{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "74c3431e-2ea5-42f2-bc9f-314dc7268807",
          "code": "N01BB06",
          "comments": "ATC|NERVOUS SYSTEM|ANESTHETICS|ANESTHETICS, LOCAL|Amides|cinchocaine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N01BB06&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "26d6138c-ef78-47fe-a5fa-e4dada2e1f95",
          "code": "S01HA06",
          "comments": "ATC|SENSORY ORGANS|OPHTHALMOLOGICALS|LOCAL ANESTHETICS|Local anesthetics|cinchocaine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=S01HA06&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "079404be-5afe-4934-aa0b-64903acb9ded",
          "code": "D04AB02",
          "comments": "ATC|DERMATOLOGICALS|ANTIPRURITICS, INCL. ANTIHISTAMINES, ANESTHETICS, ETC.|ANTIPRURITICS, INCL. ANTIHISTAMINES, ANESTHETICS, ETC.|Anesthetics for topical use|cinchocaine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D04AB02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "faa117b1-2b31-4194-bcd7-9e0a1b31065b",
          "code": "C05AD04",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|VASOPROTECTIVES|AGENTS FOR TREATMENT OF HEMORRHOIDS AND ANAL FISSURES FOR TOPICAL USE|Local anesthetics|cinchocaine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C05AD04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "eb07ed89-1b7e-4e6f-8fb6-be5c42c6edff",
          "code": "QS01HA06",
          "comments": "VATC|OPHTHALMOLOGICALS|LOCAL ANESTHETICS|Local anesthetics|cinchocaine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QS01HA06&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "5af6ced6-39fb-454e-9a05-f090b66c16f5",
          "code": "QN01BB06",
          "comments": "VATC|ANESTHETICS|ANESTHETICS, LOCAL|Amides|cinchocaine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN01BB06&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "c0e759fe-5b55-4090-be7c-ebbc06e1e58f",
          "code": "QD04AB02",
          "comments": "VATC|ANTIPRURITICS, INCL. ANTIHISTAMINES, ANESTHETICS, ETC.|ANTIPRURITICS, INCL. ANTIHISTAMINES, ANESTHETICS,  ETC.|Anesthetics for topical use|cinchocaine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD04AB02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "0b74ea81-e7cc-4f98-a1d8-15253ee209b8",
          "code": "QC05AD04",
          "comments": "VATC|VASOPROTECTIVES|AGENTS FOR TREATMENT OF HEMORRHOIDS AND ANAL FISSURES FOR TOPICAL USE|Local anesthetics|cinchocaine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC05AD04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "b0d84b0b-b820-48e3-9729-63b3dd308d7e",
          "code": "QS02DA04",
          "comments": "VATC|OTOLOGICALS|OTHER OTOLOGICALS|Analgesics and anesthetics|cinchocaine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QS02DA04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "c210e80c-e6ed-4d98-bced-bd2f0b8bc62c",
          "code": "85-79-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=85-79-0",
          "code_system": "CAS",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9",
            "36d9a37f-eb0e-4cef-a3b5-181a1925aca8"
          ]
        },
        {
          "uuid": "a8a27dbe-91a1-4458-b59a-778ee895cdd1",
          "code": "C28984",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C28984",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "b2c8c649-74c0-4020-92ff-78794b0371ae",
          "code": "D003992",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68003992",
          "code_system": "MESH",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "8f1d67ea-7c5a-4522-9a36-c663c6b58b47",
          "code": "21 CFR 346.10",
          "comments": "PART 346 -- ANORECTAL DRUG PRODUCTS FOR OVER-THE-COUNTER HUMAN USE|Subpart B--Active Ingredients|Sec. 346.10 Local anesthetic active ingredients.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=346.10",
          "code_system": "CFR",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "0774beb9-acbc-4698-b10e-6cbea8ed5606",
          "code": "21 CFR 310.538",
          "comments": "PART 310 -- NEW DRUGS|Subpart E--Requirements for Specific New Drugs or Devices|Sec. 310.538 Drug products containing active ingredients offered over-the-counter (OTC) for use for ingrown toenail relief.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=310.538",
          "code_system": "CFR",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "1bc60195-3235-4d1b-b6bf-deba3e068d05",
          "code": "N0000185508",
          "comments": "Established Pharmacologic Class [EPC]|Standardized Chemical Allergen [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000185508",
          "code_system": "NDF-RT",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "869c15a4-52e1-48b6-a338-4faeaec5f489",
          "code": "S02DA04",
          "comments": "ATC|SENSORY ORGANS|OTOLOGICALS|OTHER OTOLOGICALS|Analgesics and anesthetics|cinchocaine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=S02DA04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "08787699-963f-461a-99af-d5bdc6258f94",
          "code": "SUB06287MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "99dd8456-0a5a-4446-a0cd-6fd3ecc15c14",
          "code": "108",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=108",
