{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7448e677-0bc1-4706-afce-c6924447998f",
          "code": "QJ05AH01",
          "comments": "VATC|ANTIVIRALS FOR SYSTEMIC USE|DIRECT ACTING ANTIVIRALS|Neuraminidase inhibitors|zanamivir",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QJ05AH01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "a31169be-525b-4e23-9682-b34ac8c1ae73"
          ]
        },
        {
          "uuid": "a4b305e7-5958-4138-b512-698f0382935d",
          "code": "139110-80-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=139110-80-8",
          "code_system": "CAS",
          "references": [
            "a31169be-525b-4e23-9682-b34ac8c1ae73",
            "84a0df5f-ed38-4f5b-8d34-f36b73c749f4"
          ]
        },
        {
          "uuid": "78eb0275-b371-40ad-8d08-53eb0be82b39",
          "code": "C47786",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47786",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a31169be-525b-4e23-9682-b34ac8c1ae73"
          ]
        },
        {
          "uuid": "402794cd-cb00-4825-a45b-ec9542e45fed",
          "code": "NBK548527",
          "comments": "LiverTox|Antimicrobial|Antiviral: Influenza|Neuraminidase inhibitor",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548527/",
          "code_system": "LIVERTOX",
          "references": [
            "da2fde00-ca6d-36a4-6a1e-8c5e77072c89"
          ]
        },
        {
          "uuid": "aa2e5279-d127-4d22-805b-9dbaca066c78",
          "code": "D053243",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68053243",
          "code_system": "MESH",
          "references": [
            "a31169be-525b-4e23-9682-b34ac8c1ae73"
          ]
        },
        {
          "uuid": "090595a9-dcb8-4b29-9146-c08e9d5feb1d",
          "code": "ZANAMIVIR",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Zanamivir",
          "code_system": "WIKIPEDIA",
          "references": [
            "a31169be-525b-4e23-9682-b34ac8c1ae73"
          ]
        },
        {
          "uuid": "2bb847b7-da59-436a-9d83-6346dce526bb",
          "code": "SUB00137MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a31169be-525b-4e23-9682-b34ac8c1ae73"
          ]
        },
        {
          "uuid": "5c62adc6-0a48-4430-9296-c2bc72d860d1",
          "code": "7272",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=7272",
          "code_system": "INN",
          "references": [
            "a31169be-525b-4e23-9682-b34ac8c1ae73"
          ]
        },
        {
          "uuid": "c79e529e-81aa-42f2-b004-a62c36d0a631",
          "code": "69722",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/69722/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a31169be-525b-4e23-9682-b34ac8c1ae73"
          ]
        },
        {
          "uuid": "9a3c8a50-e6e4-4916-9d13-800f3a613828",
          "code": "m11581",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11581?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a31169be-525b-4e23-9682-b34ac8c1ae73"
          ]
        },
        {
          "uuid": "9cbb30b2-b705-49e9-8a19-8b0611730277",
          "code": "CHEMBL222813",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL222813",
          "code_system": "ChEMBL",
          "references": [
            "a31169be-525b-4e23-9682-b34ac8c1ae73"
          ]
        },
        {
          "uuid": "0ecd9857-6c63-4a43-9861-f56002378cba",
          "code": "60855",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/60855",
          "code_system": "PUBCHEM",
          "references": [
            "a31169be-525b-4e23-9682-b34ac8c1ae73"
          ]
        },
        {
          "uuid": "c94c18c4-39fa-4905-879b-9fa79492c579",
          "code": "DB00558",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00558",
          "code_system": "DRUG BANK",
          "references": [
            "a31169be-525b-4e23-9682-b34ac8c1ae73"
          ]
        },
        {
          "uuid": "ad5cc3e1-6eaa-45bf-9d20-5c06d104c603",
          "code": "J05AH01",
          "comments": "ATC|ANTIINFECTIVES FOR SYSTEMIC USE|ANTIVIRALS FOR SYSTEMIC USE|DIRECT ACTING ANTIVIRALS|Neuraminidase inhibitors|zanamivir",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=J05AH01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "a31169be-525b-4e23-9682-b34ac8c1ae73"
          ]
        },
        {
          "uuid": "46c585fb-7ad6-431f-862f-55c061f196a6",
          "code": "N0000175436",
          "comments": "Cellular or Molecular Interactions [MoA]|Enzyme Interactions [MoA]|Enzyme Inhibitors [MoA]|Neuraminidase Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175436",
