{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1bb4aeeb-e47b-44a0-804d-e66c7f87d775",
          "code": "869-06-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=869-06-7",
          "code_system": "CAS",
          "references": [
            "a1b45bc1-9a27-498f-901f-b0778dfa6389",
            "f5cd2a83-948f-4b87-a615-6bffdc1e2673"
          ]
        },
        {
          "uuid": "ec0514a3-deea-482c-afb9-37d92c643147",
          "code": "C87336",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87336",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a1b45bc1-9a27-498f-901f-b0778dfa6389"
          ]
        },
        {
          "uuid": "031aad45-8f1f-411d-9c0d-7b293cf9478e",
          "code": "24561-63-5",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=24561-63-5",
          "code_system": "CAS",
          "references": [
            "a1b45bc1-9a27-498f-901f-b0778dfa6389",
            "b9fe2223-e9b4-4600-8ad1-cfe53bde6d7b"
          ]
        },
        {
          "uuid": "02f6ff5e-a9d1-40d9-b980-729ce5326f85",
          "code": "MAGNESIUM MALATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Magnesium_malate",
          "code_system": "WIKIPEDIA",
          "references": [
            "a1b45bc1-9a27-498f-901f-b0778dfa6389"
          ]
        },
        {
          "uuid": "c4f1e0ba-8ff7-4aee-b1f9-224c849a88b3",
          "code": "212-784-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.623",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a1b45bc1-9a27-498f-901f-b0778dfa6389"
          ]
        },
        {
          "uuid": "21e86e7d-da4c-4e9f-8e49-f96d50338307",
          "code": "283578",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/283578/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a1b45bc1-9a27-498f-901f-b0778dfa6389"
          ]
        },
        {
          "uuid": "4351bc72-6376-46ee-8fa7-89e4d800e3f7",
          "code": "SUB22026",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a1b45bc1-9a27-498f-901f-b0778dfa6389"
          ]
        },
        {
          "uuid": "3d7ccd82-ae3a-497c-b5f4-4d10d113de84",
          "code": "164748",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/164748",
          "code_system": "PUBCHEM",
          "references": [
            "a1b45bc1-9a27-498f-901f-b0778dfa6389"
          ]
        },
        {
          "uuid": "3e55b5fd-fd29-804f-6839-34b83c94997c",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "667731e7-2e14-9ae3-5c2b-35f3585ed80d"
          ]
        },
        {
          "uuid": "afafc026-d1da-7928-624b-b2715efe2699",
          "code": "DB15555",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB15555",
          "code_system": "DRUG BANK",
          "references": [
            "667731e7-2e14-9ae3-5c2b-35f3585ed80d"
          ]
        },
        {
          "uuid": "e6d8a679-f146-4e91-92d6-f6c5e3c1f750",
          "code": "LA9X9UJA2Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e7cd79f0-04cc-70b7-89f1-024641425490",
          "code": "2466 (Number of products:54)",
          "comments": "Dietary Supplement Label Database|chemical|Magnesium Malate",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2466&item=Magnesium Malate",
          "code_system": "DSLD",
          "references": [
            "667731e7-2e14-9ae3-5c2b-35f3585ed80d"
          ]
        },
        {
          "uuid": "b83c669c-004f-0dff-0c7b-e647c9874087",
          "code": "DTXSID70893860",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70893860",
          "code_system": "EPA CompTox",
          "references": [
            "667731e7-2e14-9ae3-5c2b-35f3585ed80d"
          ]
        },
        {
          "uuid": "a39693a1-e8bf-5f35-2732-0e7e22db7918",
          "code": "LA9X9UJA2Z",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=LA9X9UJA2Z",
          "code_system": "DAILYMED",
          "references": [
            "83744258-12d1-3858-cf1c-9ed95de078e9"
          ]
        },
        {
          "uuid": "09e84155-f4b5-a7d9-290b-658bf87b81e9",
          "code": "100000088911",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "b88ff40e-d78a-1a0c-d998-14a7692ee2d1"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "07650ddd-53d8-4c7e-b6fc-8e7eeb6a511b",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "7581a07f-2963-4bb1-bb2c-584ff6942f18",
            "refuuid": "66b2f71b-ed33-477e-a787-234966de5e31",
            "name": "MAGNESIUM CATION",
            "unii": "T6V3LHY838",
            "linking_id": "T6V3LHY838",
            "ref_pname": "MAGNESIUM CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9bba6f3d-2340-472e-a499-b05e1ded8e3a",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "79c5d186-ccd2-4d9b-8a4c-50c13d1a63e0",
            "refuuid": "0901faae-ac67-4048-a1e2-e194321ea9dd",
            "name": "Malic acid",
            "unii": "817L1N4CKP",
            "linking_id": "817L1N4CKP",
            "ref_pname": "Malic acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0f83ff7f-0129-4ecf-a4b9-4a54bfecf87a",
          "name": "(±)-MAGNESIUM MALATE",
          "stdName": "(+/-)-MAGNESIUM MALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "28107f29-b66f-4da3-a6d3-ca95bad45bf8",
            "ff8ab8d8-2325-4551-a202-9ad2fb93daeb"
          ],
          "display_name": false
        },
        {
          "uuid": "6db7ea83-bb0e-48cf-b954-a240e34ad914",
          "name": "BUTANEDIOIC ACID, 2-HYDROXY-, MAGNESIUM SALT (1:1)",
          "stdName": "BUTANEDIOIC ACID, 2-HYDROXY-, MAGNESIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ced9e01-ab44-4531-9ce3-af990b37edf7",
            "28107f29-b66f-4da3-a6d3-ca95bad45bf8"
          ],
          "display_name": false
