{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bb203e27-20ef-41f0-8834-99a92e8062bb",
          "code": "7789-80-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7789-80-2",
          "code_system": "CAS",
          "references": [
            "283cb9cb-e3f3-49fd-9159-c007ccf04d19",
            "65a11d8e-66ea-4353-b730-70a5a1580bfd"
          ]
        },
        {
          "uuid": "df4a46e6-32b7-4a12-9c85-62911d6bea87",
          "code": "CALCIUM IODATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Calcium_iodate",
          "code_system": "WIKIPEDIA",
          "references": [
            "283cb9cb-e3f3-49fd-9159-c007ccf04d19"
          ]
        },
        {
          "uuid": "f7cfda3c-86bc-459c-89d1-5760e7a2bd64",
          "code": "21 CFR 184.1206",
          "comments": "PART 184 -- DIRECT FOOD SUBSTANCES AFFIRMED AS GENERALLY RECOGNIZED AS SAFE|Subpart B--Listing of Specific Substances Affirmed as GRAS|Sec. 184.1206 Calcium iodate",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=184.1206",
          "code_system": "CFR",
          "references": [
            "283cb9cb-e3f3-49fd-9159-c007ccf04d19"
          ]
        },
        {
          "uuid": "302ed56b-90b1-44fa-9fd2-24c3cf1b7ec4",
          "code": "m2948",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2948?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "283cb9cb-e3f3-49fd-9159-c007ccf04d19"
          ]
        },
        {
          "uuid": "161242cb-8170-47de-833b-b7f983aff8a2",
          "code": "232-191-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.029.265",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "283cb9cb-e3f3-49fd-9159-c007ccf04d19"
          ]
        },
        {
          "uuid": "a5355762-b4d7-4085-bc15-48478f97358d",
          "code": "24619",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24619",
          "code_system": "PUBCHEM",
          "references": [
            "283cb9cb-e3f3-49fd-9159-c007ccf04d19"
          ]
        },
        {
          "uuid": "28168e40-03b8-2f02-e10c-5da9fe75fe55",
          "code": "986",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/986",
          "code_system": "HSDB",
          "references": [
            "a05b7d2d-d27f-e8c2-2b7e-8b681b5e0f45"
          ]
        },
        {
          "uuid": "cff6aae5-0fe3-4abe-88a7-49ba596f4354",
          "code": "L8MN4Y57BR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "25312ce5-9745-bc3b-f43f-a55141c03da8",
          "code": "DTXSID301014485",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301014485",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2561a561-ab81-40ee-8137-1d76c77598fe",
          "name": "CALCIUM IODATE",
          "stdName": "CALCIUM IODATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "408f1349-5af7-4f23-bbb4-65c365424eb5",
            "d6b44623-2b7c-4563-a702-a4e7100fc5ed",
            "5dbaccbb-d93f-4f05-bd59-be0240cdcd30",
            "59b5e4bd-77c3-4d8a-b374-4bbb5c42775d",
            "4468d195-145a-46a0-b650-f0ca77494126",
            "683ae1e0-b259-4769-96b3-15213e78f8b2",
            "f935f1c7-1342-40ea-9457-8b7f8698aec3",
            "0bed59c4-6e41-42a7-ae14-e7447b1beafa",
            "ff198b52-30e2-4ded-a125-d47bf343dfee",
            "5e4fe91b-3b03-453a-9466-03be7c4e238b"
          ],
          "display_name": true
        },
        {
          "uuid": "0bdcf7d3-5d30-4f58-a947-d35162675e97",
          "name": "CALCIUM IODATE [FCC]",
          "stdName": "CALCIUM IODATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff198b52-30e2-4ded-a125-d47bf343dfee",
            "d6b44623-2b7c-4563-a702-a4e7100fc5ed"
          ],
          "display_name": false
        },
        {
          "uuid": "9dc999f7-2075-489a-baf7-95276279e705",
          "name": "CALCIUM IODATE [HSDB]",
          "stdName": "CALCIUM IODATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f935f1c7-1342-40ea-9457-8b7f8698aec3",
            "ff198b52-30e2-4ded-a125-d47bf343dfee"
          ],
          "display_name": false
        },
        {
          "uuid": "ccdcc05e-986b-495b-a78b-b9adcdaec6d9",
          "name": "CALCIUM IODATE [MI]",
          "stdName": "CALCIUM IODATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "683ae1e0-b259-4769-96b3-15213e78f8b2",
            "ff198b52-30e2-4ded-a125-d47bf343dfee"
          ],
          "display_name": false
        },
        {
          "uuid": "d0e15241-263c-48d0-a439-13e6547f4967",
          "name": "CALCIUM IODATE [VANDF]",
          "stdName": "CALCIUM IODATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0bed59c4-6e41-42a7-ae14-e7447b1beafa",
            "ff198b52-30e2-4ded-a125-d47bf343dfee"
          ],
          "display_name": false
        },
        {
          "uuid": "0fb25651-ecbd-4c13-b4e6-7eadab6790e0",
          "name": "LAUTARITE",
          "stdName": "LAUTARITE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c574ec47-64c3-4338-8c13-df999cf54ec0",
