{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "12788d09-8337-4a9f-b85e-d997bd168d29",
          "code": "7365-44-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7365-44-8",
          "code_system": "CAS",
          "references": [
            "e32dacd9-e0d1-4f84-bb60-f7e52198e03b",
            "27cf5620-03ab-4aaa-af35-cc33614b3972"
          ]
        },
        {
          "uuid": "db1e740b-93e1-4f6a-85e3-66264a01eb4d",
          "code": "230-906-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.097",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e32dacd9-e0d1-4f84-bb60-f7e52198e03b"
          ]
        },
        {
          "uuid": "29346a3f-47ff-499e-89d9-92d48242fb4d",
          "code": "m10589",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10589?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e32dacd9-e0d1-4f84-bb60-f7e52198e03b"
          ]
        },
        {
          "uuid": "ca997084-472a-6b98-056b-44c49f3a13df",
          "code": "DTXSID3064643",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3064643",
          "code_system": "EPA CompTox",
          "references": [
            "9968fc9f-8b05-6ae6-5f13-a70bfc6b572e"
          ]
        },
        {
          "uuid": "747d6659-dcea-9448-a10e-a7309769c875",
          "code": "81831",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/81831",
          "code_system": "PUBCHEM",
          "references": [
            "b07b1b60-95d2-594b-6943-6d294f348b4d"
          ]
        },
        {
          "uuid": "e81ffb53-d932-8496-e9bf-2568ce180297",
          "code": "DB02371",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB02371",
          "code_system": "DRUG BANK",
          "references": [
            "0af113af-41cc-1f04-06f2-f37c97de9411"
          ]
        },
        {
          "uuid": "06fda1c2-c1e4-4d9f-8d50-fe25a9df2b67",
          "code": "L173DK6289",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d52e24e0-83ac-513f-ec59-1aa9fa87752b",
          "code": "44356",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:44356",
          "code_system": "CHEBI",
          "references": [
            "0af113af-41cc-1f04-06f2-f37c97de9411"
          ]
        },
        {
          "uuid": "28d2f6e2-411f-2cff-3c1b-76ae934d98b9",
          "code": "TES (buffer)",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/TES_(buffer)",
          "code_system": "WIKIPEDIA",
          "references": [
            "eb5c1797-1136-9b70-eef7-464b9c628c15"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bb33488d-7222-443a-99c7-e60176158b7f",
          "name": "2-((2-HYDROXY-1,1-BIS(HYDROXYMETHYL)ETHYL)AMINO)ETHANESULFONIC ACID",
          "stdName": "2-((2-HYDROXY-1,1-BIS(HYDROXYMETHYL)ETHYL)AMINO)ETHANESULFONIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "72b45b98-18ec-4144-9363-1f3994b46b77",
            "d6937f3f-8cdb-4860-92c9-4cc90d9d6e27"
          ],
          "display_name": false
        },
        {
          "uuid": "fbc955b5-be86-4886-8fdf-cca91cbbc9ab",
          "name": "ETHANESULFONIC ACID, 2-((2-HYDROXY-1,1-BIS(HYDROXYMETHYL)ETHYL)AMINO)-",
          "stdName": "ETHANESULFONIC ACID, 2-((2-HYDROXY-1,1-BIS(HYDROXYMETHYL)ETHYL)AMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f132eb5-055f-45d8-801b-c9182103dbe5",
            "d6937f3f-8cdb-4860-92c9-4cc90d9d6e27"
          ],
          "display_name": false
        },
        {
          "uuid": "4df0c54c-15b0-49f7-903f-952775f7ee7b",
          "name": "N-TRIS(HYDROXYMETHYL)METHYL-2-AMINOETHANESULFONIC ACID",
          "stdName": "N-TRIS(HYDROXYMETHYL)METHYL-2-AMINOETHANESULFONIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7f132eb5-055f-45d8-801b-c9182103dbe5",
            "86c02352-e2d0-4fc0-b277-b5a335e8c243"
          ],
          "display_name": true
        },
        {
          "uuid": "8c173620-fafa-4a01-a178-2f929827b112",
          "name": "TES",
          "stdName": "TES",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b70fe166-83d6-4b8b-b640-0cfb6bf43495",
            "72b45b98-18ec-4144-9363-1f3994b46b77",
            "d6937f3f-8cdb-4860-92c9-4cc90d9d6e27"
          ],
          "display_name": false
        },
        {
          "uuid": "152492ee-f5e2-4f57-a6c6-58cd3bb9a1b0",
          "name": "TES [MI]",
          "stdName": "TES [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "72b45b98-18ec-4144-9363-1f3994b46b77",
            "d6937f3f-8cdb-4860-92c9-4cc90d9d6e27"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7f132eb5-055f-45d8-801b-c9182103dbe5",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "86c02352-e2d0-4fc0-b277-b5a335e8c243",
