{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "965c17ec-68fe-43b5-9ac7-9712e7a452a8",
          "code": "81-54-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=81-54-9",
          "code_system": "CAS",
          "references": [
            "b45d1c13-ea92-4831-94d2-9244591cbecf",
            "eb7bfdef-2fe7-4545-927e-e06e5ae072a1"
          ]
        },
        {
          "uuid": "b759807c-e523-481b-ab25-48feb5a565d9",
          "code": "1,2,4-TRIHYDROXYANTHRAQUINONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/1,2,4-Trihydroxyanthraquinone",
          "code_system": "WIKIPEDIA",
          "references": [
            "b45d1c13-ea92-4831-94d2-9244591cbecf"
          ]
        },
        {
          "uuid": "6270f39a-659e-4e20-9b71-addfb5a1677b",
          "code": "201-359-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.237",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b45d1c13-ea92-4831-94d2-9244591cbecf"
          ]
        },
        {
          "uuid": "e1b7bdd8-4d25-4a02-9143-0df2fb609f4a",
          "code": "m9326",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9326?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b45d1c13-ea92-4831-94d2-9244591cbecf"
          ]
        },
        {
          "uuid": "d521ba1f-c8a9-43a2-9fb2-a16d3ba0ca96",
          "code": "6683",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6683",
          "code_system": "PUBCHEM",
          "references": [
            "b45d1c13-ea92-4831-94d2-9244591cbecf"
          ]
        },
        {
          "uuid": "f81099a5-b123-fa53-9551-47eeed6ae7b2",
          "code": "DTXSID4021214",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4021214",
          "code_system": "EPA CompTox",
          "references": [
            "d032c6d3-2da2-f658-5640-b9c4135eea3c"
          ]
        },
        {
          "uuid": "a08be8cd-24f8-41a1-8c7a-1a1f5cfa13bc",
          "code": "L1GT81LS6N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "59835c9a-4919-c586-0753-ba2a0ed2e021",
          "code": "8645",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:8645",
          "code_system": "CHEBI"
        },
        {
          "uuid": "d415a6a6-e166-b14b-00b3-380012e365fa",
          "code": "10447",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=10447",
          "code_system": "NSC",
          "references": [
            "5a3df700-61d6-2057-5e97-68b712e67a9c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a47352de-a443-4def-b303-53213bd79b26",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "3ac5a5e3-f338-46ad-a224-e39767b1672a"
          ],
          "related_substance": {
            "uuid": "508a09fe-ab49-45c2-89f9-035cc675647a",
            "refuuid": "30fcf4fd-5005-4425-9b2b-402d6e98e2b2",
            "name": "RUBIA TINCTORUM ROOT",
            "unii": "0SVP95L23G",
            "linking_id": "0SVP95L23G",
            "ref_pname": "RUBIA TINCTORUM ROOT"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c4c9b085-1d82-41d4-8594-5e4860b37018",
          "name": "1,2,4-TRIHYDROXY-9,10-ANTHRACENEDIONE",
          "stdName": "1,2,4-TRIHYDROXY-9,10-ANTHRACENEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9ea489c-ab25-4a95-b768-a74069f6b1ab",
            "84d80372-8815-4c97-830e-240707597a1b"
          ],
          "display_name": false
        },
        {
          "uuid": "f26154c8-1bbd-453c-981f-c971ccecd0f5",
          "name": "1,2,4-TRIHYDROXYANTHRAQUINONE",
          "stdName": "1,2,4-TRIHYDROXYANTHRAQUINONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5a6e5fa-2b41-4cb6-a6a4-3db47743f7e2",
            "84d80372-8815-4c97-830e-240707597a1b"
          ],
          "display_name": false
        },
        {
          "uuid": "c5bc40ef-3073-49d7-b781-956485f4250d",
          "name": "ANTHRAQUINONE, 1,2,4-TRIHYDROXY-",
          "stdName": "ANTHRAQUINONE, 1,2,4-TRIHYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5a6e5fa-2b41-4cb6-a6a4-3db47743f7e2",
            "84d80372-8815-4c97-830e-240707597a1b"
          ],
          "display_name": false
        },
        {
          "uuid": "8ab3e52e-5321-4dce-ab30-dbae0644cb7c",
          "name": "C.I. 58205",
          "stdName": "C.I. 58205",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5a6e5fa-2b41-4cb6-a6a4-3db47743f7e2",
            "84d80372-8815-4c97-830e-240707597a1b"
          ],
          "display_name": false
        },
        {
          "uuid": "fa0c480b-ce50-46af-bee3-125a5323fb11",
          "name": "C.I. 75410",
          "stdName": "C.I. 75410",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5a6e5fa-2b41-4cb6-a6a4-3db47743f7e2",
