{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "be77f5f3-b9a4-4e7b-99eb-2a5358dc4cb4",
          "code": "C01BA02",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|CARDIAC THERAPY|ANTIARRHYTHMICS, CLASS I AND III|Antiarrhythmics, class Ia|procainamide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C01BA02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "9ed938e7-a279-42f9-8c87-cce790659974"
          ]
        },
        {
          "uuid": "21dce6dd-2191-424d-9e34-33df452341bb",
          "code": "N0000175426",
          "comments": "Established Pharmacologic Class [EPC]|Antiarrhythmic [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175426",
          "code_system": "NDF-RT",
          "references": [
            "9ed938e7-a279-42f9-8c87-cce790659974"
          ]
        },
        {
          "uuid": "8399b77c-6f60-453e-958c-06ee0815ee8a",
          "code": "QC01BA02",
          "comments": "VATC|CARDIAC THERAPY|ANTIARRYTHMICS, CLASS I  AND III|Antiarrhythmics, class Ia|procainamide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC01BA02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "9ed938e7-a279-42f9-8c87-cce790659974"
          ]
        },
        {
          "uuid": "a0251bda-a28d-470d-a186-03cff615d29a",
          "code": "C61905",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61905",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9ed938e7-a279-42f9-8c87-cce790659974"
          ]
        },
        {
          "uuid": "308182b4-6745-4e04-8934-e9d8f5ff00d1",
          "code": "51-06-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51-06-9",
          "code_system": "CAS",
          "references": [
            "9ed938e7-a279-42f9-8c87-cce790659974",
            "a8fc375d-18a0-4503-a432-78837be17997"
          ]
        },
        {
          "uuid": "0ad8e963-4172-4648-b10d-ac173728012c",
          "code": "D011342",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68011342",
          "code_system": "MESH",
          "references": [
            "9ed938e7-a279-42f9-8c87-cce790659974"
          ]
        },
        {
          "uuid": "65a6f90e-9b7a-47e1-8c3f-caf6a8225cf8",
          "code": "NBK548477",
          "comments": "LiverTox|Cardiac|Anti-arrhythmic|Na channel blocker: Class Ia",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548477/",
          "code_system": "LIVERTOX",
          "references": [
            "3a8922af-86e9-52eb-b939-0eded4bc640b"
          ]
        },
        {
          "uuid": "c791d435-14e7-44ef-a37e-e480efd3e7de",
          "code": "PROCAINAMIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Procainamide",
          "code_system": "WIKIPEDIA",
          "references": [
            "9ed938e7-a279-42f9-8c87-cce790659974"
          ]
        },
        {
          "uuid": "f594835e-2eb3-46bc-bd9e-4a8488e6bf66",
          "code": "SUB10055MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "9ed938e7-a279-42f9-8c87-cce790659974"
          ]
        },
        {
          "uuid": "daafb858-54c9-4717-8d1f-4f144ed26abc",
          "code": "4179",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4179",
          "code_system": "INN",
          "references": [
            "9ed938e7-a279-42f9-8c87-cce790659974"
          ]
        },
        {
          "uuid": "38039807-11bc-4cde-8ed8-f70071f48887",
          "code": "200-078-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.072",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9ed938e7-a279-42f9-8c87-cce790659974"
          ]
        },
        {
          "uuid": "22279975-fa9a-44d0-9ed6-afefc4d8ed79",
          "code": "4811",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=4811",
          "code_system": "IUPHAR",
          "references": [
            "9ed938e7-a279-42f9-8c87-cce790659974"
          ]
        },
        {
          "uuid": "baf6f1e5-bb31-40b7-9297-5c1041bbc98a",
          "code": "8700",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/8700/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9ed938e7-a279-42f9-8c87-cce790659974"
          ]
        },
        {
          "uuid": "6b8e41da-1c52-4b69-a6bf-c7f067312ebc",
          "code": "DB01035",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01035",
          "code_system": "DRUG BANK",
          "references": [
            "9ed938e7-a279-42f9-8c87-cce790659974"
          ]
        },
        {
          "uuid": "4a9a5326-7a3a-4f24-971a-01d6e2d2d15f",
          "code": "CHEMBL640",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL640",
          "code_system": "ChEMBL",
          "references": [
