{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "79080e81-bc3e-47da-8ee6-d66bebffc726",
          "code": "A06AD12",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|LAXATIVES|LAXATIVES|Osmotically acting laxatives|lactitol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A06AD12&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "1cba6553-e0a4-4653-80c1-d2065f1a0644",
          "code": "QA06AD12",
          "comments": "VATC|DRUGS FOR CONSTIPATION|DRUGS FOR CONSTIPATION|Osmotically acting laxatives|lactitol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA06AD12&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "f7434058-af47-4d25-b9c0-c64877f88b75",
          "code": "C81025",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81025",
          "code_system": "NCI_THESAURUS",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "71e1b2e3-d4c9-439f-9c72-a04b72506f63",
          "code": "585-86-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=585-86-4",
          "code_system": "CAS",
          "references": [
            "39817861-9154-4737-96c8-5763db660964",
            "70a7ef00-aa37-4161-9850-939113671087"
          ]
        },
        {
          "uuid": "5fca461f-b61c-4009-8565-800e4b63e49c",
          "code": "E 966",
          "type": "PRIMARY",
          "url": "http://www.food-info.net/uk/e/e966.htm",
          "code_system": "EU FOOD ADDITIVES",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "74c62f60-8449-450c-9e0d-5acbedb28cb8",
          "code": "C014635",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67014635",
          "code_system": "MESH",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "7383ba46-9026-440c-a402-1d786a228184",
          "code": "LACTITOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Lactitol",
          "code_system": "WIKIPEDIA",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "8faec487-28b7-4659-8e83-353817d8fcf9",
          "code": "SUB08385MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "b93da70b-4cb4-4afd-bc5d-f294230bcf3f",
          "code": "INS-966",
          "comments": "Codex Alimentarius|Functional Classification|Emulsifier|Sweetener|Thickener",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=156",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "5f80c8b5-0add-405d-944f-14fddd6bba03",
          "code": "INS-966",
          "comments": "JECFA|Functional Classification|Emulsifier|Sweetener|Thickener",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=966",
          "code_system": "JECFA EVALUATION",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "d9ed2259-80b3-4480-a74c-2d21880eb7f4",
          "code": "6414",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6414",
          "code_system": "INN",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "b191a90f-4bff-47c3-9c02-44c17246a8d9",
          "code": "28395",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/28395/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "2f868d97-0e99-43b2-a0a3-e444ebc62238",
          "code": "m6659",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6659?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "46727b27-625a-46d2-b96c-86655e22e129",
          "code": "SUB126857",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "3e46ac22-b5c7-427f-89ad-8bc745d64d4a",
          "code": "CHEMBL296306",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL296306",
          "code_system": "ChEMBL",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "9653b493-8719-4ba3-9578-d6d790254f70",
          "code": "209-566-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.698",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "838e71eb-78c1-4568-8d16-ca8bafa07ecf",
          "code": "157355",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/157355",
          "code_system": "PUBCHEM",
          "references": [
            "39817861-9154-4737-96c8-5763db660964"
          ]
        },
        {
          "uuid": "5e10fcc1-03eb-d462-6686-fd565fd72b2d",
          "code": "7970",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7970",
          "code_system": "HSDB",
          "references": [
            "44d72131-718c-1fb9-cd8d-a2f7045f2491"
          ]
        },
        {
          "uuid": "75629ed0-f2cb-5708-cd7c-d157704b5eca",
          "code": "DTXSID9044247",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9044247",
          "code_system": "EPA CompTox",
          "references": [