          "code_system": "INN",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "5a52288c-e37f-478a-8bf2-8d0a6b6026b9",
          "code": "201-632-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.484",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "803a6b08-45b6-46e2-a13a-54b0c3b1e6b8",
          "code": "7159",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7159",
          "code_system": "IUPHAR",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "8f2f0e0d-5073-41a7-b2f7-4daae9e2a32d",
          "code": "3339",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/3339/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "99280604-5b89-4ad2-bd34-a61416f35bc0",
          "code": "m4306",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4306?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "385386da-002d-4c5c-95aa-57a2f107a17b",
          "code": "DB00527",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00527",
          "code_system": "DRUG BANK",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "958f3fa8-fb7c-4e72-b702-098652d1a611",
          "code": "CHEMBL1086",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1086",
          "code_system": "ChEMBL",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "226f29a6-2800-4ada-89ac-7168acaf6f2a",
          "code": "N0000175629",
          "comments": "Increased Histamine Release [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175629",
          "code_system": "NDF-RT",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "939afda7-e060-426c-840e-e27d353947f8",
          "code": "N0000184306",
          "comments": "Cell-mediated Immunity [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000184306",
          "code_system": "NDF-RT",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "15608fc4-7383-409c-8559-59c18203bfa6",
          "code": "N0000171131",
          "comments": "Allergens [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000171131",
          "code_system": "NDF-RT",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "42aeebc7-0aba-40c1-9e6b-86b3de4e74fc",
          "code": "3025",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3025",
          "code_system": "PUBCHEM",
          "references": [
            "1558f9f9-a075-4387-a2f9-9f8423b2d5d9"
          ]
        },
        {
          "uuid": "59b5f68b-0629-2ff9-4270-84c22f87c4c6",
          "code": "Cinchocaine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Cinchocaine",
          "code_system": "WIKIPEDIA",
          "references": [
            "b080fdb5-36ff-561a-8ac4-73893d1662d0"
          ]
        },
        {
          "uuid": "4ade571f-4de6-da4d-1d17-67baffdf0d38",
          "code": "3312",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3312",
          "code_system": "HSDB",
          "references": [
            "cded3a2a-08d1-ec44-bb8c-c00f741cd26a"
          ]
        },
        {
          "uuid": "3dc92f17-cf49-8df9-5599-09ecc8ef0f9a",
          "code": "DTXSID3045271",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3045271",
          "code_system": "EPA CompTox",
          "references": [
            "805486fe-c996-eb84-9d9a-c91be8acaf97"
          ]
        },
        {
          "uuid": "dd3ed876-9c9f-e501-16df-b23f31a2ee52",
          "code": "Dibucaine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM846/",
          "code_system": "LACTMED",
          "references": [
            "04b49ea7-faac-cfa6-1c61-b1670930a1b9"
          ]
        },
        {
          "uuid": "2c2a4499-626a-76a9-64a3-fa302acb3eb6",
          "code": "C245",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anesthetic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C245",
          "code_system": "NCI_THESAURUS",
          "references": [
            "04b49ea7-faac-cfa6-1c61-b1670930a1b9"
          ]
        },
        {
          "uuid": "6811b2fe-e2c1-42a9-b1d3-45a89428da01",
          "code": "L6JW2TJG99",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "850566fb-a346-1db3-cf62-f39071668053",
          "code": "859",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/859",
          "code_system": "DRUG CENTRAL",
          "references": [
            "04b49ea7-faac-cfa6-1c61-b1670930a1b9"
          ]
        },
        {
          "uuid": "d7291d35-b6f5-c0eb-682a-515c955dd18f",
          "code": "247956",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:247956",
          "code_system": "CHEBI",
          "references": [
            "04b49ea7-faac-cfa6-1c61-b1670930a1b9"
          ]
        },
        {
          "uuid": "bc169d49-dd90-c6cd-bff4-5b924513c371",
          "code": "159055",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=159055",
          "code_system": "NSC",
          "references": [
            "c61f7239-8941-ef86-efaa-20525f4e360e"
          ]
        },
        {
          "uuid": "c8cfb9ca-6016-061e-a040-2abfccbe4032",
          "code": "100000081060",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ca5317cc-d200-a7e3-bc52-288906663e5f"
          ]
        },
        {
          "uuid": "ab7dd3a4-c803-0a52-5bb3-63e15ab0d61f",
          "code": "L6JW2TJG99",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=L6JW2TJG99",
          "code_system": "DAILYMED",
          "references": [
