{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bd1a825d-764c-420a-858d-06557c6066a5",
          "code": "101-61-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=101-61-1",
          "code_system": "CAS",
          "references": [
            "79e154f5-cc58-4f4f-9dc2-1203dc003b53",
            "6fc7de56-4c9e-413a-94ef-294f2a9bf423"
          ]
        },
        {
          "uuid": "400c0477-988f-456f-aa0c-9d093da02fdc",
          "code": "C035472",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67035472",
          "code_system": "MESH",
          "references": [
            "79e154f5-cc58-4f4f-9dc2-1203dc003b53"
          ]
        },
        {
          "uuid": "d980a4ef-158b-4d2c-b28f-08afca3eb1f6",
          "code": "202-959-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.691",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "79e154f5-cc58-4f4f-9dc2-1203dc003b53"
          ]
        },
        {
          "uuid": "96a673c2-abdd-407d-885a-55feac9d5353",
          "code": "m7525",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7525?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "79e154f5-cc58-4f4f-9dc2-1203dc003b53"
          ]
        },
        {
          "uuid": "7cb233ae-21d9-49a3-ae03-e0fd540d7afa",
          "code": "7567",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7567",
          "code_system": "PUBCHEM",
          "references": [
            "79e154f5-cc58-4f4f-9dc2-1203dc003b53"
          ]
        },
        {
          "uuid": "309f046f-817c-498b-94a4-ef2a57a12029",
          "code": "2856",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/2856",
          "code_system": "HSDB",
          "references": [
            "9dbfccf6-3b83-7240-701e-4f9405de72e2"
          ]
        },
        {
          "uuid": "8a928a63-be0e-631f-8a0a-aa1b24a72c84",
          "code": "DTXSID5020869",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5020869",
          "code_system": "EPA CompTox",
          "references": [
            "13b439c6-6a78-99ed-a02d-09035d6eb5a0"
          ]
        },
        {
          "uuid": "c6ec94d6-029a-72d3-af34-e6b54d85340e",
          "code": "C45178",
          "comments": "Chemical Modifier[C1932]|Carcinogen[C347]|Chemical Carcinogen[C1743]|Organic Carcinogen[C45175]|Organo-nitrogen Carcinogen[C45176]|Carcinogenic Aromatic Amine",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45178",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c636831c-f39d-5b5a-064c-4c793547e3ec"
          ]
        },
        {
          "uuid": "13197367-fa51-409b-2799-646996eeadff",
          "code": "C44402",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C44402",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1fca483b-71d4-e04e-e01d-c7196b05a3f1"
          ]
        },
        {
          "uuid": "50d2c58c-1d15-480b-bd40-6afc9a4b24f3",
          "code": "L6SPP9K4WQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fd11e645-bf00-c631-5246-83de467b2173",
          "code": "36782",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=36782",
          "code_system": "NSC",
          "references": [
            "6163a2fd-4117-ffce-638c-eeb71c4cc6c1"
          ]
        },
        {
          "uuid": "5d3cf37e-0025-1fff-b796-66f07755ef5f",
          "code": "9029",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=9029",
          "code_system": "NSC",
          "references": [
            "6163a2fd-4117-ffce-638c-eeb71c4cc6c1"
          ]
        },
        {
          "uuid": "79a856fc-7355-d09a-6b2b-e195a763b832",
          "code": "4892",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4892",
          "code_system": "NSC",
          "references": [
            "6163a2fd-4117-ffce-638c-eeb71c4cc6c1"
          ]
        },
        {
          "uuid": "e27b1b0f-fe9b-9a90-4973-0306ecf19a5d",
          "code": "300000053732",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d4e474ba-4aff-df23-d2fa-a428178ddc6d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9ff9cc1e-a90b-4ad4-adee-b601cac0e0be",
          "name": "4,4'-(DIMETHYLAMINO)DIPHENYLMETHANE",
          "stdName": "4,4'-(DIMETHYLAMINO)DIPHENYLMETHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "46bf2db6-eb2c-4733-a428-16e6bb1d534d",
          "name": "4,4'-BIS(DIMETHYLAMINO)DIPHENYLMETHANE",
          "stdName": "4,4'-BIS(DIMETHYLAMINO)DIPHENYLMETHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "f2c2f648-84ab-4e3e-8150-f6262f8edc47",
          "name": "4,4'-BIS(DIMETHYLAMINOPHENYL)METHANE",
          "stdName": "4,4'-BIS(DIMETHYLAMINOPHENYL)METHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "76a36c35-e6a9-454a-abd2-b43a45575e2e",
          "name": "4,4'-METHYLENEBIS(N,N-DIMETHYL)BENZENAMINE",
          "stdName": "4,4'-METHYLENEBIS(N,N-DIMETHYL)BENZENAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "200c9bfd-bde6-4505-b923-b00067c97779",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "7913c07b-35eb-448a-af4f-eb84bffe6b61",
          "name": "4,4'-METHYLENEBIS(N,N-DIMETHYLANILINE)",