          "citation": "DMF 7482",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72b45b98-18ec-4144-9363-1f3994b46b77",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6937f3f-8cdb-4860-92c9-4cc90d9d6e27",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e32dacd9-e0d1-4f84-bb60-f7e52198e03b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390008000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7d356862-b878-4af9-92c2-3659fad101a0",
          "citation": "SRS import [L173DK6289]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=L173DK6289",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390008000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b70fe166-83d6-4b8b-b640-0cfb6bf43495",
          "citation": "TES [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9968fc9f-8b05-6ae6-5f13-a70bfc6b572e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=7365-44-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b07b1b60-95d2-594b-6943-6d294f348b4d",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "27cf5620-03ab-4aaa-af35-cc33614b3972",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "eb5c1797-1136-9b70-eef7-464b9c628c15",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "0af113af-41cc-1f04-06f2-f37c97de9411",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "334409d3-e09a-4a16-9971-a66dc1560f0b",
          "id": "334409d3-e09a-4a16-9971-a66dc1560f0b",
          "molfile": "\n  Marvin  01132102442D          \n\n 14 13  0  0  0  0            999 V2000\n   10.9786   -6.0866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1581   -6.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8221   -5.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4861   -4.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9706   -3.8262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5756   -4.9114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2433   -5.3960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0686   -5.5834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4009   -5.0990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6474   -5.4349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9797   -4.9504    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4951   -5.6182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4642   -4.2827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3119   -4.4659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  6  1  0  0  0  0\n  3  8  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  2  0  0  0  0\nM  END",
          "smiles": "C(CS(=O)(=O)O)NC(CO)(CO)CO",
          "formula": "C6H15NO6S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "469bc1c3-ea49-4bfc-bd5c-9878e4a8b1a4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "229.2527",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4d7877c6-03f2-4c17-8f1d-b6f6c3f8e373",
      "version": "7",
      "structure": {
        "id": "643296d8-05d2-42a1-9af7-53fcffd27b87",
        "molfile": "\n  Marvin  01132105122D          \n\n 14 13  0  0  0  0            999 V2000\n    9.8221   -5.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1581   -6.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9786   -6.0866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4861   -4.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9706   -3.8262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5756   -4.9114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2433   -5.3960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0686   -5.5834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4009   -5.0990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6474   -5.4349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9797   -4.9504    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4951   -5.6182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4642   -4.2827    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3119   -4.4659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  1  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  2  0  0  0  0\nM  END",
        "smiles": "C(CS(=O)(=O)O)NC(CO)(CO)CO",
        "formula": "C6H15NO6S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "229.2527",
        "optical_activity": "NONE",
        "references": [
          "7f132eb5-055f-45d8-801b-c9182103dbe5",
          "7d356862-b878-4af9-92c2-3659fad101a0"
        ],
        "stereo_centers": 0
      },
      "unii": "L173DK6289"
    }
  ]
}