            "b8bd4537-606a-673b-fa72-6b1944cb3e93"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "11842721-b9dc-4063-af18-d6b99009cb42",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "cc6e569e-a7d0-4f53-8b08-db8334351552",
            "refuuid": "870dc588-25e4-4362-bc74-95f6452b569b",
            "name": "DIBUCAINE",
            "unii": "L6JW2TJG99",
            "linking_id": "L6JW2TJG99",
            "ref_pname": "DIBUCAINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7353840b-47a2-4f86-a44a-3be5d9563549",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "82629d39-8f3e-4e6e-9425-b12d87979be3",
            "refuuid": "08daa581-78c1-408b-ac36-4f1de2dde897",
            "name": "DIBUCAINE HYDROCHLORIDE",
            "unii": "Z97702A5DG",
            "linking_id": "Z97702A5DG",
            "ref_pname": "DIBUCAINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "77e771a1-75d6-43af-848b-f9d14cec2625",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "0a30c7a5-500c-4904-9dc0-63a20e80519f",
            "refuuid": "567c0f5a-7a21-49bf-a17d-49ce9fc7ec75",
            "name": "DIBUCAINE BENZOATE",
            "unii": "J31043J63M",
            "linking_id": "J31043J63M",
            "ref_pname": "DIBUCAINE BENZOATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cc1e7e3f-6bc0-4055-b897-b9f872a4fdef",
          "name": "2-BUTOXY-N-(2-(DIETHYLAMINO)ETHYL)-4-QUINOLINECARBOXAMIDE",
          "stdName": "2-BUTOXY-N-(2-(DIETHYLAMINO)ETHYL)-4-QUINOLINECARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "941eb37e-6e9e-492b-9bb4-065383ed6a19",
            "d09143cf-8e3c-444e-9b40-516ca828efa6"
          ],
          "display_name": false
        },
        {
          "uuid": "f26c5bd9-ab9e-4077-bf98-0b56af7419e0",
          "name": "2-BUTOXY-N-(2-DIETHYLAMINOETHYL)CINCHONINAMIDE",
          "stdName": "2-BUTOXY-N-(2-DIETHYLAMINOETHYL)CINCHONINAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "941eb37e-6e9e-492b-9bb4-065383ed6a19",
            "d09143cf-8e3c-444e-9b40-516ca828efa6"
          ],
          "display_name": false
        },
        {
          "uuid": "074d8c09-89d9-4248-a176-5109fd5abf54",
          "name": "2-Butoxy-N-[2-(diethylamino)ethyl]cinchoninamide",
          "stdName": "2-BUTOXY-N-(2-(DIETHYLAMINO)ETHYL)CINCHONINAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dde5507a-7fdd-4c14-8d84-1c2dffec30e1"
          ],
          "display_name": false
        },
        {
          "uuid": "c7fd5195-63e5-4044-97ec-114df8bce9f3",
          "name": "4-QUINOLINECARBOXAMIDE, 2-BUTOXY-N-(2-(DIETHYLAMINO)ETHYL)",
          "stdName": "4-QUINOLINECARBOXAMIDE, 2-BUTOXY-N-(2-(DIETHYLAMINO)ETHYL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe3f76c5-cf44-4f5e-a923-a962a6cb7858"
          ],
          "display_name": false
        },
        {
          "uuid": "3da08a43-f21e-44df-afaa-342cd6c9c341",
          "name": "CINCHOCAINE",
          "stdName": "CINCHOCAINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2fe2cb41-137d-48a0-9922-42fd2c540c40"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "3dde20b2-fda4-4ffe-97e6-eec5a16749fd",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "e2977ecc-6018-4381-89b9-e54fb1450f11",
          "name": "CINCHOCAINE [MART.]",
          "stdName": "CINCHOCAINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68a5dde4-4008-4fe8-a564-43582fc253d1"
          ],
          "display_name": false
        },
        {
          "uuid": "38f68b1d-8d7e-83a8-978c-35ed4abb8a9e",
          "name": "Cinchocaine [WHO-DD]",
          "stdName": "CINCHOCAINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "66ae13ee-eae2-03e5-e03b-26ffdd3f6c78"
          ],
          "display_name": false
        },
        {
          "uuid": "3fe21747-da8f-4d54-a7c2-1a07d202aa1d",
          "name": "DIBUCAINE",
          "stdName": "DIBUCAINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa254810-4aca-4ba2-b245-97bc7027bc3a",
            "0e978b06-a037-41bf-9102-694a62b3bca3",
            "fe878175-ccd7-4501-beda-d91aac25c85a",
            "d2e814bd-af26-4619-b08a-e89457d52350",
            "500f28f6-0af9-4006-8fee-4f96a95f2965",
            "d09143cf-8e3c-444e-9b40-516ca828efa6",
            "8bdc1e2a-5e16-4fca-88a3-828c9129878f",
            "08b6df52-9b63-4604-9495-b910fa5e19fb",
            "3336b287-5fce-4ac0-a14e-33fa907a9d33",
            "17ece5b4-c353-40c0-8e27-cd9380b7f33e"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "301865bc-f097-45ee-b45f-41da7dbc5156",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "dbebb273-1659-448e-9b78-bd5291298745",
          "name": "DIBUCAINE [HSDB]",
          "stdName": "DIBUCAINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe878175-ccd7-4501-beda-d91aac25c85a",
            "d09143cf-8e3c-444e-9b40-516ca828efa6"
          ],
          "display_name": false
        },
        {
          "uuid": "5c348c7e-bc2f-4b26-810d-091a7b14838e",
          "name": "DIBUCAINE [MI]",
          "stdName": "DIBUCAINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2e814bd-af26-4619-b08a-e89457d52350",
            "d09143cf-8e3c-444e-9b40-516ca828efa6"
          ],
          "display_name": false
        },
        {
          "uuid": "12d8524a-5591-06d1-037f-1335995469c7",
          "name": "DIBUCAINE [USP IMPURITY]",