            "84d80372-8815-4c97-830e-240707597a1b"
          ],
          "display_name": false
        },
        {
          "uuid": "3099ba57-61dd-484b-a3e7-9d9a5e9cda96",
          "name": "C.I. NATURAL RED 16",
          "stdName": "C.I. NATURAL RED 16",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84d80372-8815-4c97-830e-240707597a1b",
            "e384330c-73ca-40df-bc13-b07884fb57a0"
          ],
          "display_name": false
        },
        {
          "uuid": "5105cf45-d0a6-4457-b28d-10d4b2416cfe",
          "name": "C.I. NATURAL RED 8",
          "stdName": "C.I. NATURAL RED 8",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84d80372-8815-4c97-830e-240707597a1b",
            "e384330c-73ca-40df-bc13-b07884fb57a0"
          ],
          "display_name": false
        },
        {
          "uuid": "7f16279b-8e90-4621-b431-68945ef8409b",
          "name": "HYDROXYLIZARIC ACID",
          "stdName": "HYDROXYLIZARIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5a6e5fa-2b41-4cb6-a6a4-3db47743f7e2",
            "84d80372-8815-4c97-830e-240707597a1b"
          ],
          "display_name": false
        },
        {
          "uuid": "d3ddeda5-7be4-40fa-b7c4-0840f0ef2168",
          "name": "NSC-10447",
          "stdName": "NSC-10447",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5a6e5fa-2b41-4cb6-a6a4-3db47743f7e2",
            "84d80372-8815-4c97-830e-240707597a1b"
          ],
          "display_name": false
        },
        {
          "uuid": "d8893f63-537d-4767-be1b-9c64d84a4b80",
          "name": "PURPURIN",
          "stdName": "PURPURIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "422a3a4c-e228-488c-bb33-7553437a31a5",
            "d5a6e5fa-2b41-4cb6-a6a4-3db47743f7e2",
            "84d80372-8815-4c97-830e-240707597a1b",
            "e384330c-73ca-40df-bc13-b07884fb57a0"
          ],
          "display_name": true
        },
        {
          "uuid": "ead7532b-289a-4043-81b7-7a22e6a24a67",
          "name": "PURPURIN (DYE)",
          "stdName": "PURPURIN (DYE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5a6e5fa-2b41-4cb6-a6a4-3db47743f7e2",
            "84d80372-8815-4c97-830e-240707597a1b"
          ],
          "display_name": false
        },
        {
          "uuid": "1773556a-e947-4f2d-b5cd-368c5d2695b7",
          "name": "PURPURIN [MI]",
          "stdName": "PURPURIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84d80372-8815-4c97-830e-240707597a1b",
            "e384330c-73ca-40df-bc13-b07884fb57a0"
          ],
          "display_name": false
        },
        {
          "uuid": "1b9e8610-eb6e-4e6e-9e30-ca940ab75143",
          "name": "PURPURINE",
          "stdName": "PURPURINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5a6e5fa-2b41-4cb6-a6a4-3db47743f7e2",
            "84d80372-8815-4c97-830e-240707597a1b"
          ],
          "display_name": false
        },
        {
          "uuid": "12087d40-4c66-4a0f-895e-03aeb948f7c9",
          "name": "SMOKE BROWN G",
          "stdName": "SMOKE BROWN G",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5a6e5fa-2b41-4cb6-a6a4-3db47743f7e2",
            "84d80372-8815-4c97-830e-240707597a1b"
          ],
          "display_name": false
        },
        {
          "uuid": "1513008e-efbc-4152-81cc-82ebe0c33b29",
          "name": "VERANTIN",
          "stdName": "VERANTIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5a6e5fa-2b41-4cb6-a6a4-3db47743f7e2",
            "84d80372-8815-4c97-830e-240707597a1b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3ac5a5e3-f338-46ad-a224-e39767b1672a",
          "citation": "WIKIPEDIA",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "c9ea489c-ab25-4a95-b768-a74069f6b1ab",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "84d80372-8815-4c97-830e-240707597a1b",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d5a6e5fa-2b41-4cb6-a6a4-3db47743f7e2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e384330c-73ca-40df-bc13-b07884fb57a0",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b45d1c13-ea92-4831-94d2-9244591cbecf",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391627000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed8cd7a1-585e-4a47-9136-56dace08b67b",
          "citation": "SRS import [L1GT81LS6N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L1GT81LS6N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391627000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5097eee-0f46-46b9-8b14-7e5e377eaa91",