            "9ed938e7-a279-42f9-8c87-cce790659974"
          ]
        },
        {
          "uuid": "97d1eb6b-1f37-47f0-8f9a-329b7685e1fa",
          "code": "4913",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4913",
          "code_system": "PUBCHEM",
          "references": [
            "9ed938e7-a279-42f9-8c87-cce790659974"
          ]
        },
        {
          "uuid": "181e4099-ff93-f732-147e-70bd6a374df9",
          "code": "3170",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3170",
          "code_system": "HSDB",
          "references": [
            "0e0978b9-0aa3-f581-341f-285366f91316"
          ]
        },
        {
          "uuid": "9ef39d25-ef11-8cf4-c559-76a36b16aff0",
          "code": "DTXSID7023512",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7023512",
          "code_system": "EPA CompTox",
          "references": [
            "98c4349a-7e92-1bf6-defc-b386308e0b48"
          ]
        },
        {
          "uuid": "3e669fc2-a63a-ed80-50d8-4827d38fda06",
          "code": "Procainamide",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM225/",
          "code_system": "LACTMED",
          "references": [
            "3a8922af-86e9-52eb-b939-0eded4bc640b"
          ]
        },
        {
          "uuid": "d851bcdd-afc8-babf-1540-814dc9cc90c8",
          "code": "C47793",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Cardiovascular System[C78274]|Antiarrhythmic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47793",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3a8922af-86e9-52eb-b939-0eded4bc640b"
          ]
        },
        {
          "uuid": "82d0a999-1305-9733-aed7-151f6555977d",
          "code": "C93038",
          "comments": "Pharmacologic Substance[C1909]|Cation Channel Blocker",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C93038",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3a8922af-86e9-52eb-b939-0eded4bc640b"
          ]
        },
        {
          "uuid": "74a78026-c7bc-4ea1-98d8-e82de3004aa0",
          "code": "L39WTC366D",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bfb286b6-7894-e76a-21bd-4b92e8e4a242",
          "code": "2270",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2270",
          "code_system": "DRUG CENTRAL",
          "references": [
            "3a8922af-86e9-52eb-b939-0eded4bc640b"
          ]
        },
        {
          "uuid": "7a24713c-c10d-1b46-c4ea-243d8741e0b2",
          "code": "8428",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:8428",
          "code_system": "CHEBI",
          "references": [
            "3a8922af-86e9-52eb-b939-0eded4bc640b"
          ]
        },
        {
          "uuid": "d271230f-b9a0-8ba1-76d4-d30713a54a3f",
          "code": "L39WTC366D",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=L39WTC366D",
          "code_system": "DAILYMED",
          "references": [
            "60ab1434-8644-a5fb-8081-5456feb85534"
          ]
        },
        {
          "uuid": "26270c0a-54e4-17f2-ec01-c7807c3fe1d0",
          "code": "100000081092",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d9a6f628-9ae8-bdf6-ec7d-bdf988bfe20c"
          ]
        },
        {
          "uuid": "238e3279-f1b2-f0fc-3db2-ccd1b0098945",
          "code": "27461",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=27461",
          "code_system": "NSC",
          "references": [
            "fc644dab-93ad-105f-0f70-8303039d822b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7e986fa0-b84a-4775-b727-0e7246ed20c7",
          "amount": {
            "uuid": "c5324fe7-74f7-4dd0-a0dd-c22eef98d1f6"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "37d94df4-6d68-494e-a378-d2c433e1ebd9",
            "refuuid": "0ad81a30-92cd-44d2-b8e9-520773e948ce",
            "name": "PROCAINAMIDE",
            "unii": "L39WTC366D",
            "linking_id": "L39WTC366D",
            "ref_pname": "PROCAINAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b7f11800-f024-46d5-a945-9ff0694d77d2",
          "amount": {
            "uuid": "9d722d45-08b2-4c91-bc16-02eb4a723c80"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "70de87c1-1637-483c-af2d-147cdf621252",
            "refuuid": "9a4b407a-6709-4838-b469-57df206cbacb",
            "name": "PROCAINAMIDE HYDROCHLORIDE",
            "unii": "SI4064O0LX",
            "linking_id": "SI4064O0LX",
            "ref_pname": "PROCAINAMIDE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fe1385c0-df78-4453-8d42-5c398f80877e",
          "amount": {
            "uuid": "81c5a41d-8b5c-4360-85b2-b46345c6403e"
          },
          "type": "METABOLITE ACTIVE->PARENT",