          "stdName": "DIBUCAINE [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa254810-4aca-4ba2-b245-97bc7027bc3a"
          ],
          "display_name": false
        },
        {
          "uuid": "23edb6a3-c633-aa6f-428e-dd2c8c10edea",
          "name": "DIBUCAINE [USP MONOGRAPH]",
          "stdName": "DIBUCAINE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ef957c5-258b-4ddc-69db-748e2b696202"
          ],
          "display_name": false
        },
        {
          "uuid": "f70d8890-ba49-4573-92e6-a4ff7f255da2",
          "name": "DIBUCAINE [VANDF]",
          "stdName": "DIBUCAINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "500f28f6-0af9-4006-8fee-4f96a95f2965",
            "d09143cf-8e3c-444e-9b40-516ca828efa6"
          ],
          "display_name": false
        },
        {
          "uuid": "47b717d8-7148-4829-ba48-98ead4e5de0b",
          "name": "NSC-159055",
          "stdName": "NSC-159055",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ac80c21-568a-4359-9ee8-08002d6ae7a6",
            "d09143cf-8e3c-444e-9b40-516ca828efa6"
          ],
          "display_name": false
        },
        {
          "uuid": "c1b1f0b2-7c7d-4012-a883-2a8fc53879e4",
          "name": "cinchocaine [INN]",
          "stdName": "CINCHOCAINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2fe2cb41-137d-48a0-9922-42fd2c540c40"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "941eb37e-6e9e-492b-9bb4-065383ed6a19",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d09143cf-8e3c-444e-9b40-516ca828efa6",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dde5507a-7fdd-4c14-8d84-1c2dffec30e1",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18868bcc-88b1-497e-93aa-ba4115d13c51",
          "citation": "ACD9.0(USAN 2006)",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe3f76c5-cf44-4f5e-a923-a962a6cb7858",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e978b06-a037-41bf-9102-694a62b3bca3",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2fe2cb41-137d-48a0-9922-42fd2c540c40",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aa254810-4aca-4ba2-b245-97bc7027bc3a",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68a5dde4-4008-4fe8-a564-43582fc253d1",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2e814bd-af26-4619-b08a-e89457d52350",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ac80c21-568a-4359-9ee8-08002d6ae7a6",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe878175-ccd7-4501-beda-d91aac25c85a",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f8cd67ba-4889-4608-8784-d37b301f6270",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "500f28f6-0af9-4006-8fee-4f96a95f2965",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1558f9f9-a075-4387-a2f9-9f8423b2d5d9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389709000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab15255e-7108-4b56-ab30-3ae00c64e25f",
          "citation": "SRS import [L6JW2TJG99]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L6JW2TJG99",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389709000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "772c2f70-13da-45d5-b38c-971576b0d44f",
          "citation": "CINCHOCAINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "08b6df52-9b63-4604-9495-b910fa5e19fb",
          "citation": "DIBUCAINE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eaa55da0-d6c3-4215-b11d-f6b43e304bdd",
          "citation": "CINCHOCAINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3336b287-5fce-4ac0-a14e-33fa907a9d33",
          "citation": "DIBUCAINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8bdc1e2a-5e16-4fca-88a3-828c9129878f",
          "citation": "DIBUCAINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d17f4021-60f1-478b-91c5-3f8710818571",
          "citation": "CINCHOCAINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "17ece5b4-c353-40c0-8e27-cd9380b7f33e",
          "citation": "DIBUCAINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b080fdb5-36ff-561a-8ac4-73893d1662d0",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Cinchocaine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cded3a2a-08d1-ec44-bb8c-c00f741cd26a",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+85-79-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b74e101a-559f-4ec6-52b4-8385ae0a15ec",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+85-79-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "805486fe-c996-eb84-9d9a-c91be8acaf97",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=85-79-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "04b49ea7-faac-cfa6-1c61-b1670930a1b9",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "36d9a37f-eb0e-4cef-a3b5-181a1925aca8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3ef957c5-258b-4ddc-69db-748e2b696202",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "c61f7239-8941-ef86-efaa-20525f4e360e",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "66ae13ee-eae2-03e5-e03b-26ffdd3f6c78",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b8bd4537-606a-673b-fa72-6b1944cb3e93",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "ca5317cc-d200-a7e3-bc52-288906663e5f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "22f86938-683d-4d7f-b257-de0e869a0ee1",
