{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0f8cbd7c-558f-43cd-8e0e-e5612e9e3f88",
          "code": "186028-79-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=186028-79-5",
          "code_system": "CAS",
          "references": [
            "bbca00c3-f86c-49f4-a46e-5b730585c0c6",
            "92228575-ec22-43e3-bd8c-6a75ef26eb9e"
          ]
        },
        {
          "uuid": "41eb502b-e7f5-4cda-b9db-c983e6898910",
          "code": "C400939",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67400939",
          "code_system": "MESH",
          "references": [
            "bbca00c3-f86c-49f4-a46e-5b730585c0c6"
          ]
        },
        {
          "uuid": "18fbf7b0-5fbc-4a50-87e6-ec2367288d4e",
          "code": "METHYLONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Methylone",
          "code_system": "WIKIPEDIA",
          "references": [
            "bbca00c3-f86c-49f4-a46e-5b730585c0c6"
          ]
        },
        {
          "uuid": "6d6f1070-9cce-435e-ba27-0b8ab8339fdf",
          "code": "7540",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule I.|Hallucinogenic substances",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "bbca00c3-f86c-49f4-a46e-5b730585c0c6"
          ]
        },
        {
          "uuid": "11d7cbf1-a1ca-40df-8259-3ce3d68933b9",
          "code": "SUB90507",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bbca00c3-f86c-49f4-a46e-5b730585c0c6"
          ]
        },
        {
          "uuid": "1716423f-4016-445f-817b-8bf717ba2872",
          "code": "45789647",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/45789647",
          "code_system": "PUBCHEM",
          "references": [
            "bbca00c3-f86c-49f4-a46e-5b730585c0c6"
          ]
        },
        {
          "uuid": "9b194ca2-346d-7e00-44aa-ef78e31138ac",
          "code": "7997",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7997",
          "code_system": "HSDB",
          "references": [
            "d5d17243-86e3-5ecb-7c8f-f05bc1efcf44"
          ]
        },
        {
          "uuid": "c1343bd3-1b0b-4860-b3f8-fc1efbdc2992",
          "code": "L4I4B1R01F",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "94834c77-3555-bede-0bb2-06291973a964",
          "code": "DTXSID80870167",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80870167",
          "code_system": "EPA CompTox",
          "references": [
            "dac67c3a-185d-00ce-78db-fbd7cbf5c004"
          ]
        },
        {
          "uuid": "92f73b81-b45f-c5fc-71d8-9cf57933ab1a",
          "code": "Designer-drugs-Methylone",
          "comments": "Wikipedia|List of designer drugs|Empathogens|MDxx (Substituted methylenedioxyphenethylamines)",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "dac67c3a-185d-00ce-78db-fbd7cbf5c004"
          ]
        },
        {
          "uuid": "1e4440d2-2d77-fea3-ecac-f165137e6207",
          "code": "100000140993",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d67f5178-b14f-1008-22e7-1aeac923e91c"
          ]
        },
        {
          "uuid": "9ceb354e-f781-4af9-8f27-107ff7ae5cab",
          "code": "PiHKAL",
          "comments": "Wikipedia|PiHKAL|Phenethylamines",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/PiHKAL",
          "code_system": "WIKIPEDIA"
        }
      ],
      "relationships": [
        {
          "uuid": "182554a4-c779-46ea-965e-299c8d723721",
          "amount": {
            "uuid": "e5c89c15-5021-4f4e-b019-28dd29fed562"
          },
          "type": "ACTIVE MOIETY",
          "references": [
            "c367eb70-916d-4914-b5c9-4cdebb850e0b"
          ],
          "related_substance": {
            "uuid": "815be791-3240-4d22-8356-9bfcb7f3ef92",
            "refuuid": "720e6bd8-9aa7-4473-be81-4438726f64cf",
            "name": "MDMC",
            "unii": "L4I4B1R01F",
            "linking_id": "L4I4B1R01F",
            "ref_pname": "MDMC",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "feede931-3da1-468e-9d9d-862360cc0bc0",
          "amount": {
            "uuid": "bdb33621-e29a-4f08-8a56-b15556c7e501"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "6472fe89-9c12-4204-96c6-c44337024842",
            "refuuid": "489d6a6f-42d3-4331-aa00-8292b039f3bb",
            "name": "MDMC hydrochloride",
            "unii": "D930G9LZ75",
