d6f141320", "molfile": "\n Marvin 01132102132D \n\n 13 14 0 0 0 0 999 V2000\n 4.8724 -14.9041 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3875 -14.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8724 -13.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6570 -13.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3715 -13.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0860 -13.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0860 -14.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3715 -15.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6570 -14.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5625 -14.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1500 -13.5221 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1500 -14.9510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8004 -13.4116 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 1 9 1 0 0 0 0\n 4 9 2 0 0 0 0\n 10 11 2 0 0 0 0\n 10 12 1 0 0 0 0\n 2 10 1 0 0 0 0\n 6 13 1 0 0 0 0\nM END", "smiles": "c1cc2c(cc1F)cc(C(=O)O)[nH]2", "formula": "C9H6FNO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "179.1482", "optical_activity": "NONE", "references": [ "67cabf5a-f618-4179-add3-1f4b8ed649c5" ], "stereo_centers": 0 }, "unii": "LFV2Z936CQ" } ] }