{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7b3bae4e-3deb-4f5c-a737-8a5ebc18f407",
          "code": "68239-82-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68239-82-7",
          "code_system": "CAS",
          "references": [
            "7ecd3496-37f9-4eda-b480-213ba950782e",
            "a31a5495-3156-417e-906b-4f002a5c3b46"
          ]
        },
        {
          "uuid": "c300668c-420c-428b-8925-5af826af002a",
          "code": "269-476-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.063.141",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7ecd3496-37f9-4eda-b480-213ba950782e"
          ]
        },
        {
          "uuid": "fc0015ae-224f-3f4c-abb4-236b95d71b61",
          "code": "6235",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6235",
          "code_system": "HSDB",
          "references": [
            "664865f7-0def-40e6-e61a-81b1003fe361"
          ]
        },
        {
          "uuid": "a9219623-269c-7181-dfae-d61876d69a58",
          "code": "5361844",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5361844",
          "code_system": "PUBCHEM",
          "references": [
            "c194a832-d265-43b4-9573-6fa5db3893ad"
          ]
        },
        {
          "uuid": "c5aa5ce5-2f81-41a2-bd7a-f4cd4466d9f7",
          "code": "L1E2M78P4W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "16601457-4b64-dfe3-7e9c-99e42a95c241",
          "code": "DTXSID50887308",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50887308",
          "code_system": "EPA CompTox",
          "references": [
            "2611106b-c873-7ed0-2739-477f24ffa91c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "fb46a1ac-7e69-42a4-b206-9962566ae191",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "043ced9c-3217-4749-829e-1e847191300c",
            "refuuid": "4ade9f68-1373-49a6-840f-71268d4073d9",
            "name": "4-NITRO-O-PHENYLENEDIAMINE",
            "unii": "5A9AX7Y0TT",
            "linking_id": "5A9AX7Y0TT",
            "ref_pname": "4-NITRO-O-PHENYLENEDIAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "55d72eb7-9037-439d-98f2-0fb547712762",
          "name": "1,2-BENZENEDIAMINE, 4-NITRO-, SULFATE (1:1)",
          "stdName": "1,2-BENZENEDIAMINE, 4-NITRO-, SULFATE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d389f99d-1b7a-4fac-859a-5a6eff2a5054",
            "1db05aab-b128-44b7-9f59-08e1feb7b683"
          ],
          "display_name": false
        },
        {
          "uuid": "7f56ee98-ab81-4ae7-b76c-b804edbfb4c1",
          "name": "4-NITRO-1,2-BENZENEDIAMINE SULFATE [HSDB]",
          "stdName": "4-NITRO-1,2-BENZENEDIAMINE SULFATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d389f99d-1b7a-4fac-859a-5a6eff2a5054",
            "f28d6014-eafd-41be-a833-25e4b137b5c1"
          ],
          "display_name": false
        },
        {
          "uuid": "d93bf63f-c753-44f3-8f11-d55332e29162",
          "name": "4-NITRO-O-PHENYLENEDIAMINE SULFATE",
          "stdName": "4-NITRO-O-PHENYLENEDIAMINE SULFATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d389f99d-1b7a-4fac-859a-5a6eff2a5054",
            "be8a431c-5cdb-4c20-99dc-443aef5463a1",
            "f4533d70-02fd-4329-8a83-1af84977e630"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0f2d129f-5c4b-4bab-9686-2210f3f77afe",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e86bd437-5792-6699-3cba-ea89125f2bdc",
          "name": "4-nitro-o-phenylenediamine sulfate [WHO-DD]",
          "stdName": "4-NITRO-O-PHENYLENEDIAMINE SULFATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc675106-b9ee-929f-4ad3-f991d0cb6f76"
          ],
          "display_name": false
        },
        {
          "uuid": "e471f1d2-32e5-4514-a128-a662d43aeaec",
          "name": "RODOL 4JS",
          "stdName": "RODOL 4JS",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d389f99d-1b7a-4fac-859a-5a6eff2a5054",
            "f4533d70-02fd-4329-8a83-1af84977e630"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f4533d70-02fd-4329-8a83-1af84977e630",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d389f99d-1b7a-4fac-859a-5a6eff2a5054",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1db05aab-b128-44b7-9f59-08e1feb7b683",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f28d6014-eafd-41be-a833-25e4b137b5c1",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ecd3496-37f9-4eda-b480-213ba950782e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391012000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "245d4b94-744f-402b-99dd-d92d1f5d7aa9",
          "citation": "SRS import [L1E2M78P4W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L1E2M78P4W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391012000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef52bd12-0ff4-42f2-b6a8-868e693c0d71",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be8a431c-5cdb-4c20-99dc-443aef5463a1",