          "code_system": "NDF-RT",
          "references": [
            "a31169be-525b-4e23-9682-b34ac8c1ae73"
          ]
        },
        {
          "uuid": "4620134a-481e-4ecf-8843-f6f15dbcd204",
          "code": "N0000175524",
          "comments": "Established Pharmacologic Class [EPC]|Neuraminidase Inhibitor [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175524",
          "code_system": "NDF-RT",
          "references": [
            "a31169be-525b-4e23-9682-b34ac8c1ae73"
          ]
        },
        {
          "uuid": "de20a1da-35c3-5523-03f8-193d9ca371ba",
          "code": "7437",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7437",
          "code_system": "HSDB",
          "references": [
            "16f5944e-b75e-6f89-65fe-29a6c30b7f71"
          ]
        },
        {
          "uuid": "8e58fe2f-6c62-aba9-57fb-e74714e9856a",
          "code": "DTXSID0023749",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0023749",
          "code_system": "EPA CompTox",
          "references": [
            "edffd6c5-1096-a5d8-26db-d59f9edeee08"
          ]
        },
        {
          "uuid": "5f39b4aa-f35a-742c-47d0-71604deb95ef",
          "code": "C281",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antiviral Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C281",
          "code_system": "NCI_THESAURUS",
          "references": [
            "da2fde00-ca6d-36a4-6a1e-8c5e77072c89"
          ]
        },
        {
          "uuid": "5170cd4f-3fd2-48b9-a18e-c4b085bfb39f",
          "code": "L6O3XI777I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "faa6cab3-b049-a682-88d7-1d213743d99e",
          "code": "Zanamivir",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM717/",
          "code_system": "LACTMED",
          "references": [
            "da2fde00-ca6d-36a4-6a1e-8c5e77072c89"
          ]
        },
        {
          "uuid": "f17c8b46-b896-918d-1bd1-c1866f8a4056",
          "code": "2859",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2859",
          "code_system": "DRUG CENTRAL",
          "references": [
            "da2fde00-ca6d-36a4-6a1e-8c5e77072c89"
          ]
        },
        {
          "uuid": "5203da66-c190-9e92-ecc1-5d8e12abb3df",
          "code": "1724088",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1724088",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "da2fde00-ca6d-36a4-6a1e-8c5e77072c89"
          ]
        },
        {
          "uuid": "cde6dacc-a97a-6737-b889-8db35eb37d38",
          "code": "50663",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:50663",
          "code_system": "CHEBI",
          "references": [
            "da2fde00-ca6d-36a4-6a1e-8c5e77072c89"
          ]
        },
        {
          "uuid": "86daf83d-702e-e3bf-f71a-e0b30eab0077",
          "code": "GG-107",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/GG-107/relevant/1/",
          "code_system": "USAN",
          "references": [
            "ae968eca-46ee-fb33-8bd3-6ba4c136893e"
          ]
        },
        {
          "uuid": "67a7de9d-d120-88b0-3206-be54919be430",
          "code": "L6O3XI777I",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=L6O3XI777I",
          "code_system": "DAILYMED",
          "references": [
            "3ccac470-89e9-156d-5085-62d1db4afcec"
          ]
        },
        {
          "uuid": "3256a24a-5a1b-0d7d-8d93-663b27ae4b30",
          "code": "100000093415",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "976ce0ac-7b2d-cb49-ca6a-f537f629eb90"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "2c0f4402-67d6-4779-a5eb-a066ea4ee0b3",
          "citation": "USP42-NF37 - 4628, Zanamivir Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "27857438-0bad-41b6-b42c-6deadd0b4921",
          "citation": "USP42-NF37 - 4628, Zanamivir Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e2d38fde-f105-4774-9373-3b1248b274c1",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cd3e2165-9369-4f81-8e62-fdfe5951a0bd",
          "citation": "USP DICTIONARY 2013",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e7dc3a2-6397-4560-abb7-4bc8f3cabd7e",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c8337276-1569-41f5-9427-54ebb66434aa",
