{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "43b363f0-0efa-4c51-95c9-6ccc041d1467",
          "code": "1112937-64-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1112937-64-0",
          "code_system": "CAS",
          "references": [
            "1feaaf45-1d57-45db-878d-11dd415fc137",
            "2cd90d7b-ca13-4779-93bd-59f97e8558bf"
          ]
        },
        {
          "uuid": "41c2acff-18b4-41e7-8c59-5d765eff6494",
          "code": "ETHYLONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ethylone",
          "code_system": "WIKIPEDIA",
          "references": [
            "1feaaf45-1d57-45db-878d-11dd415fc137"
          ]
        },
        {
          "uuid": "1bf511c0-8b32-4c12-bd8e-769359d6b9d1",
          "code": "SUB179033",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "1feaaf45-1d57-45db-878d-11dd415fc137"
          ]
        },
        {
          "uuid": "0baf1a5d-8880-4ba2-ba08-f515c8005b98",
          "code": "57252245",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/57252245",
          "code_system": "PUBCHEM",
          "references": [
            "1feaaf45-1d57-45db-878d-11dd415fc137"
          ]
        },
        {
          "uuid": "712bd664-1a9d-4578-8313-835671afd942",
          "code": "7547",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I. |Hallucinogenic substances",
          "type": "PRIMARY",
          "url": "https://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "c3a87262-9c2f-41b4-9473-9b1c10ff8059"
          ]
        },
        {
          "uuid": "e0e7de6c-32aa-4199-9601-c698be244b2a",
          "code": "L91C78FW96",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2ac6258e-d593-78c5-a574-77340cc00dba",
          "code": "Designer-drugs-Ethylone",
          "comments": "Wikipedia|List of designer drugs|Empathogens|MDxx (Substituted methylenedioxyphenethylamines)",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "cdccbe3f-a0ee-7231-f4c1-fa369aafa3e6"
          ]
        },
        {
          "uuid": "2ce847ab-f8d5-a7e9-1a28-f838bf215591",
          "code": "100000164556",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "baf963f3-f41f-b1c3-09ff-10e96d364a8d"
          ]
        },
        {
          "uuid": "d313e16e-dde9-de9f-cc88-7c24509f4732",
          "code": "DTXSID20894842",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20894842",
          "code_system": "EPA CompTox",
          "references": [
            "cdccbe3f-a0ee-7231-f4c1-fa369aafa3e6"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "dea229b0-2e43-40bb-a2cc-5eda5d8351b9",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3c450d8f-7b85-4668-91d2-a3453d1d92ef",
            "refuuid": "0e599e5e-1390-4767-899f-299689b4ba61",
            "name": "ETHYLONE",
            "unii": "L91C78FW96",
            "linking_id": "L91C78FW96",
            "ref_pname": "ETHYLONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1f80356a-c966-437d-b389-b933b2ff468b",
          "comments": "abuser A: 0.28 (0.23, after hydrolysis) mcg/mL; abuser B: not quantitated",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VIVO",
          "references": [
            "796103b8-0f7c-465f-8ca4-1c91a9eec4b3"
          ],
          "related_substance": {
            "uuid": "80cc31d3-cce5-49ef-81f0-bf386fd5f63d",
            "refuuid": "18bdfb4c-697d-45e1-b4eb-d3e575bcda71",
            "name": "BK-MDA",
            "unii": "K0XHQ9FYT3",
            "linking_id": "K0XHQ9FYT3",
            "ref_pname": "BK-MDA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "139dec8d-9fa1-4fdc-a6e2-0410ea8c2b1c",
          "comments": "abuser A: 0.96 (30, after hydrolysis) mcg/mL; abuser B: N.D. (1.6, after hydrolysis) mcg/mL",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VIVO",
          "references": [
            "796103b8-0f7c-465f-8ca4-1c91a9eec4b3"
          ],
          "related_substance": {
            "uuid": "88718476-98c2-4b45-a8ff-5b699be4cc3c",
            "refuuid": "12feb84b-25d6-4ae6-964f-7a8743c96f92",
            "name": "BK-MDEA-M1",
            "unii": "01S427WO5V",
            "linking_id": "01S427WO5V",
            "ref_pname": "BK-MDEA-M1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6c5381a1-c9f8-4133-b1e1-77cddaef5ec4",
          "comments": "abuser A: N.D. (10, after hydrolysis) mcg/mL; abuser B: N.D. (0.49, after hydrolysis) mcg/mL",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VIVO",
          "references": [
            "796103b8-0f7c-465f-8ca4-1c91a9eec4b3"
          ],
          "related_substance": {
            "uuid": "82977820-4208-40ce-8d5d-10d82422a420",
            "refuuid": "454fa85e-9ba7-4592-a04e-f0025e904978",
            "name": "BK-MDEA-M2",
            "unii": "M0Q623MM1W",
            "linking_id": "M0Q623MM1W",
            "ref_pname": "BK-MDEA-M2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "afd5e7ec-d63f-4cf3-b77e-1e10f0c34237",
          "comments": "abuser A: 19[42*] (23[43*], after hydrolysis) msg/mL; abuser B: 0.25[2.6*] (0.18[2.5*], after hydrolysis) mcg/mL; *diastereomer",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VIVO",
          "references": [
            "796103b8-0f7c-465f-8ca4-1c91a9eec4b3"
          ],
          "related_substance": {
            "uuid": "7aac1eac-72cc-48ca-949a-6584c16a800e",
