{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3aa8d672-9cb8-4ed0-85b0-73b9002975b2",
          "code": "17585-69-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=17585-69-2",
          "code_system": "CAS",
          "references": [
            "f74610b6-608f-4726-98fb-35aee9f9fc82",
            "42fc0e95-14b1-4bde-b1fd-631036dc5d81"
          ]
        },
        {
          "uuid": "26d1b41b-8b4c-4825-9a72-9c2fd92a5d0e",
          "code": "241-554-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.761",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f74610b6-608f-4726-98fb-35aee9f9fc82"
          ]
        },
        {
          "uuid": "b45bb076-0642-434a-b82f-2f9178c6f113",
          "code": "12000150",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12000150",
          "code_system": "PUBCHEM",
          "references": [
            "f74610b6-608f-4726-98fb-35aee9f9fc82"
          ]
        },
        {
          "uuid": "362289a8-0a81-594b-1577-54cd0f8092fd",
          "code": "DBSALT001774",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT001774",
          "code_system": "DRUG BANK",
          "references": [
            "5aaf00b9-dd1d-6831-5ae0-75a29237e7df"
          ]
        },
        {
          "uuid": "1f3f7823-62d2-4c32-93c8-c57d2412b324",
          "code": "L6O14A5L6Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "10ddf660-24fa-4566-9662-7e643c51c8a3",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "8341ccf6-e81b-472d-ab40-b04b7a9fe9dc",
            "refuuid": "6a922272-bbed-4f3a-9987-8d0552c8828d",
            "name": "Phenylalanine",
            "unii": "47E5O17Y3R",
            "linking_id": "47E5O17Y3R",
            "ref_pname": "Phenylalanine",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "67d21b9e-4b2f-49b6-ab86-80ddb0559873",
          "name": ".BETA.-PHENYL-L-ALANINE HYDROCHLORIDE",
          "stdName": ".BETA.-PHENYL-L-ALANINE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "148b700b-d153-429b-9522-27902d747f8f",
            "eeb363a5-0708-4b01-a0a7-a461edf64b8f"
          ],
          "display_name": false
        },
        {
          "uuid": "8964da81-f7d6-459c-b118-ce8d6a24de71",
          "name": "ALANINE, PHENYL-, HYDROCHLORIDE, L-",
          "stdName": "ALANINE, PHENYL-, HYDROCHLORIDE, L-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "148b700b-d153-429b-9522-27902d747f8f",
            "eeb363a5-0708-4b01-a0a7-a461edf64b8f"
          ],
          "display_name": false
        },
        {
          "uuid": "eb4eccb6-6a9d-43b2-b03d-bdc263d90647",
          "name": "L-PHENYLALANINE HYDROCHLORIDE",
          "stdName": "L-PHENYLALANINE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "148b700b-d153-429b-9522-27902d747f8f",
            "8bda4fae-86c0-4941-846f-3972ba5333a9"
          ],
          "display_name": false
        },
        {
          "uuid": "86ba59cf-32ca-47f5-8787-00d314f36ee5",
          "name": "L-PHENYLALANINE, HYDROCHLORIDE",
          "stdName": "L-PHENYLALANINE, HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "148b700b-d153-429b-9522-27902d747f8f",
            "eeb363a5-0708-4b01-a0a7-a461edf64b8f"
          ],
          "display_name": false
        },
        {
          "uuid": "6192a05e-5c1d-4701-96f6-225fa265eae7",
          "name": "L-PHENYLALANINE, HYDROCHLORIDE (1:1)",
          "stdName": "L-PHENYLALANINE, HYDROCHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "148b700b-d153-429b-9522-27902d747f8f",
            "eeb363a5-0708-4b01-a0a7-a461edf64b8f"
          ],
          "display_name": false
        },
        {
          "uuid": "4b869aa0-e2f5-4949-a79d-f453bc145832",
          "name": "PHENYLALANINE HYDROCHLORIDE",
          "stdName": "PHENYLALANINE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "148b700b-d153-429b-9522-27902d747f8f",
            "eeb363a5-0708-4b01-a0a7-a461edf64b8f"
          ],
          "display_name": true
        },
        {
          "uuid": "9c1f64b8-d78c-47b7-aa5a-c0f8b8f3c5ae",
          "name": "PHENYLALANINE HYDROCHLORIDE, L-",
          "stdName": "PHENYLALANINE HYDROCHLORIDE, L-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "148b700b-d153-429b-9522-27902d747f8f",
            "eeb363a5-0708-4b01-a0a7-a461edf64b8f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8bda4fae-86c0-4941-846f-3972ba5333a9",
          "citation": "SIGMA-ALDRICH",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "148b700b-d153-429b-9522-27902d747f8f",
          "citation": "SIGMA-ALDRICH",
          "doc_type": "SIGMA-ALDRICH",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eeb363a5-0708-4b01-a0a7-a461edf64b8f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f74610b6-608f-4726-98fb-35aee9f9fc82",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391041000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e7b204a-6481-43d0-b354-1e04a04c33f1",
          "citation": "SRS import [L6O14A5L6Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L6O14A5L6Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391041000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99b8fdfe-ad30-4019-968c-0d92ce1eed37",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5aaf00b9-dd1d-6831-5ae0-75a29237e7df",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "42fc0e95-14b1-4bde-b1fd-631036dc5d81",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "36579e26-a036-4448-a6c7-29e773335d4d",
          "id": "36579e26-a036-4448-a6c7-29e773335d4d",
          "molfile": "\n  Marvin  01132102542D          \n\n  1  0  0  0  1  0            999 V2000\n   10.6413   -5.2403    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "38ff59a8-565b-48b4-9177-f5ae279c2746"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "db050cd3-2fe2-4bc1-b3d6-9825f5b8e417",
          "id": "db050cd3-2fe2-4bc1-b3d6-9825f5b8e417",
          "molfile": "\n  Marvin  01132111222D          \n\n 12 12  0  0  1  0            999 V2000\n    6.1101   -5.4583    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.6973   -6.1771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6973   -4.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8718   -4.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4590   -4.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6335   -4.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2207   -4.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6335   -5.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4590   -5.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9403   -5.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3530   -4.7440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3530   -6.1771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1 10  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  9  4  2  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C[C@@H](C(=O)O)N",
          "formula": "C9H11NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8fa24eb6-8356-4363-8ea3-6ecda345c752"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "165.1895",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b9e7ab4a-d03a-4198-b334-3c277db0f11a",
      "version": "3",
      "structure": {
        "id": "ba735f22-a556-43b8-849b-8bdf168dc1a5",
        "molfile": "\n  Marvin  01132109392D          \n\n 13 12  0  0  1  0            999 V2000\n   10.6413   -5.2403    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.9403   -5.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1101   -5.4583    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.6973   -4.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8718   -4.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4590   -4.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6335   -4.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2207   -4.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6335   -5.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4590   -5.4583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6973   -6.1771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3530   -4.7440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3530   -6.1771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10  5  1  0  0  0  0\n  3 11  1  1  0  0  0\n 12  2  2  0  0  0  0\n 13  2  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C[C@@H](C(=O)O)N.Cl",
        "formula": "C9H11NO2.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "201.6504",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "99b8fdfe-ad30-4019-968c-0d92ce1eed37",
          "4e7b204a-6481-43d0-b354-1e04a04c33f1"
        ],
        "stereo_centers": 1
      },
      "unii": "L6O14A5L6Q"
    }
  ]
}