          "citation": "INN Proposed List 72",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL72.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ede9b6a8-a1e3-47d6-ab6b-19c0ef938e25",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ea59957-a786-4e01-a544-a1a926667227",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad037b67-55e8-4eb1-b620-0b67a83a21e5",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aeda4ce5-0476-48de-99ef-fc438f5912d3",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f72a4147-ca4c-4dfa-8b11-3d401e97a9b7",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "540c0ec1-6476-4f4c-9535-4f663ade438d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a841028b-891f-4807-b528-7205ea9d2413",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2078c79-b187-446c-b82f-81fc4a2f1bc0",
          "citation": "http://www.nature.com/nrd/journal/v5/n12/fig_tab/nrd2175_F5.html",
          "url": "http://www.nature.com/nrd/journal/v5/n12/fig_tab/nrd2175_F5.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ff6551a-c786-4f6a-ad45-e88766b2413b",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cdcd30e-1a7e-4c08-8a9e-aa059249fefd",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a31169be-525b-4e23-9682-b34ac8c1ae73",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390467000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f6570ae-8d6b-49bf-8d08-e9e2941d8825",
          "citation": "ZANAMIVIR \\\\n MONOGRAPH [USP 39]",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96500874-fd7d-4ead-a79b-7fbe544157e6",
          "citation": "SRS import [L6O3XI777I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L6O3XI777I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390467000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3780cdad-40f3-423d-b14a-df4210203001",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0323135c-507a-4da2-87ff-292213966e94",
          "citation": "ZANAMIVIR [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8a1b5fad-653d-47d1-9ab4-5f475db654a7",
          "citation": "ZANAMIVIR [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4f335d1c-2856-4a5b-9880-41fe8c6efcc5",
          "citation": "ZANAMIVIR [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "429f18b8-8099-4ae5-984d-dff0474466b8",
          "citation": "ZANAMIVIR [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "989e7a43-a770-48d8-99e4-be4190b0fe9a",
          "citation": "ZANAMIVIR [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae3bda09-3413-4b8c-b7d0-ebbf5bd55b69",
          "citation": "ZANAMIVIR [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4e7615cd-83d3-49d5-9ac6-ccdc58000dde",
          "citation": "ZANAMIVIR [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "78bf5bd0-9fdb-44f5-bfdc-46bf0b081331",
          "citation": "ZANAMIVIR [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6b5dcd03-8387-4972-8acb-c2a0a31b032a",
          "citation": "ZANAMIVIR [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1b954ef7-0741-114e-7a32-cf2bbdf8ae63",
          "citation": "https://www.clinicalkey.com/pharmacology/monograph/2259?sec=monphar",
          "doc_type": "CLINICAL PHARMACOLOGY",
          "public_domain": true
        },
        {
          "uuid": "16f5944e-b75e-6f89-65fe-29a6c30b7f71",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+139110-80-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "edffd6c5-1096-a5d8-26db-d59f9edeee08",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=139110-80-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6a5e347a-fb3f-39f0-f84b-9db7f9fdb719",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+139110-80-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "da2fde00-ca6d-36a4-6a1e-8c5e77072c89",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4c970d6c-5fbb-e7ad-ad1b-05f9596818f4",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/nda/99/021036-clinpharm1.pdf",
          "doc_type": "NDA PUBLIC REVIEW",
          "public_domain": true
        },
        {
          "uuid": "ae968eca-46ee-fb33-8bd3-6ba4c136893e",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "84a0df5f-ed38-4f5b-8d34-f36b73c749f4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "90e27777-e06b-4cb6-97ce-9c2976b3f65d",
          "citation": "USP42-NF37 - 4628, Zanamivir Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5d7a1d0a-6b6d-4ed8-a2a1-6ba0cee0b66b",
          "citation": "USP42-NF37 - 4628, Zanamivir Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fd948199-1528-97f6-e7c9-779b774f3d82",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "cae1a78a-18f6-4c8f-9cf7-4aa725eb77f5",
          "citation": "Groaz, Elisabetta, Erik De Clercq, and Piet Herdewijn. \"Anno 2021: Which antivirals for the coming decade?.\" Annual Reports in Medicinal Chemistry. Vol. 57. Academic Press, 2021. 49-107.",
