{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "eba2be5a-c95f-4a72-98dc-f17156512fd2",
          "code": "59708-52-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=59708-52-0",
          "code_system": "CAS",
          "references": [
            "58da9031-5af2-4183-9d24-fb165d50984a",
            "41b677bc-7e10-4a9a-b85e-31352ddc5473"
          ]
        },
        {
          "uuid": "9866bc06-ec13-4b9c-9729-45b0f1ef017f",
          "code": "C80574",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80574",
          "code_system": "NCI_THESAURUS",
          "references": [
            "58da9031-5af2-4183-9d24-fb165d50984a"
          ]
        },
        {
          "uuid": "5e2e63bf-a9f4-41ac-9213-5f50f7b5841a",
          "code": "C017114",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67017114",
          "code_system": "MESH",
          "references": [
            "58da9031-5af2-4183-9d24-fb165d50984a"
          ]
        },
        {
          "uuid": "107dfab1-2137-43e8-afab-fa9ca877c724",
          "code": "SUB06626MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "58da9031-5af2-4183-9d24-fb165d50984a"
          ]
        },
        {
          "uuid": "a82a5e8b-ab1e-423a-900a-fddd8766033e",
          "code": "4430",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4430",
          "code_system": "INN",
          "references": [
            "58da9031-5af2-4183-9d24-fb165d50984a"
          ]
        },
        {
          "uuid": "01fe5a65-663a-4997-93f4-965725e61569",
          "code": "9743",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.12 Schedule II.|Opiates",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "58da9031-5af2-4183-9d24-fb165d50984a"
          ]
        },
        {
          "uuid": "a15a054f-a945-49c7-b3c2-b22074cfada5",
          "code": "CHEMBL290429",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL290429",
          "code_system": "ChEMBL",
          "references": [
            "58da9031-5af2-4183-9d24-fb165d50984a"
          ]
        },
        {
          "uuid": "f0d9ca05-a663-4079-ab4a-d63c3ef4fc2d",
          "code": "CARFENTANIL",
          "type": "PRIMARY",
          "url": "https://www.revolvy.com/topic/Carfentanil&item_type=topic",
          "code_system": "WEB RESOURCE",
          "references": [
            "58da9031-5af2-4183-9d24-fb165d50984a"
          ]
        },
        {
          "uuid": "91c2b6a7-7d39-47e5-a6d7-506e431e07a3",
          "code": "62156",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/62156",
          "code_system": "PUBCHEM",
          "references": [
            "58da9031-5af2-4183-9d24-fb165d50984a"
          ]
        },
        {
          "uuid": "1784b95a-07ee-4447-a045-d85d8f178c38",
          "code": "CARFENTANIL",
          "comments": "Side effects of carfentanil are similar to those of fentanyl, which include itching, nausea and respiratory depression, which can be life-threatening. Fentanyl analogs have killed hundreds of people throughout Europe and the former Soviet republics since the most recent resurgence in use began in Estonia in the early 2000s, and novel derivatives continue to appear. Carfentanil is classified as Schedule II under the Controlled Substances Act in the United States with a DEA ACSCN of 9743 and a 2016 annual aggregate manufacturing quota of 19 grams. In 2016, carfentanil was identified as an additive in heroin sold in Ohio, leading to a spike in the number of overdose cases.",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Carfentanil",
          "code_system": "WIKIPEDIA",
          "references": [
            "58da9031-5af2-4183-9d24-fb165d50984a"
          ]
        },
        {
          "uuid": "d48efc68-3da3-4aa5-f367-8ab0c68ee386",
          "code": "DTXSID40208427",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40208427",
          "code_system": "EPA CompTox",
          "references": [
            "1a725bee-29ea-a5f2-3def-2e4a8d1482c6"
          ]
        },
        {
          "uuid": "b022df0b-fbd5-ba57-3b21-20c6bc82aee8",
          "code": "C67413",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Opioid Receptor Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C67413",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f8980e51-30ff-904d-8c39-ab0eee7a2c7b"
          ]
        },
        {
          "uuid": "6cdf7cdf-a226-4a72-ac89-caad974cb5e6",
          "code": "List_of_fentanyl_analogues",
          "comments": "WIKIPEDIA|FENTANYL ANALOGUES",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_fentanyl_analogues",
          "code_system": "WIKIPEDIA"
        },
        {
          "uuid": "974f6c7f-3479-4cef-a6e2-5a066604ecab",