          "citation": "CHEMID RECORD 81-54-9",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "422a3a4c-e228-488c-bb33-7553437a31a5",
          "citation": "PURPURIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d032c6d3-2da2-f658-5640-b9c4135eea3c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=81-54-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "eb7bfdef-2fe7-4545-927e-e06e5ae072a1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5a3df700-61d6-2057-5e97-68b712e67a9c",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7ac4952f-3a2e-45c9-ba63-25617a16d128",
          "id": "7ac4952f-3a2e-45c9-ba63-25617a16d128",
          "molfile": "\n  Marvin  01132106232D          \n\n 19 21  0  0  0  0            999 V2000\n    2.5637    0.7833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8428    0.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8428   -0.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1220   -0.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1220   -1.6848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4099   -0.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2970   -0.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2970   -1.6848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0126   -0.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7247   -0.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4490   -0.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4490    0.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7247    0.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0126    0.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2970    0.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2970    1.6014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4099    0.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1220    0.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1220    1.6014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 18  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n 17  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 14  9  2  0  0  0  0\n 10 11  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)C(=O)c3c(cc(c(c3C2=O)O)O)O",
          "formula": "C14H8O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "11fa2ccc-1ec2-42a7-a563-4e8682bc3b40"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "256.2109",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b45015ef-74f6-4235-95ec-ca0436aa1218",
      "version": "8",
      "structure": {
        "id": "50c37b56-252a-49f1-8be4-def089d10aa3",
        "molfile": "\n  Marvin  01132104122D          \n\n 19 21  0  0  0  0            999 V2000\n    0.4099    0.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4099   -0.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2970    0.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1220    0.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2970   -0.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1220   -0.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0126    0.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2970    1.6014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8428    0.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1220    1.6014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0126   -0.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2970   -1.6848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8428   -0.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1220   -1.6848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7247    0.7712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5637    0.7833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7247   -0.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4490    0.3682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4490   -0.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  3  8  2  0  0  0  0\n  4  9  2  0  0  0  0\n  4 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n  5 12  2  0  0  0  0\n  6 13  2  0  0  0  0\n  6 14  1  0  0  0  0\n  7 15  1  0  0  0  0\n  9 16  1  0  0  0  0\n 11 17  1  0  0  0  0\n 15 18  2  0  0  0  0\n 17 19  2  0  0  0  0\n  7 11  2  0  0  0  0\n  9 13  1  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)C(=O)c3c(cc(c(c3C2=O)O)O)O",
        "formula": "C14H8O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "256.2109",
        "optical_activity": "NONE",
        "references": [
          "ed8cd7a1-585e-4a47-9136-56dace08b67b",
          "b5097eee-0f46-46b9-8b14-7e5e377eaa91"
        ],
        "stereo_centers": 0
      },
      "unii": "L1GT81LS6N"
    }
  ]
}