{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a0230ff1-d9a4-466c-be01-01f5f4e6c368",
          "code": "6486-23-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6486-23-3",
          "code_system": "CAS",
          "references": [
            "94de9f62-3397-42be-8d48-7380b9811bcb",
            "4d50417c-3de4-4870-a7b7-7a93f2aa0ddf"
          ]
        },
        {
          "uuid": "65e03ecf-2b93-4168-ace8-0ad4e9869cbe",
          "code": "1491868",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1491868/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "94de9f62-3397-42be-8d48-7380b9811bcb"
          ]
        },
        {
          "uuid": "b11b4fb9-38b1-4532-9359-8c015adca3e2",
          "code": "229-355-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.687",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "94de9f62-3397-42be-8d48-7380b9811bcb"
          ]
        },
        {
          "uuid": "0f01b387-f9c9-4634-973f-432bd2ea5f60",
          "code": "94326",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94326",
          "code_system": "PUBCHEM",
          "references": [
            "94de9f62-3397-42be-8d48-7380b9811bcb"
          ]
        },
        {
          "uuid": "ee1fa3d1-3688-4ae1-a253-4a00509679bd",
          "code": "L885GOC9B6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f87e5054-19e1-a828-4612-6ec95de943b1",
          "code": "DTXSID40863873",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40863873",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "4e07b5cd-653a-fbfe-618b-e19eb5e003e1",
          "code": "17264",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=17264",
          "code_system": "NSC",
          "references": [
            "1e75e07a-62f0-8503-01b4-4d060bcd40e8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2fc6f7d2-7769-4caa-8516-bee71c1ecaba",
          "name": "(±)-PIGMENT YELLOW 3",
          "stdName": "(+/-)-PIGMENT YELLOW 3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15d5c116-fc48-4bd7-96dd-8810da18ce3f",
            "7039ae6f-c536-4a38-af0c-ae43ece0c384"
          ],
          "display_name": false
        },
        {
          "uuid": "5d1d0771-5202-4ab0-b609-07197c1bffd4",
          "name": ".ALPHA.-(4-CHLORO-2-NITROPHENYLAZO)ACETOACETIC ACID O-CHLOROANILIDE",
          "stdName": ".ALPHA.-(4-CHLORO-2-NITROPHENYLAZO)ACETOACETIC ACID O-CHLOROANILIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7039ae6f-c536-4a38-af0c-ae43ece0c384",
            "72ff7e3b-22f4-4398-84e5-c5d9f736984c"
          ],
          "display_name": false
        },
        {
          "uuid": "ed3d5052-c616-4101-8633-a487c614c65c",
          "name": "ACETOACETANILIDE, 2'-CHLORO-2-(4-CHLORO-2-NITROPHENYLAZO)-",
          "stdName": "ACETOACETANILIDE, 2'-CHLORO-2-(4-CHLORO-2-NITROPHENYLAZO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7039ae6f-c536-4a38-af0c-ae43ece0c384",
            "72ff7e3b-22f4-4398-84e5-c5d9f736984c"
          ],
          "display_name": false
        },
        {
          "uuid": "6f535670-41ab-4451-9d65-45bf1fc2af9e",
          "name": "BUTANAMIDE, 2-((4-CHLORO-2-NITROPHENYL)AZO)-N-(2-CHLOROPHENYL)-3-OXO-",
          "stdName": "BUTANAMIDE, 2-((4-CHLORO-2-NITROPHENYL)AZO)-N-(2-CHLOROPHENYL)-3-OXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7039ae6f-c536-4a38-af0c-ae43ece0c384",
            "72ff7e3b-22f4-4398-84e5-c5d9f736984c"
          ],
          "display_name": false
        },
        {
          "uuid": "4dd1bf98-99b1-46a0-8208-89566ee225db",
          "name": "BUTANAMIDE, 2-(2-(4-CHLORO-2-NITROPHENYL)DIAZENYL)-N-(2-CHLOROPHENYL)-3-OXO-",
          "stdName": "BUTANAMIDE, 2-(2-(4-CHLORO-2-NITROPHENYL)DIAZENYL)-N-(2-CHLOROPHENYL)-3-OXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7039ae6f-c536-4a38-af0c-ae43ece0c384",
            "72ff7e3b-22f4-4398-84e5-c5d9f736984c"
          ],
          "display_name": false
        },
        {
          "uuid": "e0db0a2a-34ba-4555-8096-375198b82f31",
          "name": "C.I. PIGMENT YELLOW 3",
          "stdName": "C.I. PIGMENT YELLOW 3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7039ae6f-c536-4a38-af0c-ae43ece0c384",
            "72ff7e3b-22f4-4398-84e5-c5d9f736984c"
          ],
          "display_name": false
        },
        {
          "uuid": "925e5e19-a806-4887-b7bc-e3c5839e76d7",
          "name": "CARNELIO YELLOW 10G",
          "stdName": "CARNELIO YELLOW 10G",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7039ae6f-c536-4a38-af0c-ae43ece0c384",
            "72ff7e3b-22f4-4398-84e5-c5d9f736984c"
          ],
          "display_name": false
        },
        {
          "uuid": "261a5b25-798f-4515-af64-73f69690a584",
          "name": "CI 11710",
          "stdName": "CI 11710",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "842dc54a-66ce-4297-9af0-6510eb735279",
            "7039ae6f-c536-4a38-af0c-ae43ece0c384",