          "code": "LA9DTA2L8F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1320d64c-4958-44a9-93cd-69df212542ac",
          "code": "DB01535",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01535",
          "code_system": "DRUG BANK",
          "references": [
            "f8980e51-30ff-904d-8c39-ab0eee7a2c7b"
          ]
        },
        {
          "uuid": "9a33db51-2eef-5e31-696b-2ca09f91ac22",
          "code": "61084",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:61084",
          "code_system": "CHEBI",
          "references": [
            "f8980e51-30ff-904d-8c39-ab0eee7a2c7b"
          ]
        },
        {
          "uuid": "2ce75796-4cd7-c15a-9520-8a5a2fd6f394",
          "code": "100000084592",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "cc28fe4a-4118-4462-faa4-fddac79eb229"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "dcfb7ab8-22ad-449a-816c-ce92cd1e86d8",
          "amount": {
            "uuid": "c7b87534-4778-4b64-8936-4dd9dc2f2114"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "25101e89-7b46-4d68-a3fb-ae4e398f7932",
            "refuuid": "51d86dfe-80bd-4ab2-a0cd-09cd28dc2843",
            "name": "Carfentanil",
            "unii": "LA9DTA2L8F",
            "linking_id": "LA9DTA2L8F",
            "ref_pname": "Carfentanil",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d61476cd-2054-4331-ab71-709d9efb1325",
          "amount": {
            "uuid": "b606be09-7022-4e32-8aaf-23dde9505bb4"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "716f393f-3d6b-464d-aea5-5fbf1de98d0a",
            "refuuid": "776b109f-dc18-4a46-b1fb-7d22e7453bc9",
            "name": "CARFENTANIL CITRATE",
            "unii": "7LG286J8GV",
            "linking_id": "7LG286J8GV",
            "ref_pname": "CARFENTANIL CITRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5e259656-ff0f-4d69-af5c-91e233489dcc",
          "amount": {
            "uuid": "274dac67-be5e-4ca2-8160-590ae9aa1507",
            "average": 0.19,
            "high": 0.2,
            "low": 0.18,
            "units": "NANOMOLAR"
          },
          "comments": "IC50 of Fentanyl= 1.23 NM",
          "qualification": "IC50",
          "type": "TARGET->AGONIST",
          "references": [
            "9893548a-f4a2-4b33-ac63-72f4104edc01"
          ],
          "related_substance": {
            "uuid": "20be01c3-71d3-404d-9c2d-7a5a18020b38",
            "refuuid": "39262e4f-d963-4b83-9b34-52fd55036f0e",
            "name": "MU-TYPE OPIOID RECEPTOR",
            "unii": "1PE72K8X46",
            "linking_id": "1PE72K8X46",
            "ref_pname": "MU-TYPE OPIOID RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ddc07561-31ba-4d9e-970e-3f6d2a69a29e",
          "amount": {
            "uuid": "28960679-091c-42fb-9bb5-a2680ea2060d"
          },
          "comments": "More active than Carfentanil.  ",
          "type": "METABOLITE ACTIVE->PARENT",
          "interaction_type": "MINOR",
          "related_substance": {
            "uuid": "efffa43f-a788-4202-865b-c32de8fb1831",
            "refuuid": "6adc9e30-e0e0-41be-89db-6d24aab0b6ed",
            "name": "Ortho-hydroxycarfentanil",
            "unii": "E2G5LHA2KZ",
            "linking_id": "E2G5LHA2KZ",
            "ref_pname": "Ortho-hydroxycarfentanil",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d6eeced3-0609-4c82-b30b-ef1803db8693",
          "amount": {
            "uuid": "dc78278e-0fb8-44b8-8560-3251c48d075a",
            "units": "%"
          },
          "comments": "Liver microsomes many CYP Enzymes catalyze reaction.",
          "type": "METABOLITE ACTIVE->PARENT",
          "mediator_substance": {
            "uuid": "2c955a55-4145-4322-b116-bb5867099502",
            "refuuid": "067f0cda-3bfe-4af9-ba1e-dcd127c8a228",
            "name": "CYTOCHROME P450 3A5",
            "unii": "805SU96HKF",
            "linking_id": "805SU96HKF",
            "ref_pname": "CYTOCHROME P450 3A5",
            "substance_class": "reference"
          },
          "references": [
            "3ce9fa26-25af-4b0a-8624-97a62aa6fe8e"
          ],
          "related_substance": {
            "uuid": "b80391af-68fa-4ab7-9fb6-a794af8ba2fc",
            "refuuid": "70e61922-86be-49ce-931e-fc3b701482a2",
            "name": "β-keto-Carfentanil",
            "unii": "4WDU6UFD98",
            "linking_id": "4WDU6UFD98",
            "ref_pname": "β-keto-Carfentanil",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c2ae434f-7570-4f55-952f-5567c1cbd207",
          "amount": {
            "uuid": "9db5ef3b-13ac-4b43-a0bf-21916afdf2f9"
          },
          "type": "METABOLITE INACTIVE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "7882691d-2069-4a6e-80eb-bbdfb8bb6604"
          ],
          "related_substance": {
            "uuid": "33c63178-f527-4e55-9835-c1cca4ce3ba8",