          "citation": "4-NITRO-O-PHENYLENEDIAMINE SULFATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "664865f7-0def-40e6-e61a-81b1003fe361",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+68239-82-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2611106b-c873-7ed0-2739-477f24ffa91c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a31a5495-3156-417e-906b-4f002a5c3b46",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2ebf25b5-c318-e5d4-18bc-de9f115e5265",
          "citation": "WHO DRUG DICTIONARY 2019",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c194a832-d265-43b4-9573-6fa5db3893ad",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "fc675106-b9ee-929f-4ad3-f991d0cb6f76",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "990d66ae-937b-4fb4-ac18-4dc4f510c18f",
          "id": "990d66ae-937b-4fb4-ac18-4dc4f510c18f",
          "molfile": "\n  Marvin  01132107572D          \n\n  5  4  0  0  0  0            999 V2000\n    4.8522   -5.0402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4405   -5.6131    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8637   -6.1945    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0395   -5.0402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0395   -6.2053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  5  2  0  0  0  0\nM  END",
          "smiles": "OS(=O)(=O)O",
          "formula": "H2O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2bde02b5-91ae-4b6a-b154-9dda5cf2d966"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "98.0796",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "23258e7c-0900-410f-8b24-c7767b8f923d",
          "id": "23258e7c-0900-410f-8b24-c7767b8f923d",
          "molfile": "\n  Marvin  01132101582D          \n\n 11 11  0  0  0  0            999 V2000\n    6.3237   -1.6945    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6071   -2.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8760   -1.6945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1594   -2.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1594   -2.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8760   -3.3372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6071   -2.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3086   -3.3372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4542   -3.3372    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    3.4542   -4.1700    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.7413   -2.9284    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  7  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  9  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\nM  CHG  2   9   1  10  -1\nM  END",
          "smiles": "c1cc(c(cc1[N+](=O)[O-])N)N",
          "formula": "C6H7N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "03000357-c41a-4ab1-af07-6e9d96a2d7db"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "153.1389",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3e1e69f3-f5c6-48e8-a120-b9c43305c4fe",
      "version": "10",
      "structure": {
        "id": "04aa32ec-b467-4d26-94a5-4250fcd4d1ff",
        "molfile": "\n  Marvin  01132100322D          \n\n 16 15  0  0  0  0            999 V2000\n    4.1594   -2.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8760   -3.3372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6071   -2.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6071   -2.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3237   -1.6945    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8760   -1.6945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1594   -2.1147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3086   -3.3372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4542   -3.3372    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    3.4542   -4.1700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7413   -2.9284    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.4124   -5.5841    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8271   -5.0142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8386   -6.1625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0083   -5.0142    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0083   -6.1732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  6  1  0  0  0  0\n  1  7  2  0  0  0  0\n  3  8  1  0  0  0  0\n  1  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n  9 11  1  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  2  0  0  0  0\n 12 16  2  0  0  0  0\nM  CHG  2   9   1  11  -1\nM  END",
        "smiles": "c1cc(c(cc1[N+](=O)[O-])N)N.OS(=O)(=O)O",
        "formula": "C6H7N3O2.H2O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "251.2185",
        "optical_activity": "NONE",
        "references": [
          "ef52bd12-0ff4-42f2-b6a8-868e693c0d71",
          "245d4b94-744f-402b-99dd-d92d1f5d7aa9"
        ],
        "stereo_centers": 0
      },
      "unii": "L1E2M78P4W"
    }
  ]
}