{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b1639cb6-5cad-4693-ab7c-e3c674d7417c",
          "code": "185568-15-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=185568-15-4",
          "code_system": "CAS",
          "references": [
            "68ba800f-f98d-40aa-93f9-a3eff291a7ef",
            "73f400bc-216e-434f-8c0d-49b9c38d754e"
          ]
        },
        {
          "uuid": "2a1f308e-ceec-4c10-9c89-e30061910db6",
          "code": "54482767",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/54482767",
          "code_system": "PUBCHEM",
          "references": [
            "68ba800f-f98d-40aa-93f9-a3eff291a7ef"
          ]
        },
        {
          "uuid": "ff7fe677-a0a9-4d73-b94a-8b163994a449",
          "code": "L4SEB7Q73D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ba92dfc7-f45f-09f3-8870-dc26d4233d73",
          "code": "DTXSID80939980",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80939980",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e30b2537-3c7f-4904-9c35-efb9d8ddc8e3",
          "name": "(±)-DIISOOCTYL IPDI",
          "stdName": "(+/-)-DIISOOCTYL IPDI",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e832839-6c8f-4704-a9a4-a5becca04295",
            "930a873d-1092-4e70-a8c6-739267c1d480"
          ],
          "display_name": false
        },
        {
          "uuid": "608d757e-a9a5-4958-933e-f8e3e71c700d",
          "name": "CARBAMIC ACID, (3-((((ISOOCTYLOXY)CARBONYL)AMINO)METHYL)-3,5,5-TRMETHYLCYCLOHEXYL)-, ISOOCTYL ESTER",
          "stdName": "CARBAMIC ACID, (3-((((ISOOCTYLOXY)CARBONYL)AMINO)METHYL)-3,5,5-TRMETHYLCYCLOHEXYL)-, ISOOCTYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "533ad64c-6bc7-4651-b859-fcb2f8192df6",
            "930a873d-1092-4e70-a8c6-739267c1d480"
          ],
          "display_name": false
        },
        {
          "uuid": "a642e150-6242-4bcb-95cc-1f9acd273d3d",
          "name": "DIETHYLHEXYL IPDI",
          "stdName": "DIETHYLHEXYL IPDI",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "533ad64c-6bc7-4651-b859-fcb2f8192df6",
            "930a873d-1092-4e70-a8c6-739267c1d480",
            "54942c3f-afeb-4b54-91c1-491407c00c1c"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "b1a43d83-7e80-4e7a-a4ab-3d72b5779159",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "613c9cf2-c797-4b3a-b2e8-5cedbf3787b9",
          "name": "DIETHYLHEXYL ISOPHORONE DIISOCYANATE",
          "stdName": "DIETHYLHEXYL ISOPHORONE DIISOCYANATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e832839-6c8f-4704-a9a4-a5becca04295",
            "930a873d-1092-4e70-a8c6-739267c1d480"
          ],
          "display_name": true
        },
        {
          "uuid": "eff8d429-d626-4413-b1ab-13eb0ad3b530",
          "name": "DIISOOCTYL IPDI",
          "stdName": "DIISOOCTYL IPDI",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e832839-6c8f-4704-a9a4-a5becca04295",
            "930a873d-1092-4e70-a8c6-739267c1d480"
          ],
          "display_name": false
        },
        {
          "uuid": "9fecfc79-0842-49c3-ab84-cce6f57190f7",
          "name": "MONODERM I-8",
          "stdName": "MONODERM I-8",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "533ad64c-6bc7-4651-b859-fcb2f8192df6",
            "930a873d-1092-4e70-a8c6-739267c1d480"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "533ad64c-6bc7-4651-b859-fcb2f8192df6",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "930a873d-1092-4e70-a8c6-739267c1d480",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e832839-6c8f-4704-a9a4-a5becca04295",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68ba800f-f98d-40aa-93f9-a3eff291a7ef",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391634000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b231bd3f-684c-418b-91fa-4f75a0ab4e27",
          "citation": "SRS import [L4SEB7Q73D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L4SEB7Q73D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391634000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54942c3f-afeb-4b54-91c1-491407c00c1c",
          "citation": "DIETHYLHEXYL IPDI [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "73f400bc-216e-434f-8c0d-49b9c38d754e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "adeb80d9-3c6b-4f57-89dc-26b517ab53de",
          "id": "adeb80d9-3c6b-4f57-89dc-26b517ab53de",
          "molfile": "\n  Marvin  01132109012D          \n\n 34 34  0  0  0  0            999 V2000\n    4.8733  -16.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6983  -16.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1108  -17.2234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9358  -17.2234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3483  -17.9379    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.9358  -18.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1108  -18.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1733  -17.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5858  -18.6523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4108  -18.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8233  -17.9378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8233  -19.3668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4108  -20.0812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8233  -20.7957    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.0481  -21.0779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4553  -20.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2305  -20.5476    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   11.3738  -21.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7418  -21.8903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3293  -22.6048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3738  -22.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9666  -21.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8625  -20.0173    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6378  -20.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7810  -21.1119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2698  -19.7691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0450  -20.0513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6770  -19.5210    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   14.5337  -18.7085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7584  -18.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4522  -19.8032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0842  -19.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8594  -19.5551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4914  -19.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 22 14  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 23  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 19 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 24 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 31  1  0  0  0  0\n 29 30  1  0  0  0  0\n 32 31  1  0  0  0  0\n 32 33  1  0  0  0  0\n 33 34  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)NCC1(C)CC(CC(C)(C)C1)NC(=O)OCC(CC)CCCC",
          "formula": "C28H54N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2fa78f6e-e151-4bd6-a7e4-5ba8d08876e9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "482.7404",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "aa912214-1735-4445-b21b-21512a8024a4",
      "version": "4",
      "structure": {
        "id": "86cc0ead-2af3-4f39-bd3c-ce046815d1f3",
        "molfile": "\n  Marvin  01132107002D          \n\n 34 34  0  0  0  0            999 V2000\n    6.1108  -17.2234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9358  -17.2234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3483  -17.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9358  -18.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1108  -18.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1733  -17.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5858  -18.6523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4108  -18.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8233  -19.3668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4108  -20.0812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8233  -20.7957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4553  -20.2654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2305  -20.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8625  -20.0173    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6378  -20.2994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7810  -21.1119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2698  -19.7691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0450  -20.0513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6770  -19.5210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5337  -18.7085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7584  -18.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4522  -19.8032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0842  -19.2729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8594  -19.5551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4914  -19.0248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3738  -21.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7418  -21.8903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3293  -22.6048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3738  -22.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9666  -21.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0481  -21.0779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8233  -17.9378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6983  -16.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8733  -16.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 19 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 13 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  1  0  0  0  0\n 27 30  1  0  0  0  0\n 30 11  1  0  0  0  0\n 11 31  1  0  0  0  0\n  8 32  2  0  0  0  0\n  1 33  1  0  0  0  0\n 33 34  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)NCC1(C)CC(CC(C)(C)C1)NC(=O)OCC(CC)CCCC",
        "formula": "C28H54N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "482.7404",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b231bd3f-684c-418b-91fa-4f75a0ab4e27",
          "533ad64c-6bc7-4651-b859-fcb2f8192df6"
        ],
        "stereo_centers": 4
      },
      "unii": "L4SEB7Q73D"
    }
  ]
}