{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ce52d595-aaed-4789-9220-b2aecfd68b34",
          "code": "2092-56-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2092-56-0",
          "code_system": "CAS",
          "references": [
            "13b7f73c-b1c0-4949-a8df-c293dd6a8937",
            "cd0c2ab0-5396-4300-8c75-2e1935b275a2"
          ]
        },
        {
          "uuid": "9acfe3a0-fe19-490e-a5f9-7e3b5b1143cd",
          "code": "C74553",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74553",
          "code_system": "NCI_THESAURUS",
          "references": [
            "13b7f73c-b1c0-4949-a8df-c293dd6a8937"
          ]
        },
        {
          "uuid": "94555e6e-5621-479c-9358-d6e09da23f2d",
          "code": "218-248-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.016.589",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "13b7f73c-b1c0-4949-a8df-c293dd6a8937"
          ]
        },
        {
          "uuid": "f5a97cd1-d542-eb9f-bb6c-2e2509f19b03",
          "code": "DTXSID6062173",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6062173",
          "code_system": "EPA CompTox",
          "references": [
            "e3a2d80e-799e-8e6b-9e6b-6bc80ffde75a"
          ]
        },
        {
          "uuid": "241fe5c2-3586-7cc3-29d0-92073a68fdf2",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8446839d-d5f3-6847-bd3b-b9769f46f482"
          ]
        },
        {
          "uuid": "5ba175a8-1539-40c8-9381-96a2ca505702",
          "code": "LD7P3TL2DQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "70271fc5-19eb-4e16-aaa5-fede0f871fde",
          "name": "5-CHLORO-2-((2-HYDROXY-1-NAPHTHALENYL)AZO)-4-METHYLBENZENESULFONIC ACID, MONOSODIUM SALT",
          "stdName": "5-CHLORO-2-((2-HYDROXY-1-NAPHTHALENYL)AZO)-4-METHYLBENZENESULFONIC ACID, MONOSODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61a001d1-35f3-4566-9bed-f498b647bbd2",
            "d8b02a33-446a-40b4-a707-ae6f27713226"
          ],
          "display_name": false
        },
        {
          "uuid": "7d84a45e-8102-4e0d-af1a-921261929e00",
          "name": "AKA203",
          "stdName": "AKA203",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "61a001d1-35f3-4566-9bed-f498b647bbd2",
            "e2e926a8-c448-4172-a931-2182182a0399",
            "d8b02a33-446a-40b4-a707-ae6f27713226"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b8055d8b-9799-406f-bb27-da59b1cf9402",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "1b2f2249-abe1-4f63-9a98-43cd31cbaf4c",
          "name": "BENZENESULFONIC ACID, 5-CHLORO-2-(2-(2-HYDROXY-1-NAPHTHALENYL)DIAZENYL)-4-METHYL-, SODIUM SALT (1:1)",
          "stdName": "BENZENESULFONIC ACID, 5-CHLORO-2-(2-(2-HYDROXY-1-NAPHTHALENYL)DIAZENYL)-4-METHYL-, SODIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8b02a33-446a-40b4-a707-ae6f27713226",
            "cbc3dda7-c1c8-49ce-a07d-ab408b8d6315"
          ],
          "display_name": false
        },
        {
          "uuid": "84a6d6b6-522d-49e9-be04-db700a3f898f",
          "name": "BRONZE ORANGE",
          "stdName": "BRONZE ORANGE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8b02a33-446a-40b4-a707-ae6f27713226",
            "9e10d060-2d97-455d-92c1-012f1c7ac0d6"
          ],
          "display_name": true
        },
        {
          "uuid": "e3531e31-8ec5-477f-ba48-8616b5ce7597",
          "name": "C.I. PIGMENT RED 53",
          "stdName": "C.I. PIGMENT RED 53",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f49d890f-dfa1-4ae5-b597-ec5075621e5a",
            "d8b02a33-446a-40b4-a707-ae6f27713226"
          ],
          "display_name": false
        },
        {
          "uuid": "4f59181a-a189-4470-be9a-61afddbdc694",
          "name": "D&C RED NO. 8 (DELISTED)",
          "stdName": "D&C RED NO. 8 (DELISTED)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8b02a33-446a-40b4-a707-ae6f27713226",
            "24a10ac1-8217-4242-85bf-58125e33f84c"
          ],
          "display_name": false
        },
        {
          "uuid": "f8186491-13ce-4cdd-83e5-6e08c8152ae6",
          "name": "PIGMENT RED 53",
          "stdName": "PIGMENT RED 53",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "aeaee16d-4ef8-489c-b1a6-a2c5cc6e2bd0",
            "61a001d1-35f3-4566-9bed-f498b647bbd2",
            "96812fcd-55b9-46a5-82e5-9b07dce36e40",
            "d8b02a33-446a-40b4-a707-ae6f27713226",
            "1acda3e5-7945-45c5-8259-15fc0075d54e"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3314ef39-b057-49a4-a11d-e54a47ca50ce",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "873f278f-640e-43d6-8658-170756a93842",
          "name": "RED NO. 203",
          "stdName": "RED NO. 203",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "96812fcd-55b9-46a5-82e5-9b07dce36e40",
            "d8b02a33-446a-40b4-a707-ae6f27713226"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3f3e7b46-a7ff-4512-91c5-8cea04e3ddbe",
          "citation": "ACD 8.0",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aeaee16d-4ef8-489c-b1a6-a2c5cc6e2bd0",
          "citation": "CTFA 2004",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61a001d1-35f3-4566-9bed-f498b647bbd2",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9e10d060-2d97-455d-92c1-012f1c7ac0d6",
          "citation": "HPA 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8b02a33-446a-40b4-a707-ae6f27713226",
          "citation": "HANDBOOK OF PHARMACEUTICAL ADDITIVES",
          "doc_type": "HANDBOOK OF PHARMACEUTICAL ADDITIVES",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "24a10ac1-8217-4242-85bf-58125e33f84c",
          "citation": "CFR",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cbc3dda7-c1c8-49ce-a07d-ab408b8d6315",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96812fcd-55b9-46a5-82e5-9b07dce36e40",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f49d890f-dfa1-4ae5-b597-ec5075621e5a",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13b7f73c-b1c0-4949-a8df-c293dd6a8937",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389949000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6aca8447-cb80-49e7-955c-8335bf42ff38",
          "citation": "SRS import [LD7P3TL2DQ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=LD7P3TL2DQ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389949000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f7f0181-5ed6-480c-b618-b17dcc763ce2",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2e926a8-c448-4172-a931-2182182a0399",
