{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c9347f5e-6f7c-4364-b239-a4105abcc8b2", "code": "68475-50-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=68475-50-3", "code_system": "CAS", "references": [ "a704cc06-5611-46a5-a6c1-470326a30d88", "a772834b-bf0a-4885-9f49-31ec4b089b25" ] }, { "uuid": "71379643-ba3e-42d7-aa5f-70bd1868fc93", "code": "270-648-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.064.206", "code_system": "ECHA (EC/EINECS)", "references": [ "a704cc06-5611-46a5-a6c1-470326a30d88" ] }, { "uuid": "f52603a2-cbab-7814-8aa8-6bd08bb6be9f", "code": "DTXSID8071562", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8071562", "code_system": "EPA CompTox", "references": [ "126fa643-6921-2a86-f96b-aedcf263ef65" ] }, { "uuid": "d2d8fa14-21c8-f73b-50aa-a3297786d12d", "code": "1310563", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1310563/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "ba24dfe2-d91a-d9dd-ad67-93957c1bf4ec" ] }, { "uuid": "28194d65-5b88-7851-70d1-66ae58654761", "code": "DTXSID001018664", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001018664", "code_system": "EPA CompTox" }, { "uuid": "47d429e8-5aea-4d5e-b6ee-77974ff32d4a", "code": "L3FT3LUT29", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "f4aabe21-ee6b-4e90-9788-88ec55e23053", "code": "172449-97-7", "type": "NON-SPECIFIC STOICHIOMETRY", "url": "https://commonchemistry.cas.org/detail?cas_rn=172449-97-7", "code_system": "CAS", "references": [ "a772834b-bf0a-4885-9f49-31ec4b089b25" ] } ], "substance_class": "chemical", "references": [ { "uuid": "c4cf8f32-e8a1-4848-bd26-647d5452be17", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ad350fd5-4ddd-4dd0-8229-65e282e903e5", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a704cc06-5611-46a5-a6c1-470326a30d88", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393778000, "tags": [ "NOMEN" ] }, { "uuid": "126fa643-6921-2a86-f96b-aedcf263ef65", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=68475-50-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a772834b-bf0a-4885-9f49-31ec4b089b25", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "0bb72bec-0912-273d-bf73-7467f6d77c3d", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "7ad7c658-202e-b057-e18b-3b23a3cc4542", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "0e33fcaa-1a55-4601-afda-be7a11ab49d3", "citation": "21CFR74.1330", "doc_type": "CFR", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f5c8fc84-1f48-9519-babd-382c1f5f0f1f", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "80541486-e281-fddb-e5ca-8081392adc92", "citation": "SRS import [[ingredient] 0088131AA]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=[ingredient] 0088131AA", "doc_type": "SRS", "public_domain": true, "document_date": 1493394609000, "tags": [ "NOMEN" ] }, { "uuid": "1e55db4a-b226-5702-d8ba-264b7d32b646", "citation": "D&C RED NO. 30 LAKE [II]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "ba24dfe2-d91a-d9dd-ad67-93957c1bf4ec", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "11203b9f-33ea-ff2f-9645-9d283df5d660", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "eec4cfe9-b243-40f8-9bbd-c338a6a41b22", "id": "eec4cfe9-b243-40f8-9bbd-c338a6a41b22", "molfile": "\n CDK 02212407332D\n\n 1 0 0 0 0 0 0 0 0 0999 V2000\n 10.3416 -8.7103 0.0000 Al 0 1 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 3\nM END", "smiles": "[Al+3]", "formula": "Al", "atropisomerism": "No", "charge": 3, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "893c0a93-4e9f-4732-81d2-3c4a9bddc5ae" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "26.9815", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "7a58d7d4-a788-40ae-9cd0-5323fc0465b9", "id": "7a58d7d4-a788-40ae-9cd0-5323fc0465b9", "molfile": "\n CDK 02212407332D\n\n 28 30 0 0 0 0 0 0 0 0999 V2000\n 23.2608 -8.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.9050 -7.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.9003 -6.3346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5602 -8.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2105 -7.8984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2076 -6.3372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8579 -5.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8532 -3.9952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5023 -3.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1545 -4.0065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1498 -5.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5023 -6.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5602 -10.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2105 -11.0160 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9848 -12.3658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4282 -9.6586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8609 -11.7904 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 21.9050 -11.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2608 -10.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6158 -11.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9689 -10.2258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3209 -11.0036 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0910 -9.6516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5430 -12.3557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6729 -11.7819 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 25.9592 -8.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6061 -7.