{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "935da4aa-af0c-4bbb-9800-3b555ae17723", "code": "125789-39-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=125789-39-1", "code_system": "CAS", "references": [ "abcdac99-24e6-4b3b-a5c0-6ae2fd714fb7", "565435d6-db16-4356-a275-a182bca74a9b" ] }, { "uuid": "bb470d5f-dc2e-4d32-b704-6bdb023bc666", "code": "15132222", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15132222", "code_system": "PUBCHEM", "references": [ "abcdac99-24e6-4b3b-a5c0-6ae2fd714fb7" ] }, { "uuid": "4e4af259-bb79-43ee-a42d-a990ddc1c870", "code": "L64P51H27G", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "78cf220c-db7b-438c-af40-eed811efb846", "name": "ADAMANTANYL DIHYDROCAFFEAMIDE", "stdName": "ADAMANTANYL DIHYDROCAFFEAMIDE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "7e44248f-8c87-4e7d-9573-fba292b3ccd7", "98ab9832-4600-4991-bee7-0b77235efd8b", "86c3be5a-e80c-4dd0-a620-40dc0f2af8f5", "df2715fa-ad86-457d-8e76-da944e3233c3" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "05816f09-849d-4f40-8fd0-db60644fba7a", "name_org": "INCI" } ] }, { "uuid": "6b5fd92f-3203-4a10-9ac2-c555f6f3904f", "name": "BENZENEPROPANAMIDE, 3,4-DIHYDROXY-N-TRICYCLO(3.3.1.13,7)DEC-1-YL-", "stdName": "BENZENEPROPANAMIDE, 3,4-DIHYDROXY-N-TRICYCLO(3.3.1.13,7)DEC-1-YL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "86c3be5a-e80c-4dd0-a620-40dc0f2af8f5", "df2715fa-ad86-457d-8e76-da944e3233c3" ], "display_name": false }, { "uuid": "f2fc0d73-02b8-4555-9dec-90968d6189f1", "name": "SNOWIN AP-6", "stdName": "SNOWIN AP-6", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "98ab9832-4600-4991-bee7-0b77235efd8b", "86c3be5a-e80c-4dd0-a620-40dc0f2af8f5" ], "display_name": false } ], "references": [ { "uuid": "df2715fa-ad86-457d-8e76-da944e3233c3", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "86c3be5a-e80c-4dd0-a620-40dc0f2af8f5", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "98ab9832-4600-4991-bee7-0b77235efd8b", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "abcdac99-24e6-4b3b-a5c0-6ae2fd714fb7", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391327000, "tags": [ "NOMEN" ] }, { "uuid": "eee1c272-b7dc-4066-ba34-96797902e3ac", "citation": "SRS import [L64P51H27G]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L64P51H27G", "doc_type": "SRS", "public_domain": true, "document_date": 1493391327000, "tags": [ "NOMEN" ] }, { "uuid": "7e44248f-8c87-4e7d-9573-fba292b3ccd7", "citation": "ADAMANTANYL DIHYDROCAFFEAMIDE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "565435d6-db16-4356-a275-a182bca74a9b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "8b7f3079-67be-4bb8-a7f9-b52e703e0a83", "id": "8b7f3079-67be-4bb8-a7f9-b52e703e0a83", "molfile": "\n Marvin 01132107152D \n\n 23 26 0 0 0 0 999 V2000\n 10.5825 -10.1375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1768 -10.8559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5960 -11.5664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1902 -12.2848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3653 -12.2925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9595 -13.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1346 -13.0187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7288 -13.7371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1480 -14.4475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9038 -13.7448 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4981 -14.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9770 -14.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9831 -15.3733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5088 -15.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5159 -16.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4693 -16.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9364 -15.3841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4633 -15.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4525 -14.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0297 -15.3638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9460 -11.5820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3518 -10.8636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9326 -10.1531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 22 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 21 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 19 1 0 0 0 0\n 11 20 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 13 18 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 20 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 19 17 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\nM END", "smiles": "c1cc(c(cc1CCC(=O)NC23CC4CC(CC(C4)C2)C3)O)O", "formula": "C19H25NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "47381b3c-cf7e-4fc6-9531-5464b73b0ce1" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "315.4074", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "eab90a32-3f39-460c-8090-a9202bc309f3", "version": "4", "structure": { "id": "9545aeac-9340-4114-a8d3-ed2cc33f2bf5", "molfile": "\n Marvin 01132107452D \n\n 23 26 0 0 0 0 999 V2000\n 9.3518 -10.8636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9460 -11.5820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3653 -12.2925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1902 -12.2848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5960 -11.5664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1768 -10.8559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9326 -10.1531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5825 -10.1375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9595 -13.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1346 -13.0187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7288 -13.7371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1480 -14.4475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9038 -13.7448 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4981 -14.4631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9770 -14.7697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9831 -15.3733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5088 -15.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5159 -16.2739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0297 -15.3638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4525 -14.4728 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9364 -15.3841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4633 -15.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4693 -16.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 1 6 1 0 0 0 0\n 1 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 3 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 15 14 1 0 0 0 0\n 14 19 1 0 0 0 0\n 14 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 16 22 1 0 0 0 0\n 18 23 1 0 0 0 0\n 21 23 1 0 0 0 0\nM END", "smiles": "c1cc(c(cc1CCC(=O)NC23CC4CC(CC(C4)C2)C3)O)O", "formula": "C19H25NO3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "315.4074", "optical_activity": "NONE", "references": [ "98ab9832-4600-4991-bee7-0b77235efd8b", "eee1c272-b7dc-4066-ba34-96797902e3ac" ], "stereo_centers": 4 }, "unii": "L64P51H27G" } ] }