          "url": "https://pdf.sciencedirectassets.com/273013/1-s2.0-S0065774321X00036/1-s2.0-S0065774321000208/main.pdf?X-Amz-Security-Token=IQoJb3JpZ2luX2VjEHEaCXVzLWVhc3QtMSJHMEUCIQCtcSrzrmUNP8LoaEhQl5QiwVE1vO%2BLLfeDoETPVugxEAIgVzTNOqSBfh65w0gAimjxKDbz5Ezh8Bw1F0dPp5BtHiwq%2BgMIahAEGgwwNTkwMDM1NDY4NjUiDKx1NeDKRPAETxgekCrXA1q3mhT4Lxk6ip6r%2FpTFWYwH%2FuzX4ApkAL5EieLp3WrIn%2B%2BoQikZ4XXQhVCiU0LDgEzJ5a5HRGJEls5aI2LZWLCmg8lLpcVmILGx6Aw5yK5rC%2B7L6OIXqln8kCKoHpRf%2F9XaKlGTaLR3ucJ4vgVauEEyiIqiDSoLQc3fghLzht4L%2BVR5BE9W2i4oo0Xcm29Iizl8lVPMXjGOF60IJYNUpHqrAhSkMVPjbapLz9D1KjMLBnQppA8EkfajdHOBAwSgT%2BrevtAsW6MfXDQ40LLhMvdghJn0q1kw%2FXJ4mIqqDc1m1jgdRD%2BmY3azYZpDVVhz7CoJIDEJfoZEAv9TT3XOWO4x%2FlcOgG2k6mRhf6d0VrJgcGJFIsptEdeUwzg19Gi%2B%2Bi4eYXG7XHEme3QwfdXHFIF8puhUhNrPdnPn7PBMVS43zL%2FHPuLVYLVLWYjmHKh%2FcltbCRdfhj9IyD7seNKKTr5JNjhjkNS9fGHKkPX6c3WJ9P%2FQWLzhEmwlnIeQTGm2tFMLDvKMPzIPqU51MJP2RUv5M7HMeIwmBfmD4vTblzlbjpqm9wRv2uyIrnSfSfAj7LO7sOx3%2Fj6Ce3OJZDq4DgbvtMorqB7JZSVGu6qsWODICAk0UN1YrDCm2ZmOBjqlARjiIga%2F%2FH1YIDd62a%2BFsx6IfEpDrsKIxz8qj1vgp7I7MqoD%2BiiA%2BYA5UkGkw1j%2FVLfZgWgmCxpiRiMmthzOFpp4XpZD%2BzZqLMOP1g1Hy7RDH3uKsvmwG2wAiDTT8IHq3n0oanN4iOqlnlTngVaykcszy%2Bb7VZHNteGftluYe9SVHPNvlIcgNo4g5lsy6Hwzag8OwMpYi8qgw6bahYnw3eOdZtuSbQ%3D%3D&X-Amz-Algorithm=AWS4-HMAC-SHA256&X-Amz-Date=20211225T021759Z&X-Amz-SignedHeaders=host&X-Amz-Expires=300&X-Amz-Credential=ASIAQ3PHCVTYZXH4AB6A%2F20211225%2Fus-east-1%2Fs3%2Faws4_request&X-Amz-Signature=d8d7c9be4046f007ca859ee130a95feb500a0574be95da51525705f775e391d2&hash=cc44a0f277a9f315eecd27f786071a8bdfad703a21221f7e70424050369a7bf0&host=68042c943591013ac2b2430a89b270f6af2c76d8dfd086a07176afe7c76c2c61&pii=S0065774321000208&tid=spdf-861148de-860f-4240-b8d2-f595ba441103&sid=c346977184e90043ea5b963-faf995818be3gxrqa&type=client",
          "doc_type": "BOOK",
          "public_domain": true
        },
        {
          "uuid": "1289f531-d790-2cd5-60d7-398627355fe4",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "3ccac470-89e9-156d-5085-62d1db4afcec",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "976ce0ac-7b2d-cb49-ca6a-f537f629eb90",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8c3f83cc-1e63-4735-a344-52b6aebee81d",
          "id": "8c3f83cc-1e63-4735-a344-52b6aebee81d",
          "molfile": "\n  Marvin  01132107172D          \n\n 23 23  0  0  1  0            999 V2000\n   10.4587   -5.1695    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.9284   -4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2712   -5.0263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5534   -4.2510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1765   -5.9447    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.7068   -6.5767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3641   -6.0880    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.3641   -5.2630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6496   -4.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9351   -5.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9351   -6.0880    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.2207   -6.5005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5062   -6.0880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7917   -6.5005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5062   -5.2630    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6496   -6.5005    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.6496   -7.3255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9351   -7.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2207   -7.3255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9351   -8.5630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6496   -4.0255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3640   -3.6130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9351   -3.6130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  1  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  1  0  0  0\n 16  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n  9 21  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  1  0  0  0\n 16 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 16 17  1  6  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)N[C@@H]1[C@H](C=C(C(=O)O)O[C@H]1[C@@H]([C@@H](CO)O)O)NC(=N)N",
          "formula": "C12H20N4O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5de10a2b-fec4-434c-94d4-ca240af9fec8"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "332.3103",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3c3a6b02-c23e-4f63-8ff4-37c1559fa99e",