            "linking_id": "D930G9LZ75",
            "ref_pname": "MDMC hydrochloride",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9f06c2ac-5035-481a-898f-1eaa490a1f3f",
          "amount": {
            "uuid": "7da1f878-1b3f-4f4d-9462-61d556bcb22f"
          },
          "comments": "No free form was detected. After hydrolysis, 170 ng/mL of $-HMMC was observed in a methylone abuser's urine specimen.",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VIVO",
          "references": [
            "f2241291-d01f-466c-b027-b86405cd43f8"
          ],
          "related_substance": {
            "uuid": "3754b1c3-8b11-423a-b782-863407d0c51c",
            "refuuid": "1404d85e-eeb5-452a-9e4e-100d19691c57",
            "name": "4-HMMC",
            "unii": "FJ267O4DJ1",
            "linking_id": "FJ267O4DJ1",
            "ref_pname": "4-HMMC",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0a4e472c-592f-4a06-95ba-5132e30b03be",
          "amount": {
            "uuid": "877026f0-058b-4661-b5c8-e4fe5effc5c2"
          },
          "comments": "No free form was detected. After hydrolysis, 74 ng/mL of 3-HMMC was observed in a methylone abuser's urine specimen.",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VIVO",
          "references": [
            "f2241291-d01f-466c-b027-b86405cd43f8"
          ],
          "related_substance": {
            "uuid": "07211610-d2fc-439c-95b7-3e0da9d9d847",
            "refuuid": "5b3be95e-ecbc-4736-825b-edfb97f94a0c",
            "name": "3-HYDROXY-4-METHOXYMETHCATHINONE",
            "unii": "WMV46KRG5J",
            "linking_id": "WMV46KRG5J",
            "ref_pname": "3-HYDROXY-4-METHOXYMETHCATHINONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0ade62d4-d3c5-4473-8513-14f38dd1a2ff",
          "amount": {
            "uuid": "e9e48699-12e7-49d5-a24a-a8f46f36d9cd"
          },
          "qualification": "Scientific Literature",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VITRO",
          "references": [
            "294dc1b8-0fe8-4388-91e4-6f0379a9a08e"
          ],
          "related_substance": {
            "uuid": "250e1cb6-7d71-4c24-b396-4a26f979a07b",
            "refuuid": "18bdfb4c-697d-45e1-b4eb-d3e575bcda71",
            "name": "BK-MDA",
            "unii": "K0XHQ9FYT3",
            "linking_id": "K0XHQ9FYT3",
            "ref_pname": "BK-MDA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7a470812-d3d7-464c-9f1e-34f32c945f1d",
          "amount": {
            "uuid": "4837923d-5936-44ee-9d45-7d1d63cdc9f3"
          },
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "IN-VIVO",
          "references": [
            "f2241291-d01f-466c-b027-b86405cd43f8"
          ],
          "related_substance": {
            "uuid": "de0923a5-6a22-4a70-ab04-31e4e43cda9f",
            "refuuid": "18bdfb4c-697d-45e1-b4eb-d3e575bcda71",
            "name": "BK-MDA",
            "unii": "K0XHQ9FYT3",
            "linking_id": "K0XHQ9FYT3",
            "ref_pname": "BK-MDA",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9fd3a1b0-1974-4129-9639-c80ac9441e31",
          "amount": {
            "uuid": "e212bcdd-acf5-47cb-82fd-b651a7afb412"
          },
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "3e2d9522-1c1b-493e-8cd0-4fd24d905cd5"
          ],
          "related_substance": {
            "uuid": "e273f1c1-da09-4455-a4fa-38a39f03bae0",
            "refuuid": "7bb52e18-86af-4d28-b191-80581f2f1b07",
            "name": "DIHYDRO-METHYLONE",
            "unii": "59KGS52BZN",
            "linking_id": "59KGS52BZN",
            "ref_pname": "DIHYDRO-METHYLONE"
          }
        },
        {
          "uuid": "6406c969-255d-4b87-8cfc-c47fbaa45aa7",
          "amount": {
            "uuid": "0f730f39-b837-4e8d-bb61-c53e7d6bc6ea"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "interaction_type": "MAJOR",
          "references": [
            "2e1789bc-ba2f-e347-605f-21b99de5c441"
          ],
          "related_substance": {
            "uuid": "d5d0cec3-6f69-486e-95e7-2548d7e155ca",
            "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b",
            "name": "CYTOCHROME P450 2D6",
            "unii": "8E4LAA4357",
            "linking_id": "8E4LAA4357",
            "ref_pname": "CYTOCHROME P450 2D6",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "481f5da3-ed4b-4d12-8efe-5d20902838dd",