          "id": "22f86938-683d-4d7f-b257-de0e869a0ee1",
          "molfile": "\n  Marvin  01132101582D          \n\n 25 26  0  0  0  0            999 V2000\n    0.6305   -2.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0835   -2.6680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7974   -2.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5114   -2.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2254   -2.2589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9394   -2.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9311   -3.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6450   -3.9248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6450   -4.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3590   -5.1524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9311   -5.1607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2171   -4.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5031   -5.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7891   -4.7390    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7974   -3.9123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0835   -3.4989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0752   -5.1524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6388   -4.7390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3673   -3.5115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0813   -3.9248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7953   -3.5115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7953   -2.6848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0813   -2.2714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3673   -2.6848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6534   -2.2672    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 25  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n 19  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 17 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 24 19  2  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  1  0  0  0  0\nM  END",
          "smiles": "CCCCOc1cc(c2ccccc2n1)C(=O)NCCN(CC)CC",
          "formula": "C20H29N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e981a811-f422-483c-af05-ab219f34c54a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "343.4639",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "870dc588-25e4-4362-bc74-95f6452b569b",
      "version": "21",
      "structure": {
        "id": "01fddcb9-7bdf-4383-9dc4-b9aed689ba28",
        "molfile": "\n  Marvin  01132100252D          \n\n 25 26  0  0  0  0            999 V2000\n   -3.6450   -3.9248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6534   -2.2672    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6450   -4.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3673   -3.5115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3673   -2.6848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9394   -2.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9311   -3.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3590   -5.1524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9311   -5.1607    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7891   -4.7390    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2254   -2.2589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2171   -4.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0813   -3.9248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.0813   -2.2714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5031   -5.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7974   -3.9123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0752   -5.1524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5114   -2.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7974   -2.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0835   -2.6680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0835   -3.4989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6388   -4.7390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7953   -3.5115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.7953   -2.6848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6305   -2.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  6  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  1  2  0  0  0  0\n  8  3  2  0  0  0  0\n  9  3  1  0  0  0  0\n 10 15  1  0  0  0  0\n 11  6  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13  4  2  0  0  0  0\n 14  5  2  0  0  0  0\n 15 12  1  0  0  0  0\n 16 10  1  0  0  0  0\n 17 10  1  0  0  0  0\n 18 11  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 16  1  0  0  0  0\n 22 17  1  0  0  0  0\n 23 13  1  0  0  0  0\n 24 23  2  0  0  0  0\n 25 20  1  0  0  0  0\n  2  5  1  0  0  0  0\n 14 24  1  0  0  0  0\nM  END",
        "smiles": "CCCCOc1cc(c2ccccc2n1)C(=O)NCCN(CC)CC",
        "formula": "C20H29N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "343.4639",
        "optical_activity": "NONE",
        "references": [
          "0e978b06-a037-41bf-9102-694a62b3bca3",
          "ab15255e-7108-4b56-ab30-3ae00c64e25f",
          "2fe2cb41-137d-48a0-9922-42fd2c540c40"
        ],
        "stereo_centers": 0
      },
      "unii": "L6JW2TJG99"
    }
  ]
}