          "stdName": "4,4'-METHYLENEBIS(N,N-DIMETHYLANILINE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "771c2e33-03ad-4c0d-9215-c74f0f8dad87",
          "name": "4,4'-METHYLENEBIS(N,N-DIMETHYLBENZENAMINE)",
          "stdName": "4,4'-METHYLENEBIS(N,N-DIMETHYLBENZENAMINE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "bdc39d13-21bc-4de4-8980-df7eda29cc3b",
          "name": "4,4'-TETRAMETHYLDIAMINODIPHENYLMETHANE",
          "stdName": "4,4'-TETRAMETHYLDIAMINODIPHENYLMETHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "288def1b-c510-4968-9a44-2d75220b474f",
          "name": "ANILINE, 4,4'-METHYLENEBIS(N,N-DIMETHYL-",
          "stdName": "ANILINE, 4,4'-METHYLENEBIS(N,N-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "205297f3-deaa-463c-941d-bfe4a38370c9",
          "name": "ARNOLD'S BASE",
          "stdName": "ARNOLD'S BASE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "2d8c0d76-90bf-4008-97ae-2c5343efaed9",
          "name": "BENZENAMINE, 4,4'-METHYLENEBIS(N,N-DIMETHYL-",
          "stdName": "BENZENAMINE, 4,4'-METHYLENEBIS(N,N-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "200c9bfd-bde6-4505-b923-b00067c97779",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "a121be44-8e77-40a6-b356-6939595d9c7b",
          "name": "BIS(4-(N,N-DIMETHYLAMINO)PHENYL)METHANE",
          "stdName": "BIS(4-(N,N-DIMETHYLAMINO)PHENYL)METHANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "a2b3ebe3-a8aa-45e3-b735-c1a915c1a490",
          "name": "BIS(P-(DIMETHYLAMINO)PHENYL)METHANE",
          "stdName": "BIS(P-(DIMETHYLAMINO)PHENYL)METHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "c07feac1-481b-4e9b-b01a-034852136435",
          "name": "MICHLER'S BASE",
          "stdName": "MICHLER'S BASE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "200c9bfd-bde6-4505-b923-b00067c97779",
            "c9af5c5e-b5c7-4ee3-8e81-713bd44a589e",
            "0c33251f-982a-4352-9fee-8037329b976b",
            "d0d2325d-d2c8-4269-b50a-5c62ecf61324"
          ],
          "display_name": true
        },
        {
          "uuid": "ccdac093-76ed-4f2b-bea1-a41099d3bd19",
          "name": "MICHLER'S BASE [MI]",
          "stdName": "MICHLER'S BASE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0c33251f-982a-4352-9fee-8037329b976b",
            "d0d2325d-d2c8-4269-b50a-5c62ecf61324"
          ],
          "display_name": false
        },
        {
          "uuid": "cc770016-e3aa-42f5-88f6-9fcea20b9c06",
          "name": "MICHLER'S HYDRIDE",
          "stdName": "MICHLER'S HYDRIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "af8f7a48-1d2e-4556-98ae-ca1f33f61ebd",
          "name": "MICHLER'S METHANE",
          "stdName": "MICHLER'S METHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "8e490f54-7829-4aec-acb6-88c0d7010d4c",
          "name": "N,N,N',N'-TETRAMETHYL-4,4'-DIAMINODIPHENYLMETHANE",
          "stdName": "N,N,N',N'-TETRAMETHYL-4,4'-DIAMINODIPHENYLMETHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "30e10d38-c3af-4e25-8001-ac8ef63c0de1",
          "name": "N,N,N',N-TETRAMETHYL-4,4'-METHYLENEDIANILINE",
          "stdName": "N,N,N',N-TETRAMETHYL-4,4'-METHYLENEDIANILINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "152682c2-1500-4961-82bd-ad64ae5d7017",
          "name": "NSC-36782",
          "stdName": "NSC-36782",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "cbfd6afb-c8bd-4859-9a5a-b26a49c32ee9",
          "name": "NSC-4892",
          "stdName": "NSC-4892",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "5783531e-ac51-4160-a3a2-f4fff6104dfc",
          "name": "NSC-9029",
          "stdName": "NSC-9029",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "0ca0c2ef-b029-416c-b859-292b8220f605",
          "name": "P,P'-BIS(DIMETHYLAMINO)DIPHENYLMETHANE",
          "stdName": "P,P'-BIS(DIMETHYLAMINO)DIPHENYLMETHANE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "71d86086-8b4b-4eb8-aaa0-09c2170a20ea",
          "name": "REDUCED MICHLER'S KETONE",
          "stdName": "REDUCED MICHLER'S KETONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        },
        {
          "uuid": "9038edec-cfa3-4983-943b-c73f9b9d4370",
          "name": "TETRABASE",
          "stdName": "TETRABASE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de212a3b-d040-4121-8f4e-2028bb7df742",
            "0c33251f-982a-4352-9fee-8037329b976b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "200c9bfd-bde6-4505-b923-b00067c97779",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0c33251f-982a-4352-9fee-8037329b976b",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de212a3b-d040-4121-8f4e-2028bb7df742",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0d2325d-d2c8-4269-b50a-5c62ecf61324",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79e154f5-cc58-4f4f-9dc2-1203dc003b53",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391631000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b6874c2-b651-4db7-8efb-6b440e1100eb",
          "citation": "SRS import [L6SPP9K4WQ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L6SPP9K4WQ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391631000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35db659e-d4f6-4a00-b5e4-d989c5f09790",