      "version": "41",
      "structure": {
        "id": "bda7ac2c-dedd-479c-94cc-00d924d120ee",
        "molfile": "\n  Marvin  01132109482D          \n\n 24 24  0  0  1  0            999 V2000\n    8.6496   -7.3255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6496   -6.5005    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9351   -6.0880    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.2207   -6.5005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5062   -6.0880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7917   -6.5005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5062   -5.2630    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9351   -5.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6496   -4.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6496   -4.0255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3640   -3.6130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9351   -3.6130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3641   -5.2630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3641   -6.0880    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.6462   -6.8633    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1765   -5.9447    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.7068   -6.5767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4587   -5.1695    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.9284   -4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2712   -5.0263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5534   -4.2510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9351   -7.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9351   -8.5630    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2207   -7.3255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  1  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  3  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14 13  1  0  0  0  0\n  2 14  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  1  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  6  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n  1 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 22 24  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)N[C@@H]1[C@H](C=C(C(=O)O)O[C@@]1([H])[C@@H]([C@@H](CO)O)O)NC(=N)N",
        "formula": "C12H20N4O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "332.3103",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "3780cdad-40f3-423d-b14a-df4210203001",
          "96500874-fd7d-4ead-a79b-7fbe544157e6",
          "c8337276-1569-41f5-9427-54ebb66434aa"
        ],
        "stereo_centers": 5
      },
      "unii": "L6O3XI777I",
      "relationships": [
        {
          "uuid": "a94b4055-bb46-4f08-8699-480f2548774c",
          "amount": {
            "uuid": "82deeb1d-7555-4b48-b3a2-b8f94836f523"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d333f363-eed5-4dec-bbc8-3f2be7e9c664",
            "refuuid": "3c3a6b02-c23e-4f63-8ff4-37c1559fa99e",
            "name": "ZANAMIVIR",
            "unii": "L6O3XI777I",
            "linking_id": "L6O3XI777I",
            "ref_pname": "ZANAMIVIR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7b9b34bd-7ebd-48f8-b385-936354716cae",
          "amount": {
            "uuid": "e2881646-9896-417a-afcc-356bdff2fe71",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.5
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "9f6570ae-8d6b-49bf-8d08-e9e2941d8825",
            "2c0f4402-67d6-4779-a5eb-a066ea4ee0b3"
          ],
          "related_substance": {
            "uuid": "d93bc0c4-0241-47d6-82a2-2465b53f99d5",
            "refuuid": "f25053d5-1b5a-4a4c-88a9-c06404dc88e6",
            "name": "ZANAMIVIR DIMER",
            "unii": "DNF75389IT",
            "linking_id": "DNF75389IT",
            "ref_pname": "ZANAMIVIR DIMER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "59cace49-6ce3-4bd3-a43d-fa4d16271661",
          "amount": {
            "uuid": "c1327b8a-9b17-48c9-91ad-a81d9e39be61",
            "low": 10,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "1b954ef7-0741-114e-7a32-cf2bbdf8ae63"
          ],
          "related_substance": {
            "uuid": "7186860b-c5ad-4307-82b6-878a1a44e2bd",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2e2c7953-f675-4a87-92b3-839413dc3fe6",
          "amount": {
            "uuid": "d9d9dff2-24d1-481c-8d39-66c8201e40a2",
            "type": "MOLE PERCENT OF AMOUNT ADMINISTERED",
            "average": 98,
            "units": "%"
