{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "42e8bcb2-8784-4550-8260-33728a69a840",
          "code": "1005-24-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1005-24-9",
          "code_system": "CAS",
          "references": [
            "0e4394b6-8327-4731-8c81-06077c792a9e",
            "dd685c88-36eb-43ad-8d86-d2203d944bdf"
          ]
        },
        {
          "uuid": "9b0b2d67-ffe4-4587-847e-1614c6c2864c",
          "code": "m11132",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11132?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0e4394b6-8327-4731-8c81-06077c792a9e"
          ]
        },
        {
          "uuid": "968fab8a-2d5b-4edf-a9ee-e621398e0a32",
          "code": "70495",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/70495",
          "code_system": "PUBCHEM",
          "references": [
            "0e4394b6-8327-4731-8c81-06077c792a9e"
          ]
        },
        {
          "uuid": "4caed22d-6eea-6263-fb05-72dec26a1198",
          "code": "DBSALT002055",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DBSALT002055",
          "code_system": "DRUG BANK",
          "references": [
            "b0504b67-1d7d-d399-a167-df7ef4ba712f"
          ]
        },
        {
          "uuid": "be6386c7-5b99-4719-90e6-1935d799a719",
          "code": "L54XNJ1D5G",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "df143e91-a1ab-0713-a145-8f330935632a",
          "code": "DTXSID10905552",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10905552",
          "code_system": "EPA CompTox",
          "references": [
            "b0504b67-1d7d-d399-a167-df7ef4ba712f"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "94a2d0f6-0e91-4190-947c-dae194355a8e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "5d3b6267-81c2-4e00-9240-127fdb8d52b6",
            "refuuid": "ccdc151e-68dc-486b-af6b-d44d2d46cabc",
            "name": "TRIGONELLAMIDE",
            "unii": "UM47085BXC",
            "linking_id": "UM47085BXC",
            "ref_pname": "TRIGONELLAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "41989eca-4a8e-4ca7-91fb-d883e3b295e0",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "009781d5-2971-4788-8881-8dbfa1b8f17c",
            "refuuid": "ccdc151e-68dc-486b-af6b-d44d2d46cabc",
            "name": "TRIGONELLAMIDE",
            "unii": "UM47085BXC",
            "linking_id": "UM47085BXC",
            "ref_pname": "TRIGONELLAMIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "73f4715f-5fc2-4c12-97e0-0952eb4b478e",
          "name": "METHYL NIACINAMIDE CHLORIDE",
          "stdName": "METHYL NIACINAMIDE CHLORIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "c9a9ae02-5c14-4092-979c-23c9869a2f47",
            "044b3263-8475-4ea5-9c7a-29e9b97dc909",
            "9e387483-846a-471f-84d4-621e86ba7d60"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ec72ac39-7ef8-4092-ba95-5bd25d639f00",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "675d102e-bf89-4d14-b307-0d8d67e35164",
          "name": "MNA CHLORIDE",
          "stdName": "MNA CHLORIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9a9ae02-5c14-4092-979c-23c9869a2f47",
            "9e387483-846a-471f-84d4-621e86ba7d60"
          ],
          "display_name": false
        },
        {
          "uuid": "721eb3d5-3786-4c4a-888b-8855e25fe211",
          "name": "TRIGONELLAMIDE CHLORIDE",
          "stdName": "TRIGONELLAMIDE CHLORIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d469749-d401-4ec4-a880-e4e2ca03f1c3",
            "8d199f1e-5e8d-4a29-8bf1-f6335fc0e115",
            "a5f432e8-1f11-4055-9577-a41b3df52946",
            "9e387483-846a-471f-84d4-621e86ba7d60"
          ],
          "display_name": true
        },
        {
          "uuid": "06d164ac-bd57-4d14-9169-a74fad754423",
          "name": "TRIGONELLAMIDE CHLORIDE [MI]",
          "stdName": "TRIGONELLAMIDE CHLORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d469749-d401-4ec4-a880-e4e2ca03f1c3",
            "9e387483-846a-471f-84d4-621e86ba7d60"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8d469749-d401-4ec4-a880-e4e2ca03f1c3",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9e387483-846a-471f-84d4-621e86ba7d60",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d199f1e-5e8d-4a29-8bf1-f6335fc0e115",
          "citation": "merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9a9ae02-5c14-4092-979c-23c9869a2f47",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e4394b6-8327-4731-8c81-06077c792a9e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391027000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6a31716-28f6-4bc5-8c44-aba5e1abcbde",
          "citation": "SRS import [L54XNJ1D5G]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L54XNJ1D5G",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391027000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d051d9c0-107c-4cfe-83f3-db89a06d8092",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a5f432e8-1f11-4055-9577-a41b3df52946",
          "citation": "TRIGONELLAMIDE CHLORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "044b3263-8475-4ea5-9c7a-29e9b97dc909",
          "citation": "METHYL NIACINAMIDE CHLORIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b0504b67-1d7d-d399-a167-df7ef4ba712f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "dd685c88-36eb-43ad-8d86-d2203d944bdf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3d1094fc-b871-43b6-8239-328f4cb5a1c1",
          "id": "3d1094fc-b871-43b6-8239-328f4cb5a1c1",
          "molfile": "\n  Marvin  01132103142D          \n\n  1  0  0  0  0  0            999 V2000\n    6.6838   -3.7307    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1047e9cf-3594-4066-84e3-a11f342c054a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "d0c90ebf-b182-4adf-b23b-a8885ad8c586",
          "id": "d0c90ebf-b182-4adf-b23b-a8885ad8c586",
          "molfile": "\n  Marvin  01132110482D          \n\n 10 10  0  0  0  0            999 V2000\n    5.4459   -4.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8585   -5.1597    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.4459   -5.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8585   -6.5884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6838   -6.5884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0965   -5.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6838   -5.1597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9219   -5.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3346   -6.5884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3346   -5.1597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  7  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\nM  CHG  1   2   1\nM  END",
          "smiles": "C[n+]1cccc(c1)C(=O)N",
          "formula": "C7H9N2O",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4da47070-61d8-4188-a5f5-513709cf6005"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "137.1594",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b071e983-44bf-4038-862b-c345e85b1806",
      "version": "6",
      "structure": {
        "id": "f7751380-8706-4ca7-b1da-288ad0d6dd1a",
        "molfile": "\n  Marvin  01132112502D          \n\n 11 10  0  0  0  0            999 V2000\n    6.6838   -3.7307    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n    6.6838   -5.1597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0965   -5.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6838   -6.5884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8585   -6.5884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4459   -5.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8585   -5.1597    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.4459   -4.4452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9219   -5.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3346   -5.1597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3346   -6.5884    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  2  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\nM  CHG  2   1  -1   7   1\nM  END",
        "smiles": "C[n+]1cccc(c1)C(=O)N.[Cl-]",
        "formula": "C7H9N2O.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "172.6124",
        "optical_activity": "NONE",
        "references": [
          "b6a31716-28f6-4bc5-8c44-aba5e1abcbde",
          "d051d9c0-107c-4cfe-83f3-db89a06d8092"
        ],
        "stereo_centers": 0
      },
      "unii": "L54XNJ1D5G"
    }
  ]
}