          "citation": "CHEMID RECORD 101-61-1",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9af5c5e-b5c7-4ee3-8e81-713bd44a589e",
          "citation": "MICHLER'S BASE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9dbfccf6-3b83-7240-701e-4f9405de72e2",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+101-61-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "13b439c6-6a78-99ed-a02d-09035d6eb5a0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=101-61-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c636831c-f39d-5b5a-064c-4c793547e3ec",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1fca483b-71d4-e04e-e01d-c7196b05a3f1",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "6fc7de56-4c9e-413a-94ef-294f2a9bf423",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6163a2fd-4117-ffce-638c-eeb71c4cc6c1",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d4e474ba-4aff-df23-d2fa-a428178ddc6d",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b9a1671c-20d0-42a8-b187-2e0488544442",
          "id": "b9a1671c-20d0-42a8-b187-2e0488544442",
          "molfile": "\n  Marvin  01132109362D          \n\n 19 20  0  0  0  0            999 V2000\n   -2.8597    1.3857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8597    0.5583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5727    0.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1428    0.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1448   -0.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4299   -1.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7109   -0.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0020   -1.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7149   -0.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4238   -1.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1448   -0.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1448    0.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4238    0.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7149    0.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8557    0.5583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8557    1.3857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5767    0.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7109    0.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4299    0.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n 19  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 18  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 12 15  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "CN(C)c1ccc(cc1)Cc2ccc(cc2)N(C)C",
          "formula": "C17H22N2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a115c9e4-cfde-4213-8f53-0aac07b04cb4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "254.3706",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0e4138c5-03d6-49d1-b9df-00a9710fdd9d",
      "version": "11",
      "structure": {
        "id": "823c6e20-37c9-4815-b513-8f868f64324b",
        "molfile": "\n  Marvin  01132106452D          \n\n 19 20  0  0  0  0            999 V2000\n   -0.7109   -0.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0020   -1.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4299   -1.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7109    0.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7149   -0.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1448   -0.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4299    0.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4238   -1.0824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7149    0.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1428    0.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1448   -0.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4238    0.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8597    0.5583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1448    0.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.8597    1.3857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5727    0.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8557    0.5583    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8557    1.3857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5767    0.1506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  2  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  2  0  0  0  0\n  5  8  2  0  0  0  0\n  5  9  1  0  0  0  0\n  6 10  2  0  0  0  0\n  8 11  1  0  0  0  0\n  9 12  2  0  0  0  0\n 10 13  1  0  0  0  0\n 11 14  2  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n  7 10  1  0  0  0  0\n 12 14  1  0  0  0  0\nM  END",
        "smiles": "CN(C)c1ccc(cc1)Cc2ccc(cc2)N(C)C",
        "formula": "C17H22N2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "254.3706",
        "optical_activity": "NONE",
        "references": [
          "35db659e-d4f6-4a00-b5e4-d989c5f09790",
          "0b6874c2-b651-4db7-8efb-6b440e1100eb"
        ],
        "stereo_centers": 0
      },
      "unii": "L6SPP9K4WQ"
    }
  ]
}