{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e502faef-e90e-4e0e-90d8-162ea4539f5d", "code": "71277-79-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=71277-79-7", "code_system": "CAS", "references": [ "4325463b-940f-4eb3-84d8-031ffb29eee0", "811bb99e-0497-409c-850d-e81ea0f155db" ] }, { "uuid": "1ade0c26-9323-4629-bacb-4a81cbb3181a", "code": "1313716", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1313716/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "4325463b-940f-4eb3-84d8-031ffb29eee0" ] }, { "uuid": "8a7a3ea9-89dd-494e-b08f-abbcf35d2434", "code": "118984432", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/118984432", "code_system": "PUBCHEM", "references": [ "4325463b-940f-4eb3-84d8-031ffb29eee0" ] }, { "uuid": "a4e3f957-63d7-6add-065f-9f1a22a5be21", "code": "DTXSID8020670", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8020670", "code_system": "EPA CompTox", "references": [ "75ebb63a-8734-3ff5-b266-607752b229af" ] }, { "uuid": "0e4f157f-de75-4fc9-a8d0-636c2ea2d183", "code": "L8Q0US0J7V", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "ad978b36-fcb7-5ade-ffba-48f1866332d9", "code": "300000031807", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "dcea5a1f-32bb-3fad-1eba-45d72d7ce255" ] }, { "uuid": "93d0809b-1376-ea8d-2a8c-010fe7f9abac", "code": "L8Q0US0J7V", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=L8Q0US0J7V", "code_system": "DAILYMED", "references": [ "b61f82bf-24ea-f7ff-be7e-a2e7b26eac1e" ] } ], "substance_class": "chemical", "names": [ { "uuid": "ab17e042-ffee-4c05-af4a-81146c92dece", "name": "DISODIUM GLYCYRRHIZATE", "stdName": "DISODIUM GLYCYRRHIZATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "253ede8f-05e6-4309-93e3-153c20a4e233", "ef6e0570-d237-42b7-9721-259a2c19a44e", "92ae703b-1069-4105-bb47-1a387b048de4", "104c4f4e-ae35-484b-ba21-6875da5ce916" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "eb0720b8-9a94-4615-aa8d-46870b8a6f2f", "name_org": "INCI" } ] }, { "uuid": "90a33295-88dc-9f5d-f405-d57039724f74", "name": "Disodium glycyrrhizate [WHO-DD]", "stdName": "DISODIUM GLYCYRRHIZATE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "93f00eca-3656-c958-7c8e-517d957a677b" ], "display_name": false } ], "references": [ { "uuid": "ef6e0570-d237-42b7-9721-259a2c19a44e", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "104c4f4e-ae35-484b-ba21-6875da5ce916", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "92ae703b-1069-4105-bb47-1a387b048de4", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4325463b-940f-4eb3-84d8-031ffb29eee0", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391113000, "tags": [ "NOMEN" ] }, { "uuid": "ee16254d-9dd1-4e59-ad03-f35fd2bebfb6", "citation": "SRS import [L8Q0US0J7V]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L8Q0US0J7V", "doc_type": "SRS", "public_domain": true, "document_date": 1493391113000, "tags": [ "NOMEN" ] }, { "uuid": "6983978d-7029-4258-983f-26e87b5add53", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "253ede8f-05e6-4309-93e3-153c20a4e233", "citation": "DISODIUM GLYCYRRHIZATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "75ebb63a-8734-3ff5-b266-607752b229af", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=71277-79-7", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "93f00eca-3656-c958-7c8e-517d957a677b", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "e2e1c894-c995-0ac1-c4d1-0e17db330bfd", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "811bb99e-0497-409c-850d-e81ea0f155db", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "b61f82bf-24ea-f7ff-be7e-a2e7b26eac1e", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "dcea5a1f-32bb-3fad-1eba-45d72d7ce255", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "c90c4f36-7be5-4d96-b5de-6a03e0b53fa4", "id": "c90c4f36-7be5-4d96-b5de-6a03e0b53fa4", "molfile": "\n Marvin 01132110232D \n\n 1 0 0 0 1 0 999 V2000\n 10.4824 -18.4940 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "5665fdea-a154-48c1-b984-b6072f4c9db3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "6bde6499-afc4-4ae6-9e5e-38b3ee316569", "id": "6bde6499-afc4-4ae6-9e5e-38b3ee316569", "molfile": "\n Marvin 01132105362D \n\n 58 64 0 0 1 0 999 V2000\n 10.6471 -13.7709 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.9601 -13.3497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2238 -13.7489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2238 -14.5669 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 9.2238 -15.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9314 -14.9927 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 9.9314 -15.8128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2034 -16.2144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5151 -15.8004 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.5151 -16.6183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5151 -14.9740 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.8014 -14.5557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8014 -13.7238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0734 -14.9684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0734 -15.7920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3616 -16.2096 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 5.6518 -15.7908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9324 -16.2096 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 4.9324 -15.3821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9324 -17.0370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6518 -17.