            "3342b7cc-6662-4976-b0fa-35fbcabc9af7"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4102b3c6-9c5d-4058-9255-93559c53908e",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "9f07cb1d-4ffe-43d4-9d1d-d657beb7c98e",
          "name": "ELJON FAST YELLOW 10G",
          "stdName": "ELJON FAST YELLOW 10G",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7039ae6f-c536-4a38-af0c-ae43ece0c384",
            "72ff7e3b-22f4-4398-84e5-c5d9f736984c"
          ],
          "display_name": false
        },
        {
          "uuid": "86a1f5fd-e80c-4c1c-b786-c09699146e6b",
          "name": "HANSA YELLOW 10G",
          "stdName": "HANSA YELLOW 10G",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7039ae6f-c536-4a38-af0c-ae43ece0c384",
            "72ff7e3b-22f4-4398-84e5-c5d9f736984c"
          ],
          "display_name": false
        },
        {
          "uuid": "af62738e-87c2-47bd-a7c4-1c81fbd77f64",
          "name": "JAUNE COVANOR W 1603",
          "stdName": "JAUNE COVANOR W 1603",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7039ae6f-c536-4a38-af0c-ae43ece0c384",
            "3342b7cc-6662-4976-b0fa-35fbcabc9af7"
          ],
          "display_name": false
        },
        {
          "uuid": "1dbf63d7-990e-4e13-953a-28678ab02b6b",
          "name": "NSC-17264",
          "stdName": "NSC-17264",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7039ae6f-c536-4a38-af0c-ae43ece0c384",
            "72ff7e3b-22f4-4398-84e5-c5d9f736984c"
          ],
          "display_name": false
        },
        {
          "uuid": "b5bc2027-55e1-4846-84be-5798d808306c",
          "name": "PERMANENT YELLOW TONER 10G",
          "stdName": "PERMANENT YELLOW TONER 10G",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7039ae6f-c536-4a38-af0c-ae43ece0c384",
            "72ff7e3b-22f4-4398-84e5-c5d9f736984c"
          ],
          "display_name": false
        },
        {
          "uuid": "c834c419-a3e4-4a73-9d85-b463ea026643",
          "name": "PIGMENT YELLOW 10G",
          "stdName": "PIGMENT YELLOW 10G",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7039ae6f-c536-4a38-af0c-ae43ece0c384",
            "72ff7e3b-22f4-4398-84e5-c5d9f736984c"
          ],
          "display_name": false
        },
        {
          "uuid": "07d24595-eaec-4f7b-8028-f82a93c902fd",
          "name": "PIGMENT YELLOW 3",
          "stdName": "PIGMENT YELLOW 3",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "031eb32f-1915-47df-8262-87ef7286d517",
            "7039ae6f-c536-4a38-af0c-ae43ece0c384",
            "3342b7cc-6662-4976-b0fa-35fbcabc9af7"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b5ba1a8e-fb01-47e6-aa43-aba28b38232a",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "84b690c1-797f-4d1e-8ede-de04761f8f99",
          "name": "TOLUIDINE YELLOW AH 177",
          "stdName": "TOLUIDINE YELLOW AH 177",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7039ae6f-c536-4a38-af0c-ae43ece0c384",
            "72ff7e3b-22f4-4398-84e5-c5d9f736984c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3342b7cc-6662-4976-b0fa-35fbcabc9af7",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7039ae6f-c536-4a38-af0c-ae43ece0c384",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72ff7e3b-22f4-4398-84e5-c5d9f736984c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15d5c116-fc48-4bd7-96dd-8810da18ce3f",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94de9f62-3397-42be-8d48-7380b9811bcb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391543000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f0505d2c-879a-4ba8-9c98-ea3879deae19",
          "citation": "SRS import [L885GOC9B6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L885GOC9B6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391543000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "031eb32f-1915-47df-8262-87ef7286d517",
          "citation": "PIGMENT YELLOW 3 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "842dc54a-66ce-4297-9af0-6510eb735279",
          "citation": "CI 11710 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4d50417c-3de4-4870-a7b7-7a93f2aa0ddf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1e75e07a-62f0-8503-01b4-4d060bcd40e8",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "5935db73-635c-85c1-5999-d131b4db5cfb",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0e4b0b68-b3cd-440b-98d1-074caea5c370",
          "id": "0e4b0b68-b3cd-440b-98d1-074caea5c370",