          },
          "comments": "IV ADMINISTERED DRUG",
          "qualification": "URINE",
          "type": "EXCRETED UNCHANGED",
          "references": [
            "4c970d6c-5fbb-e7ad-ad1b-05f9596818f4"
          ],
          "related_substance": {
            "uuid": "c59c1d46-c734-4421-98d7-6e5240a17a94",
            "refuuid": "3c3a6b02-c23e-4f63-8ff4-37c1559fa99e",
            "name": "ZANAMIVIR",
            "unii": "L6O3XI777I",
            "linking_id": "L6O3XI777I",
            "ref_pname": "ZANAMIVIR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8b424a86-f020-433b-b4a8-60f1bd7e34a8",
          "amount": {
            "uuid": "4fe69c21-16fa-4c26-afe3-1e250eb944c6",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "90e27777-e06b-4cb6-97ce-9c2976b3f65d"
          ],
          "related_substance": {
            "uuid": "04836ffe-bb7e-4c58-8dff-6730803b415e",
            "refuuid": "b6b2c6b4-839a-4797-8d8f-70eee00c3fcc",
            "name": "ZANAMIVIR UREA ANALOG",
            "unii": "M4C0CG6JQ9",
            "linking_id": "M4C0CG6JQ9",
            "ref_pname": "ZANAMIVIR UREA ANALOG"
          }
        },
        {
          "uuid": "2e4b748f-39bf-4cb9-970f-9785ea719fb6",
          "amount": {
            "uuid": "1bb1ab02-dbbe-4358-b171-e6b638a89efe",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.01
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "2c0f4402-67d6-4779-a5eb-a066ea4ee0b3"
          ],
          "related_substance": {
            "uuid": "c365c4b0-7111-4164-b6db-a0085350fef0",
            "refuuid": "302e210d-8923-4ccb-928d-c0ef9852928e",
            "name": "1H-IMIDAZOLE-1-CARBOXIMIDAMIDE",
            "unii": "8ZEE9HCZ44",
            "linking_id": "8ZEE9HCZ44",
            "ref_pname": "1H-IMIDAZOLE-1-CARBOXIMIDAMIDE"
          }
        },
        {
          "uuid": "36d54921-3f67-42a3-be19-9934e7e092d5",
          "amount": {
            "uuid": "e6b329af-f4a8-4b84-aff7-a27f7c80a300",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "27857438-0bad-41b6-b42c-6deadd0b4921"
          ],
          "related_substance": {
            "uuid": "2335e132-6e53-4c59-b264-039a37b8a988",
            "refuuid": "74c4963e-4bbc-42ea-b8a4-6d3cc26d0f9a",
            "name": "4-AMINO ZANAMIVIR",
            "unii": "4L2S7ZLG0Q",
            "linking_id": "4L2S7ZLG0Q",
            "ref_pname": "4-AMINO ZANAMIVIR"
          }
        },
        {
          "uuid": "74f4488d-c747-4f09-9e6e-74f787e6cdfe",
          "amount": {
            "uuid": "46612de7-a190-4429-acbb-be960d0a9b06",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.3
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "5d7a1d0a-6b6d-4ed8-a2a1-6ba0cee0b66b"
          ],
          "related_substance": {
            "uuid": "bb39ca50-d4b1-4fe5-9a99-d6e6589245bc",
            "refuuid": "36976870-3b6a-486b-b775-412a35922d36",
            "name": "O-TRIAZINYL ZANAMIVIR",
            "unii": "S5G7P6V66M",
            "linking_id": "S5G7P6V66M",
            "ref_pname": "O-TRIAZINYL ZANAMIVIR"
          }
        },
        {
          "uuid": "dc1a2c34-5cae-be23-63bc-1e9cde7775a6",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "84a0df5f-ed38-4f5b-8d34-f36b73c749f4"
          ],
          "related_substance": {
            "uuid": "df84d7df-bb59-45a4-86de-43024aa06d42",
            "refuuid": "33980853-03de-441d-b7a7-8e7923cda7db",
            "name": "ZANAMIVIR HYDRATE",
            "unii": "9E25RDB1Q0",
            "linking_id": "9E25RDB1Q0",
            "ref_pname": "ZANAMIVIR HYDRATE"
          }
        },
        {
          "uuid": "373404c8-6e38-4be5-b619-24a2da5f47a5",
          "amount": {
            "uuid": "0958561c-efba-4dc1-b997-af56320eda4b"
          },
          "type": "TARGET ORGANISM->INHIBITOR",
          "references": [
            "cae1a78a-18f6-4c8f-9cf7-4aa725eb77f5"
          ],
          "related_substance": {
            "uuid": "91482fb7-ab70-42a8-8de7-a4961db44305",
            "refuuid": "685b19b9-46a2-4430-8e52-4a08550f8e3b",
            "name": "INFLUENZA B VIRUS WHOLE",
            "unii": "1314JZ2X6W",
            "linking_id": "1314JZ2X6W",
            "ref_pname": "INFLUENZA B VIRUS WHOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "67b8c412-4b4b-46cd-ad62-f941bf50a2f8",
          "amount": {
            "uuid": "d3709c8b-f3bb-4d8d-be1e-35de4748b621"
          },
          "type": "TARGET ORGANISM->INHIBITOR",
          "references": [
            "cae1a78a-18f6-4c8f-9cf7-4aa725eb77f5"
          ],
          "related_substance": {
