{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6696460d-d3f8-8418-0d38-ccf00dc5d8a0", "code": "449127", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/449127", "code_system": "PUBCHEM", "references": [ "b008f984-0ac1-3950-3e22-1d1f4406bc74" ] }, { "uuid": "35bfebd9-2ea2-12c9-d49e-4e8643fac7b3", "code": "57295-49-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=57295-49-5", "code_system": "CAS", "references": [ "c4ef1bfc-298e-4536-9acb-69196a7d1c01" ] }, { "uuid": "86f568f2-7538-43c9-2c1c-0690c6d42370", "code": "DTXSID20332299", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20332299", "code_system": "EPA CompTox" }, { "uuid": "4f583673-c9e1-498f-89c2-a3771c113758", "code": "L7GWP3G5UB", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "c4ef1bfc-298e-4536-9acb-69196a7d1c01" ] } ], "substance_class": "chemical", "names": [ { "uuid": "7d34e2dd-9cd6-46d3-81f7-60636507d8d8", "name": "1H-1,2,4-Triazole, 3-(4-chlorophenyl)-5-(methylthio)-", "stdName": "1H-1,2,4-TRIAZOLE, 3-(4-CHLOROPHENYL)-5-(METHYLTHIO)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c4ef1bfc-298e-4536-9acb-69196a7d1c01" ], "display_name": false }, { "uuid": "b388b584-9a45-4e59-9103-c8655f2ac892", "name": "3-(4-Chlorophenyl)-5-(methylthio)-1H-1,2,4-triazole", "stdName": "3-(4-CHLOROPHENYL)-5-(METHYLTHIO)-1H-1,2,4-TRIAZOLE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c4ef1bfc-298e-4536-9acb-69196a7d1c01" ], "display_name": true }, { "uuid": "6a823844-7702-4355-6a6b-72bb77aa7e45", "name": "3-(4-Chlorophenyl)-5-methylsulfanyl-1H-1,2,4-triazole", "stdName": "3-(4-CHLOROPHENYL)-5-METHYLSULFANYL-1H-1,2,4-TRIAZOLE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "978638f3-b1eb-60d8-8b54-5c9355041f7c" ], "display_name": false } ], "references": [ { "uuid": "978638f3-b1eb-60d8-8b54-5c9355041f7c", "citation": "ZINC", "url": "http://zinc.docking.org/substances/subsets/in-vivo/", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "c4ef1bfc-298e-4536-9acb-69196a7d1c01", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "b008f984-0ac1-3950-3e22-1d1f4406bc74", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "605e7b1c-45a7-4705-9b8c-79bb8e9b801c", "id": "605e7b1c-45a7-4705-9b8c-79bb8e9b801c", "molfile": "\n Marvin 01132104592D \n\n 14 15 0 0 0 0 999 V2000\n 2.6570 -3.4782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5707 -2.6577 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8171 -2.3222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6455 -1.5152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 -1.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 1.4290 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4895 -2.1826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1025 -2.7347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 14 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 13 2 0 0 0 0\n 6 7 2 0 0 0 0\n 12 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 13 14 1 0 0 0 0\nM END", "smiles": "CSc1nc(-c2ccc(cc2)Cl)n[nH]1", "formula": "C9H8ClN3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "84efc07b-6dc0-4b32-9860-3d31b3c6e313" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "225.6993", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "c40fdb06-29e3-45a3-ab5f-5a02ad6bd810", "version": "7", "structure": { "id": "1d4ccf92-abd7-4a32-b242-ee89b377b350", "molfile": "ZINC000018004728\n Marvin 01132101412D \n\n 14 15 0 0 0 0 999 V2000\n 2.6570 -3.4782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5707 -2.6577 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.8171 -2.3222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.6455 -1.5152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 -1.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 1.4290 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8250 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4125 -0.7145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4895 -2.1826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1025 -2.7347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 5 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 3 1 0 0 0 0\n 12 6 1 0 0 0 0\nM END", "smiles": "CSc1nc(-c2ccc(cc2)Cl)n[nH]1", "formula": "C9H8ClN3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "225.6993", "optical_activity": "NONE", "references": [ "978638f3-b1eb-60d8-8b54-5c9355041f7c" ], "stereo_centers": 0 }, "unii": "L7GWP3G5UB" } ] }