            "ff198b52-30e2-4ded-a125-d47bf343dfee"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d6b44623-2b7c-4563-a702-a4e7100fc5ed",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5dbaccbb-d93f-4f05-bd59-be0240cdcd30",
          "citation": "OTC",
          "doc_type": "USP FOOD CHEMICALS CODEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c574ec47-64c3-4338-8c13-df999cf54ec0",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff198b52-30e2-4ded-a125-d47bf343dfee",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "683ae1e0-b259-4769-96b3-15213e78f8b2",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f935f1c7-1342-40ea-9457-8b7f8698aec3",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0bed59c4-6e41-42a7-ae14-e7447b1beafa",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "283cb9cb-e3f3-49fd-9159-c007ccf04d19",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390829000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2745dbde-7dd0-4d0a-b7e8-53106a06e393",
          "citation": "SRS import [L8MN4Y57BR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L8MN4Y57BR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390829000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4468d195-145a-46a0-b650-f0ca77494126",
          "citation": "CALCIUM IODATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "59b5e4bd-77c3-4d8a-b374-4bbb5c42775d",
          "citation": "CALCIUM IODATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5e4fe91b-3b03-453a-9466-03be7c4e238b",
          "citation": "CALCIUM IODATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "408f1349-5af7-4f23-bbb4-65c365424eb5",
          "citation": "CALCIUM IODATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a05b7d2d-d27f-e8c2-2b7e-8b681b5e0f45",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+7789-80-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "65a11d8e-66ea-4353-b730-70a5a1580bfd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f6e1a1b6-ee1c-4b9d-8e0e-a43fbb2c8451",
          "id": "f6e1a1b6-ee1c-4b9d-8e0e-a43fbb2c8451",
          "molfile": "\n  Marvin  01132112482D          \n\n  1  0  0  0  0  0            999 V2000\n    5.7073   -2.0006    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Ca+2]",
          "formula": "Ca",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8206f7cf-2429-4c45-a567-cf0ca69a50d7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "40.078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "ce8a9e66-dbcf-4a79-ba55-6253b79db680",
          "id": "ce8a9e66-dbcf-4a79-ba55-6253b79db680",
          "molfile": "\n  Marvin  01132110402D          \n\n  4  3  0  0  0  0            999 V2000\n    4.5093   -3.2240    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.8924   -3.2240    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3873   -2.5717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3417   -3.9297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "I(=O)(=O)[O-]",
          "formula": "IO3",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "e290b1cf-19c4-4151-b427-1f45934a65b6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "174.9027",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "27061d9e-3e1a-41a4-bbcc-1de890a0c24f",
      "version": "4",
      "structure": {
        "id": "5f853e02-5e15-4584-aa74-a1c7571dcfdf",
        "molfile": "\n  Marvin  01132104562D          \n\n  9  6  0  0  0  0            999 V2000\n    3.8924   -3.2240    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3873   -2.5717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3417   -3.9297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5093   -3.2240    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.7073   -2.0006    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0\n    3.8924   -3.2240    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3873   -2.5717    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3417   -3.9297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5093   -3.2240    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  4  1  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  2  0  0  0  0\n  6  9  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6  8  2  0  0  0  0\nM  CHG  3   4  -1   5   2   9  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  8   1   2   3   4   6   7   8   9\nM  SPA   1  4   1   2   3   4\nM  SDI   1  4    2.9217   -4.3497    2.9217   -2.1517\nM  SDI   1  4    4.9293   -2.1517    4.9293   -4.3497\nM  SMT   1 2\nM  END",
        "smiles": "[Ca+2].I(=O)(=O)[O-].I(=O)(=O)[O-]",
        "formula": "Ca.2IO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "389.8834",
        "optical_activity": "NONE",
        "references": [
          "2745dbde-7dd0-4d0a-b7e8-53106a06e393",
          "d6b44623-2b7c-4563-a702-a4e7100fc5ed"
        ],
        "stereo_centers": 0
      },
      "unii": "L8MN4Y57BR"
    }
  ]
}