          "references": [
            "3f2934e8-ee02-43ce-b026-776f463dcdb4"
          ],
          "related_substance": {
            "uuid": "714146f3-7a97-4139-bf86-80e2a10ef337",
            "refuuid": "06bfe617-23d4-41f8-81bd-0b9fa96b1ed0",
            "name": "ACECAINIDE",
            "unii": "910Q707V6F",
            "linking_id": "910Q707V6F",
            "ref_pname": "ACECAINIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "78f3fca7-72f2-4efa-8c24-f368736b8d28",
          "amount": {
            "uuid": "4f9635f0-d150-4e7d-a321-1d3bd2229fd0",
            "type": "RELATIONSHIP_AMOUNT",
            "average": 16,
            "units": "MOLE PERCENT OF AMOUNT EXCRETED"
          },
          "comments": "Percent of dose excreted in urine as metabolite.",
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "AMOUNT EXCRETED",
          "references": [
            "a172458b-34ee-4ed6-af6e-985e85e435d1"
          ],
          "related_substance": {
            "uuid": "28f8ba17-b383-4790-b144-465f3c3367a9",
            "refuuid": "06bfe617-23d4-41f8-81bd-0b9fa96b1ed0",
            "name": "ACECAINIDE",
            "unii": "910Q707V6F",
            "linking_id": "910Q707V6F",
            "ref_pname": "ACECAINIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "575a3c8b-c0ab-49d5-a38e-78da514f65b3",
          "amount": {
            "uuid": "df4e134f-d7f0-446a-8691-2040e2163fe4",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "METABOLITE/PARENT RATIO",
            "high_limit": 2.4,
            "low_limit": 0.5
          },
          "comments": "Metabolite to parent drug ratio in non-uraemic human plasma.",
          "qualification": "PLASMA; URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "METABOLITE TO PARENT DRUG RATIO",
          "references": [
            "a172458b-34ee-4ed6-af6e-985e85e435d1"
          ],
          "related_substance": {
            "uuid": "f1eff7cf-063f-4494-ac67-8f7c0118d6ec",
            "refuuid": "06bfe617-23d4-41f8-81bd-0b9fa96b1ed0",
            "name": "ACECAINIDE",
            "unii": "910Q707V6F",
            "linking_id": "910Q707V6F",
            "ref_pname": "ACECAINIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c1165668-062b-4ba3-a16c-9e46b89924e6",
          "amount": {
            "uuid": "1942b124-da2e-4dda-8afd-112961fff45f",
            "average": 1230,
            "high": 1260,
            "low": 1200,
            "units": "MICROMOLAR"
          },
          "qualification": "Km",
          "type": "TRANSPORTER->SUBSTRATE",
          "references": [
            "32135976-04f8-5ff9-efc8-3652a202092b"
          ],
          "related_substance": {
            "uuid": "a053ccc8-94c1-41d9-8a5a-564234ec6b19",
            "refuuid": "99b36ccf-a943-4908-9ec5-0851afa8046c",
            "name": "MULTIDRUG AND TOXIN EXTRUSION PROTEIN 1",
            "unii": "6NP3XSMIP3",
            "linking_id": "6NP3XSMIP3",
            "ref_pname": "MULTIDRUG AND TOXIN EXTRUSION PROTEIN 1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "82f618ea-7899-456b-87eb-fa3414cbf3e9",
          "amount": {
            "uuid": "c516f478-0395-4941-b2da-7e51e64ec756",
            "average": 7.56,
            "high": 9.26,
            "low": 5.86,
            "units": "nM/min/mg protein"
          },
          "qualification": "Vmax",
          "type": "TRANSPORTER->SUBSTRATE",
          "references": [
            "32135976-04f8-5ff9-efc8-3652a202092b"
          ],
          "related_substance": {
            "uuid": "bd2b9586-4f7d-4552-b80e-a37833033a01",
            "refuuid": "99b36ccf-a943-4908-9ec5-0851afa8046c",
            "name": "MULTIDRUG AND TOXIN EXTRUSION PROTEIN 1",
            "unii": "6NP3XSMIP3",
            "linking_id": "6NP3XSMIP3",
            "ref_pname": "MULTIDRUG AND TOXIN EXTRUSION PROTEIN 1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9106c9c8-f746-4922-b49f-20aebb927a4c",
          "amount": {
            "uuid": "b805d27e-08fa-4d2d-ad1f-722484e4d653",
            "average": 1580,
            "high": 1620,
            "low": 1540,
            "units": "MICROMOLAR"
          },
          "qualification": "Km",
          "type": "TRANSPORTER->SUBSTRATE",
          "references": [
            "32135976-04f8-5ff9-efc8-3652a202092b"
          ],
          "related_substance": {
            "uuid": "dbfcbedf-2766-43c5-8841-b51edc0313f4",
            "refuuid": "14a4690b-45b6-455e-b530-a8ffd7dc8184",
            "name": "MATE-2",
            "unii": "B46KUN2O9L",
            "linking_id": "B46KUN2O9L",
            "ref_pname": "MATE-2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "96b202db-17c8-495b-b7ba-33aea36058cd",