          "molfile": "\n  Marvin  01132100592D          \n\n 26 27  0  0  0  0            999 V2000\n   10.5216   -5.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8118   -6.0362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8118   -6.8612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0960   -5.6358    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.0960   -4.7987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3892   -4.3983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3892   -3.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6794   -3.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6794   -2.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3892   -1.9080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3892   -1.0708    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.0960   -2.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0960   -3.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8301   -3.5672    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   10.5671   -3.1668    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.8301   -4.4347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3892   -6.0362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3892   -6.8612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6794   -5.6358    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9728   -6.0362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9728   -6.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2630   -7.2950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5562   -6.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5562   -6.0362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2630   -5.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2630   -4.7987    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 17  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 13  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 25  2  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  CHG  2  14   1  15  -1\nM  END",
          "smiles": "CC(=O)C(C(=O)Nc1ccccc1Cl)/N=N/c2ccc(cc2[N+](=O)[O-])Cl",
          "formula": "C16H12Cl2N4O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "442042af-08a5-4809-9fb1-c5f3abc12de6"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "395.1974",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fbaac9b2-144a-4ad3-846a-538f75366315",
      "version": "8",
      "structure": {
        "id": "ae960b54-6bca-4b86-8e26-24471b0221f2",
        "molfile": "\n  Marvin  01132109042D          \n\n 26 27  0  0  0  0            999 V2000\n    5.5562   -6.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2630   -7.2950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2630   -4.7987    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.5562   -6.0362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9728   -6.8612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2630   -5.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9728   -6.0362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8118   -6.8612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5216   -5.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3892   -6.8612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6794   -5.6358    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8118   -6.0362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3892   -6.0362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3892   -1.0708    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.0960   -5.6358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5671   -3.1668    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.8301   -4.4347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3892   -1.9080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6794   -2.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0960   -4.7987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8301   -3.5672    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.0960   -2.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6794   -3.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3892   -4.3983    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0960   -3.1395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3892   -3.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n 19 18  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  3  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12  8  2  0  0  0  0\n 12  9  1  0  0  0  0\n 13 10  2  0  0  0  0\n 13 11  1  0  0  0  0\n 15 12  1  0  0  0  0\n 15 13  1  0  0  0  0\n 18 14  1  0  0  0  0\n 20 15  1  0  0  0  0\n 21 16  1  0  0  0  0\n 21 17  2  0  0  0  0\n 22 18  1  0  0  0  0\n 23 19  1  0  0  0  0\n 24 20  2  0  0  0  0\n 25 21  1  0  0  0  0\n 25 22  2  0  0  0  0\n 26 23  2  0  0  0  0\n 26 24  1  0  0  0  0\n 26 25  1  0  0  0  0\nM  CHG  2  16  -1  21   1\nM  END",
        "smiles": "CC(=O)C(C(=O)Nc1ccccc1Cl)/N=N/c2ccc(cc2[N+](=O)[O-])Cl",
        "formula": "C16H12Cl2N4O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "395.1974",
        "optical_activity": "( + / - )",
        "references": [
          "f0505d2c-879a-4ba8-9c98-ea3879deae19",
          "72ff7e3b-22f4-4398-84e5-c5d9f736984c"
        ],
        "stereo_centers": 1
      },
      "unii": "L885GOC9B6"
    }
  ]
}