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5997 -6.3346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14 17 1 0 0 0 0\n 13 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 1 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 2 0 0 0 0\n 22 25 1 0 0 0 0\n 21 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 1 2 0 0 0 0\n 27 28 1 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 7 2 0 0 0 0\n 4 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 2 0 0 0 0\nM CHG 1 17 -1\nM CHG 1 25 -1\nM END", "smiles": "c1ccc(cc1)/N=N/c2c(cc3cc(cc(c3c2O)N)S(=O)(=O)[O-])S(=O)(=O)[O-]", "formula": "C16H11N3O7S2", "atropisomerism": "No", "charge": -2, "count": 3, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 3, "units": "MOL RATIO", "uuid": "f9314aa6-48fa-41c7-aea9-adb3946cfb61" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "421.4072", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "0090a487-3e61-4e97-9a13-e44e63d6f83d", "version": "15", "structure": { "id": "4219be5d-a8a7-4618-8288-55dfc4235b91", "molfile": "\n JSDraw202212407332D\n\n 86 90 0 0 0 0 0 V2000\n 23.2608 -8.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.9050 -7.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.9003 -6.3346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5602 -8.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2105 -7.8984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2076 -6.3372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8579 -5.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8532 -3.9952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5023 -3.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1545 -4.0065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1498 -5.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5023 -6.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5602 -10.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2105 -11.0160 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9848 -12.3658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4282 -9.6586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8609 -11.7904 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 21.9050 -11.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2608 -10.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6158 -11.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9689 -10.2258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3209 -11.0036 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0910 -9.6516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5430 -12.3557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6729 -11.7819 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 25.9592 -8.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6061 -7.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5997 -6.3346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3416 -8.7103 0.0000 Al 0 1 0 0 0 0 0 0 0 0 0 0\n 10.3416 -8.7103 0.0000 Al 0 1 0 0 0 0 0 0 0 0 0 0\n 23.2608 -8.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.9050 -7.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.9003 -6.3346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5602 -8.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2105 -7.8984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2076 -6.3372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8579 -5.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8532 -3.9952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5023 -3.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1545 -4.0065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1498 -5.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5023 -6.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5602 -10.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2105 -11.0160 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9848 -12.3658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4282 -9.6586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8609 -11.7904 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 21.9050 -11.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2608 -10.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6158 -11.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9689 -10.2258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3209 -11.0036 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0910 -9.6516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5430 -12.3557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6729 -11.7819 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 25.9592 -8.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6061 -7.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5997 -6.3346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2608 -8.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.9050 -7.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.9003 -6.3346 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5602 -8.6727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2105 -7.8984 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2076 -6.3372 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8579 -5.5629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8532 -3.9952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5023 -3.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1545 -4.0065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1498 -5.5580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5023 -6.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.5602 -10.