            "refuuid": "c834eb2c-10b1-46f7-835a-a41c71eacdd2",
            "name": "2-ETHYLAMINO-1-(3,4-METHYLENEDIOXYPHENYL)PROPAN-1-OL",
            "unii": "29HPR92AIB",
            "linking_id": "29HPR92AIB",
            "ref_pname": "2-ETHYLAMINO-1-(3,4-METHYLENEDIOXYPHENYL)PROPAN-1-OL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bd5be92a-cf9e-4296-baf8-1a03e4a33b6c",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "references": [
            "9924d66c-5712-40ad-9a13-930673d2c6f0"
          ],
          "related_substance": {
            "uuid": "780d234e-58a7-4fbc-9bd1-62396cb6986a",
            "refuuid": "23c640f0-496e-4fdc-b966-c88203447153",
            "name": "1-(3,4-DIHYDROXYPHENYL)-2-(ETHYLAMINO)-1-PROPANONE",
            "unii": "LF4AO9N378",
            "linking_id": "LF4AO9N378",
            "ref_pname": "1-(3,4-DIHYDROXYPHENYL)-2-(ETHYLAMINO)-1-PROPANONE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "63e34391-c195-473b-9408-8022c358040d",
          "name": "1-(1,3-BENZODIOXOL-5-YL)-2-(ETHYLAMINO)PROPAN-1-ONE",
          "stdName": "1-(1,3-BENZODIOXOL-5-YL)-2-(ETHYLAMINO)PROPAN-1-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3a87262-9c2f-41b4-9473-9b1c10ff8059"
          ],
          "display_name": false
        },
        {
          "uuid": "de6e7890-a80a-4aea-aeff-27641be568f1",
          "name": "1-(BENZO(D)(1,3)DIOXOL-5-YL)-2-(ETHYLAMINO)PROPAN-1-ONE",
          "stdName": "1-(BENZO(D)(1,3)DIOXOL-5-YL)-2-(ETHYLAMINO)PROPAN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab1575cc-7583-4dc3-b2aa-b35fafd46df6",
            "9a141d6a-ca97-410b-8462-9d0fb1cdfc89"
          ],
          "display_name": false
        },
        {
          "uuid": "010dfed4-4c83-40f4-8fb6-7a75a5c57b22",
          "name": "1-PROPANONE, 1-(1,3-BENZODIOXOL-5-YL)-2-(ETHYLAMINO)-",
          "stdName": "1-PROPANONE, 1-(1,3-BENZODIOXOL-5-YL)-2-(ETHYLAMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab1575cc-7583-4dc3-b2aa-b35fafd46df6",
            "9a141d6a-ca97-410b-8462-9d0fb1cdfc89"
          ],
          "display_name": false
        },
        {
          "uuid": "5efd91fa-394f-4602-9626-f214ba72a7f4",
          "name": "2-ETHYLAMINO-1-(3,4-METHYLENEDIOXYPHENYL)PROPAN-1-ONE",
          "stdName": "2-ETHYLAMINO-1-(3,4-METHYLENEDIOXYPHENYL)PROPAN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab1575cc-7583-4dc3-b2aa-b35fafd46df6",
            "f4593fb5-df67-47ef-9456-91748731013a"
          ],
          "display_name": false
        },
        {
          "uuid": "9b0a42e4-89b6-4292-a64f-48b91d438efa",
          "name": "3,4-METHYLENEDIOXY-N-ETHYLCATHINONE",
          "stdName": "3,4-METHYLENEDIOXY-N-ETHYLCATHINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23d62eba-3c5d-494d-83c4-3820ad9dac00",
            "ab1575cc-7583-4dc3-b2aa-b35fafd46df6"
          ],
          "display_name": false
        },
        {
          "uuid": "b236e5c8-4fba-40ae-bf8c-634c74621ba1",
          "name": "BK-MDE",
          "stdName": "BK-MDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab69fc0f-f1d4-4999-b200-3c4afa859a9a"
          ],
          "display_name": false
        },
        {
          "uuid": "1890d86d-b2c8-4bbe-ab3f-ee8c76515a2f",
          "name": "BK-MDEA",
          "stdName": "BK-MDEA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab1575cc-7583-4dc3-b2aa-b35fafd46df6",
            "f4593fb5-df67-47ef-9456-91748731013a"
          ],
          "display_name": false
        },
        {
          "uuid": "5c1cec01-20c3-45bf-934b-827d7b07984d",
          "name": "ETHYLONE",
          "stdName": "ETHYLONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab1575cc-7583-4dc3-b2aa-b35fafd46df6",
            "9a141d6a-ca97-410b-8462-9d0fb1cdfc89"
          ],
          "display_name": true
        },
        {
          "uuid": "e8c1b723-da07-478f-9d26-fb04f7602038",
          "name": "J2.528.311B",
          "stdName": "J2.528.311B",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9e14d61-5663-4ced-ae07-c14f5d535ca0",
            "ab1575cc-7583-4dc3-b2aa-b35fafd46df6"
          ],
          "display_name": false
        },
        {
          "uuid": "f8c84320-f1b4-41c8-bdf3-211eaddbc40b",
          "name": "MDEC",
          "stdName": "MDEC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab69fc0f-f1d4-4999-b200-3c4afa859a9a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "23d62eba-3c5d-494d-83c4-3820ad9dac00",
          "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/1112937-64-0",
          "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/1112937-64-0",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ab1575cc-7583-4dc3-b2aa-b35fafd46df6",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a141d6a-ca97-410b-8462-9d0fb1cdfc89",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9e14d61-5663-4ced-ae07-c14f5d535ca0",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J2.528.311B",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J2.528.311B",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4593fb5-df67-47ef-9456-91748731013a",
          "citation": "http://www.sciencedirect.com/science/article/pii/S0379073809001558",