            "refuuid": "ce662a6d-e44b-42a9-bcd1-9a3aa4e79cb4",
            "name": "NORCARFENTANIL",
            "unii": "OH8N7NE9ZG",
            "linking_id": "OH8N7NE9ZG",
            "ref_pname": "NORCARFENTANIL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "eae372b9-baf1-42ee-8e82-091502bad072",
          "amount": {
            "uuid": "895146f3-462b-4f6c-a4e7-babef98da505",
            "average": 12,
            "units": "%"
          },
          "comments": "Liver microsomes many CYP Enzymes catalyze reaction.",
          "type": "METABOLITE ACTIVE->PARENT",
          "interaction_type": "MAJOR",
          "mediator_substance": {
            "uuid": "73108404-4a27-4b47-aa98-f9a3bf6cfb15",
            "refuuid": "067f0cda-3bfe-4af9-ba1e-dcd127c8a228",
            "name": "CYTOCHROME P450 3A5",
            "unii": "805SU96HKF",
            "linking_id": "805SU96HKF",
            "ref_pname": "CYTOCHROME P450 3A5",
            "substance_class": "reference"
          },
          "references": [
            "74ce35de-62ea-41c6-a277-ed6eceaf25e8"
          ],
          "related_substance": {
            "uuid": "1bef4e34-0086-4d97-8776-50a153726d11",
            "refuuid": "fac6cc6a-c942-48e9-873a-215cc7e642b8",
            "name": "β-hydroxy-Carfentanil",
            "unii": "79P5284592",
            "linking_id": "79P5284592",
            "ref_pname": "β-hydroxy-Carfentanil",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "76747952-49fa-45d2-a35c-3cb17783b5b8",
          "name": "(4-CARBOMETHOXY FENTANYL)",
          "stdName": "(4-CARBOMETHOXY FENTANYL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1a41e8a-47bc-4b4f-ba31-5d05c82fc54c",
            "560fc73b-b6e3-47fd-9a42-a7c130c8ae2a"
          ],
          "display_name": false
        },
        {
          "uuid": "df2f2f21-2ab5-47bb-89b6-667a783e76db",
          "name": "4-CARBOMETHOXYFENTANYL",
          "stdName": "4-CARBOMETHOXYFENTANYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd69618a-86b5-4d44-be58-b0e0c12de45f",
            "a1a41e8a-47bc-4b4f-ba31-5d05c82fc54c"
          ],
          "display_name": false
        },
        {
          "uuid": "ab9cd2ee-2327-4205-aa37-a9f6d1ea19dc",
          "name": "4-PIPERIDINECARBOXYLIC ACID, 4-((1-OXOPROPYL)PHENYLAMINO)-1-(2-PHENYLETHYL)-, METHYL ESTER",
          "stdName": "4-PIPERIDINECARBOXYLIC ACID, 4-((1-OXOPROPYL)PHENYLAMINO)-1-(2-PHENYLETHYL)-, METHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aae28b36-974c-4f4a-b024-8d220f4f9f5c"
          ],
          "display_name": false
        },
        {
          "uuid": "563ac0ac-c5a1-47f8-9973-e6efa88b0f5b",
          "name": "CARFENTANYL",
          "stdName": "CARFENTANYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1a41e8a-47bc-4b4f-ba31-5d05c82fc54c",
            "2a9de5d0-5450-4a49-ad4b-23a45cf039e2"
          ],
          "display_name": false
        },
        {
          "uuid": "a62ada63-e967-49b4-830e-6c8791f7f568",
          "name": "Carfentanil",
          "stdName": "CARFENTANIL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aae28b36-974c-4f4a-b024-8d220f4f9f5c",
            "8ae11239-4740-4caf-ab95-b7727de86ea4",
            "cbb5f81c-07f4-4d7f-b121-50531f248ed5"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "c67a1cce-9245-4733-9793-57d40417724b",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "ec360a82-9ef2-48a3-ba38-9d90f0964b68",
          "name": "METHYL 1-PHENETHYL-4-(N-PHENYLPROPIONAMIDO)ISONIPECOTATE",
          "stdName": "METHYL 1-PHENETHYL-4-(N-PHENYLPROPIONAMIDO)ISONIPECOTATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aae28b36-974c-4f4a-b024-8d220f4f9f5c"
          ],
          "display_name": false
        },
        {
          "uuid": "3d94228a-00ac-478b-bc69-8191a3da0044",
          "name": "R 31833",
          "stdName": "R 31833",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1a41e8a-47bc-4b4f-ba31-5d05c82fc54c",
            "2a9de5d0-5450-4a49-ad4b-23a45cf039e2"
          ],
          "display_name": false
        },
        {
          "uuid": "9db1584d-45c2-4ad2-b9a2-869c9ebb86cf",
          "name": "carfentanil [INN]",
          "stdName": "CARFENTANIL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbb5f81c-07f4-4d7f-b121-50531f248ed5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "141638bd-8e40-4de7-a4dc-7cc235933ef6",
          "citation": "SRS import [LA9DTA2L8F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=LA9DTA2L8F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390768000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ae11239-4740-4caf-ab95-b7727de86ea4",
          "citation": "CARFENTANIL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aae28b36-974c-4f4a-b024-8d220f4f9f5c",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cbb5f81c-07f4-4d7f-b121-50531f248ed5",