            "8c1d981c-4f43-60ef-a0b4-b146eebde2b1"
          ]
        },
        {
          "uuid": "b7099abf-b7a8-e617-d730-1cc5770c4b26",
          "code": "C283",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Artificial Sweetener",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C283",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a34d4141-2f19-6c2c-d6f4-814dc4f6d815"
          ]
        },
        {
          "uuid": "d99ae36e-bf19-40df-b700-e24fb26bc1ae",
          "code": "L2B0WJF7ZY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e1be65f7-1eed-fdd4-8df0-839044fb00d9",
          "code": "1130 (Number of products:1)",
          "comments": "Dietary Supplement Label Database|Carbohydrate|Lactitol",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1130&item=Lactitol",
          "code_system": "DSLD",
          "references": [
            "a34d4141-2f19-6c2c-d6f4-814dc4f6d815"
          ]
        },
        {
          "uuid": "f1c8c74d-1801-959f-cc72-ea0c900b2916",
          "code": "1534",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1534",
          "code_system": "DRUG CENTRAL",
          "references": [
            "a34d4141-2f19-6c2c-d6f4-814dc4f6d815"
          ]
        },
        {
          "uuid": "a52f73d5-a1c1-360f-6c31-f53fdb44689e",
          "code": "DB12942",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB12942",
          "code_system": "DRUG BANK",
          "references": [
            "a34d4141-2f19-6c2c-d6f4-814dc4f6d815"
          ]
        },
        {
          "uuid": "b163851d-4053-a9b1-f827-a03c04b9d288",
          "code": "1356687",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1356687",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "a34d4141-2f19-6c2c-d6f4-814dc4f6d815"
          ]
        },
        {
          "uuid": "db5063cf-55c6-83a9-e607-bafb60fdcd32",
          "code": "75323",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:75323",
          "code_system": "CHEBI",
          "references": [
            "a34d4141-2f19-6c2c-d6f4-814dc4f6d815"
          ]
        },
        {
          "uuid": "18cf6854-0873-99f4-e6a9-18f9246080fb",
          "code": "L2B0WJF7ZY",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=L2B0WJF7ZY",
          "code_system": "DAILYMED",
          "references": [
            "501f3fc7-8aee-e681-7fb2-a9a103b2ec54"
          ]
        },
        {
          "uuid": "8173fad7-74b3-7618-7cf4-01fd23bcdd1f",
          "code": "100000091655",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "61cdd951-47a9-6c9d-cd21-03918ac66fdb"
          ]
        },
        {
          "uuid": "15de27a3-a3d0-f4b2-c7b3-2bf14b44787f",
          "code": "231323",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=231323",
          "code_system": "NSC",
          "references": [
            "898b9ff7-14ab-b37d-8c68-717ce3326841"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "1d75a8a9-ba72-49d4-b8a4-83253500093e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5d99170b-eb18-45f1-942d-5257ac1e1515",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "311215f4-1be7-4d33-8109-c0bd3c1ccc1b",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ec00819-f2dc-49e5-ae64-a31018eb586a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d80a1271-f40b-42c2-99d5-7f90f56b9ce4",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1320fc8b-1e88-4a9b-8243-8dcf9937f383",
          "citation": "D08266",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d057d1b5-d506-41e3-8907-cd14abb5b9e3",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87810d0d-e14a-4d18-8e5a-b6184e374914",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca9243be-dcae-4eb4-af34-ca85aef15dcd",
          "citation": "SWEDISH SUBSTANCE LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d33690a7-c4cb-4387-aba1-be5fe9b52c01",
          "citation": "evmpd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00dff43e-1eeb-46d9-84ba-69a1e627b85b",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=156",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=156",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d58bdea3-45b7-480f-835d-095d1c922753",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39817861-9154-4737-96c8-5763db660964",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389723000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe22b654-8240-4430-980a-1dc449b66805",
