{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a4889ed3-94c0-9fe5-89b1-04c0ff55c951",
          "code": "DTXSID1074547",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1074547",
          "code_system": "EPA CompTox",
          "references": [
            "2f7fffe0-190e-d04c-e4a2-97900b1ab76c"
          ]
        },
        {
          "uuid": "f608527f-e64f-342c-e280-7c2c374c758f",
          "code": "3084219",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3084219",
          "code_system": "PUBCHEM",
          "references": [
            "6d14a7de-e67e-5a9a-e2cb-3f4190121a29"
          ]
        },
        {
          "uuid": "ec6eeba3-f3f1-4492-8fd4-a9e3fd39ae88",
          "code": "15178-76-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15178-76-4",
          "code_system": "CAS"
        },
        {
          "uuid": "4ef9e289-d6bf-4cc1-9b42-3e089dd0b385",
          "code": "L4755UU7TU",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "326c1ca0-f1e5-4442-9307-4384bf5c12ed",
          "name": "1-Octanaminium, N,N-dimethyl-N-(3-sulfopropyl)-, inner salt",
          "stdName": "1-OCTANAMINIUM, N,N-DIMETHYL-N-(3-SULFOPROPYL)-, INNER SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98a4d444-965e-40a3-ab0b-7932fc848eb7"
          ],
          "display_name": false
        },
        {
          "uuid": "c208ce04-6965-4319-b641-0fc315ff8e27",
          "name": "3-(Dimethyloctylammonio)propane-1-sulfonate",
          "stdName": "3-(DIMETHYLOCTYLAMMONIO)PROPANE-1-SULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98a4d444-965e-40a3-ab0b-7932fc848eb7"
          ],
          "display_name": true
        },
        {
          "uuid": "91256b43-ddbf-4f72-9fff-27ef3ad78c40",
          "name": "3-(N,N-Dimethyloctcylammonio)propanesulfonate inner salt",
          "stdName": "3-(N,N-DIMETHYLOCTCYLAMMONIO)PROPANESULFONATE INNER SALT",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98a4d444-965e-40a3-ab0b-7932fc848eb7"
          ],
          "display_name": false
        },
        {
          "uuid": "b74c0345-3a8a-47c9-8ad4-74b9ee4e70a2",
          "name": "3-(N,N-Dimethyloctylammonio)propanesulfonate",
          "stdName": "3-(N,N-DIMETHYLOCTYLAMMONIO)PROPANESULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98a4d444-965e-40a3-ab0b-7932fc848eb7"
          ],
          "display_name": false
        },
        {
          "uuid": "194a2be4-08f6-4912-b1d0-91c347cdce4a",
          "name": "3-(Octyldimethylammonio)-1-propanesulfonate",
          "stdName": "3-(OCTYLDIMETHYLAMMONIO)-1-PROPANESULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98a4d444-965e-40a3-ab0b-7932fc848eb7"
          ],
          "display_name": false
        },
        {
          "uuid": "f53cb52a-8658-4bfc-bb3e-e73edb998ea1",
          "name": "N-Octyl-N,N-dimethyl-3-ammonio-1-propanesulfonate",
          "stdName": "N-OCTYL-N,N-DIMETHYL-3-AMMONIO-1-PROPANESULFONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98a4d444-965e-40a3-ab0b-7932fc848eb7"
          ],
          "display_name": false
        },
        {
          "uuid": "c5d1d4de-20e7-415f-994d-fba20c76614c",
          "name": "N-Octylsulfobetaine",
          "stdName": "N-OCTYLSULFOBETAINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98a4d444-965e-40a3-ab0b-7932fc848eb7"
          ],
          "display_name": false
        },
        {
          "uuid": "4d309446-f497-44a0-8a2d-1074d0c50bd3",
          "name": "OCTYL SULFOBETAINE",
          "stdName": "OCTYL SULFOBETAINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98a4d444-965e-40a3-ab0b-7932fc848eb7"
          ],
          "display_name": false
        },
        {
          "uuid": "31435b1d-a491-4b5b-859a-d1e62a70baa5",
          "name": "S8",
          "stdName": "S8",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98a4d444-965e-40a3-ab0b-7932fc848eb7"
          ],
          "display_name": false
        },
        {
          "uuid": "580af984-3f3c-4893-9064-ea8996578375",
          "name": "Sulfobetaine 8",
          "stdName": "SULFOBETAINE 8",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98a4d444-965e-40a3-ab0b-7932fc848eb7"
          ],
          "display_name": false
        },
        {
          "uuid": "1a4937d2-1fbd-4edb-8d9b-9f9ebe354a63",
          "name": "Zwittergent 3-08",
          "stdName": "ZWITTERGENT 3-08",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "98a4d444-965e-40a3-ab0b-7932fc848eb7"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6d14a7de-e67e-5a9a-e2cb-3f4190121a29",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "2f7fffe0-190e-d04c-e4a2-97900b1ab76c",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "98a4d444-965e-40a3-ab0b-7932fc848eb7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4c690ae7-c05a-456a-a2bc-504368224015",
          "id": "4c690ae7-c05a-456a-a2bc-504368224015",
          "molfile": "\n  Marvin  05202213322D          \n\n 18 17  0  0  0  0            999 V2000\n   14.3817   -4.0700    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   15.0962   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6673   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7942   -4.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9692   -4.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8106   -4.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9528   -4.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5251   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2383   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2396   -4.0700    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5238   -4.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6521   -3.3555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8271   -4.7845    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.9540   -4.4825    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.8093   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0949   -4.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3805   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6660   -4.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 10 13  2  0  0  0  0\n 10 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  CHG  2   1   1  14  -1\nM  END",
          "smiles": "CCCCCCCC[N+](C)(C)CCCS(=O)(=O)[O-]",
          "formula": "C13H29NO3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ac7d5a2c-b2fa-4d40-b30a-6ffab7be0500"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "279.4409",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8677b162-758b-4e55-b33e-076f8d8b6c60",
      "version": "6",
      "structure": {
        "id": "47b3cbbe-2e02-4393-9b3c-86f49c9e4522",
        "molfile": "1-Octanaminium, N,N-dimethyl-N-(3-sulfopropyl)-, inner salt\n   JSDraw205202213322D\n\n 18 17  0  0  0  0              0 V2000\n   27.1945   -7.6960    0.0000 N   0  3  0  0  0  0  4  0  0  0  0  0\n   28.5455   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.8436   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.9744   -9.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.4145   -9.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.8965   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4925   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.2475   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.1415   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.5985   -7.6960    0.0000 S   0  0  0  0  0  0  6  0  0  0  0  0\n   21.7905   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   33.3785   -6.3450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   31.8185   -9.0470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   33.9494   -8.4760    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   20.4395   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0886   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7376   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3866   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 10 12  2  0  0  0  0\n 10 13  2  0  0  0  0\n 10 14  1  0  0  0  0\n 11 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\nM  CHG  2   1   1  14  -1\nM  END",
        "smiles": "CCCCCCCC[N+](C)(C)CCCS(=O)(=O)[O-]",
        "formula": "C13H29NO3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "279.4409",
        "optical_activity": "NONE",
        "references": [
          "98a4d444-965e-40a3-ab0b-7932fc848eb7"
        ],
        "stereo_centers": 0
      },
      "unii": "L4755UU7TU"
    }
  ]
}