          "amount": {
            "uuid": "2649ddd0-2fc6-4cb4-8f92-2d59ccb6d26e",
            "average": 6.77,
            "high": 7.71,
            "low": 5.83,
            "units": "nM/min/mg protein"
          },
          "qualification": "Vmax",
          "type": "TRANSPORTER->SUBSTRATE",
          "references": [
            "32135976-04f8-5ff9-efc8-3652a202092b"
          ],
          "related_substance": {
            "uuid": "f8a8c4b4-2284-46cb-b9fb-412d0506e81d",
            "refuuid": "14a4690b-45b6-455e-b530-a8ffd7dc8184",
            "name": "MATE-2",
            "unii": "B46KUN2O9L",
            "linking_id": "B46KUN2O9L",
            "ref_pname": "MATE-2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f489b70e-1273-4fe3-81cf-1c790666e823",
          "amount": {
            "uuid": "4de39e34-cd4e-4521-b9ae-71b98d478e74"
          },
          "type": "BINDER->LIGAND",
          "references": [
            "423ec709-f6f5-9c2e-bf54-ba28f0070d91"
          ],
          "related_substance": {
            "uuid": "3eada38d-1d8c-4bb4-8427-13e160155c2c",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b04d15fd-9863-4e68-88b8-4b314920f69a",
          "amount": {
            "uuid": "c9054e8d-99cc-4206-a1d2-30a6415e6795",
            "average": 7200,
            "units": "NANOMOLAR"
          },
          "comments": "Inhibits DNMT1 on a hemimethylated substrate ",
          "qualification": "Ki",
          "type": "TARGET->INHIBITOR",
          "references": [
            "cf326257-1abf-4049-afa2-bdf9ab13b949"
          ],
          "related_substance": {
            "uuid": "9525d1bd-e3a8-438b-963c-8138b93db78b",
            "refuuid": "fd199a38-a159-4ab2-ad2e-e383b3b69210",
            "name": "DNA (CYTOSINE-5)-METHYLTRANSFERASE 1",
            "unii": "L5R0QCN8LZ",
            "linking_id": "L5R0QCN8LZ",
            "ref_pname": "DNA (CYTOSINE-5)-METHYLTRANSFERASE 1",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "384519a5-d8d7-4c42-947a-2aaf2d6a0764",
          "name": "4-AMINO-N-(2-DIETHYLAMINOETHYL) BENZAMIDE",
          "stdName": "4-AMINO-N-(2-DIETHYLAMINOETHYL) BENZAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "582cef0c-fadf-4ea2-94d7-102309e3e362",
            "a07f5cc8-a67d-4324-9df6-dcf7394af32a"
          ],
          "display_name": false
        },
        {
          "uuid": "bf404216-0390-4a69-b46a-65cb9097f0a1",
          "name": "BENZAMIDE, 4-AMINO-N-(2-(DIETHYLAMINO)ETHYL)-",
          "stdName": "BENZAMIDE, 4-AMINO-N-(2-(DIETHYLAMINO)ETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a195c383-a2d5-4134-a338-65f481525935",
            "a07f5cc8-a67d-4324-9df6-dcf7394af32a"
          ],
          "display_name": false
        },
        {
          "uuid": "b196f3fc-1b23-4dca-8c3e-6e24bfc7f1ba",
          "name": "N-(2-(DIETHYLAMINO)ETHYL)-4-AMINOBENZAMIDE",
          "stdName": "N-(2-(DIETHYLAMINO)ETHYL)-4-AMINOBENZAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a195c383-a2d5-4134-a338-65f481525935",
            "a07f5cc8-a67d-4324-9df6-dcf7394af32a"
          ],
          "display_name": false
        },
        {
          "uuid": "1b166fcc-9266-4580-836a-b6b738dc0bbf",
          "name": "NOVOCAINAMIDE",
          "stdName": "NOVOCAINAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a195c383-a2d5-4134-a338-65f481525935",
            "a07f5cc8-a67d-4324-9df6-dcf7394af32a"
          ],
          "display_name": false
        },
        {
          "uuid": "5b147464-85ae-426e-909a-48fde326e7a0",
          "name": "NSC-27461",
          "stdName": "NSC-27461",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a195c383-a2d5-4134-a338-65f481525935",
            "a07f5cc8-a67d-4324-9df6-dcf7394af32a"
          ],
          "display_name": false
        },
        {
          "uuid": "7ff128f2-1cb2-43cc-88e1-040cc4561c59",
          "name": "PROCAINAMIDE",
          "stdName": "PROCAINAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0ede881-8513-4fe8-b1f8-bd4b4a10a775",
            "a4e6972d-216a-47bf-8793-28ab0d64e0d6",
            "ad3ec29f-2725-41cc-93c6-ab7508eb0f7e",
            "5cb1e6b6-c169-4895-ab46-f98ea4ce111a",
            "f68a6451-63f4-4f9a-98e2-3b37ea7e0152",
            "3e9348d7-4e27-415b-8f82-e060b96ff130",
            "a07f5cc8-a67d-4324-9df6-dcf7394af32a",
            "b6b5d58e-2da9-46a0-856f-c280c1f83677",
            "8a6a304b-7ded-422b-b1d2-0bc5523c636d",
            "4f59bf45-0e12-4b07-a168-26ae95603bf5"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "a52aa3f4-fc00-4ca1-b6a3-66576094c5d3",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "128768cd-c1bf-41e6-be49-0520b09206cb",