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3616 -17.0370 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.3616 -17.8544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0759 -17.4470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7918 -17.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7918 -16.2100 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 7.7918 -15.3821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2171 -15.7959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5023 -16.2146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2171 -14.9733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6471 -14.6003 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 10.6471 -15.4179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4444 -14.8002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3733 -13.3547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0880 -13.7680 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 12.0880 -14.5971 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8039 -15.0057 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 12.8039 -15.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5278 -16.2368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0878 -16.2441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5191 -14.5958 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 14.2359 -15.0099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5191 -13.7672 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 14.2354 -13.3530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8023 -13.3524 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 12.8023 -11.8712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4611 -11.4603 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 13.4611 -10.6893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0960 -10.2848 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 14.0960 -9.5014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3947 -9.1321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7341 -9.0968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8010 -10.6530 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 15.4404 -10.2443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.8010 -11.4261 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 15.4766 -11.7931 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 14.1419 -11.8287 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 14.1419 -12.6069 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 31 1 0 0 0 0\n 1 34 1 6 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 1 6 0 0 0\n 6 4 1 0 0 0 0\n 4 11 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 31 1 6 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 6 0 0 0\n 11 9 1 0 0 0 0\n 9 26 1 0 0 0 0\n 11 12 1 6 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 1 0 0 0\n 26 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 22 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 1 0 0 0\n 18 20 1 0 0 0 0\n 18 28 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 6 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 1 1 0 0 0\n 28 29 1 0 0 0 0\n 28 30 2 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\n 35 34 1 6 0 0 0\n 35 36 1 0 0 0 0\n 45 35 1 0 0 0 0\n 37 36 1 0 0 0 0\n 37 38 1 1 0 0 0\n 41 37 1 0 0 0 0\n 38 39 1 0 0 0 0\n 38 40 2 0 0 0 0\n 41 42 1 6 0 0 0\n 41 43 1 0 0 0 0\n 43 44 1 1 0 0 0\n 43 45 1 0 0 0 0\n 45 46 1 6 0 0 0\n 47 46 1 6 0 0 0\n 47 48 1 0 0 0 0\n 57 47 1 0 0 0 0\n 49 48 1 0 0 0 0\n 49 50 1 6 0 0 0\n 53 49 1 0 0 0 0\n 50 51 1 0 0 0 0\n 50 52 2 0 0 0 0\n 53 54 1 1 0 0 0\n 53 55 1 0 0 0 0\n 55 56 1 6 0 0 0\n 55 57 1 0 0 0 0\n 57 58 1 1 0 0 0\nM CHG 2 56 -1 58 -1\nM END", "smiles": "C[C@@]1(C)[C@@H]2CC[C@]3(C)[C@H](C(=O)C=C4[C@@H]5C[C@](C)(CC[C@]5(C)CC[C@]43C)C(=O)O)[C@@]2(C)CC[C@@H]1O[C@@H]6[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O6)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@@H](C(=O)O)O7)O)[O-])[O-]", "formula": "C42H60O16", "atropisomerism": "No", "charge": -2, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b4865530-b3d4-49c5-8c3f-a0e393dbdc5a" }, "defined_stereo": 19, "ez_centers": 0, "molecular_weight": "820.9178", "optical_activity": "UNSPECIFIED", "stereo_centers": 19 } ], "definition_level": "COMPLETE", "uuid": "2539a55b-40d3-4b63-acb0-16bc3f959d10", "version": "13", "structure": { "id": "c816db63-d5cd-40c1-b522-0e01135f89d0", "molfile": "\n Marvin 01132110202D \n\n 65 69 0 0 1 0 999 V2000\n 4.9315 -16.2067 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.3604 -16.2067 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.3604 -17.0339 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.7904 -16.2071 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 8.5136 -14.9713 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.5136 -15.7975 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.9296 -14.9900 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.2221 -14.5643 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.6452 -13.7684 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.0858 -13.7655 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.8016 -15.0030 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.5166 -14.5931 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.5166 -13.7647 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 12.8000 -13.3500 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.4587 -11.4582 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.1393 -11.8265 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.7983 -11.4240 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.7983 -10.6511 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.0934 -10.2829 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 5.6508 -15.7879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6508 -17.