          "amount": {
            "uuid": "bb627e18-0782-4f81-8199-7faa60ba6585"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "interaction_type": "MINOR",
          "references": [
            "2e1789bc-ba2f-e347-605f-21b99de5c441"
          ],
          "related_substance": {
            "uuid": "9fa7316c-00f8-4ac3-805b-2c687958e929",
            "refuuid": "2964cc53-40a9-4b2b-b19c-d61342fadb5a",
            "name": "CYTOCHROME P450 1A2",
            "unii": "VK4SQL11C0",
            "linking_id": "VK4SQL11C0",
            "ref_pname": "CYTOCHROME P450 1A2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3e560e25-6967-4d2f-b4c6-d2b565a34d20",
          "amount": {
            "uuid": "7b3a0c5c-8a8c-42a9-b9d1-054adb98623e"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "2e1789bc-ba2f-e347-605f-21b99de5c441"
          ],
          "related_substance": {
            "uuid": "26807720-ffdb-4709-b41b-6619e287cae4",
            "refuuid": "83e3f07e-be5b-48ac-be08-0c68c20e8bf0",
            "name": "CYTOCHROME P450 2B6",
            "unii": "0UY97CSG1T",
            "linking_id": "0UY97CSG1T",
            "ref_pname": "CYTOCHROME P450 2B6",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5d2f2c8c-a022-4f14-8e89-5e7a316092d5",
          "amount": {
            "uuid": "fa94a0e6-2e24-4e89-99ca-823b853d71a7"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "interaction_type": "MINOR",
          "references": [
            "2e1789bc-ba2f-e347-605f-21b99de5c441"
          ],
          "related_substance": {
            "uuid": "1aed2091-18e9-4bc9-8cd9-34a381286dc0",
            "refuuid": "4f746c19-0e0a-447a-beda-d28b91d6f23e",
            "name": "CYTOCHROME P450 2C19",
            "unii": "081I12ZA58",
            "linking_id": "081I12ZA58",
            "ref_pname": "CYTOCHROME P450 2C19",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8dc5e736-fb31-4233-a982-bc6d7d2b5616",
          "amount": {
            "uuid": "797d3b60-1045-44c1-89f9-b325e11b93c4"
          },
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "mediator_substance": {
            "uuid": "316a3cc5-9e9f-43e1-8ef5-f0249beb84ab",
            "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b",
            "name": "CYTOCHROME P450 2D6",
            "unii": "8E4LAA4357",
            "linking_id": "8E4LAA4357",
            "ref_pname": "CYTOCHROME P450 2D6",
            "substance_class": "reference"
          },
          "references": [
            "d6425772-492d-4d21-8f43-0525fe5fe46a"
          ],
          "related_substance": {
            "uuid": "9cae63ad-1ce4-4f10-a7d7-33b3a4799e78",
            "refuuid": "405ca7d9-cbad-42c5-9947-2719fa8eb08e",
            "name": "DIHYDROXYMETHCATHINONE",
            "unii": "RZR1W6RS9C",
            "linking_id": "RZR1W6RS9C",
            "ref_pname": "DIHYDROXYMETHCATHINONE"
          }
        },
        {
          "uuid": "a34b725f-8e17-4c1b-9a42-6dc97edb73ad",
          "amount": {
            "uuid": "9df65b37-21c0-4405-bb08-ca0c265df662"
          },
          "comments": "IN VITRO",
          "type": "METABOLITE->PARENT",
          "references": [
            "1d50534f-0e81-4aef-8567-79153d4557ca"
          ],
          "related_substance": {
            "uuid": "72b4a41f-7c34-4e07-b61b-3e56c71b3ea7",
            "refuuid": "dddd9567-d8d0-483c-baa4-5b1e0f074b46",
            "name": "1-(1,3-BENZODIOXOL-5-YL)-2-(HYDROXYMETHYLAMINO)-1-PROPANONE",
            "unii": "3SC7D9EI62",
            "linking_id": "3SC7D9EI62",
            "ref_pname": "1-(1,3-BENZODIOXOL-5-YL)-2-(HYDROXYMETHYLAMINO)-1-PROPANONE"
          }
        },
        {
          "uuid": "b5913bd3-7da3-45e8-8ae8-c032ca139654",
          "amount": {
            "uuid": "c0993aa5-b2e9-4b3b-8f5d-22d1130c582f"
          },
          "type": "ENANTIOMER->RACEMATE",
          "related_substance": {
            "uuid": "1f0bd9aa-8317-4de2-af4e-269bd1945df0",
            "refuuid": "8dfe07a4-de2f-4972-9429-04f8e800699e",
            "name": "MDMC, (S)-",
            "unii": "125FZ7WBJJ",
            "linking_id": "125FZ7WBJJ",
            "ref_pname": "MDMC, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "088ce2f3-d4a2-4e74-8403-4b96d91bac5e",
          "amount": {
            "uuid": "8c909b69-ae92-4c8a-ace1-7e3300d80411",
            "average": 560,