          "citation": "SRS import [L2B0WJF7ZY]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L2B0WJF7ZY",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389723000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30a44b24-8486-4e29-8153-aae4a87aa31c",
          "citation": "LACTITOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9edb60e4-e90d-4078-934d-bf7668444487",
          "citation": "LACTITOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7ccbd070-4ec1-42bf-a8a0-d89bdb4d8efb",
          "citation": "LACTITOL [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3f3c5f5b-ad88-49e7-9d96-eafa6d2784e6",
          "citation": "LACTITOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "44d72131-718c-1fb9-cd8d-a2f7045f2491",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+585-86-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8c1d981c-4f43-60ef-a0b4-b146eebde2b1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=585-86-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "941f013e-7c32-49cc-ba93-3517a2d7ae0a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a34d4141-2f19-6c2c-d6f4-814dc4f6d815",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d9c2ca85-7047-4d5a-9b70-4ad10f726dda",
          "citation": "INN Proposed List 61",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL61.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6296e1e7-3afc-3885-2a08-f7d95c7e6b43",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2020/211281s000lbl.pdf",
          "doc_type": "FDA APPROVED DRUG LABEL",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "70a7ef00-aa37-4161-9850-939113671087",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f3525f12-2e27-6815-9cb0-af491db8baf7",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "f9e538e3-a1dd-4eaf-a9f4-eaeae0cd2fea",
          "citation": "OB",
          "url": "https://www.fda.gov/drugs/drug-approvals-and-databases/approved-drug-products-therapeutic-equivalence-evaluations-orange-book",
          "doc_type": "ORANGE BOOK",
          "public_domain": true
        },
        {
          "uuid": "898b9ff7-14ab-b37d-8c68-717ce3326841",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "501f3fc7-8aee-e681-7fb2-a9a103b2ec54",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "2c22bbee-1863-75d4-f70c-9da54181dfc9",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b65006f1-ebbd-40c8-9e42-734af2a15a50",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "61cdd951-47a9-6c9d-cd21-03918ac66fdb",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "787a8165-ae79-442e-bb3f-2ec66504f45e",
          "id": "787a8165-ae79-442e-bb3f-2ec66504f45e",
          "molfile": "\n  Marvin  01132106152D          \n\n 23 23  0  0  1  0            999 V2000\n   12.2589   -5.9244    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   12.2589   -6.7495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9734   -5.5119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6879   -5.9244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5445   -5.5119    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   11.5445   -4.6870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8300   -5.9244    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.8300   -6.7495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1155   -7.1619    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.4011   -6.7495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6867   -7.1619    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.9722   -6.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2577   -7.1619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6867   -7.9869    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.9722   -8.3995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4011   -8.3995    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.4011   -9.2244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1155   -7.9869    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.8300   -8.3995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1155   -5.5119    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    9.4011   -5.9245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1155   -4.6870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8300   -4.2745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  6  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  6  0  0  0\n 20  7  1  0  0  0  0\n  9  8  1  1  0  0  0\n  9 10  1  0  0  0  0\n 18  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  1  0  0  0\n 14 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  1  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  6  0  0  0\n 20 21  1  6  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "C([C@@H]([C@H]([C@@H]([C@@H](CO)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O)O)O",