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9315 -17.0339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0746 -17.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7904 -17.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0721 -15.7891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0721 -14.9657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8000 -14.5531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2017 -16.2115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9296 -15.8099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2221 -13.7464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9583 -13.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6452 -14.5976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6452 -15.4151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4423 -14.7975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3712 -13.3523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0858 -12.9385 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0858 -14.5944 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8016 -15.8238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5253 -16.2338 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 12.0856 -16.2411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2333 -15.0072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8000 -11.8690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4587 -10.6874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0934 -9.4997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.3923 -9.1304 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7314 -9.0951 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 15.4376 -10.2424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4738 -11.7910 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1393 -12.6046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.7086 -11.2582 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2328 -13.3506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2221 -15.3893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9296 -14.1640 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5136 -16.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5136 -14.1437 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8000 -13.7213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7904 -15.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3604 -17.8512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3604 -15.3793 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2163 -15.7930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5017 -16.2117 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 4.2163 -14.9706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9315 -15.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4824 -18.4940 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 10.4824 -18.4940 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 4 6 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 8 1 0 0 0 0\n 8 7 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 10 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 2 20 1 0 0 0 0\n 1 20 1 0 0 0 0\n 21 3 1 0 0 0 0\n 22 21 1 0 0 0 0\n 1 22 1 0 0 0 0\n 3 23 1 0 0 0 0\n 24 4 1 0 0 0 0\n 23 24 1 0 0 0 0\n 2 25 1 0 0 0 0\n 25 4 1 0 0 0 0\n 25 26 2 0 0 0 0\n 5 27 1 0 0 0 0\n 27 26 1 0 0 0 0\n 6 28 1 0 0 0 0\n 29 7 1 0 0 0 0\n 28 29 1 0 0 0 0\n 8 30 1 0 0 0 0\n 9 31 1 0 0 0 0\n 31 30 1 0 0 0 0\n 7 32 1 0 0 0 0\n 32 9 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 34 1 0 0 0 0\n 9 35 1 6 0 0 0\n 35 10 1 0 0 0 0\n 10 36 1 1 0 0 0\n 10 37 1 0 0 0 0\n 37 11 1 0 0 0 0\n 11 38 1 1 0 0 0\n 38 39 1 0 0 0 0\n 38 40 2 0 0 0 0\n 12 41 1 6 0 0 0\n 14 42 1 6 0 0 0\n 42 15 1 0 0 0 0\n 19 43 1 0 0 0 0\n 15 43 1 0 0 0 0\n 19 44 1 6 0 0 0\n 44 45 2 0 0 0 0\n 44 46 1 0 0 0 0\n 18 47 1 1 0 0 0\n 17 48 1 6 0 0 0\n 16 49 1 1 0 0 0\n 15 50 1 1 0 0 0\n 13 51 1 1 0 0 0\n 8 52 1 6 0 0 0\n 7 53 1 1 0 0 0\n 6 54 1 6 0 0 0\n 5 55 1 1 0 0 0\n 27 56 2 0 0 0 0\n 4 57 1 1 0 0 0\n 3 58 1 6 0 0 0\n 2 59 1 6 0 0 0\n 1 60 1 0 0 0 0\n 60 61 1 0 0 0 0\n 60 62 2 0 0 0 0\n 1 63 1 1 0 0 0\nM CHG 5 39 -1 46 -1 61 -1 64 1 65 1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 2 64 65\nM SPA 1 1 64\nM SDI 1 4 10.0624 -18.9140 10.0624 -18.0740\nM SDI 1 4 10.9024 -18.0740 10.9024 -18.9140\nM SMT 1 2\nM END", "smiles": "CC1(C)[C@]2([H])CC[C@]3(C)[C@]([H])(C(=O)C=C4[C@]5([H])C[C@](C)(CC[C@]5(C)CC[C@]43C)C(=O)[O-])[C@@]2(C)CC[C@@H]1O[C@]6([H])[C@@H]([C@H]([C@@H]([C@@H](C(=O)[O-])O6)O)O)O[C@@]7([H])[C@@H]([C@H]([C@@H]([C@@H](C(=O)[O-])O7)O)O)O.[Na+].[Na+]", "formula": "C42H59O16.2Na", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 19, "ez_centers": 0, "molecular_weight": "865.8894", "optical_activity": "UNSPECIFIED", "references": [ "6983978d-7029-4258-983f-26e87b5add53", "ee16254d-9dd1-4e59-ad03-f35fd2bebfb6" ], "stereo_centers": 19 }, "unii": "L8Q0US0J7V" } ] }