            "high": 610,
            "low": 510,
            "units": "NANOMOLAR"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "1133a68f-781a-4ae1-83f1-5d4977df8e64"
          ],
          "related_substance": {
            "uuid": "e836664f-e445-4fd6-978f-b7816630f0d2",
            "refuuid": "5630b02a-204e-4bcd-bb78-b4f1e1118451",
            "name": "SODIUM-DEPENDENT DOPAMINE TRANSPORTER",
            "unii": "F202H3PMO2",
            "linking_id": "F202H3PMO2",
            "ref_pname": "SODIUM-DEPENDENT DOPAMINE TRANSPORTER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d7aecc15-2262-4e8d-a614-9d1fde60e054",
          "amount": {
            "uuid": "41782191-1c78-4cab-898f-db0d1d09f539",
            "average": 230,
            "high": 260,
            "low": 200,
            "units": "NANOMOLAR"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "1133a68f-781a-4ae1-83f1-5d4977df8e64"
          ],
          "related_substance": {
            "uuid": "68acd0ef-203d-4ede-a0ac-f1ca3f161678",
            "refuuid": "06df8044-d6c0-4403-85ab-26c75e41e405",
            "name": "SODIUM-DEPENDENT SEROTONIN TRANSPORTER",
            "unii": "CJZ26L1EGI",
            "linking_id": "CJZ26L1EGI",
            "ref_pname": "SODIUM-DEPENDENT SEROTONIN TRANSPORTER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d600cf41-c833-46d2-8287-975252385b93",
          "amount": {
            "uuid": "eebee509-7056-4ef2-a639-7b65af17e7ad",
            "average": 530,
            "high": 580,
            "low": 480,
            "units": "NANOMOLAR"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "3d126096-0251-4bfd-a561-445b8424f919"
          ],
          "related_substance": {
            "uuid": "125bc2c9-1a65-4298-85cb-c73be3776e30",
            "refuuid": "0984671c-0dd0-410d-b763-0a7c9195929d",
            "name": "SODIUM-DEPENDENT NORADRENALINE TRANSPORTER",
            "unii": "HN86OLH1NW",
            "linking_id": "HN86OLH1NW",
            "ref_pname": "SODIUM-DEPENDENT NORADRENALINE TRANSPORTER",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3c785932-b744-4f5e-acae-5661578cb740",
          "name": ".BETA.K-MDMA",
          "stdName": ".BETA.K-MDMA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c367eb70-916d-4914-b5c9-4cdebb850e0b"
          ],
          "display_name": false
        },
        {
          "uuid": "120ed666-7cbb-4539-83ef-8d3227698794",
          "name": "1-PROPANONE, 1-(1,3-BENZODIOXOL-5-YL)-2-(METHYLAMINO)-",
          "stdName": "1-PROPANONE, 1-(1,3-BENZODIOXOL-5-YL)-2-(METHYLAMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92228575-ec22-43e3-bd8c-6a75ef26eb9e"
          ],
          "display_name": false
        },
        {
          "uuid": "475803ea-2d0c-490f-b34c-9d9d84b4f866",
          "name": "2-METHYLAMINO-1-(3,4-METHYLENEDIOXYPHENYL)PROPAN-1-ONE",
          "stdName": "2-METHYLAMINO-1-(3,4-METHYLENEDIOXYPHENYL)PROPAN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92228575-ec22-43e3-bd8c-6a75ef26eb9e"
          ],
          "display_name": false
        },
        {
          "uuid": "f051e367-21a4-4c58-bb91-1972bf8f006d",
          "name": "3,4-METHYLENEDIOXY-N-METHYLCATHINONE",
          "stdName": "3,4-METHYLENEDIOXY-N-METHYLCATHINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c367eb70-916d-4914-b5c9-4cdebb850e0b"
          ],
          "display_name": false
        },
        {
          "uuid": "cbc176c4-5c5f-4db4-b099-59dbb5ffa98d",
          "name": "J899.632F",
          "stdName": "J899.632F",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6c2623c-a130-4db0-8652-54c79b2dbb02"
          ],
          "display_name": false
        },
        {
          "uuid": "52a583da-0c8b-43cf-812a-913e2e4f64d0",
          "name": "M1 (PSYCHEDELIC)",
          "stdName": "M1 (PSYCHEDELIC)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c367eb70-916d-4914-b5c9-4cdebb850e0b"
          ],
          "display_name": false
        },
        {
          "uuid": "5318cda0-fdcf-4d68-bbf8-053df344bd42",
          "name": "MDMC",
          "stdName": "MDMC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c367eb70-916d-4914-b5c9-4cdebb850e0b"
          ],
          "display_name": true
        },
        {
          "uuid": "6411c5b6-e33b-43b0-b681-56cadca0362e",
          "name": "METHYLENEDIOXYMETHCATHINONE",