            "uuid": "1a6c438a-1b03-46f5-89c5-b8822def053b",
            "refuuid": "2b89d8ab-ed5f-4a61-bd29-9ebe300bcf49",
            "name": "INFLUENZA A VIRUS WHOLE",
            "unii": "R9HH0NDE2E",
            "linking_id": "R9HH0NDE2E",
            "ref_pname": "INFLUENZA A VIRUS WHOLE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d8ec7cc0-5bf4-45c8-a9a2-3d11654d25d6",
          "amount": {
            "uuid": "a0ae4523-f530-4dbf-9a28-4cbb9c2c12ee"
          },
          "type": "CONJUGATE->CONJUGATE COMPONENT",
          "related_substance": {
            "uuid": "d1dbd28e-f86f-45e3-b175-1c72efa03fb3",
            "refuuid": "840ad594-88ec-49e8-b980-ba0c23c4893a",
            "name": "Efitazanamivir alfa",
            "unii": "7CA5JND7QE",
            "linking_id": "7CA5JND7QE",
            "ref_pname": "Efitazanamivir alfa",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "a317d210-2896-476b-af2a-11b1f9f3c9b6",
          "name": "5-(ACETYLAMINO)-4-((AMINOIMINOMETHYL)-AMINO)-2,6-ANHYDRO-3,4,5-TRIDEOXY-D-GLYCERO-D-GALACTO-NON-2-ENONIC ACID",
          "stdName": "5-(ACETYLAMINO)-4-((AMINOIMINOMETHYL)-AMINO)-2,6-ANHYDRO-3,4,5-TRIDEOXY-D-GLYCERO-D-GALACTO-NON-2-ENONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2d38fde-f105-4774-9373-3b1248b274c1"
          ],
          "display_name": false
        },
        {
          "uuid": "3f6aafa5-6693-4fe5-a022-b6d4d27bd6a3",
          "name": "D-GLYCERO-D-GALACTO-NON-2-ENONIC ACID, 5-(ACETYLAMINO)-4-((AMINOIMINOMETHYL)AMINO)-2,6-ANHYDRO-3,4,5-TRIDEOXY-",
          "stdName": "D-GLYCERO-D-GALACTO-NON-2-ENONIC ACID, 5-(ACETYLAMINO)-4-((AMINOIMINOMETHYL)AMINO)-2,6-ANHYDRO-3,4,5-TRIDEOXY-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2d38fde-f105-4774-9373-3b1248b274c1"
          ],
          "display_name": false
        },
        {
          "uuid": "f8817dbc-dc75-42a2-a77b-17db36356971",
          "name": "GG-167",
          "stdName": "GG-167",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f2078c79-b187-446c-b82f-81fc4a2f1bc0"
          ],
          "display_name": false
        },
        {
          "uuid": "cb53fb68-707f-4238-993c-0b13e46e8947",
          "name": "GG167",
          "stdName": "GG167",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ff6551a-c786-4f6a-ad45-e88766b2413b"
          ],
          "display_name": false
        },
        {
          "uuid": "e78bfea9-f7ad-42c6-ad0c-e1d79d024de0",
          "name": "GR 121167X",
          "stdName": "GR 121167X",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1cdcd30e-1a7e-4c08-8a9e-aa059249fefd"
          ],
          "display_name": false
        },
        {
          "uuid": "a9035f1e-7740-4f12-ace9-b7edac9f9681",
          "name": "GR-121167",
          "stdName": "GR-121167",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1ff6551a-c786-4f6a-ad45-e88766b2413b"
          ],
          "display_name": false
        },
        {
          "uuid": "917247e4-b63c-4421-aca3-817218527ead",
          "name": "GR-121167X",
          "stdName": "GR-121167X",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd3e2165-9369-4f81-8e62-fdfe5951a0bd"
          ],
          "display_name": false
        },
        {
          "uuid": "e12f3b4b-9234-41a2-964d-bafb9dade350",
          "name": "RELENZA",
          "stdName": "RELENZA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2d38fde-f105-4774-9373-3b1248b274c1"
          ],
          "display_name": false
        },
        {
          "uuid": "37ad1d4d-57e3-410f-81ce-d712e2a300f9",
          "name": "ZANAMIVIR",
          "stdName": "ZANAMIVIR",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0323135c-507a-4da2-87ff-292213966e94",
            "c8337276-1569-41f5-9427-54ebb66434aa",
            "989e7a43-a770-48d8-99e4-be4190b0fe9a",
            "6b5dcd03-8387-4972-8acb-c2a0a31b032a",
            "540c0ec1-6476-4f4c-9535-4f663ade438d",
            "ae3bda09-3413-4b8c-b7d0-ebbf5bd55b69",
            "f72a4147-ca4c-4dfa-8b11-3d401e97a9b7",
            "7ea59957-a786-4e01-a544-a1a926667227",
            "e2d38fde-f105-4774-9373-3b1248b274c1",
            "4f335d1c-2856-4a5b-9880-41fe8c6efcc5",
            "aeda4ce5-0476-48de-99ef-fc438f5912d3",
            "ede9b6a8-a1e3-47d6-ab6b-19c0ef938e25",
            "429f18b8-8099-4ae5-984d-dff0474466b8",
            "78bf5bd0-9fdb-44f5-bfdc-46bf0b081331",
            "ad037b67-55e8-4eb1-b620-0b67a83a21e5",
            "4e7615cd-83d3-49d5-9ac6-ccdc58000dde",
            "8a1b5fad-653d-47d1-9ab4-5f475db654a7",
            "a841028b-891f-4807-b528-7205ea9d2413",