          "name": "PROCAINAMIDE [HSDB]",
          "stdName": "PROCAINAMIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a07f5cc8-a67d-4324-9df6-dcf7394af32a",
            "b6b5d58e-2da9-46a0-856f-c280c1f83677"
          ],
          "display_name": false
        },
        {
          "uuid": "7bab7ca5-38d1-4b4d-b1ed-77b2e528a7f1",
          "name": "PROCAINAMIDE [VANDF]",
          "stdName": "PROCAINAMIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a07f5cc8-a67d-4324-9df6-dcf7394af32a",
            "5cb1e6b6-c169-4895-ab46-f98ea4ce111a"
          ],
          "display_name": false
        },
        {
          "uuid": "227c1fee-05a4-aaf5-dce2-d9828e496527",
          "name": "Procainamide [WHO-DD]",
          "stdName": "PROCAINAMIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dde36bca-27c9-8c34-e887-69e66568a008"
          ],
          "display_name": false
        },
        {
          "uuid": "5f855fdb-4647-43e0-ab37-de0a00f816f4",
          "name": "SP 100 (PHARMACEUTICAL)",
          "stdName": "SP 100 (PHARMACEUTICAL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a195c383-a2d5-4134-a338-65f481525935",
            "a07f5cc8-a67d-4324-9df6-dcf7394af32a"
          ],
          "display_name": false
        },
        {
          "uuid": "9f3999c8-cfe6-4133-9eb8-bf3690d1d25e",
          "name": "procainamide [INN]",
          "stdName": "PROCAINAMIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e9348d7-4e27-415b-8f82-e060b96ff130"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8a6a304b-7ded-422b-b1d2-0bc5523c636d",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3e9348d7-4e27-415b-8f82-e060b96ff130",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b6b5d58e-2da9-46a0-856f-c280c1f83677",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a07f5cc8-a67d-4324-9df6-dcf7394af32a",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f68a6451-63f4-4f9a-98e2-3b37ea7e0152",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5cb1e6b6-c169-4895-ab46-f98ea4ce111a",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "582cef0c-fadf-4ea2-94d7-102309e3e362",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a195c383-a2d5-4134-a338-65f481525935",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ed938e7-a279-42f9-8c87-cce790659974",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390738000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f2934e8-ee02-43ce-b026-776f463dcdb4",
          "citation": "DRUGS. 1990 MAY;39(5):720-40.",
          "url": "http://www.ncbi.nlm.nih.gov/pubmed/1693889",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a172458b-34ee-4ed6-af6e-985e85e435d1",
          "citation": "HANDBOOK OF CLINICAL PHARMACOKINETICS; EDS MILO GIBALDI AND LAURIE PRESCOTT; ADIS HEALTH SCIENCE PRESS; ISBN 0 86792 004 1; 1983",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5ff25fd-770f-46a6-ba47-c03b358d42f7",
          "citation": "SRS import [L39WTC366D]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L39WTC366D",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390738000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94954b01-0e29-4d50-a805-751c388c602f",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f59bf45-0e12-4b07-a168-26ae95603bf5",
          "citation": "PROCAINAMIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c0ede881-8513-4fe8-b1f8-bd4b4a10a775",
          "citation": "PROCAINAMIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a4e6972d-216a-47bf-8793-28ab0d64e0d6",
          "citation": "PROCAINAMIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ad3ec29f-2725-41cc-93c6-ab7508eb0f7e",
          "citation": "PROCAINAMIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "32135976-04f8-5ff9-efc8-3652a202092b",
          "citation": "Biochemical Pharmacology\nVolume 74, Issue 2, 15 July 2007, Pages 359-371",
          "url": "http://www.sciencedirect.com/science/article/pii/S0006295207002298?via%3Dihub",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "423ec709-f6f5-9c2e-bf54-ba28f0070d91",
          "citation": "Pharmacol Rev 65:578–640, April 2013",
          "url": "http://dx.doi.org/10.1124/pr.111.005439",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "0e0978b9-0aa3-f581-341f-285366f91316",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+51-06-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "98c4349a-7e92-1bf6-defc-b386308e0b48",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=51-06-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b1ad4ea9-42d1-24eb-aa46-10b12ece5aa3",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+51-06-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3a8922af-86e9-52eb-b939-0eded4bc640b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a8fc375d-18a0-4503-a432-78837be17997",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cf326257-1abf-4049-afa2-bdf9ab13b949",