        },
        {
          "uuid": "68837d11-07ab-4a0c-a8dd-5fa60629cd37",
          "name": "MAGNESIUM MALATE",
          "stdName": "MAGNESIUM MALATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e579d8b0-0c6d-4996-be94-7dd6456e9f38",
            "2ced9e01-ab44-4531-9ce3-af990b37edf7",
            "28107f29-b66f-4da3-a6d3-ca95bad45bf8",
            "65044d9b-42d2-46da-80e4-c3975b44dbdc"
          ],
          "display_name": true
        },
        {
          "uuid": "0d1ae3f8-12bd-4070-936a-d4c753d566c1",
          "name": "MAGNESIUM MALATE, (±)-",
          "stdName": "MAGNESIUM MALATE, (+/-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "28107f29-b66f-4da3-a6d3-ca95bad45bf8",
            "ff8ab8d8-2325-4551-a202-9ad2fb93daeb"
          ],
          "display_name": false
        },
        {
          "uuid": "1a5c73b4-662e-bc9f-069e-6afef45af0cf",
          "name": "Magnesium malate [WHO-DD]",
          "stdName": "MAGNESIUM MALATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "659d479d-5b82-5880-9ab9-4f56e18ec487"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2ced9e01-ab44-4531-9ce3-af990b37edf7",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "28107f29-b66f-4da3-a6d3-ca95bad45bf8",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff8ab8d8-2325-4551-a202-9ad2fb93daeb",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e579d8b0-0c6d-4996-be94-7dd6456e9f38",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1b45bc1-9a27-498f-901f-b0778dfa6389",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390834000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1155dd16-dba7-4eed-a948-a3761624142b",
          "citation": "SRS import [LA9X9UJA2Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=LA9X9UJA2Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390834000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65044d9b-42d2-46da-80e4-c3975b44dbdc",
          "citation": "MAGNESIUM MALATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "667731e7-2e14-9ae3-5c2b-35f3585ed80d",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f5cd2a83-948f-4b87-a615-6bffdc1e2673",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b9fe2223-e9b4-4600-8ad1-cfe53bde6d7b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "659d479d-5b82-5880-9ab9-4f56e18ec487",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "83744258-12d1-3858-cf1c-9ed95de078e9",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "b88ff40e-d78a-1a0c-d998-14a7692ee2d1",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ff057866-f0d1-44db-8049-1179df28b3fb",
          "id": "ff057866-f0d1-44db-8049-1179df28b3fb",
          "molfile": "\n  Marvin  01132113122D          \n\n  1  0  0  0  0  0            999 V2000\n   -0.9102   -1.0313    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Mg+2]",
          "formula": "Mg",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1e4f1708-c591-4a52-9288-73e62a255b3f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "24.3051",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "5101cd9f-f826-4893-9940-6b7a4e43b4e6",
          "id": "5101cd9f-f826-4893-9940-6b7a4e43b4e6",
          "molfile": "\n  Marvin  01132104132D          \n\n  9  8  0  0  0  0            999 V2000\n   -2.8517   -2.4718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1377   -2.0585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1419   -1.2317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4237   -2.4676    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -1.4280   -3.2943    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.7098   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0042   -2.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7182   -2.0500    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.2901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\nM  CHG  2   5  -1   8  -1\nM  END",
          "smiles": "C(C(C(=O)O)[O-])C(=O)[O-]",
          "formula": "C4H4O5",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "933b6f71-1099-4094-9982-da998bc26927"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "132.0717",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "eff52d24-09c0-4719-861f-04c8a923bcaa",
      "version": "10",
      "structure": {
        "id": "f7c68d6a-821c-407d-b413-5189b40870f6",
        "molfile": "\n  Marvin  01132112512D          \n\n 10  8  0  0  0  0            999 V2000\n   -2.8517   -2.4718    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.1377   -2.0585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4237   -2.4676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7098   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0042   -2.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7182   -2.0500    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.1419   -1.2317    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.2901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4280   -3.2943    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9102   -1.0313    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  2  0  0  0  0\n  5  8  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  9  1  0  0  0  0\n  1  2  1  0  0  0  0\nM  CHG  3   1  -1   6  -1  10   2\nM  END",
        "smiles": "C(C(C(=O)[O-])O)C(=O)[O-].[Mg+2]",
        "formula": "C4H4O5.Mg",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "156.3768",
        "optical_activity": "( + / - )",
        "references": [
          "2ced9e01-ab44-4531-9ce3-af990b37edf7",
          "1155dd16-dba7-4eed-a948-a3761624142b"
        ],
        "stereo_centers": 1
      },
      "unii": "LA9X9UJA2Z"
    }
  ]
}