          "citation": "INN Proposed List 39",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL39.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2a9de5d0-5450-4a49-ad4b-23a45cf039e2",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1a41e8a-47bc-4b4f-ba31-5d05c82fc54c",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd69618a-86b5-4d44-be58-b0e0c12de45f",
          "citation": "https://www.revolvy.com/topic/Carfentanil&item_type=topic",
          "url": "https://www.revolvy.com/topic/Carfentanil&item_type=topic",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "560fc73b-b6e3-47fd-9a42-a7c130c8ae2a",
          "citation": "Current Medicinal Chemistry, 2009, 16(19), pp-2468-2474",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58da9031-5af2-4183-9d24-fb165d50984a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390768000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a725bee-29ea-a5f2-3def-2e4a8d1482c6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=59708-52-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f8980e51-30ff-904d-8c39-ab0eee7a2c7b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "41b677bc-7e10-4a9a-b85e-31352ddc5473",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "74ce35de-62ea-41c6-a277-ed6eceaf25e8",
          "citation": "Kong, Li, and Andrew J. Walz. \"Identification of human cytochrome P450 isozymes involved in the oxidative metabolism of carfentanil.\" Toxicology Letters 343 (2021): 28-33.",
          "url": "https://www.sciencedirect.com/science/article/pii/S0378427421000631",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "3ce9fa26-25af-4b0a-8624-97a62aa6fe8e",
          "citation": "Kong, Li, and Andrew J. Walz. \"Identification of human cytochrome P450 isozymes involved in the oxidative metabolism of carfentanil.\" Toxicology Letters 343 (2021): 28-33.",
          "url": "https://www.sciencedirect.com/science/article/pii/S0378427421000631",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "d8b1837e-f1a8-4c22-b338-4e8c8f9b9a57",
          "citation": "Hsu, Fu-Lian, et al. \"Synthesis and μ-opioid activity of the primary metabolites of carfentanil.\" ACS Medicinal Chemistry Letters 10.11 (2019): 1568-1572.",
          "url": "https://www.ncbi.nlm.nih.gov/pmc/articles/PMC6862335/",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "7882691d-2069-4a6e-80eb-bbdfb8bb6604",
          "citation": "Hsu, Fu-Lian, et al. \"Synthesis and μ-opioid activity of the primary metabolites of carfentanil.\" ACS Medicinal Chemistry Letters 10.11 (2019): 1568-1572.",
          "url": "https://www.ncbi.nlm.nih.gov/pmc/articles/PMC6862335/",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "9893548a-f4a2-4b33-ac63-72f4104edc01",
          "citation": "Lipiński, Piotr FJ, et al. \"Fentanyl family at the mu-opioid receptor: uniform assessment of binding and computational analysis.\" Molecules 24.4 (2019): 740.",
          "url": "https://www.mdpi.com/1420-3049/24/4/740",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "2d539c40-01ab-4cc1-8f40-51d044f3d4db",
          "citation": "Kong, Li, and Andrew J. Walz. \"Identification of human cytochrome P450 isozymes involved in the oxidative metabolism of carfentanil.\" Toxicology Letters 343 (2021): 28-33.",
          "url": "https://www.sciencedirect.com/science/article/pii/S0378427421000631",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "cc28fe4a-4118-4462-faa4-fddac79eb229",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9ed3c84b-6155-419e-b11c-0c771e746bc1",
          "id": "9ed3c84b-6155-419e-b11c-0c771e746bc1",
          "molfile": "\n  Marvin  01132108152D          \n\n 29 31  0  0  0  0            999 V2000\n    3.5199   -0.2606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6952   -0.2606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2811    0.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8487    1.1316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4743    0.4533    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2566    1.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4784    1.4922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2891    2.2918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8674    2.8523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6707    2.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8635    1.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8925   -0.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4570    0.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3892    0.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7747   -0.1321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6207   -0.