          "formula": "C12H24O11",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bc698ddf-c1e9-4b49-9eee-4f1a00c692bd"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "344.3129",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "041aaa53-729d-4a43-8eea-875c0ae9ee1c",
      "version": "28",
      "structure": {
        "id": "cf74441e-2a91-4a38-834d-8d812ceaf46c",
        "molfile": "\n  Marvin  01132110432D          \n\n 23 23  0  0  1  0            999 V2000\n   13.6879   -5.9244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9734   -5.5119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2589   -5.9244    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.5445   -5.5119    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.8300   -5.9244    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.1155   -5.5119    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.1155   -4.6870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8300   -4.2745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4011   -5.9245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8300   -6.7495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1155   -7.1619    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.4011   -6.7495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6867   -7.1619    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9722   -6.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2577   -7.1619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6867   -7.9869    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.9722   -8.3995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4011   -8.3995    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.4011   -9.2244    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1155   -7.9869    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.8300   -8.3995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5445   -4.6870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2589   -6.7495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  6  9  1  6  0  0  0\n  5 10  1  6  0  0  0\n 11 10  1  1  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  1  0  0  0\n 14 15  1  0  0  0  0\n 16 13  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  1  0  0  0\n 20 18  1  0  0  0  0\n 11 20  1  0  0  0  0\n 20 21  1  6  0  0  0\n  4 22  1  6  0  0  0\n  3 23  1  6  0  0  0\nM  END",
        "smiles": "C([C@@H]([C@H]([C@@H]([C@@H](CO)O)O[C@H]1[C@@H]([C@H]([C@H]([C@@H](CO)O1)O)O)O)O)O)O",
        "formula": "C12H24O11",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "344.3129",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "5d99170b-eb18-45f1-942d-5257ac1e1515",
          "fe22b654-8240-4430-980a-1dc449b66805",
          "d9c2ca85-7047-4d5a-9b70-4ad10f726dda"
        ],
        "stereo_centers": 9
      },
      "unii": "L2B0WJF7ZY",
      "relationships": [
        {
          "uuid": "4767b7ec-7f9c-4cce-ba68-42b62b26802a",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "16b5261b-c546-4ffa-ab71-2272554dbb05",
            "refuuid": "041aaa53-729d-4a43-8eea-875c0ae9ee1c",
            "name": "LACTITOL",
            "unii": "L2B0WJF7ZY",
            "linking_id": "L2B0WJF7ZY",
            "ref_pname": "LACTITOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8d41fd31-04cc-4584-9dfe-8fef88d7c981",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "eda5b190-1343-4b34-9ac1-1622ece66ae6",
            "refuuid": "0375fdef-901f-49cf-b3ab-86468a45fb4e",
            "name": "LACTITOL DIHYDRATE",
            "unii": "1F5S85F60B",
            "linking_id": "1F5S85F60B",
            "ref_pname": "LACTITOL DIHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fc241b48-0286-4aa3-a590-15e2f02926f9",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "75bf8c70-df3a-402a-a1de-6b290d18629b",
            "refuuid": "f2e1c6ca-2ee9-4940-99af-c908b8c23543",
            "name": "LACTITOL MONOHYDRATE",
            "unii": "UH2K6W1Y64",
            "linking_id": "UH2K6W1Y64",