          "stdName": "METHYLENEDIOXYMETHCATHINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22977439-ffc2-472e-8d19-dbc165955a9b"
          ],
          "display_name": false
        },
        {
          "uuid": "b692b11f-1489-4319-8d9e-cf87b7b18417",
          "name": "METHYLONE",
          "stdName": "METHYLONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c367eb70-916d-4914-b5c9-4cdebb850e0b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "294dc1b8-0fe8-4388-91e4-6f0379a9a08e",
          "citation": "DRUG METAB DISPOS, 41, 1247-55 (2013)",
          "url": "http://dmd.aspetjournals.org/content/41/6/1247",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e17fe2d2-c5bb-42f0-8287-ddfba30fc02a",
          "citation": "SRS import [L4I4B1R01F]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L4I4B1R01F",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391412000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c367eb70-916d-4914-b5c9-4cdebb850e0b",
          "citation": "https://en.wikipedia.org/wiki/Methylone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "22977439-ffc2-472e-8d19-dbc165955a9b",
          "citation": "http://dmd.aspetjournals.org/content/early/2013/04/01/dmd.112.050880.full.pdf+html?sid=f5604d4e-e294",
          "url": "http://dmd.aspetjournals.org/content/early/2013/04/01/dmd.112.050880.full.pdf+html?sid=f5604d4e-e294",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6c2623c-a130-4db0-8652-54c79b2dbb02",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J899.632F",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J899.632F",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbca00c3-f86c-49f4-a46e-5b730585c0c6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391412000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2241291-d01f-466c-b027-b86405cd43f8",
          "citation": "XENOBIOTICA, 36, 709-23 (2006)",
          "url": "http://informahealthcare.com/doi/abs/10.1080/00498250600780191",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5d17243-86e3-5ecb-7c8f-f05bc1efcf44",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+186028-79-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1133a68f-781a-4ae1-83f1-5d4977df8e64",
          "citation": "López‐Arnau, Raul, et al. \"Comparative neuropharmacology of three psychostimulant cathinone derivatives: butylone, mephedrone and methylone.\" British journal of pharmacology 167.2 (2012): 407-420.",
          "url": "https://bpspubs.onlinelibrary.wiley.com/doi/full/10.1111/j.1476-5381.2012.01998.x?casa_token=I2e3iKAo3nUAAAAA%3AIF7AVMAPgE0xKoxQrSEPGqNTNyPCFSaHlitjyIgsaORlapM1XKoOqwl9PRDsUPL9ArxD5PTVvl0XAAI",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "3d126096-0251-4bfd-a561-445b8424f919",
          "citation": "López‐Arnau, Raul, et al. \"Comparative neuropharmacology of three psychostimulant cathinone derivatives: butylone, mephedrone and methylone.\" British journal of pharmacology 167.2 (2012): 407-420.",
          "url": "https://bpspubs.onlinelibrary.wiley.com/doi/pdfdirect/10.1111/j.1476-5381.2012.01998.x?casa_token=n1zW1gg9eEUAAAAA:q-0lh9YnUi-FqwSabNjdAE3GXYop9WhtNvU0aOcPseL3hFXAIYHdFQpqjP2KBBOMdsqU9mbSIkuNdYk",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "3e2d9522-1c1b-493e-8cd0-4fd24d905cd5",
          "citation": "Pedersen, Anders Just, Trine Hedebrink Petersen, and Kristian Linnet. \"In vitro metabolism and pharmacokinetic studies on methylone.\" Drug Metabolism and Disposition 41.6 (2013): 1247-1255.",
          "url": "http://dmd.aspetjournals.org/content/41/6/1247",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1d50534f-0e81-4aef-8567-79153d4557ca",
          "citation": "Pedersen, Anders Just, Trine Hedebrink Petersen, and Kristian Linnet. \"In vitro metabolism and pharmacokinetic studies on methylone.\" Drug Metabolism and Disposition 41.6 (2013): 1247-1255.",
          "url": "http://dmd.aspetjournals.org/content/41/6/1247",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2e1789bc-ba2f-e347-605f-21b99de5c441",
          "citation": "Pedersen, Anders Just, Trine Hedebrink Petersen, and Kristian Linnet. \"In vitro metabolism and pharmacokinetic studies on methylone.\" Drug Metabolism and Disposition 41.6 (2013): 1247-1255.",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "92228575-ec22-43e3-bd8c-6a75ef26eb9e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c8249e38-ef74-43b2-840b-2d5f8ea37412",