          "citation": "AKA203 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1acda3e5-7945-45c5-8259-15fc0075d54e",
          "citation": "PIGMENT RED 53 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e3a2d80e-799e-8e6b-9e6b-6bc80ffde75a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2092-56-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8446839d-d5f3-6847-bd3b-b9769f46f482",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "cd0c2ab0-5396-4300-8c75-2e1935b275a2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "57724bb9-c346-414e-80c7-9d926625d4a5",
          "id": "57724bb9-c346-414e-80c7-9d926625d4a5",
          "molfile": "\n  Marvin  01132104322D          \n\n  1  0  0  0  0  0            999 V2000\n   10.7939   -7.2043    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c3bb6c44-3b00-4bca-99f1-eb17ec61c07b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b3ac1a70-00cd-44b6-94e9-729d2a3ecc35",
          "id": "b3ac1a70-00cd-44b6-94e9-729d2a3ecc35",
          "molfile": "\n  Marvin  01132109182D          \n\n 25 27  0  0  0  0            999 V2000\n    3.7615   -4.3108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7677   -5.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5927   -5.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9989   -5.8646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1895   -5.8665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6703   -6.5850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8543   -6.5836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2737   -5.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2695   -5.0362    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.0981   -5.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5099   -6.5873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0923   -7.3070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4984   -8.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0850   -8.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2567   -8.7268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8501   -8.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2673   -7.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5854   -6.5749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7572   -6.5713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3505   -5.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5161   -5.8498    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.5792   -7.3889    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7664   -7.3794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5795   -8.2017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3952   -7.4014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 20  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n 18  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7 17  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 12 17  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 19 18  2  0  0  0  0\n 18 22  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n 22 25  2  0  0  0  0\nM  CHG  1   9  -1\nM  END",
          "smiles": "Cc1cc(c(cc1Cl)S(=O)(=O)O)/N=N/c2c3ccccc3ccc2[O-]",
          "formula": "C17H12ClN2O4S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1bded0e8-c639-4777-87ea-4fc33a8e7a5b"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "375.8078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "27d28b36-fa71-489d-af81-ae3f32ff4ebc",
      "version": "6",
      "structure": {
        "id": "c6440382-3c2c-49e5-a009-daf53c3b2cf4",
        "molfile": "\n  Marvin  01132110152D          \n\n 26 27  0  0  0  0            999 V2000\n   10.7939   -7.2043    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    4.5927   -5.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7677   -5.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3505   -5.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7572   -6.5713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5854   -6.5749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9989   -5.8646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5161   -5.8498    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.1895   -5.8665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7615   -4.3108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2737   -5.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8543   -6.5836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5099   -6.5873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0981   -5.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0923   -7.3070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2673   -7.2996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8501   -8.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2567   -8.7268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0850   -8.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4984   -8.0201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6703   -6.5850    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2695   -5.0362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5792   -7.3889    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7664   -7.3794    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.5795   -8.2017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3952   -7.4014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3 10  1  0  0  0  0\n  7  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 16  1  0  0  0  0\n  4  8  1  0  0  0  0\n 15 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 11  1  0  0  0  0\n  4  5  1  0  0  0  0\n 15 16  1  0  0  0  0\n  2  3  1  0  0  0  0\n 16 17  2  0  0  0  0\n  5  6  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 15  2  0  0  0  0\n 21 12  1  0  0  0  0\n 11 22  1  0  0  0  0\n  9 21  2  0  0  0  0\n  6 23  1  0  0  0  0\n  9  7  1  0  0  0  0\n  6  7  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  2  0  0  0  0\n 23 26  2  0  0  0  0\nM  CHG  2   1   1  24  -1\nM  END",
        "smiles": "Cc1cc(c(cc1Cl)S(=O)(=O)[O-])/N=N/c2c3ccccc3ccc2O.[Na+]",
        "formula": "C17H12ClN2O4S.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "398.7976",
        "optical_activity": "NONE",
        "references": [
          "6aca8447-cb80-49e7-955c-8335bf42ff38",
          "3f7f0181-5ed6-480c-b618-b17dcc763ce2"
        ],
        "stereo_centers": 0
      },
      "unii": "LD7P3TL2DQ"
    }
  ]
}