            "ref_pname": "LACTITOL MONOHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "416c4d0a-afd8-4e8d-bacd-bebb13e59ea7",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "941f013e-7c32-49cc-ba93-3517a2d7ae0a"
          ],
          "related_substance": {
            "uuid": "a7b5416f-8a0d-4b66-8abd-d0e03f247b02",
            "refuuid": "0375fdef-901f-49cf-b3ab-86468a45fb4e",
            "name": "LACTITOL DIHYDRATE",
            "unii": "1F5S85F60B",
            "linking_id": "1F5S85F60B",
            "ref_pname": "LACTITOL DIHYDRATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6a234d72-c5f6-102c-b74b-277d45b3cc0a",
          "type": "SOLVATE->ANHYDROUS",
          "references": [
            "b65006f1-ebbd-40c8-9e42-734af2a15a50"
          ],
          "related_substance": {
            "uuid": "b007701e-bf9a-4e73-8ccb-49d3c18a3aa0",
            "refuuid": "f2e1c6ca-2ee9-4940-99af-c908b8c23543",
            "name": "LACTITOL MONOHYDRATE",
            "unii": "UH2K6W1Y64",
            "linking_id": "UH2K6W1Y64",
            "ref_pname": "LACTITOL MONOHYDRATE"
          }
        }
      ],
      "names": [
        {
          "uuid": "62b721b2-3412-4a85-bbc4-21e7b778181e",
          "name": "4-O-.BETA.-D-GALACTOPYRANOSYL-D-GLUCITOL",
          "stdName": "4-O-.BETA.-D-GALACTOPYRANOSYL-D-GLUCITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d99170b-eb18-45f1-942d-5257ac1e1515"
          ],
          "display_name": false
        },
        {
          "uuid": "76aac35f-5e7d-4ba5-87df-81450c90e4a8",
          "name": "D-LACTITOL",
          "stdName": "D-LACTITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d58bdea3-45b7-480f-835d-095d1c922753"
          ],
          "display_name": false
        },
        {
          "uuid": "51dfe002-d60b-45fe-84fc-75de8d33c287",
          "name": "E-966",
          "stdName": "E-966",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00dff43e-1eeb-46d9-84ba-69a1e627b85b"
          ],
          "display_name": false
        },
        {
          "uuid": "d6851f1a-ba1e-429c-8c03-8a2f2d7693d1",
          "name": "FINLAC DC",
          "stdName": "FINLAC DC",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d58bdea3-45b7-480f-835d-095d1c922753"
          ],
          "display_name": false
        },
        {
          "uuid": "5da285f5-1780-46ff-b344-8e10ef89316c",
          "name": "IMPORTAL",
          "stdName": "IMPORTAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d80a1271-f40b-42c2-99d5-7f90f56b9ce4",
            "1320fc8b-1e88-4a9b-8243-8dcf9937f383"
          ],
          "display_name": false
        },
        {
          "uuid": "e00016a5-94ce-49fb-8d39-ba1c9b8baff4",
          "name": "INS NO.966",
          "stdName": "INS NO.966",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00dff43e-1eeb-46d9-84ba-69a1e627b85b"
          ],
          "display_name": false
        },
        {
          "uuid": "755499f3-4455-4785-997b-7887fb9a8e89",
          "name": "INS-966",
          "stdName": "INS-966",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00dff43e-1eeb-46d9-84ba-69a1e627b85b"
          ],
          "display_name": false
        },
        {
          "uuid": "6acc44da-11eb-4752-bdc6-e36be40e4007",
          "name": "LACTITOL",
          "stdName": "LACTITOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9edb60e4-e90d-4078-934d-bf7668444487",
            "5d99170b-eb18-45f1-942d-5257ac1e1515",
            "8ec00819-f2dc-49e5-ae64-a31018eb586a",
            "7ccbd070-4ec1-42bf-a8a0-d89bdb4d8efb",
            "87810d0d-e14a-4d18-8e5a-b6184e374914",
            "30a44b24-8486-4e29-8153-aae4a87aa31c",
            "3f3c5f5b-ad88-49e7-9d96-eafa6d2784e6",
            "d057d1b5-d506-41e3-8907-cd14abb5b9e3",
            "311215f4-1be7-4d33-8109-c0bd3c1ccc1b"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "12f90ff9-c6f3-49aa-84f6-a293c202cb9c",
              "name_org": "INN"
            },
            {
              "uuid": "4c26fd43-984b-4de8-ad26-ed9dc9f76553",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "422687b3-481c-4cb5-95c6-c439ad324bc7",
          "name": "LACTITOL ACM 50",
          "stdName": "LACTITOL ACM 50",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d58bdea3-45b7-480f-835d-095d1c922753"
          ],
          "display_name": false
        },
        {
          "uuid": "037b6ff2-5c2e-483d-b817-7061b9138bc6",
          "name": "LACTITOL ANHYDROUS",
          "stdName": "LACTITOL ANHYDROUS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d33690a7-c4cb-4387-aba1-be5fe9b52c01"