          "citation": "Pedersen, Anders Just, Trine Hedebrink Petersen, and Kristian Linnet. \"In vitro metabolism and pharmacokinetic studies on methylone.\" Drug Metabolism and Disposition 41.6 (2013): 1247-1255.",
          "url": "http://dmd.aspetjournals.org/content/41/6/1247",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d6425772-492d-4d21-8f43-0525fe5fe46a",
          "citation": "Pedersen, Anders Just, Trine Hedebrink Petersen, and Kristian Linnet. \"In vitro metabolism and pharmacokinetic studies on methylone.\" Drug Metabolism and Disposition 41.6 (2013): 1247-1255.",
          "url": "http://dmd.aspetjournals.org/content/41/6/1247",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dac67c3a-185d-00ce-78db-fbd7cbf5c004",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d67f5178-b14f-1008-22e7-1aeac923e91c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "aad1583d-4bdb-4323-a1b6-308691e046a0",
          "id": "aad1583d-4bdb-4323-a1b6-308691e046a0",
          "molfile": "\n  Marvin  01132108522D          \n\n 15 16  0  0  0  0            999 V2000\n   15.0245   -7.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3100   -7.2277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5955   -7.6403    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   13.5955   -8.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8811   -7.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8811   -6.4027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1665   -7.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1665   -8.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4521   -8.8777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7376   -8.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9530   -8.7202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4681   -8.0527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9530   -7.3853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7376   -7.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4521   -7.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n 15  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 14 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
          "smiles": "CC(C(=O)c1ccc2c(c1)OCO2)NC",
          "formula": "C11H13NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1132e8e9-18c5-474c-a967-571e801afc40"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "207.2262",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "720e6bd8-9aa7-4473-be81-4438726f64cf",
      "version": "18",
      "structure": {
        "id": "7e991f38-e388-4a2e-b9d1-4f720555ab15",
        "molfile": "\n  Marvin  01132106342D          \n\n 15 16  0  0  0  0            999 V2000\n   11.4521   -7.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7376   -7.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7376   -8.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4521   -8.8777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1665   -8.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1665   -7.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8811   -7.2277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5955   -7.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5955   -8.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3100   -7.2277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.0245   -7.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8811   -6.4027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9530   -8.7202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9530   -7.3853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4681   -8.0527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  7 12  2  0  0  0  0\n  3 13  1  0  0  0  0\n  2 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 13  1  0  0  0  0\nM  END",
        "smiles": "CC(C(=O)c1ccc2c(c1)OCO2)NC",
        "formula": "C11H13NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "207.2262",
        "optical_activity": "( + / - )",
        "references": [
          "c367eb70-916d-4914-b5c9-4cdebb850e0b",
          "92228575-ec22-43e3-bd8c-6a75ef26eb9e"
        ],
        "stereo_centers": 1
      },
      "unii": "L4I4B1R01F"
    }
  ]
}