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0313   -0.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9059   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3414   -1.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.1267   -1.5386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5159   -0.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.1089   -0.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2593   -0.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3641   -0.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4784   -0.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4279   -1.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5167   -1.0816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8853   -2.0170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5315   -2.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  1  0  0  0  0\n 12  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 11  2  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 25  1  0  0  0  0\n 12 26  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 24 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 23  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 27  2  0  0  0  0\n 26 28  1  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
          "smiles": "CCC(=O)N(c1ccccc1)C2(CCN(CCc3ccccc3)CC2)C(=O)OC",
          "formula": "C24H30N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ff3a1026-59f9-4a62-ac87-a500fa9c55dc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "394.5075",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "51d86dfe-80bd-4ab2-a0cd-09cd28dc2843",
      "version": "17",
      "structure": {
        "id": "52e70f73-da13-47ed-ab21-9f415ff075e9",
        "molfile": "\n  Marvin  01132104192D          \n\n 29 31  0  0  0  0            999 V2000\n    0.8925   -0.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4743    0.4533    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4570    0.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4784   -0.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4279   -1.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2566    1.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2811    0.4533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3892    0.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3641   -0.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8853   -2.0170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5167   -1.0816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4784    1.4922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8635    1.8349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6952   -0.2606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8487    1.1316    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7747   -0.1321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5315   -2.8916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2891    2.2918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6707    2.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5199   -0.2606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6207   -0.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8674    2.8523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0313   -0.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9059   -0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3414   -1.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2593   -0.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.1267   -1.5386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.1089   -0.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.5159   -0.8425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  4  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n  5 11  2  0  0  0  0\n  6 12  1  0  0  0  0\n  6 13  2  0  0  0  0\n  7 14  1  0  0  0  0\n  7 15  2  0  0  0  0\n  8 16  1  0  0  0  0\n 10 17  1  0  0  0  0\n 12 18  2  0  0  0  0\n 13 19  1  0  0  0  0\n 14 20  1  0  0  0  0\n 16 21  1  0  0  0  0\n 18 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\n 25 27  2  0  0  0  0\n 26 28  1  0  0  0  0\n 27 29  1  0  0  0  0\n  9 16  1  0  0  0  0\n 19 22  2  0  0  0  0\n 28 29  2  0  0  0  0\nM  END",
        "smiles": "CCC(=O)N(c1ccccc1)C2(CCN(CCc3ccccc3)CC2)C(=O)OC",
        "formula": "C24H30N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "394.5075",
        "optical_activity": "NONE",
        "references": [
          "141638bd-8e40-4de7-a4dc-7cc235933ef6",
          "aae28b36-974c-4f4a-b024-8d220f4f9f5c",
          "cbb5f81c-07f4-4d7f-b121-50531f248ed5"
        ],
        "stereo_centers": 0
      },
      "unii": "LA9DTA2L8F"
    }
  ]
}