          ],
          "display_name": false
        },
        {
          "uuid": "a2d6bded-915a-4aeb-bc62-ece15c7484cc",
          "name": "LACTITOL [MI]",
          "stdName": "LACTITOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8ec00819-f2dc-49e5-ae64-a31018eb586a"
          ],
          "display_name": false
        },
        {
          "uuid": "4a9e2ae9-9af2-4940-a529-52b759106855",
          "name": "LACTITOL [ORANGE BOOK]",
          "stdName": "LACTITOL [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9e538e3-a1dd-4eaf-a9f4-eaeae0cd2fea"
          ],
          "display_name": false
        },
        {
          "uuid": "6820453b-52f3-5102-77f2-f5e4e1fcc08b",
          "name": "LACTITOL [USP-RS]",
          "stdName": "LACTITOL [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3525f12-2e27-6815-9cb0-af491db8baf7"
          ],
          "display_name": false
        },
        {
          "uuid": "18792f24-61c7-4058-8158-ae701c6f0c92",
          "name": "LACTOBIOSIT",
          "stdName": "LACTOBIOSIT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d75a8a9-ba72-49d4-b8a4-83253500093e"
          ],
          "display_name": false
        },
        {
          "uuid": "d929e86c-4dbf-49b1-86f8-98ba6f358630",
          "name": "LACTOSIT",
          "stdName": "LACTOSIT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1d75a8a9-ba72-49d4-b8a4-83253500093e"
          ],
          "display_name": false
        },
        {
          "uuid": "c4c691c4-82db-40a6-87b5-10131b808e3e",
          "name": "LACTOSITOL",
          "stdName": "LACTOSITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ca9243be-dcae-4eb4-af34-ca85aef15dcd"
          ],
          "display_name": false
        },
        {
          "uuid": "71131f2d-6b48-4765-b578-ad05e218f9d4",
          "name": "LACTY (SACCHARIDE)",
          "stdName": "LACTY (SACCHARIDE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d58bdea3-45b7-480f-835d-095d1c922753"
          ],
          "display_name": false
        },
        {
          "uuid": "6eb2dc29-4186-2341-0fbc-262c72e369cd",
          "name": "Lactitol [WHO-DD]",
          "stdName": "LACTITOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c22bbee-1863-75d4-f70c-9da54181dfc9"
          ],
          "display_name": false
        },
        {
          "uuid": "95a87e6a-faca-4977-badd-d3057cf8bfd8",
          "name": "MILCHEN",
          "stdName": "MILCHEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d58bdea3-45b7-480f-835d-095d1c922753"
          ],
          "display_name": false
        },
        {
          "uuid": "4210d166-7c73-4e45-bb03-53021c693b5d",
          "name": "MIRUHEN",
          "stdName": "MIRUHEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d58bdea3-45b7-480f-835d-095d1c922753"
          ],
          "display_name": false
        },
        {
          "uuid": "4c2ae8ec-13cf-4e10-9162-34ca5f387d20",
          "name": "NSC-231323",
          "stdName": "NSC-231323",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d58bdea3-45b7-480f-835d-095d1c922753"
          ],
          "display_name": false
        },
        {
          "uuid": "c5f3e0dc-5de0-4aca-b270-ad2f465e13c0",
          "name": "lactitol [INN]",
          "stdName": "LACTITOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "311215f4-1be7-4d33-8109-c0bd3c1ccc1b",
            "d9c2ca85-7047-4d5a-9b70-4ad10f726dda"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "f1eaf13c-d16b-425a-a50e-c27fd4ec4e05",
          "name": "Tmax",
          "value": {
            "uuid": "39800498-97b9-401c-b536-ec89ac5cee87",
            "average": 3.6,
            "high": 4.8,
            "low": 2.4,
            "units": "hours"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "716becec-2eab-4576-8df2-1ba87a834b63",
              "name": "SINGLE ORAL DOSE ADMINISTRATION",
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "6296e1e7-3afc-3885-2a08-f7d95c7e6b43"
          ]
        },
        {
          "uuid": "787e36e4-d255-4e3d-9b64-0cf0102533b7",
          "name": "Biological Half-life",
          "value": {
            "uuid": "58d29cc0-6b45-45c9-a38c-51036b4544bb",
            "average": 2.4,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "6296e1e7-3afc-3885-2a08-f7d95c7e6b43"
          ]
        }
      ],
      "modifications": {
        "uuid": "854eb6b4-82d9-4e01-b202-f1011a54d47b"
      }
    }
  ]
}