            "0e7dc3a2-6397-4560-abb7-4bc8f3cabd7e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "a33fbd78-db9f-4b21-add2-d3a1cf6772ac",
              "name_org": "USAN"
            },
            {
              "uuid": "cdbb2ba6-61fa-48ba-8a04-c9d90f7f647c",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "c33169c3-ea6d-42d3-8f11-4d722f579ad8",
          "name": "ZANAMIVIR [HSDB]",
          "stdName": "ZANAMIVIR [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aeda4ce5-0476-48de-99ef-fc438f5912d3"
          ],
          "display_name": false
        },
        {
          "uuid": "a9f75959-bd8a-4eb6-a8bf-085165153782",
          "name": "ZANAMIVIR [MART.]",
          "stdName": "ZANAMIVIR [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7ea59957-a786-4e01-a544-a1a926667227"
          ],
          "display_name": false
        },
        {
          "uuid": "1018bcf6-7a16-4802-b026-7eacbe77145e",
          "name": "ZANAMIVIR [MI]",
          "stdName": "ZANAMIVIR [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ad037b67-55e8-4eb1-b620-0b67a83a21e5"
          ],
          "display_name": false
        },
        {
          "uuid": "1c711ca9-8653-434c-b295-4040c57b4528",
          "name": "ZANAMIVIR [ORANGE BOOK]",
          "stdName": "ZANAMIVIR [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ede9b6a8-a1e3-47d6-ab6b-19c0ef938e25"
          ],
          "display_name": false
        },
        {
          "uuid": "b65d9adb-f760-455d-92ba-321098169023",
          "name": "ZANAMIVIR [USAN]",
          "stdName": "ZANAMIVIR [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0e7dc3a2-6397-4560-abb7-4bc8f3cabd7e"
          ],
          "display_name": false
        },
        {
          "uuid": "cc48548f-5519-2850-fdf7-eabec6884b2f",
          "name": "ZANAMIVIR [USP MONOGRAPH]",
          "stdName": "ZANAMIVIR [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd948199-1528-97f6-e7c9-779b774f3d82"
          ],
          "display_name": false
        },
        {
          "uuid": "cd05fce5-7fbe-4210-bddf-7d2c1ded9e88",
          "name": "ZANAMIVIR [USP-RS]",
          "stdName": "ZANAMIVIR [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f72a4147-ca4c-4dfa-8b11-3d401e97a9b7"
          ],
          "display_name": false
        },
        {
          "uuid": "4286f804-cdca-4f46-a737-f288cce83d33",
          "name": "ZANAMIVIR [VANDF]",
          "stdName": "ZANAMIVIR [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a841028b-891f-4807-b528-7205ea9d2413"
          ],
          "display_name": false
        },
        {
          "uuid": "4ad0b305-d897-74aa-8fc7-f860d484b9b0",
          "name": "Zanamivir [WHO-DD]",
          "stdName": "ZANAMIVIR [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1289f531-d790-2cd5-60d7-398627355fe4"
          ],
          "display_name": false
        },
        {
          "uuid": "47a82426-8457-49f7-82ac-039737e310c8",
          "name": "zanamivir [INN]",
          "stdName": "ZANAMIVIR [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8337276-1569-41f5-9427-54ebb66434aa"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "a4043232-ddc6-4c99-8b6c-f69054123e4b",
          "name": "Biological Half-life",
          "value": {
            "uuid": "9bf7e946-ff2b-431d-84bb-c6f2cd73b64e",
            "high": 6,
            "low": 3,
            "units": "hours"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "551ddac9-6281-47f1-9ed5-51e916fa96ed",
              "name": "ROUTE OF ADMINISTRATION",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "e688debc-c586-4d03-b5eb-3a13abaef6f8",
                "references": [],
                "non_numeric_value": "INHALATION"
              },
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "4c970d6c-5fbb-e7ad-ad1b-05f9596818f4"
          ]
        },
        {
          "uuid": "cffe9135-87fd-48a7-b7bf-2a1927cebfe5",
          "name": "Biological Half-life",
          "value": {
            "uuid": "e458914b-491b-481b-9bdf-9d41247843cb",
            "high": 3,
            "low": 2,
            "units": "hours"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "0164d823-216e-4619-97c1-b6efda50ae60",
              "name": "ROUTE OF ADMINISTRATION",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "4881f846-88cf-46c9-b287-1605dc8b1460",
                "references": [],
                "non_numeric_value": "INTRAVENOUS"
              },
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "4c970d6c-5fbb-e7ad-ad1b-05f9596818f4"
          ]
        }
      ]
    }
  ]
}