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.2105 -11.0160 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 19.9848 -12.3658 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.4282 -9.6586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.8609 -11.7904 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 21.9050 -11.0185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.2608 -10.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6158 -11.0151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.9689 -10.2258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.3209 -11.0036 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0910 -9.6516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.5430 -12.3557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.6729 -11.7819 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 25.9592 -8.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.6061 -7.8959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.5997 -6.3346 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14 17 1 0 0 0 0\n 13 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 1 1 0 0 0 0\n 19 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 2 0 0 0 0\n 22 25 1 0 0 0 0\n 21 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 1 2 0 0 0 0\n 27 28 1 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 7 2 0 0 0 0\n 4 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 14 16 2 0 0 0 0\n 44 47 1 0 0 0 0\n 43 48 2 0 0 0 0\n 48 49 1 0 0 0 0\n 49 31 1 0 0 0 0\n 49 50 2 0 0 0 0\n 50 51 1 0 0 0 0\n 51 52 1 0 0 0 0\n 52 53 2 0 0 0 0\n 52 54 2 0 0 0 0\n 52 55 1 0 0 0 0\n 51 56 2 0 0 0 0\n 56 57 1 0 0 0 0\n 57 31 2 0 0 0 0\n 57 58 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 32 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 2 0 0 0 0\n 36 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 2 0 0 0 0\n 41 42 1 0 0 0 0\n 42 37 2 0 0 0 0\n 34 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 2 0 0 0 0\n 44 46 2 0 0 0 0\n 72 75 1 0 0 0 0\n 71 76 2 0 0 0 0\n 76 77 1 0 0 0 0\n 77 59 1 0 0 0 0\n 77 78 2 0 0 0 0\n 78 79 1 0 0 0 0\n 79 80 1 0 0 0 0\n 80 81 2 0 0 0 0\n 80 82 2 0 0 0 0\n 80 83 1 0 0 0 0\n 79 84 2 0 0 0 0\n 84 85 1 0 0 0 0\n 85 59 2 0 0 0 0\n 85 86 1 0 0 0 0\n 59 60 1 0 0 0 0\n 60 61 1 0 0 0 0\n 60 62 2 0 0 0 0\n 62 63 1 0 0 0 0\n 63 64 2 0 0 0 0\n 64 65 1 0 0 0 0\n 65 66 1 0 0 0 0\n 66 67 2 0 0 0 0\n 67 68 1 0 0 0 0\n 68 69 2 0 0 0 0\n 69 70 1 0 0 0 0\n 70 65 2 0 0 0 0\n 62 71 1 0 0 0 0\n 71 72 1 0 0 0 0\n 72 73 2 0 0 0 0\n 72 74 2 0 0 0 0\nM STY 1 1 MUL\nM SAL 1 2 29 30\nM SPA 1 1 29\nM SDI 1 4 9.5160 -9.7991 9.5160 -8.0311\nM SDI 1 4 11.7000 -8.0311 11.7000 -9.7991\nM SMT 1 2\nM STY 1 2 MUL\nM SAL 2 8 1 2 3 4 5 6 7 8\nM SAL 2 8 9 10 11 12 13 14 15 16\nM SAL 2 8 17 18 19 20 21 22 23 24\nM SAL 2 8 25 26 27 28 31 32 33 34\nM SAL 2 8 35 36 37 38 39 40 41 42\nM SAL 2 8 43 44 45 46 47 48 49 50\nM SAL 2 8 51 52 53 54 55 56 57 58\nM SAL 2 8 59 60 61 62 63 64 65 66\nM SAL 2 8 67 68 69 70 71 72 73 74\nM SAL 2 8 75 76 77 78 79 80 81 82\nM SAL 2 4 83 84 85 86\nM SPA 2 8 1 2 3 4 5 6 7 8\nM SPA 2 8 9 10 11 12 13 14 15 16\nM SPA 2 8 17 18 19 20 21 22 23 24\nM SPA 2 4 25 26 27 28\nM SDI 2 4 13.5720 -14.0111 13.5720 -1.3231\nM SDI 2 4 30.2120 -1.3231 30.2120 -14.0111\nM SMT 2 3\nM CHG 8 17 -1 25 -1 29 3 30 3 47 -1 55 -1 75 -1 83 -1\nM END", "smiles": "c1ccc(cc1)/N=N/c2c(cc3cc(cc(c3c2O)N)S(=O)(=O)[O-])S(=O)(=O)[O-].c1ccc(cc1)/N=N/c2c(cc3cc(cc(c3c2O)N)S(=O)(=O)[O-])S(=O)(=O)[O-].c1ccc(cc1)/N=N/c2c(cc3cc(cc(c3c2O)N)S(=O)(=O)[O-])S(=O)(=O)[O-].[Al+3].[Al+3]", "formula": "3C16H11N3O7S2.2Al", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 3, "molecular_weight": "1318.1848", "optical_activity": "NONE", "references": [ "c4cf8f32-e8a1-4848-bd26-647d5452be17", "a772834b-bf0a-4885-9f49-31ec4b089b25" ], "stereo_centers": 0 }, "unii": "L3FT3LUT29", "relationships": [ { "uuid": "afe279bf-9415-4fa9-a348-3be13a54811c", "amount": { "uuid": "3261fdab-bc0e-41e4-9cfe-37f6869f246a" }, "type": "PARENT->SALT/SOLVATE", "references": [ "7ad7c658-202e-b057-e18b-3b23a3cc4542" ], "related_substance": { "uuid": "0e85add0-16d8-4e46-a69e-15253558e219", "refuuid": "c308395f-9628-4413-95af-af5ef2b7e04f", "name": "D&C RED NO. 33 FREE ACID", "unii": "942D1H6FKF", "linking_id": "942D1H6FKF", "ref_pname": "D&C RED NO. 33 FREE ACID", "substance_class": "reference" } } ], "names": [ { "uuid": "991ff027-d914-4587-9ebd-83ad6cf50c81", "name": "Aluminum, tris[5-amino-4-hydroxy-3-(2-phenyldiazenyl)-2,7-naphthalenedisulfonato(2-)]di-", "stdName": "ALUMINUM, TRIS(5-AMINO-4-HYDROXY-3-(2-PHENYLDIAZENYL)-2,7-NAPHTHALENEDISULFONATO(2-))DI-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c4cf8f32-e8a1-4848-bd26-647d5452be17", "ad350fd5-4ddd-4dd0-8229-65e282e903e5", "a772834b-bf0a-4885-9f49-31ec4b089b25" ], "display_name": false }, { "uuid": "2a8db5b9-38e7-47f4-9878-6cd3a14ce706", "name": "D&C RED NO. 33 ALUMINUM LAKE", "stdName": "D&C RED NO. 33 ALUMINUM LAKE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "0e33fcaa-1a55-4601-afda-be7a11ab49d3" ], "display_name": true, "name_orgs": [ { "uuid": "e93eb452-7cd7-4abb-802f-c6629290b433", "name_org": "FDA" } ] }, { "uuid": "60067751-7659-494c-a826-9ee79a04caa1", "name": "Tris[5-amino-4-hydroxy-3-(2-phenyldiazenyl)-2,7-naphthalenedisulfonato(2-)]dialuminum", "stdName": "TRIS(5-AMINO-4-HYDROXY-3-(2-PHENYLDIAZENYL)-2,7-NAPHTHALENEDISULFONATO(2-))DIALUMINUM", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a772834b-bf0a-4885-9f49-31ec4b089b25" ], "display_name": false } ], "modifications": { "uuid": "edde7246-88e0-4c29-8fa0-809fcda3300d" } } ] }