          "citation": "Lee, Byron H., et al. \"Procainamide is a specific inhibitor of DNA methyltransferase 1.\" Journal of Biological Chemistry 280.49 (2005): 40749-40756.",
          "url": "https://www.ncbi.nlm.nih.gov/pmc/articles/PMC1989680/",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "fc644dab-93ad-105f-0f70-8303039d822b",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "60ab1434-8644-a5fb-8081-5456feb85534",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "dde36bca-27c9-8c34-e887-69e66568a008",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d9a6f628-9ae8-bdf6-ec7d-bdf988bfe20c",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "dda7dcfe-1547-4758-a8aa-c6bd4077c97a",
          "id": "dda7dcfe-1547-4758-a8aa-c6bd4077c97a",
          "molfile": "\n  Marvin  01132111292D          \n\n 17 17  0  0  0  0            999 V2000\n    6.5039   -2.8576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7569   -2.4308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7648   -1.5954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4934   -1.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2170   -1.5798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0464   -1.2128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3281   -1.6162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6020   -1.2180    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8993   -1.6162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9071   -2.4933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1706   -1.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4549   -1.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7495   -1.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7495   -0.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4366    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1706   -0.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 17 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CCN(CC)CCNC(=O)c1ccc(cc1)N",
          "formula": "C13H21N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a93e0599-da4d-4e28-a3f4-d3283d6980a0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "235.3258",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0ad81a30-92cd-44d2-b8e9-520773e948ce",
      "version": "24",
      "structure": {
        "id": "59b0f886-caf9-4c74-92d5-306245dddf93",
        "molfile": "\n  Marvin  01132104392D          \n\n 17 17  0  0  0  0            999 V2000\n    2.8993   -1.6162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1706   -1.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9071   -2.4933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6020   -1.2180    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4549   -1.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1706   -0.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7495   -0.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7648   -1.5954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7495   -1.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4366    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3281   -1.6162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0464   -1.2128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7569   -2.4308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4934   -1.1894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5039   -2.8576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2170   -1.5798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  2  0  0  0  0\n  6  2  1  0  0  0  0\n  7 11  1  0  0  0  0\n  8 13  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11  6  2  0  0  0  0\n 12  4  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14  8  1  0  0  0  0\n 15  8  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 15  1  0  0  0  0\n  7 10  2  0  0  0  0\nM  END",
        "smiles": "CCN(CC)CCNC(=O)c1ccc(cc1)N",
        "formula": "C13H21N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "235.3258",
        "optical_activity": "NONE",
        "references": [
          "94954b01-0e29-4d50-a805-751c388c602f",
          "d5ff25fd-770f-46a6-ba47-c03b358d42f7",
          "3e9348d7-4e27-415b-8f82-e060b96ff130"
        ],
        "stereo_centers": 0
      },
      "unii": "L39WTC366D"
    }
  ]
}