          "url": "http://www.sciencedirect.com/science/article/pii/S0379073809001558",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1feaaf45-1d57-45db-878d-11dd415fc137",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393362000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "796103b8-0f7c-465f-8ca4-1c91a9eec4b3",
          "citation": "FORENSIC SCI INT, 188, 131-9 (2009)",
          "url": "http://www.sciencedirect.com/science/article/pii/S0379073809001558",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "732ed7ec-44f1-48d5-9b27-bfbfe1c2d412",
          "citation": "SRS import [L91C78FW96]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L91C78FW96",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393362000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2cd90d7b-ca13-4779-93bd-59f97e8558bf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9924d66c-5712-40ad-9a13-930673d2c6f0",
          "citation": "R Meyer, Markus, and Hans H Maurer. \"Metabolism of designer drugs of abuse: an updated review.\" Current drug metabolism 11.5 (2010): 468-482.",
          "url": "https://www.ingentaconnect.com/content/ben/cdm/2010/00000011/00000005/art00008",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ab69fc0f-f1d4-4999-b200-3c4afa859a9a",
          "citation": "U.S. Department of JusticeDrug Enforcement AdministrationDiversion Control DivisionDrug & Chemical Evaluation SectionLists of:Scheduling Actions Controlled SubstancesRegulated Chemicals",
          "url": "https://www.deadiversion.usdoj.gov/schedules/orangebook/orangebook.pdf",
          "doc_type": "ORANGE BOOK",
          "public_domain": true
        },
        {
          "uuid": "c3a87262-9c2f-41b4-9473-9b1c10ff8059",
          "citation": "Electronic Code of Federal Regulations",
          "url": "https://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cdccbe3f-a0ee-7231-f4c1-fa369aafa3e6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "baf963f3-f41f-b1c3-09ff-10e96d364a8d",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "168f2103-7cb3-4229-8251-56318ae11b97",
          "id": "168f2103-7cb3-4229-8251-56318ae11b97",
          "molfile": "\n  Marvin  01132101222D          \n\n 16 17  0  0  0  0            999 V2000\n    2.7665   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0521   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3376   -0.8250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3376    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.0521    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6231    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6231    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0914    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0914   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8058   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5203   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2473   -1.1195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7665   -0.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3172    0.2135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5203    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8058    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 16  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 15 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\nM  END",
          "smiles": "CCNC(C)C(=O)c1ccc2c(c1)OCO2",
          "formula": "C12H15NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e2459eca-8709-4d18-a0d2-1e2ddcf6e7a7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "221.2529",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0e599e5e-1390-4767-899f-299689b4ba61",
      "version": "10",
      "structure": {
        "id": "bd6ec0c6-1967-49c2-b151-75e630eccb50",
        "molfile": "\n  Marvin  01132109482D          \n\n 16 17  0  0  0  0            999 V2000\n   -1.5203    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5203   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8058   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0914   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0914    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8058    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3172    0.2135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7665   -0.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2473   -1.1195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6231    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3376    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0521    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3376   -0.8250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0521   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7665   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6231    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9  2  1  0  0  0  0\n  5 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 10 16  2  0  0  0  0\nM  END",
        "smiles": "CCNC(C)C(=O)c1ccc2c(c1)OCO2",
        "formula": "C12H15NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "221.2529",
        "optical_activity": "( + / - )",
        "references": [
          "732ed7ec-44f1-48d5-9b27-bfbfe1c2d412",
          "2cd90d7b-ca13-4779-93bd-59f97e8558bf"
        ],
        "stereo_centers": 1
      },
      "unii": "L91C78FW96"
    }
  ]
}